SU181554A1 - - Google Patents
Info
- Publication number
- SU181554A1 SU181554A1 SU822434A SU822434A SU181554A1 SU 181554 A1 SU181554 A1 SU 181554A1 SU 822434 A SU822434 A SU 822434A SU 822434 A SU822434 A SU 822434A SU 181554 A1 SU181554 A1 SU 181554A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- weight
- temperature
- acids
- terephthalic
- Prior art date
Links
- 239000002253 acid Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 4
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical class CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 4
- LWTXRSWGLSFPSU-UHFFFAOYSA-N 2-(trichloromethyl)benzoic acid Chemical class OC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LWTXRSWGLSFPSU-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 3
- 150000002531 isophthalic acids Chemical class 0.000 description 3
- 150000003504 terephthalic acids Chemical class 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- BJMLLSSSTGHJJE-UHFFFAOYSA-N (4-methylbenzoyl) 4-methylbenzoate Chemical compound C1=CC(C)=CC=C1C(=O)OC(=O)C1=CC=C(C)C=C1 BJMLLSSSTGHJJE-UHFFFAOYSA-N 0.000 description 1
- MRUKIIWRMSYKML-UHFFFAOYSA-N 4-chloro-3-methylbenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1Cl MRUKIIWRMSYKML-UHFFFAOYSA-N 0.000 description 1
- NECBSSKNQDXVKN-UHFFFAOYSA-N 4-chloro-3-methylbenzoyl chloride Chemical compound CC1=CC(C(Cl)=O)=CC=C1Cl NECBSSKNQDXVKN-UHFFFAOYSA-N 0.000 description 1
- REIDAMBAPLIATC-UHFFFAOYSA-N 4-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=CC=C(C(O)=O)C=C1 REIDAMBAPLIATC-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- -1 acid chloride methyl ester Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- HBBBDGWCSBWWKP-UHFFFAOYSA-J tetrachloroantimony Chemical compound Cl[Sb](Cl)(Cl)Cl HBBBDGWCSBWWKP-UHFFFAOYSA-J 0.000 description 1
- OSBJJYCRKAFAMP-UHFFFAOYSA-N trichloromethyl benzoate Chemical compound ClC(Cl)(Cl)OC(=O)C1=CC=CC=C1 OSBJJYCRKAFAMP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU181554A1 true SU181554A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Schwenk et al. | α-Bromination of Dicarboxylic Acids1 | |
| US3487101A (en) | Preparation of methacrylic compounds by dehydration of alpha - hydroxybutyric acid compounds | |
| US2426224A (en) | Processes for producing dibasic acids and derivatives of dibasic acids | |
| EP0607824B1 (de) | Verfahren zur Herstellung mehrfach halogenierter Benzotrichloride und Benzoylchloride sowie neue, mehrfach halogenierte Benzotrichloride | |
| US3413336A (en) | Process for the preparation of aryl esters of aromatic dicarboxylic acids | |
| US4962206A (en) | Process for the preparation of 4-bromophthalic anhydride | |
| DE2642140C2 (de) | Verfahren zur Herstellung von Benzoylcyanid | |
| Mukaiyama et al. | Reactions of Mercuric Carboxylates with Trivalent Phosphorus Compounds | |
| EP0041343B1 (en) | A process for the synthesis of gamma-unsaturated carboxylic acid esters | |
| DE1283849B (de) | Verfahren zur Herstellung von reinen Arylestern von Dicarbonsaeuren | |
| US3284488A (en) | Process for producing half ester acyl chlorides of aromatic dicarboxylic acids | |
| US3639437A (en) | Production of carboxylic esters of beth-formylcrotyl alcohol | |
| JPH026412A (ja) | カルボン酸ハライドの製造法 | |
| US3257452A (en) | Condensation of benzene dicarboxylic acid with formaldehyde to produce tetracarboxydiphenylmethanes | |
| US3413317A (en) | Bicycloheptane tricarboxylic acids, anhydrides and alkyl esters thereof | |
| SU182080A1 (enExample) | ||
| AT225703B (de) | Verfahren zur Herstellung von Halbesterchloriden aromatischer Dicarbonsäuren | |
| US3833643A (en) | Process for the production of pure aryl esters of dicarboxylic acids | |
| JPS625899B2 (enExample) | ||
| JPS60112738A (ja) | グリオキシル酸エステルの生成法 | |
| KR930007734B1 (ko) | 테레프탈산 폐기물로부터 고순도의 정제 테레프탈산에스테르를 제조하는 방법 | |
| Nakano et al. | SYNTHESIS OF CHLOROALKANE-α, ω-DIOIC ACIDS | |
| RU2001905C1 (ru) | Способ получени сложноэфирного пластификатора | |
| DE19546920A1 (de) | Verfahren zur Herstellung synthetischer Pyrethroide durch azeotrope Veresterung | |
| TW472038B (en) | Process for the separation of aliphatic diacids from their mixtures with adipic acid |