SU579846A3 - Гербицидна композици - Google Patents
Гербицидна композициInfo
- Publication number
- SU579846A3 SU579846A3 SU7301873148A SU1873148A SU579846A3 SU 579846 A3 SU579846 A3 SU 579846A3 SU 7301873148 A SU7301873148 A SU 7301873148A SU 1873148 A SU1873148 A SU 1873148A SU 579846 A3 SU579846 A3 SU 579846A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- composition
- soil
- compound
- solution
- compounds
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title description 21
- 230000002363 herbicidal effect Effects 0.000 title description 7
- 239000004009 herbicide Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 description 15
- 239000002689 soil Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000013543 active substance Substances 0.000 description 7
- 241000196324 Embryophyta Species 0.000 description 6
- 241000209219 Hordeum Species 0.000 description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Chemical group 0.000 description 3
- 229910052801 chlorine Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000013585 weight reducing agent Substances 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000002262 irrigation Effects 0.000 description 2
- 238000003973 irrigation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N Alanine Chemical class CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 229920004923 Triton X-15 Polymers 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003862 amino acid derivatives Chemical class 0.000 description 1
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical class NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 208000011117 substance-related disease Diseases 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB235372A GB1413286A (en) | 1972-01-18 | 1972-01-18 | Thiocarboxy esters and their use as herbicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU579846A3 true SU579846A3 (ru) | 1977-11-05 |
Family
ID=9738071
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7301873148A SU579846A3 (ru) | 1972-01-18 | 1973-01-16 | Гербицидна композици |
Country Status (12)
| Country | Link |
|---|---|
| AU (1) | AU471195B2 (OSRAM) |
| BE (1) | BE794108A (OSRAM) |
| CA (1) | CA994356A (OSRAM) |
| DD (1) | DD103129A5 (OSRAM) |
| DE (1) | DE2302029C2 (OSRAM) |
| ES (1) | ES410668A2 (OSRAM) |
| FR (1) | FR2168386B2 (OSRAM) |
| GB (1) | GB1413286A (OSRAM) |
| HU (1) | HU167047B (OSRAM) |
| IT (1) | IT1052124B (OSRAM) |
| NL (1) | NL174522C (OSRAM) |
| SU (1) | SU579846A3 (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH623458A5 (OSRAM) * | 1975-09-30 | 1981-06-15 | Ciba Geigy Ag | |
| CH618320A5 (OSRAM) * | 1975-09-30 | 1980-07-31 | Ciba Geigy Ag | |
| CH617568A5 (OSRAM) * | 1975-09-30 | 1980-06-13 | Ciba Geigy Ag |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1164160A (en) * | 1966-12-30 | 1969-09-17 | Shell Int Research | N,N-Disubstituted Amino Acid Derivatives and their use as Herbicides |
| GB1289283A (OSRAM) * | 1970-03-04 | 1972-09-13 |
-
0
- BE BE794108D patent/BE794108A/xx unknown
-
1972
- 1972-01-18 GB GB235372A patent/GB1413286A/en not_active Expired
- 1972-12-13 NL NL7216885A patent/NL174522C/xx not_active IP Right Cessation
- 1972-12-15 CA CA158,975A patent/CA994356A/en not_active Expired
-
1973
- 1973-01-12 IT IT4767773A patent/IT1052124B/it active
- 1973-01-16 FR FR7301419A patent/FR2168386B2/fr not_active Expired
- 1973-01-16 DD DD16826373A patent/DD103129A5/xx unknown
- 1973-01-16 SU SU7301873148A patent/SU579846A3/ru active
- 1973-01-16 ES ES410668A patent/ES410668A2/es not_active Expired
- 1973-01-16 AU AU51151/73A patent/AU471195B2/en not_active Expired
- 1973-01-16 DE DE19732302029 patent/DE2302029C2/de not_active Expired
- 1973-01-16 HU HUSE001660 patent/HU167047B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES410668A2 (es) | 1976-01-01 |
| IT1052124B (it) | 1981-06-20 |
| DE2302029A1 (de) | 1973-08-09 |
| NL174522B (nl) | 1984-02-01 |
| FR2168386A2 (OSRAM) | 1973-08-31 |
| FR2168386B2 (OSRAM) | 1977-07-29 |
| DD103129A5 (OSRAM) | 1974-01-12 |
| BE794108A (fr) | 1973-07-16 |
| NL7216885A (OSRAM) | 1973-07-20 |
| GB1413286A (en) | 1975-11-12 |
| DE2302029C2 (de) | 1985-07-18 |
| NL174522C (nl) | 1984-07-02 |
| AU471195B2 (en) | 1976-04-15 |
| AU5115173A (en) | 1974-07-18 |
| HU167047B (OSRAM) | 1975-07-28 |
| CA994356A (en) | 1976-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2513732C2 (OSRAM) | ||
| DE69607827T2 (de) | Herbizide zusammensetzungen von 4-benzoylisoxazolen oder 2-cyano-1,3-dionherbiziden und antidots für diese | |
| RU2029471C1 (ru) | Производные пиримидина, гербицидная композиция и способ борьбы с сорняками с использованием композиции | |
| DE2741437A1 (de) | Anilinderivate, verfahren zu ihrer herstellung und schaedlingsbekaempfungsmittel | |
| DE2515113C2 (OSRAM) | ||
| DE2643403C2 (de) | Thiocarbonsäurederivate, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| SU579846A3 (ru) | Гербицидна композици | |
| SU550104A3 (ru) | Гербицидный состав | |
| EP0064353B1 (en) | Use of 2,4-disubstituted-5-thiazolecarboxylic acids and derivatives for reducing injury to crop plants by acetamide herbicides | |
| US4376644A (en) | Tri-mixed alkylsulfonium salts of N-phosphonomethylglycine and their use as plant growth regulators and herbicides | |
| SU727107A3 (ru) | Фунгицидное средство | |
| BR9908415B1 (pt) | fungicidas. | |
| DE2539396C3 (de) | Pestizide | |
| US4123254A (en) | Germicidal herbicide for agriculture and horticulture | |
| SU843696A3 (ru) | Гербицидный состав | |
| SU1111673A3 (ru) | Способ борьбы с сорн ками | |
| DE2805941C2 (de) | Hydraziniumphosphite, ihre Herstellung und funigzide Zusammensetzungen | |
| SU1732804A3 (ru) | Гербицидна композици | |
| KR100449464B1 (ko) | 프로클로라즈혼합물 | |
| US3998621A (en) | Triazine--antidote compositions and methods of use for cotton | |
| JP4058166B2 (ja) | 有害生物防除剤組成物および有害生物の防除方法 | |
| SU1181517A3 (ru) | Способ борьбы с сорн ками | |
| US3909235A (en) | Substituted sulfanilyl sulfilimine compounds as herbicides | |
| KR800001571B1 (ko) | 옥사졸리딘 및 티아졸리딘 제초제 해독조성물 | |
| JPH026721B2 (OSRAM) |