SU182080A1 - - Google Patents
Info
- Publication number
- SU182080A1 SU182080A1 SU749435A SU749435A SU182080A1 SU 182080 A1 SU182080 A1 SU 182080A1 SU 749435 A SU749435 A SU 749435A SU 749435 A SU749435 A SU 749435A SU 182080 A1 SU182080 A1 SU 182080A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- chloride
- methyl
- weight
- trichloromethyl
- Prior art date
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000000034 method Methods 0.000 description 6
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- LWTXRSWGLSFPSU-UHFFFAOYSA-N 2-(trichloromethyl)benzoic acid Chemical class OC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LWTXRSWGLSFPSU-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 4
- GPZXFICWCMCQPF-UHFFFAOYSA-N 2-methylbenzoyl chloride Chemical class CC1=CC=CC=C1C(Cl)=O GPZXFICWCMCQPF-UHFFFAOYSA-N 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CWNSVVHTTQBGQB-UHFFFAOYSA-N N,N-Diethyldodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CC)CC CWNSVVHTTQBGQB-UHFFFAOYSA-N 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical class CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- -1 acid chloride methyl ester Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 150000002531 isophthalic acids Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- OSBJJYCRKAFAMP-UHFFFAOYSA-N trichloromethyl benzoate Chemical compound ClC(Cl)(Cl)OC(=O)C1=CC=CC=C1 OSBJJYCRKAFAMP-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU182080A1 true SU182080A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Raasch et al. | Mono-and Difluorobutenedioic Acids | |
| US2426224A (en) | Processes for producing dibasic acids and derivatives of dibasic acids | |
| US3365483A (en) | Process for obtaining diethylaminoethanol acetylsalicylate hydrochloride | |
| DE60002139T2 (de) | Verfahren zur Herstellung von Arylcarbonsäureestern | |
| Gething et al. | 307. Aromatic polyfluoro-compounds. Part IX. Perfluoro-o-xylene, perfluoro-p-xylene, and tetrafluoro-phthalic and-terephthalic acid | |
| KR100357651B1 (ko) | 시킴산 및 그의 염의 제조방법 | |
| US3950397A (en) | Process for the preparation of citric acid esters, citric acid or citric acid salts | |
| US3284488A (en) | Process for producing half ester acyl chlorides of aromatic dicarboxylic acids | |
| US3869517A (en) | Process for preparing hydroxy citronellal by saponification of the hydroxy ester | |
| US2500009A (en) | Chloroalkyl acylates | |
| US4281176A (en) | Preparation of ethyl carboxylates | |
| US4929775A (en) | Process for preparing brominated pentaerythritols | |
| SU195389A1 (ru) | Способ одновременного получения хлорангидридор | |
| EP0095698B1 (de) | Verfahren zur Herstellung von Terephthalsäure- und Isophthalsäuredichlorid | |
| SU181554A1 (enExample) | ||
| US3282988A (en) | Process for producing half ester acyl chlorides of aromatic dicarboxylic acids | |
| AT225703B (de) | Verfahren zur Herstellung von Halbesterchloriden aromatischer Dicarbonsäuren | |
| SU753069A1 (ru) | Способ получени этилового эфира @ -аминобензойной кислоты | |
| US2841593A (en) | Reaction of substituted benzene, chlorine, and substituted maleic anhydride and products thereof | |
| SU196833A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ЗАМЕЩЕННЫХ АМИДОВтриАлкилсилилуксусной кислоты | |
| DE68907758T2 (de) | Propanon-1,3-disulfonsäure als Veresterungskatalysator. | |
| SU346872A1 (ru) | Способ получения n-ацилпеницилликов | |
| SU186452A1 (ru) | Способ получения метилового эфира ундециленовой кислоты | |
| US3781342A (en) | Production of tertiary alkyl substituted ortho-toluic acids and esters thereof | |
| US3445506A (en) | Method for preparing ethyl acrylate |