SU165688A1 - - Google Patents
Info
- Publication number
- SU165688A1 SU165688A1 SU862391A SU862391A SU165688A1 SU 165688 A1 SU165688 A1 SU 165688A1 SU 862391 A SU862391 A SU 862391A SU 862391 A SU862391 A SU 862391A SU 165688 A1 SU165688 A1 SU 165688A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- oxidation
- during
- alkali
- potassium
- mixture
- Prior art date
Links
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- 229910000616 Ferromanganese Inorganic materials 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- DALUDRGQOYMVLD-UHFFFAOYSA-N iron manganese Chemical compound [Mn].[Fe] DALUDRGQOYMVLD-UHFFFAOYSA-N 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- OQVYMXCRDHDTTH-UHFFFAOYSA-N 4-(diethoxyphosphorylmethyl)-2-[4-(diethoxyphosphorylmethyl)pyridin-2-yl]pyridine Chemical compound CCOP(=O)(OCC)CC1=CC=NC(C=2N=CC=C(CP(=O)(OCC)OCC)C=2)=C1 OQVYMXCRDHDTTH-UHFFFAOYSA-N 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- LBSANEJBGMCTBH-UHFFFAOYSA-N manganate Chemical compound [O-][Mn]([O-])(=O)=O LBSANEJBGMCTBH-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU165688A1 true SU165688A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2626520A1 (de) | Verfahren zur herstellung von synthesegas | |
| DK161248B (da) | Fremgangsmaade til fremstilling af dimethylcarbonat ud fra methanol, carbonmonoxid og oxygen | |
| SU165688A1 (enExample) | ||
| US1743080A (en) | Manufacture of pulp and treatment of residual liquors, etc. | |
| ATE315003T1 (de) | Verfahren zur herstellung eines wasserstoff und kohlenmonoxid enthaltenden gemisches | |
| SU856974A1 (ru) | Способ получени элементарной серы | |
| US2080767A (en) | Manufacture of hydrocarbon gases | |
| DE1901171A1 (de) | Verfahren zum Entziehen von Schwefeldioxyd aus Abgasen | |
| US1115776A (en) | Producing hydrogen. | |
| GB191227955A (en) | Improvements in, or connected with, the Manufacture of Hydrogen. | |
| DE1119832B (de) | Verfahren zur Herstellung von Chlorwasserstoff | |
| USRE15314E (en) | Island | |
| AT57697B (de) | Verfahren und Vorrichtung zur Erzeugung von Wasserstoff. | |
| DE911606C (de) | Verfahren zur Herstellung von Blausaeure | |
| US1351755A (en) | Process of manufacturing-hydrogen sulfid | |
| US1050978A (en) | Process of manufacturing cyanid of hydrogen. | |
| SU1133284A1 (ru) | Способ получени битума | |
| US1602802A (en) | Manufacture of oxalates and oxalic acid | |
| SU286994A1 (ru) | Способ получения азотной кислоты | |
| US1943920A (en) | Process for the production of | |
| US1623598A (en) | Carbon catalyst and process of making it. | |
| US1458650A (en) | Process for the production of calcium chloride | |
| SU346229A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ МАНГАНАТА КАЛИЯn-vfi | |
| DE612046C (enExample) | ||
| SU628084A1 (ru) | Способ получени сернистого натри |