SU635887A3 - Способ оптического отбеливани текстильного материала - Google Patents
Способ оптического отбеливани текстильного материалаInfo
- Publication number
- SU635887A3 SU635887A3 SU752145917A SU2145917A SU635887A3 SU 635887 A3 SU635887 A3 SU 635887A3 SU 752145917 A SU752145917 A SU 752145917A SU 2145917 A SU2145917 A SU 2145917A SU 635887 A3 SU635887 A3 SU 635887A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- bleach
- textile
- whiteness
- formula
- solution
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 9
- 239000004753 textile Substances 0.000 title description 8
- 238000009994 optical bleaching Methods 0.000 title description 4
- 239000007844 bleaching agent Substances 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000004744 fabric Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000003599 detergent Substances 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- -1 nannies Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003219 pyrazolines Chemical class 0.000 description 2
- 238000006862 quantum yield reaction Methods 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- VZJHMDGVHYNWPU-UHFFFAOYSA-N 2-acetamidobenzenesulfinic acid Chemical compound CC(=O)NC1=CC=CC=C1S(O)=O VZJHMDGVHYNWPU-UHFFFAOYSA-N 0.000 description 1
- KMJOHUONLYBAKV-UHFFFAOYSA-N C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)Cl)CCCl)CCCl)Cl Chemical compound C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)Cl)CCCl)CCCl)Cl KMJOHUONLYBAKV-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 240000006909 Tilia x europaea Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- ZMJPCIAEJKVKMQ-UHFFFAOYSA-M [4-[[4-[benzyl(methyl)amino]phenyl]-[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC(=CC=1)N(C)CC=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 ZMJPCIAEJKVKMQ-UHFFFAOYSA-M 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Photoreceptors In Electrophotography (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH831174A CH602659A5 (enExample) | 1974-06-18 | 1974-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU635887A3 true SU635887A3 (ru) | 1978-11-30 |
Family
ID=4338369
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752145917A SU635887A3 (ru) | 1974-06-18 | 1975-06-18 | Способ оптического отбеливани текстильного материала |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3988346A (enExample) |
| JP (1) | JPS5113830A (enExample) |
| AR (1) | AR205466A1 (enExample) |
| BE (1) | BE830288A (enExample) |
| BR (1) | BR7503829A (enExample) |
| CA (1) | CA1051440A (enExample) |
| CH (1) | CH602659A5 (enExample) |
| CS (1) | CS187481B2 (enExample) |
| DD (1) | DD119594A5 (enExample) |
| DE (1) | DE2524927C3 (enExample) |
| ES (2) | ES438651A1 (enExample) |
| FR (1) | FR2275463A1 (enExample) |
| GB (1) | GB1512435A (enExample) |
| IT (1) | IT1040624B (enExample) |
| NL (1) | NL164276C (enExample) |
| PL (1) | PL101193B1 (enExample) |
| SU (1) | SU635887A3 (enExample) |
| ZA (1) | ZA753906B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4129563A (en) * | 1975-07-31 | 1978-12-12 | Basf Aktiengesellschaft | Pyrazoline compounds |
| US4164500A (en) * | 1975-07-31 | 1979-08-14 | Basf Aktiengesellschaft | Pyrazoline compounds |
| GB2623090A (en) | 2022-10-04 | 2024-04-10 | Sublino Ltd | Method of colouring |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL291734A (nl) * | 1962-04-21 | 1964-05-11 | Hoechst Ag | Optisch bleekmiddel |
| BE631367A (enExample) * | 1963-04-22 | |||
| AT284773B (de) * | 1968-02-24 | 1970-09-25 | Bayer Ag | Aufhellungsmittel |
| NL163212C (nl) * | 1970-03-11 | 1980-08-15 | Hoechst Ag | Werkwijze voor het optisch bleken van organische materialen en werkwijze voor het bereiden van daarbij te gebruiken optische bleekmiddelen. |
-
1974
- 1974-06-18 CH CH831174A patent/CH602659A5/xx not_active IP Right Cessation
-
1975
- 1975-01-01 AR AR259235A patent/AR205466A1/es active
- 1975-06-05 DE DE2524927A patent/DE2524927C3/de not_active Expired
- 1975-06-12 US US05/586,350 patent/US3988346A/en not_active Expired - Lifetime
- 1975-06-13 NL NL7507067.A patent/NL164276C/xx not_active IP Right Cessation
- 1975-06-16 GB GB25528/75A patent/GB1512435A/en not_active Expired
- 1975-06-16 DD DD186675A patent/DD119594A5/xx unknown
- 1975-06-16 CA CA229,388A patent/CA1051440A/en not_active Expired
- 1975-06-16 CS CS754226A patent/CS187481B2/cs unknown
- 1975-06-16 BE BE157370A patent/BE830288A/xx not_active IP Right Cessation
- 1975-06-16 IT IT50065/75A patent/IT1040624B/it active
- 1975-06-16 JP JP50072104A patent/JPS5113830A/ja active Granted
- 1975-06-17 PL PL1975181307A patent/PL101193B1/pl unknown
- 1975-06-17 ES ES438651A patent/ES438651A1/es not_active Expired
- 1975-06-17 FR FR7518881A patent/FR2275463A1/fr active Granted
- 1975-06-18 ZA ZA3906A patent/ZA753906B/xx unknown
- 1975-06-18 BR BR4925/75D patent/BR7503829A/pt unknown
- 1975-06-18 SU SU752145917A patent/SU635887A3/ru active
-
1976
- 1976-12-29 ES ES454689A patent/ES454689A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PL101193B1 (pl) | 1978-12-30 |
| JPS5629903B2 (enExample) | 1981-07-11 |
| ZA753906B (en) | 1977-01-26 |
| BE830288A (fr) | 1975-12-16 |
| ES438651A1 (es) | 1977-06-16 |
| JPS5113830A (en) | 1976-02-03 |
| IT1040624B (it) | 1979-12-20 |
| ES454689A1 (es) | 1977-11-16 |
| FR2275463B1 (enExample) | 1979-01-19 |
| FR2275463A1 (fr) | 1976-01-16 |
| NL7507067A (nl) | 1975-12-22 |
| DE2524927C3 (de) | 1980-11-06 |
| GB1512435A (en) | 1978-06-01 |
| DE2524927B2 (de) | 1980-03-20 |
| DE2524927A1 (de) | 1976-01-02 |
| CA1051440A (en) | 1979-03-27 |
| AR205466A1 (es) | 1976-05-07 |
| CH602659A5 (enExample) | 1978-07-31 |
| AU8216975A (en) | 1976-12-23 |
| CS187481B2 (en) | 1979-01-31 |
| US3988346A (en) | 1976-10-26 |
| NL164276C (nl) | 1980-12-15 |
| BR7503829A (pt) | 1976-07-06 |
| DD119594A5 (enExample) | 1976-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU635887A3 (ru) | Способ оптического отбеливани текстильного материала | |
| DE2329991C2 (de) | 3-Triazolyl-(4)-cumarinderivate | |
| US2702759A (en) | Method of brightening fabrics with sulfonated dibenzothiophene dioxide derivatives | |
| US2737516A (en) | Fluorescent whitening agents | |
| US2865916A (en) | Triazole brighteners | |
| US2713055A (en) | Whitening agents for cellulosic fiber | |
| US3547952A (en) | 7-mercapto-coumarins | |
| US2704286A (en) | Fluorescent whitening agents | |
| US3406118A (en) | Brightener agent solutions | |
| US2713054A (en) | Whitening agents for cellulosic fiber | |
| US2700044A (en) | Compounds of the benzimidazolylphenyl-1, 2-naphthotriazole type, useful as whiteningagents | |
| US2867624A (en) | Bis-aryltriazole compounds | |
| US3101333A (en) | Stilbyl-acenaphthenotriazole | |
| US2715630A (en) | Fluorescent whitening agents | |
| US2715632A (en) | Whitening agents for cellulosic fiber | |
| US3755352A (en) | 1-(4{40 -methoxysulphonyl-phenyl)-3-(4{41 -chlorophenyl)-pyrazoline | |
| DE937822C (de) | Optische Bleichmittel | |
| JPH02300147A (ja) | 新規な4―スチリルビフエニルアルデヒドとその製造法 | |
| NO119789B (enExample) | ||
| US2993892A (en) | Stilbene monotriazole brightening agents | |
| US3157644A (en) | Brightening agents | |
| US3318874A (en) | Nh- hsc n n xxnh -ch -ch=ch- sosna sosna chs cha soaxchjxchsxoh | |
| US3098848A (en) | Diarylthiophene sulfonic acids | |
| US2989527A (en) | Pyrazolo and indazolo triazolyl stilbene disulfonic acids | |
| DE2201857C3 (de) | Verwendung von Bis-stilbenverbindeungen als optische Aufhellmittel |