SU479284A3 - Способ получени изоцианатов - Google Patents
Способ получени изоцианатовInfo
- Publication number
- SU479284A3 SU479284A3 SU1888825A SU1888825A SU479284A3 SU 479284 A3 SU479284 A3 SU 479284A3 SU 1888825 A SU1888825 A SU 1888825A SU 1888825 A SU1888825 A SU 1888825A SU 479284 A3 SU479284 A3 SU 479284A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- isocyanate
- boiling point
- weight
- theoretical amount
- acid
- Prior art date
Links
- 239000012948 isocyanate Substances 0.000 title description 11
- 238000000034 method Methods 0.000 title description 11
- 150000002513 isocyanates Chemical class 0.000 title description 10
- 238000009835 boiling Methods 0.000 description 24
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 150000001336 alkenes Chemical class 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 8
- 239000012535 impurity Substances 0.000 description 6
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 5
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- 150000003863 ammonium salts Chemical class 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 3
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical group CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000001714 carbamic acid halides Chemical class 0.000 description 2
- -1 chlorine carbamic anhydrides Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- GRRYSIXDUIAUGY-UHFFFAOYSA-N n-methylcarbamoyl chloride Chemical compound CNC(Cl)=O GRRYSIXDUIAUGY-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- ISYORFGKSZLPNW-UHFFFAOYSA-N propan-2-ylazanium;chloride Chemical compound [Cl-].CC(C)[NH3+] ISYORFGKSZLPNW-UHFFFAOYSA-N 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- NJLYUINWLSVLFJ-UHFFFAOYSA-N 1-(3-isocyanatopropoxy)butane Chemical compound CCCCOCCCN=C=O NJLYUINWLSVLFJ-UHFFFAOYSA-N 0.000 description 1
- YWKUYVHZVCTJHZ-UHFFFAOYSA-N 1-ethynyl-1-isocyanatocyclohexane Chemical compound O=C=NC1(C#C)CCCCC1 YWKUYVHZVCTJHZ-UHFFFAOYSA-N 0.000 description 1
- MHNNAWXXUZQSNM-UHFFFAOYSA-N 2-methylbut-1-ene Chemical class CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 1
- BSMNBEHEFWDHJD-UHFFFAOYSA-N 2-methylpropan-1-amine;hydrochloride Chemical compound [Cl-].CC(C)C[NH3+] BSMNBEHEFWDHJD-UHFFFAOYSA-N 0.000 description 1
- FTZJLXIATZSKIL-UHFFFAOYSA-N 4-chloro-1-isocyanato-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1N=C=O FTZJLXIATZSKIL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000235789 Hyperoartia Species 0.000 description 1
- VDCSWNMEVWTNAJ-UHFFFAOYSA-N N-(3-butoxypropyl)carbamoyl chloride Chemical compound C(CCC)OCCCNC(=O)Cl VDCSWNMEVWTNAJ-UHFFFAOYSA-N 0.000 description 1
- MRQONHQNURDERP-UHFFFAOYSA-N N-(4-chloro-2-methylphenyl)carbamoyl chloride Chemical compound CC1=C(C=CC(=C1)Cl)NC(=O)Cl MRQONHQNURDERP-UHFFFAOYSA-N 0.000 description 1
- HXBPYFMVGFDZFT-UHFFFAOYSA-N allyl isocyanate Chemical compound C=CCN=C=O HXBPYFMVGFDZFT-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- ICXXXLGATNSZAV-UHFFFAOYSA-N butylazanium;chloride Chemical compound [Cl-].CCCC[NH3+] ICXXXLGATNSZAV-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- AYOCQODSVOEOHO-UHFFFAOYSA-N carbamoyl carbamate Chemical compound NC(=O)OC(N)=O AYOCQODSVOEOHO-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- DUVOZUPPHBRJJO-UHFFFAOYSA-N ethyl 2-isocyanatoacetate Chemical compound CCOC(=O)CN=C=O DUVOZUPPHBRJJO-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- KWBIXTIBYFUAGV-UHFFFAOYSA-N ethylcarbamic acid Chemical compound CCNC(O)=O KWBIXTIBYFUAGV-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004836 hexamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- RRIWSQXXBIFKQM-UHFFFAOYSA-N monomeric N-benzylcarbamic acid Natural products OC(=O)NCC1=CC=CC=C1 RRIWSQXXBIFKQM-UHFFFAOYSA-N 0.000 description 1
- FOZLEFALTUHOLA-UHFFFAOYSA-N n-cyclohexylcarbamoyl chloride Chemical compound ClC(=O)NC1CCCCC1 FOZLEFALTUHOLA-UHFFFAOYSA-N 0.000 description 1
- YSBUANSGDLZTKV-UHFFFAOYSA-N n-phenylcarbamoyl chloride Chemical compound ClC(=O)NC1=CC=CC=C1 YSBUANSGDLZTKV-UHFFFAOYSA-N 0.000 description 1
- MFPXPCGVNXPRLZ-UHFFFAOYSA-N n-propan-2-ylcarbamoyl chloride Chemical compound CC(C)NC(Cl)=O MFPXPCGVNXPRLZ-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000004817 pentamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- WPWXYQIMXTUMJB-UHFFFAOYSA-N tert-butyl 3-(aminomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(CN)C1 WPWXYQIMXTUMJB-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2210285A DE2210285C3 (de) | 1972-03-03 | 1972-03-03 | Verfahren zur Herstellung von Isocyanaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU479284A3 true SU479284A3 (ru) | 1975-07-30 |
Family
ID=5837830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1888825A SU479284A3 (ru) | 1972-03-03 | 1973-03-01 | Способ получени изоцианатов |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3860623A (enExample) |
| JP (1) | JPS5522469B2 (enExample) |
| BE (1) | BE796076A (enExample) |
| CH (1) | CH574913A5 (enExample) |
| DE (1) | DE2210285C3 (enExample) |
| FR (1) | FR2174940B1 (enExample) |
| GB (1) | GB1414079A (enExample) |
| HU (1) | HU174885B (enExample) |
| SU (1) | SU479284A3 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4146550A (en) * | 1976-08-05 | 1979-03-27 | Bayer Aktiengesellschaft | Process for the preparation of an aliphatic monoisocyanate |
| DE2639931C2 (de) * | 1976-09-04 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von aliphatischen Monoisocyanaten |
| DE2703281A1 (de) * | 1977-01-27 | 1978-08-03 | Basf Ag | Verfahren zur herstellung von aliphatischen isocyanaten |
| DE2937006A1 (de) * | 1979-09-13 | 1981-04-02 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 1-halogenalkylisocyanaten und 1-alkenylisocyanaten |
| US4391758A (en) * | 1982-04-19 | 1983-07-05 | Spaziante Placido M | Process for methyl isocyanate production |
| FR2796068B1 (fr) * | 1999-07-05 | 2001-09-07 | Rhodia Chimie Sa | Procede de deshydrogenofluoration d'un fluorure de carbamoyle aromatique |
| CN108689882A (zh) * | 2018-04-24 | 2018-10-23 | 江苏蓝丰生物化工股份有限公司 | 叔丁基异氰酸酯的合成方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3440268A (en) * | 1965-09-15 | 1969-04-22 | Stauffer Chemical Co | Process for producing organic isocyanates |
| GB1208862A (en) * | 1966-12-05 | 1970-10-14 | Ici Ltd | Manufacture of organic isocyanates |
| US3644461A (en) * | 1969-02-19 | 1972-02-22 | Ott Chemical Co | Preparation of alkyl isocyanates |
-
1972
- 1972-03-03 DE DE2210285A patent/DE2210285C3/de not_active Expired
-
1973
- 1973-02-14 US US332291A patent/US3860623A/en not_active Expired - Lifetime
- 1973-02-26 JP JP2228573A patent/JPS5522469B2/ja not_active Expired
- 1973-02-28 BE BE128196A patent/BE796076A/xx not_active IP Right Cessation
- 1973-03-01 HU HU73BA2885A patent/HU174885B/hu unknown
- 1973-03-01 SU SU1888825A patent/SU479284A3/ru active
- 1973-03-02 FR FR7307551A patent/FR2174940B1/fr not_active Expired
- 1973-03-02 CH CH314473A patent/CH574913A5/xx not_active IP Right Cessation
- 1973-03-02 GB GB1021273A patent/GB1414079A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| HU174885B (hu) | 1980-04-28 |
| FR2174940A1 (enExample) | 1973-10-19 |
| GB1414079A (en) | 1975-11-19 |
| JPS5522469B2 (enExample) | 1980-06-17 |
| DE2210285B2 (de) | 1980-08-07 |
| DE2210285C3 (de) | 1981-09-24 |
| JPS4899119A (enExample) | 1973-12-15 |
| BE796076A (fr) | 1973-08-28 |
| FR2174940B1 (enExample) | 1977-12-23 |
| US3860623A (en) | 1975-01-14 |
| DE2210285A1 (de) | 1973-09-06 |
| CH574913A5 (enExample) | 1976-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU479284A3 (ru) | Способ получени изоцианатов | |
| SU1703636A1 (ru) | Способ получени галогенированных органических соединений | |
| US3920644A (en) | Process for preparing halogen-containing organic isocyanates | |
| US3317558A (en) | Production of n-substituted phthalimidines | |
| US4729856A (en) | Process for the preparation of 2-perfluoropropoxy-perfluoropropionyl fluoride | |
| US4680412A (en) | Preparation of fluorophthalimides | |
| US2647916A (en) | Method of preparing an nu-substituted carbamate | |
| US5026864A (en) | Preparation of 2-chloro-5-aminomethyl-pyridine | |
| US3468900A (en) | Process for preparing isoxazole compounds | |
| US4333883A (en) | Preparation of N-chlorothio(methyl)carbamoyl halides | |
| RU1773259C (ru) | Способ получени анилинофумарата | |
| US3920829A (en) | Inflammation inhibiting bis-carbamate composition | |
| US4314948A (en) | Preparation of mixtures of 1-monohalogenated isocyanates and 1,2-unsaturated isocyanates | |
| CA1206484A (en) | Process for producing substituted asymmetric ureas | |
| US3862201A (en) | Production of 1-alkenyl isocyanates | |
| US4537986A (en) | Preparation of pyrocatechol methylcarbamate | |
| IL45647A (en) | Process for the manufacture of cyclopropanecarbonitrile | |
| US3266717A (en) | Addition products from halogenosulfonyl-isocyanates and olefins and process for preparing them | |
| SU512701A3 (ru) | Способ получени пирролидинил-карбоксанилидов | |
| US4464307A (en) | Substituted acid chloride process | |
| US4010160A (en) | Process for the manufacture of 1,3-bis-(β-ethylhexyl)-5-amino-5-methyl-hexahydropyrimidine | |
| JPS6013022B2 (ja) | ジアルキルアルカノ−ルアミンの製造方法 | |
| US3625993A (en) | Process for producing carbamates | |
| US4770820A (en) | Process for the preparation of carbamoyl chlorides derived from secondary amines | |
| US4058561A (en) | 2-Chloromethylphenylcarbamic acid fluoride |