SU667099A3 - Гербицидное средство - Google Patents
Гербицидное средствоInfo
- Publication number
- SU667099A3 SU667099A3 SU752157427A SU2157427A SU667099A3 SU 667099 A3 SU667099 A3 SU 667099A3 SU 752157427 A SU752157427 A SU 752157427A SU 2157427 A SU2157427 A SU 2157427A SU 667099 A3 SU667099 A3 SU 667099A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- simm
- alkyl
- triazine
- derivative
- herbicidal
- Prior art date
Links
- 239000004009 herbicide Substances 0.000 title claims description 9
- 230000002363 herbicidal effect Effects 0.000 title claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000013543 active substance Substances 0.000 claims description 3
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- -1 methoxy, methylthio Chemical group 0.000 description 1
- 230000008832 photodamage Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/52—Two nitrogen atoms with an oxygen or sulfur atom attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1026874A CH588213A5 (enExample) | 1974-07-25 | 1974-07-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU667099A3 true SU667099A3 (ru) | 1979-06-05 |
Family
ID=4361347
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752157427A SU667099A3 (ru) | 1974-07-25 | 1975-07-24 | Гербицидное средство |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4007032A (enExample) |
| JP (1) | JPS5138426A (enExample) |
| AT (1) | AT345610B (enExample) |
| BE (1) | BE831684A (enExample) |
| CA (1) | CA1050545A (enExample) |
| CH (1) | CH588213A5 (enExample) |
| DE (1) | DE2532767A1 (enExample) |
| ES (1) | ES439696A1 (enExample) |
| FR (1) | FR2279736A1 (enExample) |
| GB (1) | GB1477955A (enExample) |
| IL (1) | IL47812A (enExample) |
| IT (1) | IT1044012B (enExample) |
| NL (1) | NL7508800A (enExample) |
| SU (1) | SU667099A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160832A (en) * | 1976-08-19 | 1979-07-10 | Ciba-Geigy Corporation | Novel insecticides |
| DE3222147A1 (de) * | 1982-06-11 | 1983-12-15 | Chemische Werke Hüls AG, 4370 Marl | Verwendung gegebenenfalls substituierter thiomethylcycloalkylamino-s-triazine als selektive mittel gegen unkraeuter und schadgraeser |
| DE3322720A1 (de) * | 1983-06-24 | 1985-01-03 | Chemische Werke Hüls AG, 4370 Marl | Verwendung von in 2-stellung mit (substituierten) aminogruppen substituierten 4-dl-alkylester-(alpha)-alaninyl-6-chlor-s-triazinen als herbizide, insbesondere gegen flughafer |
| US4528027A (en) * | 1984-05-24 | 1985-07-09 | Shell Oil Company | Acylthio-substituted triazines |
| PH23300A (en) * | 1985-12-02 | 1989-06-30 | Ciba Geigy Ag | (di) alkoxy carbonylamino-s-triazine derivatives and the use thereof against pests which are parasite of domestic animals and cultivated plants |
| DE19924370A1 (de) * | 1999-05-27 | 2000-11-30 | Bayer Ag | Substituierte Cyclohexylalkylamino-1,3,5-triazine |
| DE69928282T2 (de) * | 1998-12-01 | 2006-06-29 | Bayer Cropscience Ag | Substituierte 1,3,5-triazine als herbizide |
| DE102007025451B4 (de) | 2007-05-31 | 2013-03-28 | Ami Agrolinz Melamine International Gmbh | Triazinderivate |
| EP2181966A4 (en) * | 2007-06-19 | 2014-02-19 | Kobelco Eco Solutions Co Ltd | SIMULATION METHOD, SIMULATION DEVICE, METHOD FOR BIOLOGICAL TREATMENT AND DEVICE FOR BIOLOGICAL TREATMENT |
| DE102008061139A1 (de) * | 2008-12-09 | 2010-06-10 | Borealis Agrolinz Melamine Gmbh | Verfahren zur Herstellung von Triazincarbamaten unter Verwendung von Chlorformiaten |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL277135A (enExample) | 1961-04-28 | |||
| CH550546A (de) * | 1971-08-05 | 1974-06-28 | Ciba Geigy Ag | Herbizides mittel. |
-
1974
- 1974-07-25 CH CH1026874A patent/CH588213A5/xx not_active IP Right Cessation
-
1975
- 1975-07-21 US US05/597,608 patent/US4007032A/en not_active Expired - Lifetime
- 1975-07-22 FR FR7522789A patent/FR2279736A1/fr active Granted
- 1975-07-22 DE DE19752532767 patent/DE2532767A1/de not_active Withdrawn
- 1975-07-23 CA CA232,107A patent/CA1050545A/en not_active Expired
- 1975-07-23 NL NL7508800A patent/NL7508800A/xx not_active Application Discontinuation
- 1975-07-24 JP JP50090693A patent/JPS5138426A/ja active Pending
- 1975-07-24 BE BE158568A patent/BE831684A/xx unknown
- 1975-07-24 AT AT572775A patent/AT345610B/de not_active IP Right Cessation
- 1975-07-24 IT IT25712/75A patent/IT1044012B/it active
- 1975-07-24 GB GB3102875A patent/GB1477955A/en not_active Expired
- 1975-07-24 ES ES439696A patent/ES439696A1/es not_active Expired
- 1975-07-24 SU SU752157427A patent/SU667099A3/ru active
- 1975-07-25 IL IL47812A patent/IL47812A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2532767A1 (de) | 1976-02-12 |
| GB1477955A (en) | 1977-06-29 |
| CH588213A5 (enExample) | 1977-05-31 |
| CA1050545A (en) | 1979-03-13 |
| FR2279736A1 (fr) | 1976-02-20 |
| ES439696A1 (es) | 1977-03-16 |
| IL47812A (en) | 1979-01-31 |
| NL7508800A (nl) | 1976-01-27 |
| JPS5138426A (enExample) | 1976-03-31 |
| BE831684A (fr) | 1976-01-26 |
| IT1044012B (it) | 1980-02-29 |
| AT345610B (de) | 1978-09-25 |
| FR2279736B1 (enExample) | 1977-12-09 |
| ATA572775A (de) | 1978-01-15 |
| US4007032A (en) | 1977-02-08 |
| IL47812A0 (en) | 1975-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU710499A3 (ru) | Гербицидное средство | |
| DK306880A (da) | Herbicide alkancarboxylsyre-derivater | |
| RU94045870A (ru) | Производные 2-ариламинопиримидинона, гербицидная композиция и композиция для регулирования роста растений | |
| SU667099A3 (ru) | Гербицидное средство | |
| SU670194A3 (ru) | Гербицидна композици | |
| BG31467A3 (bg) | Хербицидно средство и метод за борба с нежелана растителност | |
| SU708977A3 (ru) | Гербицидное средство | |
| RU94046293A (ru) | Производные сульфониламино(тио)карбонила и их соли, способ их получения, гербицидное средство и способ его получения, способ борьбы с сорной растительностью | |
| SU563893A3 (ru) | Гербицидный состав | |
| SU596149A3 (ru) | Гербицидна композици | |
| SU571175A3 (ru) | Гербицидное средство | |
| SU978712A3 (ru) | Гербицидное средство | |
| SU843696A3 (ru) | Гербицидный состав | |
| SU1264830A3 (ru) | Фунгицидное средство | |
| SU1209018A3 (ru) | Способ борьбы с сорн ками | |
| SU931088A3 (ru) | Фунгицидное средство | |
| SU607527A3 (ru) | Гербицидна композици | |
| SU717988A3 (ru) | Гербицидна композици | |
| RU2070798C1 (ru) | Гербицид | |
| SU643067A3 (ru) | Средство дл борьбы с насекомыми | |
| SU1715191A3 (ru) | Способ борьбы с нежелательной растительностью | |
| SU651644A3 (ru) | Гербицидное средство | |
| SU526273A3 (ru) | Гербицидный состав | |
| ES8106508A1 (es) | Procedimiento para la preparacion de derivados de acidos al-canocarboxilicos | |
| SU860676A3 (ru) | Гербицидный состав |