SU354656A1 - - Google Patents
Info
- Publication number
- SU354656A1 SU354656A1 SU1251878A SU1251878A SU354656A1 SU 354656 A1 SU354656 A1 SU 354656A1 SU 1251878 A SU1251878 A SU 1251878A SU 1251878 A SU1251878 A SU 1251878A SU 354656 A1 SU354656 A1 SU 354656A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mixture
- quinazolinone
- isopropyl
- hours
- phenyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 235000005074 zinc chloride Nutrition 0.000 description 9
- 239000011592 zinc chloride Substances 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- JOYRKODLDBILNP-UHFFFAOYSA-N ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- -1 alkyl carbamate Chemical compound 0.000 description 5
- 125000004432 carbon atoms Chemical group C* 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 3
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1H-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atoms Chemical class [H]* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-Dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- CCRPJZPLAWZERD-UHFFFAOYSA-N C(C)(C)N1C(N=C(C2=CC=C(C=C12)Cl)C1=CC=CC=C1)=O Chemical compound C(C)(C)N1C(N=C(C2=CC=C(C=C12)Cl)C1=CC=CC=C1)=O CCRPJZPLAWZERD-UHFFFAOYSA-N 0.000 description 1
- UUONGVUQZPZQNV-UHFFFAOYSA-N C(C)(C)N1C(N=C(C2=CC=CC=C12)C1=CC=C(C=C1)C)=O Chemical compound C(C)(C)N1C(N=C(C2=CC=CC=C12)C1=CC=C(C=C1)C)=O UUONGVUQZPZQNV-UHFFFAOYSA-N 0.000 description 1
- AUGHRACGNZMBMA-UHFFFAOYSA-N ClC1=CC(=C(C(=O)C2=CC=CC=C2)C=C1)NC(C)C Chemical compound ClC1=CC(=C(C(=O)C2=CC=CC=C2)C=C1)NC(C)C AUGHRACGNZMBMA-UHFFFAOYSA-N 0.000 description 1
- HEZNVIYQEUHLNI-UHFFFAOYSA-N Ethiofencarb Chemical compound CCSCC1=CC=CC=C1OC(=O)NC HEZNVIYQEUHLNI-UHFFFAOYSA-N 0.000 description 1
- UTBOHTQNUVFFMG-UHFFFAOYSA-N [2-(2-methylpropylamino)phenyl]-phenylmethanone Chemical compound CC(C)CNC1=CC=CC=C1C(=O)C1=CC=CC=C1 UTBOHTQNUVFFMG-UHFFFAOYSA-N 0.000 description 1
- AGKPGIOZNCJFTQ-UHFFFAOYSA-N [2-(methylamino)phenyl]-phenylmethanone Chemical compound CNC1=CC=CC=C1C(=O)C1=CC=CC=C1 AGKPGIOZNCJFTQ-UHFFFAOYSA-N 0.000 description 1
- WCLMEJZSXAZVIE-UHFFFAOYSA-N [5-chloro-2-(propan-2-ylamino)phenyl]-phenylmethanone Chemical compound CC(C)NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 WCLMEJZSXAZVIE-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 230000003197 catalytic Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000005020 pharmaceutical industry Methods 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- DGPMXBLZPJPMIH-UHFFFAOYSA-N phenyl-[2-(propan-2-ylamino)phenyl]methanone Chemical compound CC(C)NC1=CC=CC=C1C(=O)C1=CC=CC=C1 DGPMXBLZPJPMIH-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1327192A SU388406A3 (ja) | 1968-06-26 | 1968-06-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU354656A1 true SU354656A1 (ja) | |
| SU388406A1 SU388406A1 (ru) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK281055B6 (sk) | Spôsob výroby fenoxypyrimidínových zlúčenín | |
| EP3265439B1 (en) | Process for preparing 3-chloro-2-vinylphenylsulfonates | |
| CN110092760B (zh) | 一种3-氟代烷氧基-2(1h)-喹喔啉酮及其合成方法 | |
| EP0004024B1 (de) | Verfahren zur Herstellung von 3-Hydroxy-6-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazocinen | |
| SU1662349A3 (ru) | Способ получени замещенных 1Н-имидазолов или их солей присоединени нетоксичных, фармацевтически приемлемых кислот | |
| IL43749A (en) | Cyclopropylmethylamine derivatives of n-containing heterocyclic compounds their production and pharmaceutical compositions containing them | |
| SU354656A1 (ja) | ||
| US6187926B1 (en) | Process for producing quinolone derivatives | |
| JPH0250110B2 (ja) | ||
| EP0307101B1 (en) | Chemical process | |
| US5395945A (en) | Synthesis of 3,3-dinitroazetidine | |
| EP2754662B1 (en) | Efficient process for the preparation of Lapatinib and salts thereof by means of new intermediates | |
| HU219231B (en) | N-5-protected 2,5-diamino-4,6-dichloro-pyrimidine derivatives , process for producing them and intermediates | |
| CA1209142A (fr) | Procede d'obtention de nouvelles cyanoguanidines et des compositions pharmaceutiques en renfermant | |
| SU1299507A3 (ru) | Способ получени производных фторметилхинолина | |
| US5162529A (en) | Process for the preparation of 5-hydroxy-3,4,5,6-tetrahydro-pyrimidine derivatives | |
| JPS61178970A (ja) | 新規２−置換された１，４−ベンゾジアゼピンの製法 | |
| KR102441327B1 (ko) | 다이아미노피리미딘 유도체 또는 이의 산부가염의 신규의 제조방법 | |
| KR820000868B1 (ko) | 2-메틸-2-하이드록시 프로필 피페라진-1카복실 레이트 화합물의 제조 방법 | |
| US3997537A (en) | Process of preparing 2-amino-4-hydroxy-5(and/or 6)-alkyl substituted pyrimidines | |
| SU400096A1 (ru) | В П Т Б -SfJ'.; .i^ Л" V-^.-.--{Ynin | |
| Lee et al. | A new route to the improved synthesis of 1‐(alkoxymethyl)‐5‐alkyl‐6‐(arylselenenyl) uracils | |
| SU396022A1 (ru) | Способ получения производных хиназолин-2-она | |
| SU1490121A1 (ru) | Способ получени 5-гидрокси-5-метил-4-оксо-3-арилпирролидино[1,2- @ ]пиразолов | |
| SU388406A1 (ru) | СR,10где Нз — атом галогена, гидроксильна групла, низший алкил с 1—4 атомами углерода, низша алкоксигруппа с 1—4 атомами углерода, трифторметильна группа;R-s — атом водорода, галогена, гидроксильна группа, низший алкил с 1—4 ато.чами углерода, заключающийс в том, что соединение общей формулы II1520Пе(_/Y^>&=" ^Л 11 .iЧхХ- |