SU587865A3 - Способ получени смешанного ангидрида цефалоспориновой кислоты - Google Patents
Способ получени смешанного ангидрида цефалоспориновой кислотыInfo
- Publication number
- SU587865A3 SU587865A3 SU721826870A SU1826870A SU587865A3 SU 587865 A3 SU587865 A3 SU 587865A3 SU 721826870 A SU721826870 A SU 721826870A SU 1826870 A SU1826870 A SU 1826870A SU 587865 A3 SU587865 A3 SU 587865A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- salt
- cephalosporin
- mixed anhydride
- anhydride
- Prior art date
Links
- 239000002253 acid Substances 0.000 title description 15
- 150000008064 anhydrides Chemical class 0.000 title description 8
- 238000000034 method Methods 0.000 title description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- -1 „-thioaryloxy Chemical group 0.000 description 15
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- 229930182555 Penicillin Natural products 0.000 description 8
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 7
- 229940049954 penicillin Drugs 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 6
- 229930186147 Cephalosporin Natural products 0.000 description 5
- 229940124587 cephalosporin Drugs 0.000 description 5
- 150000001780 cephalosporins Chemical class 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical group CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 150000003248 quinolines Chemical class 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- ZJTJUVIJVLLGSP-UHFFFAOYSA-N Lumichrome Natural products N1C(=O)NC(=O)C2=C1N=C1C=C(C)C(C)=CC1=N2 ZJTJUVIJVLLGSP-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 230000003115 biocidal effect Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 150000003751 zinc Chemical class 0.000 description 3
- GNWBLLYJQXKPIP-ZOGIJGBBSA-N (1s,3as,3bs,5ar,9ar,9bs,11as)-n,n-diethyl-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1h-indeno[5,4-f]quinoline-1-carboxamide Chemical compound CN([C@@H]1CC2)C(=O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)N(CC)CC)[C@@]2(C)CC1 GNWBLLYJQXKPIP-ZOGIJGBBSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- JYYNAJVZFGKDEQ-UHFFFAOYSA-N 2,4-Dimethylpyridine Chemical compound CC1=CC=NC(C)=C1 JYYNAJVZFGKDEQ-UHFFFAOYSA-N 0.000 description 2
- LBYKODYNFRCBIR-UHFFFAOYSA-N 4-ethoxy-3-methoxybenzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C=C1OC LBYKODYNFRCBIR-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- MLRVZFYXUZQSRU-UHFFFAOYSA-N 1-chlorohexane Chemical compound CCCCCCCl MLRVZFYXUZQSRU-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FDODEDHSASFCSW-UHFFFAOYSA-N 4-bromooctane Chemical compound CCCCC(Br)CCC FDODEDHSASFCSW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000013832 Valeriana officinalis Nutrition 0.000 description 1
- 244000126014 Valeriana officinalis Species 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical group C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000004401 m-toluyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C(*)=O 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003511 tertiary amides Chemical class 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- 235000016788 valerian Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/18—7-Aminocephalosporanic or substituted 7-aminocephalosporanic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00177869A US3813389A (en) | 1971-09-03 | 1971-09-03 | Process for 7-aminocephalosporanic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU587865A3 true SU587865A3 (ru) | 1978-01-05 |
Family
ID=22650263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU721826870A SU587865A3 (ru) | 1971-09-03 | 1972-09-01 | Способ получени смешанного ангидрида цефалоспориновой кислоты |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3813389A (enExample) |
| JP (1) | JPS558988B2 (enExample) |
| AR (1) | AR208492A1 (enExample) |
| AT (1) | AT314734B (enExample) |
| AU (1) | AU463141B2 (enExample) |
| BE (1) | BE788142A (enExample) |
| BG (1) | BG22836A3 (enExample) |
| CA (1) | CA969178A (enExample) |
| CH (1) | CH558382A (enExample) |
| CS (1) | CS184315B2 (enExample) |
| DD (1) | DD101164A5 (enExample) |
| DE (1) | DE2242299A1 (enExample) |
| DK (1) | DK140942B (enExample) |
| ES (1) | ES406344A1 (enExample) |
| FR (1) | FR2150936B1 (enExample) |
| GB (1) | GB1358217A (enExample) |
| HU (1) | HU166209B (enExample) |
| IE (1) | IE36956B1 (enExample) |
| IL (1) | IL40135A (enExample) |
| NL (1) | NL7211900A (enExample) |
| PH (1) | PH9581A (enExample) |
| PL (1) | PL87749B1 (enExample) |
| RO (1) | RO59967A (enExample) |
| SE (1) | SE392724B (enExample) |
| SU (1) | SU587865A3 (enExample) |
| ZA (1) | ZA725647B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1395184A (en) * | 1972-03-09 | 1975-05-21 | Alfa Farmaceutici Spa | Cephalosporin derivatives |
| GR70261B (enExample) * | 1977-12-12 | 1982-09-02 | Takeda Chemical Industries Ltd | |
| US6518420B2 (en) * | 1997-06-04 | 2003-02-11 | Biochemie Gesellschaft M.B.H. | Precipitation process of 7-aminocephalosporanic acid (7-ACA) |
-
0
- BE BE788142D patent/BE788142A/xx unknown
-
1971
- 1971-09-03 US US00177869A patent/US3813389A/en not_active Expired - Lifetime
-
1972
- 1972-08-15 IL IL40135A patent/IL40135A/xx unknown
- 1972-08-16 ZA ZA725647A patent/ZA725647B/xx unknown
- 1972-08-17 AU AU45709/72A patent/AU463141B2/en not_active Expired
- 1972-08-23 CA CA150,030A patent/CA969178A/en not_active Expired
- 1972-08-25 PH PH13835*UA patent/PH9581A/en unknown
- 1972-08-28 CS CS7200005917A patent/CS184315B2/cs unknown
- 1972-08-28 DE DE2242299A patent/DE2242299A1/de not_active Ceased
- 1972-08-29 FR FR7230641A patent/FR2150936B1/fr not_active Expired
- 1972-08-29 BG BG021280A patent/BG22836A3/xx unknown
- 1972-08-30 GB GB4017272A patent/GB1358217A/en not_active Expired
- 1972-08-30 CH CH1279072A patent/CH558382A/fr not_active IP Right Cessation
- 1972-08-31 AR AR243852A patent/AR208492A1/es active
- 1972-08-31 NL NL7211900A patent/NL7211900A/xx not_active Application Discontinuation
- 1972-09-01 PL PL1972157545A patent/PL87749B1/pl unknown
- 1972-09-01 DK DK433772AA patent/DK140942B/da unknown
- 1972-09-01 SU SU721826870A patent/SU587865A3/ru active
- 1972-09-01 RO RO72106A patent/RO59967A/ro unknown
- 1972-09-01 IE IE1187/72A patent/IE36956B1/xx unknown
- 1972-09-01 SE SE7211345A patent/SE392724B/xx unknown
- 1972-09-01 DD DD165401A patent/DD101164A5/xx unknown
- 1972-09-01 AT AT752872A patent/AT314734B/de not_active IP Right Cessation
- 1972-09-02 JP JP8830072A patent/JPS558988B2/ja not_active Expired
- 1972-09-02 HU HUEI430A patent/HU166209B/hu unknown
- 1972-09-02 ES ES406344A patent/ES406344A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH558382A (fr) | 1975-01-31 |
| AU463141B2 (en) | 1975-07-17 |
| AU4570972A (en) | 1974-02-21 |
| IE36956L (en) | 1973-03-03 |
| AR208492A1 (es) | 1977-02-15 |
| PL87749B1 (enExample) | 1976-07-31 |
| JPS558988B2 (enExample) | 1980-03-07 |
| DE2242299A1 (de) | 1973-03-08 |
| DK140942B (da) | 1979-12-10 |
| DD101164A5 (enExample) | 1973-10-20 |
| RO59967A (enExample) | 1976-06-15 |
| HU166209B (enExample) | 1975-02-28 |
| IL40135A (en) | 1975-03-13 |
| CA969178A (en) | 1975-06-10 |
| JPS4834896A (enExample) | 1973-05-22 |
| GB1358217A (en) | 1974-07-03 |
| NL7211900A (enExample) | 1973-03-06 |
| FR2150936A1 (enExample) | 1973-04-13 |
| CS184315B2 (en) | 1978-08-31 |
| ES406344A1 (es) | 1975-09-16 |
| FR2150936B1 (enExample) | 1975-10-17 |
| PH9581A (en) | 1976-01-19 |
| ZA725647B (en) | 1974-03-27 |
| IE36956B1 (en) | 1977-03-30 |
| BE788142A (fr) | 1973-02-28 |
| BG22836A3 (bg) | 1977-04-20 |
| SE392724B (sv) | 1977-04-18 |
| AT314734B (de) | 1974-04-25 |
| IL40135A0 (en) | 1972-10-29 |
| DK140942C (enExample) | 1980-05-19 |
| US3813389A (en) | 1974-05-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU791246A3 (ru) | Способ получени производных 7-/2-(2аминотиазолил-4)-2-алкоксииминоацетамидо/-3-цефем-4-карбоновой кислоты | |
| SU629880A3 (ru) | Способ получени 7-д-(-)-2формилокси-2-(4ацилоксифенилацетамидо)-цефалоспорановых кислот или их солей | |
| JPS5946954B2 (ja) | 抗生物質の製法 | |
| IE831527L (en) | Preparation of azetidinooxazole derivatives | |
| US3840531A (en) | Process for preparing 7-(alpha-hydroxy-alpha-phenyl)acetamido-3-(1-methyl-1h-tetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid and derivatives thereof | |
| SU587865A3 (ru) | Способ получени смешанного ангидрида цефалоспориновой кислоты | |
| DK163584B (da) | 7-amino-3-propenylcephalosporinsyrederivater samt fremgangsmaade til fremstilling deraf | |
| US4908444A (en) | Method of producing cephem compounds | |
| KR940009794B1 (ko) | 세팔로스포린 유도체의 제조방법 | |
| US4880797A (en) | Cephalosporin derivatives and antibacterial agents | |
| Narisada et al. | Synthesis and substituent effects on antibacterial activity, alkaline hydrolysis rates, and infrared absorption frequencies of some cephem analogs related to latamoxef (moxalactam) | |
| KR20010087055A (ko) | 신규한 티아졸 화합물 및 그의 제조 방법 | |
| US3896118A (en) | Process for producing 7-aminocephalosporanic acids | |
| US4322526A (en) | Process for producing 7-aminocephalosporanic acid | |
| SU563918A3 (ru) | Способ получени цефалоспорановых производных или их солей, или сложных эфиров | |
| US3716533A (en) | N-deformylation of 3-halomethyl-7beta-formamidocephalosporin-1-oxidesn-deformylation of 3-halomethyl-7 beta-formamidocephalosporin-1-oxide | |
| US4051129A (en) | Process for preparing 7-methoxycephalosporin compounds | |
| US3980644A (en) | Pentavalent phosphorus amides of cephalosporins and separation process using same | |
| KR830001969B1 (ko) | 6―｛D―(―) α-(4―에틸-2. 3-디옥소-1 피페라지노카보닐아미노) 페닐(또는 하이드록시페닐)아세트아미도 페니실란산 및 그 염의 제조방법 | |
| US4075219A (en) | Epimerization process | |
| US4242509A (en) | Process for producing 7-amino-7-alkoxycephalosporins | |
| US4490370A (en) | Naphthylglycyl cephalosporin derivatives | |
| US3666770A (en) | Process for preparing d-5,5-dimethyl-{66 {11 -thiazoline-4-carboxylic derivatives | |
| GB1309375A (en) | Phosphono substituted acylpenicillins | |
| US4069246A (en) | Production of 1-hydroxy-alkane-1,1-diphosphonic acids |