PL101193B1 - Srodek do optycznego rozjasniania - Google Patents
Srodek do optycznego rozjasniania Download PDFInfo
- Publication number
- PL101193B1 PL101193B1 PL1975181307A PL18130775A PL101193B1 PL 101193 B1 PL101193 B1 PL 101193B1 PL 1975181307 A PL1975181307 A PL 1975181307A PL 18130775 A PL18130775 A PL 18130775A PL 101193 B1 PL101193 B1 PL 101193B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- model
- dimethylformamide
- hydrogen
- water
- Prior art date
Links
- 230000003287 optical effect Effects 0.000 title claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 238000005282 brightening Methods 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 238000000862 absorption spectrum Methods 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 230000007935 neutral effect Effects 0.000 claims description 3
- 150000003219 pyrazolines Chemical class 0.000 claims description 3
- 238000006862 quantum yield reaction Methods 0.000 claims description 3
- 238000005406 washing Methods 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- NZABFEPUGOJERC-UHFFFAOYSA-N CN(C)C=O.CN(C)C=O.CN(C)C=O Chemical compound CN(C)C=O.CN(C)C=O.CN(C)C=O NZABFEPUGOJERC-UHFFFAOYSA-N 0.000 claims 1
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 238000000295 emission spectrum Methods 0.000 claims 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 claims 1
- 239000004744 fabric Substances 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 8
- 239000003599 detergent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- -1 alkyl radical Chemical group 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 235000010265 sodium sulphite Nutrition 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VZJHMDGVHYNWPU-UHFFFAOYSA-N 2-acetamidobenzenesulfinic acid Chemical compound CC(=O)NC1=CC=CC=C1S(O)=O VZJHMDGVHYNWPU-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- 229920001095 Ban-Lon Polymers 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KMJOHUONLYBAKV-UHFFFAOYSA-N C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)Cl)CCCl)CCCl)Cl Chemical compound C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)Cl)CCCl)CCCl)Cl KMJOHUONLYBAKV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282421 Canidae Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003254 anti-foaming effect Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- JLFNLZLINWHATN-UHFFFAOYSA-N pentaethylene glycol Chemical compound OCCOCCOCCOCCOCCO JLFNLZLINWHATN-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 235000019830 sodium polyphosphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Photoreceptors In Electrophotography (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH831174A CH602659A5 (enExample) | 1974-06-18 | 1974-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL101193B1 true PL101193B1 (pl) | 1978-12-30 |
Family
ID=4338369
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975181307A PL101193B1 (pl) | 1974-06-18 | 1975-06-17 | Srodek do optycznego rozjasniania |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3988346A (enExample) |
| JP (1) | JPS5113830A (enExample) |
| AR (1) | AR205466A1 (enExample) |
| BE (1) | BE830288A (enExample) |
| BR (1) | BR7503829A (enExample) |
| CA (1) | CA1051440A (enExample) |
| CH (1) | CH602659A5 (enExample) |
| CS (1) | CS187481B2 (enExample) |
| DD (1) | DD119594A5 (enExample) |
| DE (1) | DE2524927C3 (enExample) |
| ES (2) | ES438651A1 (enExample) |
| FR (1) | FR2275463A1 (enExample) |
| GB (1) | GB1512435A (enExample) |
| IT (1) | IT1040624B (enExample) |
| NL (1) | NL164276C (enExample) |
| PL (1) | PL101193B1 (enExample) |
| SU (1) | SU635887A3 (enExample) |
| ZA (1) | ZA753906B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4164500A (en) * | 1975-07-31 | 1979-08-14 | Basf Aktiengesellschaft | Pyrazoline compounds |
| US4129563A (en) * | 1975-07-31 | 1978-12-12 | Basf Aktiengesellschaft | Pyrazoline compounds |
| GB2623090A (en) | 2022-10-04 | 2024-04-10 | Sublino Ltd | Method of colouring |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL291734A (nl) * | 1962-04-21 | 1964-05-11 | Hoechst Ag | Optisch bleekmiddel |
| BE631367A (enExample) * | 1963-04-22 | |||
| AT284773B (de) * | 1968-02-24 | 1970-09-25 | Bayer Ag | Aufhellungsmittel |
| ES388953A1 (es) * | 1970-03-11 | 1975-03-16 | Farbwerke Hoechst A G V Meiste | Procedimiento para la preparacion de compuestos de pirazo- lina. |
-
1974
- 1974-06-18 CH CH831174A patent/CH602659A5/xx not_active IP Right Cessation
-
1975
- 1975-01-01 AR AR259235A patent/AR205466A1/es active
- 1975-06-05 DE DE2524927A patent/DE2524927C3/de not_active Expired
- 1975-06-12 US US05/586,350 patent/US3988346A/en not_active Expired - Lifetime
- 1975-06-13 NL NL7507067.A patent/NL164276C/xx not_active IP Right Cessation
- 1975-06-16 JP JP50072104A patent/JPS5113830A/ja active Granted
- 1975-06-16 CA CA229,388A patent/CA1051440A/en not_active Expired
- 1975-06-16 BE BE157370A patent/BE830288A/xx not_active IP Right Cessation
- 1975-06-16 DD DD186675A patent/DD119594A5/xx unknown
- 1975-06-16 CS CS754226A patent/CS187481B2/cs unknown
- 1975-06-16 IT IT50065/75A patent/IT1040624B/it active
- 1975-06-16 GB GB25528/75A patent/GB1512435A/en not_active Expired
- 1975-06-17 PL PL1975181307A patent/PL101193B1/pl unknown
- 1975-06-17 FR FR7518881A patent/FR2275463A1/fr active Granted
- 1975-06-17 ES ES438651A patent/ES438651A1/es not_active Expired
- 1975-06-18 ZA ZA3906A patent/ZA753906B/xx unknown
- 1975-06-18 SU SU752145917A patent/SU635887A3/ru active
- 1975-06-18 BR BR4925/75D patent/BR7503829A/pt unknown
-
1976
- 1976-12-29 ES ES454689A patent/ES454689A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL164276C (nl) | 1980-12-15 |
| ES454689A1 (es) | 1977-11-16 |
| FR2275463B1 (enExample) | 1979-01-19 |
| JPS5629903B2 (enExample) | 1981-07-11 |
| DE2524927A1 (de) | 1976-01-02 |
| CS187481B2 (en) | 1979-01-31 |
| NL7507067A (nl) | 1975-12-22 |
| GB1512435A (en) | 1978-06-01 |
| ES438651A1 (es) | 1977-06-16 |
| DE2524927C3 (de) | 1980-11-06 |
| DE2524927B2 (de) | 1980-03-20 |
| AU8216975A (en) | 1976-12-23 |
| IT1040624B (it) | 1979-12-20 |
| CH602659A5 (enExample) | 1978-07-31 |
| AR205466A1 (es) | 1976-05-07 |
| JPS5113830A (en) | 1976-02-03 |
| BR7503829A (pt) | 1976-07-06 |
| SU635887A3 (ru) | 1978-11-30 |
| FR2275463A1 (fr) | 1976-01-16 |
| ZA753906B (en) | 1977-01-26 |
| CA1051440A (en) | 1979-03-27 |
| US3988346A (en) | 1976-10-26 |
| BE830288A (fr) | 1975-12-16 |
| DD119594A5 (enExample) | 1976-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2812278A1 (de) | Verfahren zum bleichen von textilien | |
| US2784183A (en) | Fluorescent monotriazole compounds | |
| PL85609B1 (enExample) | ||
| PL101193B1 (pl) | Srodek do optycznego rozjasniania | |
| US2713057A (en) | Fluorescent benzgtriazqle compounds | |
| US3547952A (en) | 7-mercapto-coumarins | |
| US2713056A (en) | Fluorescent whitening agents | |
| US2527427A (en) | Stilbene disulfonic acid derivatives | |
| US2704286A (en) | Fluorescent whitening agents | |
| US2901477A (en) | Stilbene tetrazole brightening agents | |
| US4218219A (en) | Condensation product from phenothiazine and p-nitrosophenol, process for the production of the condensation product, process for the production of sulfur dyestuffs using the condensation product and the sulfur dyestuffs prepared therewith | |
| US2713055A (en) | Whitening agents for cellulosic fiber | |
| US2700043A (en) | Fluorescent whitening agents | |
| US2817665A (en) | X c chi | |
| EP0126406A2 (de) | Farbstoffmischungen | |
| US2928830A (en) | Pyrazolo-triazole optical brighteners | |
| US3098848A (en) | Diarylthiophene sulfonic acids | |
| US2700044A (en) | Compounds of the benzimidazolylphenyl-1, 2-naphthotriazole type, useful as whiteningagents | |
| US2715632A (en) | Whitening agents for cellulosic fiber | |
| US2720528A (en) | Fluorescent whitening agents | |
| US3119820A (en) | Optical whitening agents of the stilbyl triazole type | |
| DE955686C (de) | Verfahren zur Herstellung von fluoreszierenden Benztriazolverbindungen | |
| US2733247A (en) | Whitening agents fos cellulosic fiber | |
| US2989527A (en) | Pyrazolo and indazolo triazolyl stilbene disulfonic acids | |
| EP0395588B1 (de) | Dibenzofuranylbiphenyle |