AT314734B - Verfahren zur Herstellung von 7-Aminocephalosporansäure - Google Patents
Verfahren zur Herstellung von 7-AminocephalosporansäureInfo
- Publication number
- AT314734B AT314734B AT752872A AT752872A AT314734B AT 314734 B AT314734 B AT 314734B AT 752872 A AT752872 A AT 752872A AT 752872 A AT752872 A AT 752872A AT 314734 B AT314734 B AT 314734B
- Authority
- AT
- Austria
- Prior art keywords
- preparation
- aminocephalosporanic acid
- aminocephalosporanic
- acid
- Prior art date
Links
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/18—7-Aminocephalosporanic or substituted 7-aminocephalosporanic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00177869A US3813389A (en) | 1971-09-03 | 1971-09-03 | Process for 7-aminocephalosporanic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT314734B true AT314734B (de) | 1974-04-25 |
Family
ID=22650263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT752872A AT314734B (de) | 1971-09-03 | 1972-09-01 | Verfahren zur Herstellung von 7-Aminocephalosporansäure |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3813389A (de) |
| JP (1) | JPS558988B2 (de) |
| AR (1) | AR208492A1 (de) |
| AT (1) | AT314734B (de) |
| AU (1) | AU463141B2 (de) |
| BE (1) | BE788142A (de) |
| BG (1) | BG22836A3 (de) |
| CA (1) | CA969178A (de) |
| CH (1) | CH558382A (de) |
| CS (1) | CS184315B2 (de) |
| DD (1) | DD101164A5 (de) |
| DE (1) | DE2242299A1 (de) |
| DK (1) | DK140942B (de) |
| ES (1) | ES406344A1 (de) |
| FR (1) | FR2150936B1 (de) |
| GB (1) | GB1358217A (de) |
| HU (1) | HU166209B (de) |
| IE (1) | IE36956B1 (de) |
| IL (1) | IL40135A (de) |
| NL (1) | NL7211900A (de) |
| PH (1) | PH9581A (de) |
| PL (1) | PL87749B1 (de) |
| RO (1) | RO59967A (de) |
| SE (1) | SE392724B (de) |
| SU (1) | SU587865A3 (de) |
| ZA (1) | ZA725647B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1395184A (en) * | 1972-03-09 | 1975-05-21 | Alfa Farmaceutici Spa | Cephalosporin derivatives |
| GR70261B (de) * | 1977-12-12 | 1982-09-02 | Takeda Chemical Industries Ltd | |
| US6518420B2 (en) * | 1997-06-04 | 2003-02-11 | Biochemie Gesellschaft M.B.H. | Precipitation process of 7-aminocephalosporanic acid (7-ACA) |
-
0
- BE BE788142D patent/BE788142A/xx unknown
-
1971
- 1971-09-03 US US00177869A patent/US3813389A/en not_active Expired - Lifetime
-
1972
- 1972-08-15 IL IL40135A patent/IL40135A/xx unknown
- 1972-08-16 ZA ZA725647A patent/ZA725647B/xx unknown
- 1972-08-17 AU AU45709/72A patent/AU463141B2/en not_active Expired
- 1972-08-23 CA CA150,030A patent/CA969178A/en not_active Expired
- 1972-08-25 PH PH13835*UA patent/PH9581A/en unknown
- 1972-08-28 DE DE2242299A patent/DE2242299A1/de not_active Ceased
- 1972-08-28 CS CS7200005917A patent/CS184315B2/cs unknown
- 1972-08-29 FR FR7230641A patent/FR2150936B1/fr not_active Expired
- 1972-08-29 BG BG021280A patent/BG22836A3/xx unknown
- 1972-08-30 CH CH1279072A patent/CH558382A/fr not_active IP Right Cessation
- 1972-08-30 GB GB4017272A patent/GB1358217A/en not_active Expired
- 1972-08-31 NL NL7211900A patent/NL7211900A/xx not_active Application Discontinuation
- 1972-08-31 AR AR243852A patent/AR208492A1/es active
- 1972-09-01 SU SU721826870A patent/SU587865A3/ru active
- 1972-09-01 IE IE1187/72A patent/IE36956B1/xx unknown
- 1972-09-01 PL PL1972157545A patent/PL87749B1/pl unknown
- 1972-09-01 DD DD165401A patent/DD101164A5/xx unknown
- 1972-09-01 SE SE7211345A patent/SE392724B/xx unknown
- 1972-09-01 AT AT752872A patent/AT314734B/de not_active IP Right Cessation
- 1972-09-01 DK DK433772AA patent/DK140942B/da unknown
- 1972-09-01 RO RO72106A patent/RO59967A/ro unknown
- 1972-09-02 JP JP8830072A patent/JPS558988B2/ja not_active Expired
- 1972-09-02 HU HUEI430A patent/HU166209B/hu unknown
- 1972-09-02 ES ES406344A patent/ES406344A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2242299A1 (de) | 1973-03-08 |
| DD101164A5 (de) | 1973-10-20 |
| DK140942B (da) | 1979-12-10 |
| CS184315B2 (en) | 1978-08-31 |
| US3813389A (en) | 1974-05-28 |
| AU4570972A (en) | 1974-02-21 |
| CH558382A (fr) | 1975-01-31 |
| SU587865A3 (ru) | 1978-01-05 |
| JPS4834896A (de) | 1973-05-22 |
| BG22836A3 (bg) | 1977-04-20 |
| AR208492A1 (es) | 1977-02-15 |
| FR2150936B1 (de) | 1975-10-17 |
| ZA725647B (en) | 1974-03-27 |
| IL40135A0 (en) | 1972-10-29 |
| NL7211900A (de) | 1973-03-06 |
| RO59967A (de) | 1976-06-15 |
| CA969178A (en) | 1975-06-10 |
| IE36956L (en) | 1973-03-03 |
| PL87749B1 (de) | 1976-07-31 |
| PH9581A (en) | 1976-01-19 |
| ES406344A1 (es) | 1975-09-16 |
| IL40135A (en) | 1975-03-13 |
| GB1358217A (en) | 1974-07-03 |
| HU166209B (de) | 1975-02-28 |
| AU463141B2 (en) | 1975-07-17 |
| BE788142A (fr) | 1973-02-28 |
| FR2150936A1 (de) | 1973-04-13 |
| IE36956B1 (en) | 1977-03-30 |
| DK140942C (de) | 1980-05-19 |
| JPS558988B2 (de) | 1980-03-07 |
| SE392724B (sv) | 1977-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT328077B (de) | Verfahren zur herstellung von 6-aminopenicillansaure | |
| AT336181B (de) | Verfahren zur herstellung von delta3-7-acylamido-desacetoxycephalosporansauren | |
| AT325201B (de) | Verfahren zur herstellung von 7-acylamidocephalosporamsäuren | |
| AT324315B (de) | Verfahren zur herstellung von carbonsäure-n-alkylestern | |
| AT317165B (de) | Verfahren zur Herstellung von γ-Alkoxyacetessigsäureestern | |
| AT317428B (de) | Verfahren zur Herstellung von Cephalosporin C | |
| AT304762B (de) | Verfahren zur Herstellung von Cephalosporansäurederivaten | |
| AT312803B (de) | Verfahren zur Herstellung von 7-Amino-desacetoxy-cephalosporansäure | |
| AT315829B (de) | Verfahren zur Herstellung von 4-Halogenmethylcumarinen | |
| AT324565B (de) | Verfahren zur herstellung von 6-aminopenicillansäure | |
| ATA1092972A (de) | Verfahren zur herstellung von 7-acylamino-3-substituierten-3-cephem-4-carbonsaurederivate | |
| AT309679B (de) | Verfahren zur Herstellung von 6-Desoxytetracyclinen | |
| DD101403A5 (de) | Verfahren zur herstellung von phenylimidazolidinonen | |
| AT331393B (de) | Verfahren zur herstellung von 7-amino-desacetoxycephalosporansaure | |
| AT301754B (de) | Verfahren zur Herstellung von 7-Aminocephalosporansäure | |
| AT324553B (de) | Verfahren zur herstellung von 3-alkylthiomethylcephalosporinen | |
| AT319211B (de) | Verfahren zur Herstellung von α-Amino-2-hydroxyphenylessigsäuren | |
| AT314734B (de) | Verfahren zur Herstellung von 7-Aminocephalosporansäure | |
| AT326816B (de) | Verfahren zur herstellung von 3-carbamoyloxymethylcephalosporinverbindungen | |
| AT318823B (de) | Verfahren zur Herstellung von 16-Carboxy-17-methoxy-eburnan | |
| CH528533A (de) | Verfahren zur Herstellung von Thiazylharnstoffen | |
| CH519518A (de) | Verfahren zur Herstellung von 7-Aminocephalosporansäure | |
| AT324551B (de) | Verfahren zur herstellung von 7-aminodesacetoxycephalosporansäureestersalzen | |
| AT317195B (de) | Verfahren zur Herstellung von Hexahydroindan-4-carbonsäureestern | |
| AT322102B (de) | Verfahren zur herstellung von derivaten der dl-7-r-amino-desacetoxycephalosporansäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |