SU368739A1 - - Google Patents
Info
- Publication number
- SU368739A1 SU368739A1 SU21264A SU21264A SU368739A1 SU 368739 A1 SU368739 A1 SU 368739A1 SU 21264 A SU21264 A SU 21264A SU 21264 A SU21264 A SU 21264A SU 368739 A1 SU368739 A1 SU 368739A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- reactor
- acid
- anhydride
- amount
- yield
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 12
- -1 alicyclic ketenes Chemical class 0.000 claims description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 9
- 238000004821 distillation Methods 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 238000001816 cooling Methods 0.000 claims description 4
- 125000002723 alicyclic group Chemical group 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 150000002561 ketenes Chemical class 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 2
- 238000007086 side reaction Methods 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 description 25
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 13
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 8
- 239000006227 byproduct Substances 0.000 description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 7
- 229910052802 copper Inorganic materials 0.000 description 7
- 239000010949 copper Substances 0.000 description 7
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 7
- 239000007789 gas Substances 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- JOHUAELJNSBTGS-UHFFFAOYSA-N cyclohexanecarbonyl cyclohexanecarboxylate Chemical compound C1CCCCC1C(=O)OC(=O)C1CCCCC1 JOHUAELJNSBTGS-UHFFFAOYSA-N 0.000 description 3
- FPIQZBQZKBKLEI-UHFFFAOYSA-N ethyl 1-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylate Chemical compound ClCCN(N=O)C(=O)NC1(C(=O)OCC)CCCCC1 FPIQZBQZKBKLEI-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- QTPJMTACJMLPLL-UHFFFAOYSA-N triethoxy(sulfanylidene)-$l^{5}-phosphane Chemical compound CCOP(=S)(OCC)OCC QTPJMTACJMLPLL-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 2
- DODNKCRINWUAHH-UHFFFAOYSA-N (diethyl-$l^{3}-selanyl)ethane Chemical compound CC[Se](CC)CC DODNKCRINWUAHH-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000010724 circulating oil Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- JWIPDQOXAJMVHL-UHFFFAOYSA-N cyclododecanecarboxylic acid Chemical compound OC(=O)C1CCCCCCCCCCC1 JWIPDQOXAJMVHL-UHFFFAOYSA-N 0.000 description 1
- BXQJYIXHTMSDRB-UHFFFAOYSA-N cyclohexane;hydrochloride Chemical compound Cl.C1CCCCC1 BXQJYIXHTMSDRB-UHFFFAOYSA-N 0.000 description 1
- URAXDCBRCGSGAT-UHFFFAOYSA-N cyclooctanecarboxylic acid Chemical compound OC(=O)C1CCCCCCC1 URAXDCBRCGSGAT-UHFFFAOYSA-N 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- TURAMGVWNUTQKH-UHFFFAOYSA-N propa-1,2-dien-1-one Chemical compound C=C=C=O TURAMGVWNUTQKH-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU368739A1 true SU368739A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2848500A (en) | Preparation of purified formaldehyde | |
| SU368739A1 (enExample) | ||
| US2497309A (en) | Process for the preparation of ethyleneurea | |
| US6723877B1 (en) | Dimethylformamide synthesis via reactive distillation of methyl formate and dimethylamine | |
| KR20070045260A (ko) | 아세트산 무수물 및 아세테이트 에스테르의 공제조 | |
| CN112094203B (zh) | 一种1-氰基-2-丙烯基乙酸酯的制备方法 | |
| CN115427389B (zh) | 用于制备ω-烷二醇单硝酸酯的方法 | |
| US3914313A (en) | Method for the production of cyclopentamethylene ketene | |
| SU187769A1 (ru) | Способ получения диэтилацетамида | |
| DE69001037T2 (de) | Verfahren zur herstellung von perfluoroalkenyl-sulfonyl-fluoriden. | |
| AU2021428925B2 (en) | Method and device for the production of lactide | |
| SU891631A1 (ru) | Способ получени метакриловой кислоты | |
| SU173778A1 (enExample) | ||
| SU205706A1 (ru) | Способ получения лактамов | |
| SU198321A1 (ru) | Способ получения грляс-1,2,3,4,11,11-гексахлортрицик- ло- | |
| SU364597A1 (ru) | Способ получения л1етилметакрилата | |
| SU183731A1 (enExample) | ||
| SU322994A1 (ru) | Способ одновременного получения нитрилов е-оксикапроновой и гексен-1-овой-6 кислот | |
| SU166012A1 (ru) | Способ получения метилметакрилата | |
| SU300993A1 (enExample) | ||
| SU413146A1 (enExample) | ||
| SU183737A1 (enExample) | ||
| SU181097A1 (enExample) | ||
| SU353409A1 (ru) | Всесоюзная iпатентно-т?хь'1^:епяд)| | |
| SU345673A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ АНГИДРИДА р-АЦЕТОКСИПИВАЛИНОВОЙ КИСЛОТЫ |