SU268889A1 - - Google Patents
Info
- Publication number
- SU268889A1 SU268889A1 SU1199163A SU1199163A SU268889A1 SU 268889 A1 SU268889 A1 SU 268889A1 SU 1199163 A SU1199163 A SU 1199163A SU 1199163 A SU1199163 A SU 1199163A SU 268889 A1 SU268889 A1 SU 268889A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbonization
- soda
- carried out
- hydrosulfite
- carbonation
- Prior art date
Links
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 12
- 238000003763 carbonization Methods 0.000 claims description 11
- 238000011084 recovery Methods 0.000 claims description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 6
- 238000001704 evaporation Methods 0.000 claims description 6
- 239000003546 flue gas Substances 0.000 claims description 6
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 claims description 4
- 230000008020 evaporation Effects 0.000 claims description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 3
- 239000001569 carbon dioxide Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims 1
- 230000001172 regenerating effect Effects 0.000 claims 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 8
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 7
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 239000006096 absorbing agent Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 230000008929 regeneration Effects 0.000 description 3
- 238000011069 regeneration method Methods 0.000 description 3
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 3
- 239000002253 acid Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000010411 cooking Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU268889A1 true SU268889A1 (en:Method) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2126863C1 (ru) | Способ отделения серных соединений (варианты) | |
| US3959452A (en) | Process for removing hydrogen sulfide from contaminated gas | |
| NO792783L (no) | Fremgangsmaate og apparatur for minskning av mengden av ineffektive kjemikalier i kokevaeske | |
| US3932584A (en) | Method for purifying hydrogen sulfide-containing gas | |
| SU268889A1 (en:Method) | ||
| US4122148A (en) | Sulfur dioxide removal process | |
| GB1336899A (en) | Pollution controlled polysulphide recovery process | |
| US5366716A (en) | Method for recovering sulphur dioxide from the chemical circulation of a sulphate pulp mill | |
| RU1804520C (ru) | Способ регенерации химикатов от варки и отбелки целлюлозной массы | |
| US2496550A (en) | Methods of recovering chemicals in | |
| PT100100B (pt) | Processo para recuperar energia e produtos quimicos a partir de licor negro | |
| US4206187A (en) | Process for removing sulfur dioxide from gas | |
| WO2004042140A1 (ja) | クラフトパルプの製造方法 | |
| FI67732B (fi) | Saett att aotervinna kemikalier fraon kloridhaltig groenlut | |
| FI89518B (fi) | Foerfarande foer aotervinning av svavel och alkali | |
| CN115666764A (zh) | 一种从制浆设备的不可凝气体中去除氨的方法 | |
| SU1228792A3 (ru) | Способ регенерации тепла отход щих газов от сжигани отработанного щелока варки целлюлозы на натриевом основании | |
| SU1602910A1 (ru) | Способ регенерации натри и серы из сульфитного щелока или последрожжевой бражки от сульфитной варки целлюлозы на натриевом основании | |
| SU1707117A1 (ru) | Способ выделени сероводорода из зеленого щелока целлюлозного производства | |
| FI123106B (fi) | Menetelmä kemikaalien regeneroimiseksi sekä sähkön ja lämmön tuottamiseksi sellun ja kemiallismekaanisen massan valmistuksen jäteliemestä | |
| SU289580A1 (ru) | Способ кристаллизации щелочи | |
| JPS6119567B2 (en:Method) | ||
| SE510171C2 (sv) | Förfarande för tillvaratagande och återanvändning av svavel i en cellulosafabrik | |
| FI115471B (fi) | Jäteliemien käsittelymenetelmä | |
| SU1414323A3 (ru) | Способ извлечени натриевых соединений из зеленого щелока и отход щих газов производства целлюлозы на натриевом основании |