SU565914A1 - Способ получени производных 8( -аминоэтил) эрголина-1 или их солей - Google Patents
Способ получени производных 8( -аминоэтил) эрголина-1 или их солейInfo
- Publication number
- SU565914A1 SU565914A1 SU7502117223A SU2117223A SU565914A1 SU 565914 A1 SU565914 A1 SU 565914A1 SU 7502117223 A SU7502117223 A SU 7502117223A SU 2117223 A SU2117223 A SU 2117223A SU 565914 A1 SU565914 A1 SU 565914A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- ergoline
- methyl
- pyridine
- aminoethyl
- amino
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title description 5
- 238000000034 method Methods 0.000 title description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 47
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 229910052759 nickel Inorganic materials 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- -1 α-amino-ethyl Chemical group 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 2
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical compound O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- ANTGQBPGYZDWAW-UHFFFAOYSA-N azane;1,4-dioxane Chemical class N.C1COCCO1 ANTGQBPGYZDWAW-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical class Br* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical class Cl* 0.000 description 1
- 150000002012 dioxanes Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- MVFCKEFYUDZOCX-UHFFFAOYSA-N iron(2+);dinitrate Chemical compound [Fe+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MVFCKEFYUDZOCX-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS1971A CS171480B1 (enExample) | 1974-03-19 | 1974-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU565914A1 true SU565914A1 (ru) | 1977-07-25 |
Family
ID=5355452
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7502117223A SU565914A1 (ru) | 1974-03-19 | 1975-03-18 | Способ получени производных 8( -аминоэтил) эрголина-1 или их солей |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4005090A (enExample) |
| JP (1) | JPS5180900A (enExample) |
| AT (1) | AT341687B (enExample) |
| BE (1) | BE826798A (enExample) |
| CA (1) | CA1033726A (enExample) |
| CS (1) | CS171480B1 (enExample) |
| DD (1) | DD118634A1 (enExample) |
| DE (1) | DE2512084A1 (enExample) |
| DK (1) | DK113775A (enExample) |
| FI (1) | FI750814A7 (enExample) |
| FR (1) | FR2264537B1 (enExample) |
| GB (1) | GB1493521A (enExample) |
| HU (1) | HU173656B (enExample) |
| NL (1) | NL7503294A (enExample) |
| SE (1) | SE7502902L (enExample) |
| SU (1) | SU565914A1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS177530B1 (en) * | 1974-07-19 | 1977-07-29 | Miroslav Semonsky | New nbeta-substituted derivatives of b-beta-aminoethyl-ergoline-i their salts and methods for the production thereof |
| CS188414B1 (en) * | 1975-12-12 | 1979-03-30 | Antonin Cerny | New d-6-alkyl-8-cyanmethyl ergolines,their salts and method of producing |
| DE2656344A1 (de) * | 1975-12-23 | 1977-07-07 | Sandoz Ag | Ergolinderivate, ihre verwendung und herstellung |
| GB2120242A (en) * | 1982-04-30 | 1983-11-30 | Erba Farmitalia | Ergoline derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL28388A (en) * | 1966-07-29 | 1971-11-29 | Farma Italia Soc | History 1, 6 - Dimethyl - A 01 - Argolin |
| GB1191099A (en) * | 1968-03-07 | 1970-05-06 | Farmaceutici Italia | Ergoline Derivatives |
-
1974
- 1974-03-19 CS CS1971A patent/CS171480B1/cs unknown
-
1975
- 1975-03-14 AT AT197575A patent/AT341687B/de active
- 1975-03-14 SE SE7502902A patent/SE7502902L/xx unknown
- 1975-03-18 HU HU75SO1141A patent/HU173656B/hu unknown
- 1975-03-18 BE BE154429A patent/BE826798A/xx unknown
- 1975-03-18 SU SU7502117223A patent/SU565914A1/ru active
- 1975-03-18 GB GB11117/75A patent/GB1493521A/en not_active Expired
- 1975-03-18 DD DD184840A patent/DD118634A1/xx unknown
- 1975-03-19 DK DK113775A patent/DK113775A/da unknown
- 1975-03-19 FI FI750814A patent/FI750814A7/fi not_active Application Discontinuation
- 1975-03-19 FR FR7508625A patent/FR2264537B1/fr not_active Expired
- 1975-03-19 JP JP50032488A patent/JPS5180900A/ja active Pending
- 1975-03-19 DE DE19752512084 patent/DE2512084A1/de active Pending
- 1975-03-19 CA CA222,553A patent/CA1033726A/en not_active Expired
- 1975-03-19 NL NL7503294A patent/NL7503294A/xx not_active Application Discontinuation
- 1975-03-19 US US05/560,106 patent/US4005090A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU7926275A (en) | 1976-09-23 |
| FI750814A7 (enExample) | 1975-09-20 |
| FR2264537A1 (enExample) | 1975-10-17 |
| DE2512084A1 (de) | 1975-10-02 |
| CS171480B1 (enExample) | 1976-10-29 |
| GB1493521A (en) | 1977-11-30 |
| DD118634A1 (enExample) | 1976-03-12 |
| DK113775A (enExample) | 1975-09-20 |
| BE826798A (fr) | 1975-07-16 |
| JPS5180900A (enExample) | 1976-07-15 |
| AT341687B (de) | 1978-02-27 |
| FR2264537B1 (enExample) | 1978-08-04 |
| ATA197575A (de) | 1977-06-15 |
| CA1033726A (en) | 1978-06-27 |
| US4005090A (en) | 1977-01-25 |
| SE7502902L (enExample) | 1975-09-22 |
| HU173656B (hu) | 1979-07-28 |
| NL7503294A (nl) | 1975-09-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1605176A (en) | Oxime derivatives of 7-amino-thiazolyl-acetic acid and processes for preparing them | |
| SU1333234A3 (ru) | Способ получени производных N-фенилбензамида или их солей | |
| Kataoka et al. | Studies of unusual amino acids and their peptides. VI. The synthese and the optical resolutions of. BETA.-methylphenylalanine and its dipeptide present in bottromycin. | |
| PL190861B1 (pl) | Sposób przemysłowego wytwarzania podstawionego perhydroizoindolu | |
| SU565914A1 (ru) | Способ получени производных 8( -аминоэтил) эрголина-1 или их солей | |
| RU1819265C (ru) | Способ получени производных эпиподофиллотоксина или его фармацевтически пригодной аддитивной соли, способ получени цианопроизводных нафталинкарбоновых кислот, способ получени аминометилпроизводных нафталинкарбоновых кислот | |
| KR20040108717A (ko) | 콤브레타스타틴의 제조 방법 | |
| FI81339C (fi) | Foerfarande foer framstaellning av pyrrolidinoderivat, mellanprodukt och dess framstaellningsfoerfarande. | |
| EP0219256B1 (en) | N-alkylation of dihydrolysergic acid | |
| Daidone et al. | Synthesis of pyrazole-4-carbohydrazide derivatives of pharmaceutical interest | |
| SE446003B (sv) | Mellanprodukter for framstellning av hydroxiaminoeburnanderivat | |
| SU608470A3 (ru) | Способ получени производных циклопропанола | |
| JPH0346460B2 (enExample) | ||
| CA1276148C (en) | Process for the preparation of -n-¬(hypoxanthin-9-yl)-pentyloxycarbonyl|-arginine | |
| WO1998032736A1 (en) | Process for producing benzylsuccinic acid derivatives | |
| JP3241741B2 (ja) | 「3−(7−アミジノ−2−ナフチル)−2−フェニルプロピオン酸誘導体の製造方法」 | |
| Karady et al. | Synthesis of D-and L-. alpha.-(3, 4-dihydroxybenzyl)-. alpha.-hydrazinopropionic acid via resolution | |
| US3758500A (en) | N-sulfonyl-indole-3-acetamides | |
| JPS5833877B2 (ja) | ユウキカゴウブツニカンスルカイリヨウ | |
| JPH0899942A (ja) | 置換ジアミノジカルボン酸誘導体の製造方法 | |
| US3737443A (en) | Omega-guanidino acid amide derivatives and manufacturing the same | |
| SU1447279A3 (ru) | Способ получени производного 9-карбамоилфлуорена | |
| WO1995000502A1 (en) | Novel intermediate for synthetic use and process for producing aminopiperazine derivative | |
| US5254733A (en) | Process for producing an aliphatic amide and salts thereof | |
| CA2720312A1 (en) | Methods for making 4-tetrazolyl-4-phenylpiperidine compounds |