SU403181A1 - - Google Patents
Info
- Publication number
- SU403181A1 SU403181A1 SU1648742A SU1648742A SU403181A1 SU 403181 A1 SU403181 A1 SU 403181A1 SU 1648742 A SU1648742 A SU 1648742A SU 1648742 A SU1648742 A SU 1648742A SU 403181 A1 SU403181 A1 SU 403181A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- methyl
- residue
- dissolved
- mol
- benzoxazin
- Prior art date
Links
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 101100079051 Mus musculus Myl6 gene Proteins 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- PRAARDGLAWZXML-UHFFFAOYSA-N o-propylhydroxylamine Chemical compound CCCON PRAARDGLAWZXML-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- -1 aliphatic secondary amine Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- HTWMTDKMOSSPMU-UHFFFAOYSA-N 1,2-benzoxazin-4-one Chemical compound C1=CC=C2C(=O)C=NOC2=C1 HTWMTDKMOSSPMU-UHFFFAOYSA-N 0.000 description 1
- LJDSTRZHPWMDPG-UHFFFAOYSA-N 2-(butylamino)ethanol Chemical compound CCCCNCCO LJDSTRZHPWMDPG-UHFFFAOYSA-N 0.000 description 1
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 1
- WXCFBRKFNFJAGR-UHFFFAOYSA-N 6,7-dimethoxy-2-methyl-3,1-benzoxazin-4-one Chemical compound N1=C(C)OC(=O)C2=C1C=C(OC)C(OC)=C2 WXCFBRKFNFJAGR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- MDLASHKKKTXKKO-UHFFFAOYSA-N Cl.Cl.Cl.N=1C(NC=C2C=CC=CC12)=O Chemical compound Cl.Cl.Cl.N=1C(NC=C2C=CC=CC12)=O MDLASHKKKTXKKO-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-O hydron;1h-pyrrole Chemical compound [NH2+]1C=CC=C1 KAESVJOAVNADME-UHFFFAOYSA-O 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- LUKNLVTZDZMBOU-UHFFFAOYSA-N n-ethoxymethanamine Chemical compound CCONC LUKNLVTZDZMBOU-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702020233 DE2020233A1 (de) | 1970-04-25 | 1970-04-25 | Basisch substituierte Derivate des 4(3H)-Chinazolinons |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU403181A1 true SU403181A1 (OSRAM) | |
| SU403181A3 SU403181A3 (OSRAM) | 1973-10-19 |
Family
ID=5769323
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1651516A SU422157A3 (ru) | 1970-04-25 | 1971-04-23 | Способ получения производных 4(зн)-хиназолинона |
| SU1648742A SU403181A3 (OSRAM) | 1970-04-25 | 1971-04-23 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1651516A SU422157A3 (ru) | 1970-04-25 | 1971-04-23 | Способ получения производных 4(зн)-хиназолинона |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3738985A (OSRAM) |
| AT (2) | AT306031B (OSRAM) |
| BE (1) | BE766241A (OSRAM) |
| CA (1) | CA933924A (OSRAM) |
| CH (2) | CH556849A (OSRAM) |
| DE (1) | DE2020233A1 (OSRAM) |
| FR (1) | FR2092091B1 (OSRAM) |
| GB (1) | GB1312392A (OSRAM) |
| NL (1) | NL7105068A (OSRAM) |
| PL (1) | PL86506B1 (OSRAM) |
| RO (1) | RO63328A (OSRAM) |
| SU (2) | SU422157A3 (OSRAM) |
| ZA (1) | ZA712630B (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US7064721B2 (en) | 2003-06-27 | 2006-06-20 | Delphi Technologies, Inc. | Mobile satellite radio antenna system |
| US20100132094A1 (en) * | 2008-12-01 | 2010-06-03 | Mullen Michael L | Removable liner system for headgear |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3322766A (en) * | 1964-11-13 | 1967-05-30 | Shulton Inc | 3-beta-(4-pyridyl) ethyl-2, 3-dihydro-4(1h)-quinazolinones |
-
1970
- 1970-04-25 DE DE19702020233 patent/DE2020233A1/de active Pending
-
1971
- 1971-04-15 NL NL7105068A patent/NL7105068A/xx unknown
- 1971-04-22 US US00136560A patent/US3738985A/en not_active Expired - Lifetime
- 1971-04-22 RO RO7100066654A patent/RO63328A/ro unknown
- 1971-04-23 CA CA111159A patent/CA933924A/en not_active Expired
- 1971-04-23 CH CH596671A patent/CH556849A/xx not_active IP Right Cessation
- 1971-04-23 FR FR7114533A patent/FR2092091B1/fr not_active Expired
- 1971-04-23 AT AT352371A patent/AT306031B/de not_active IP Right Cessation
- 1971-04-23 ZA ZA712630A patent/ZA712630B/xx unknown
- 1971-04-23 CH CH596571A patent/CH556848A/xx not_active IP Right Cessation
- 1971-04-23 GB GB1117771*[A patent/GB1312392A/en not_active Expired
- 1971-04-23 SU SU1651516A patent/SU422157A3/ru active
- 1971-04-23 SU SU1648742A patent/SU403181A3/ru active
- 1971-04-23 AT AT352271A patent/AT306030B/de not_active IP Right Cessation
- 1971-04-23 BE BE766241A patent/BE766241A/xx unknown
- 1971-04-24 PL PL1971175330A patent/PL86506B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0089167B1 (en) | Dihydropyridine anti-ischaemic and antihypertensive agents, processes for their production, and pharmaceutical compositions containing them | |
| ES2201112T3 (es) | Nuevos derivados de pirimidina y procedimientos para su preparacion. | |
| US4452788A (en) | Substituted 8-phenylxanthines | |
| US4118417A (en) | Process for resolving cis-1-substituted phenyl-1,2-cyclopropanedicarboxylic acids | |
| SU1313348A3 (ru) | Способ получени производных эрголина | |
| NZ207156A (en) | (2 quinazolinyl)-oxalkylamide derivatives and pharmaceutical compositions | |
| JPS6044308B2 (ja) | クロマン誘導体の製法 | |
| JPS61183287A (ja) | 6‐チオキサンチン誘導体 | |
| SU1628854A3 (ru) | Способ получени четвертичных органических аммониевых соединений или их фармакологически приемлемых солей | |
| SU403181A1 (OSRAM) | ||
| KR19990023859A (ko) | 치환 퀴놀론 유도체 및 이를 함유하는 의약 | |
| US4472406A (en) | Antimicrobial 6,7-dihydro-8-(imidazol-1-yl)-5-methyl-1-oxo-1H,5H-benzo [ij]quinolizine-2-carboxylic acids and derivatives | |
| DK142766B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme 8-azapurin-6-on-derivater. | |
| SK144294A3 (en) | Diamine salts of clavulanic acid, method of their preparing, pharmaceutical preparations on their base and using of these salts | |
| US4968808A (en) | Process for the preparation of nitroethene derivatives | |
| US3389138A (en) | Phenyl-alpha-piperazino-alkanoates | |
| US5324732A (en) | Crystalline fumaric acid salts of 9,9-alkylene-3,7-diazabicyclononane compounds and pharmaceutical compositions containing them | |
| SU493067A3 (ru) | Способ получени фенилимидазолидинонов | |
| CA1133483A (en) | Hexahydro-trans-pyridoindole neuroleptic agents | |
| US4179509A (en) | (Substituted 2-carboxyanilino)nicotinic acids as inhibitors of allergic reactions | |
| SU1205759A3 (ru) | Способ получени производных аминоэтанола или их солей | |
| SU286644A1 (OSRAM) | ||
| US4476125A (en) | Benzobisoxazinetetrones and anti-allergic use thereof | |
| US2152512A (en) | Chjcb | |
| US3546224A (en) | Novel quinazoline compounds and process means for producing the same |