SK283842B6 - Substituované chinolíny ako herbicídne medziprodukty a spôsob ich prípravy - Google Patents
Substituované chinolíny ako herbicídne medziprodukty a spôsob ich prípravy Download PDFInfo
- Publication number
- SK283842B6 SK283842B6 SK684-96A SK68496A SK283842B6 SK 283842 B6 SK283842 B6 SK 283842B6 SK 68496 A SK68496 A SK 68496A SK 283842 B6 SK283842 B6 SK 283842B6
- Authority
- SK
- Slovakia
- Prior art keywords
- compound
- formula
- naome
- phenyl
- cuso
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 7
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 4
- 230000002363 herbicidal effect Effects 0.000 title abstract description 8
- 239000000543 intermediate Substances 0.000 title abstract description 8
- 150000003248 quinolines Chemical class 0.000 title abstract description 4
- 229940111121 antirheumatic drug quinolines Drugs 0.000 title description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 31
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 9
- 150000003839 salts Chemical group 0.000 claims description 8
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- -1 quaternary ammonium halide Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 230000002140 halogenating effect Effects 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- 239000012065 filter cake Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- 238000006198 methoxylation reaction Methods 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 229910052723 transition metal Inorganic materials 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims 8
- 125000001246 bromo group Chemical group Br* 0.000 claims 5
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 claims 4
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical group [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 claims 3
- 125000001453 quaternary ammonium group Chemical group 0.000 claims 3
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 claims 2
- MBLLPDUTXVGWMR-UHFFFAOYSA-M (8-acetyloxyquinolin-3-yl)methyl-trimethylazanium;bromide Chemical compound [Br-].C[N+](C)(C)CC1=CN=C2C(OC(=O)C)=CC=CC2=C1 MBLLPDUTXVGWMR-UHFFFAOYSA-M 0.000 claims 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 1
- 229910002091 carbon monoxide Inorganic materials 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000000284 extract Substances 0.000 claims 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000012265 solid product Substances 0.000 claims 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 10
- MEPWORSWJGREPQ-UHFFFAOYSA-N 5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-ylimidazolidin-2-yl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(COC)=CN=C1C1NC(C)(C(C)C)C(=O)N1 MEPWORSWJGREPQ-UHFFFAOYSA-N 0.000 abstract description 3
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 abstract description 2
- 239000005725 8-Hydroxyquinoline Substances 0.000 abstract 1
- 229960003540 oxyquinoline Drugs 0.000 abstract 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 abstract 1
- 239000002904 solvent Substances 0.000 description 5
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- LHPOFWYKNOUJJN-UHFFFAOYSA-N 3-methylquinolin-8-ol Chemical class OC1=CC=CC2=CC(C)=CN=C21 LHPOFWYKNOUJJN-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- UFEDBSXWGPWPLE-UHFFFAOYSA-N (3-methylquinolin-8-yl) acetate Chemical compound CC1=CN=C2C(OC(=O)C)=CC=CC2=C1 UFEDBSXWGPWPLE-UHFFFAOYSA-N 0.000 description 2
- HYQAHWLXBFESQU-UHFFFAOYSA-N 3-(methoxymethyl)quinolin-8-ol Chemical compound OC1=CC=CC2=CC(COC)=CN=C21 HYQAHWLXBFESQU-UHFFFAOYSA-N 0.000 description 2
- ACKBYYXIYCPBIT-UHFFFAOYSA-N 3-methylquinolin-8-ol;hydrochloride Chemical compound Cl.OC1=CC=CC2=CC(C)=CN=C21 ACKBYYXIYCPBIT-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- CJSGMWRJOBFTCK-UHFFFAOYSA-N 5-(methoxymethyl)pyridine-2,3-dicarboxylic acid Chemical compound COCC1=CN=C(C(O)=O)C(C(O)=O)=C1 CJSGMWRJOBFTCK-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/32—Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/32—Esters
- C07D215/34—Carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quinoline Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/461,786 US5633380A (en) | 1995-06-05 | 1995-06-05 | Substituted quinoline herbicide intermediates and process |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK68496A3 SK68496A3 (en) | 1997-01-08 |
| SK283842B6 true SK283842B6 (sk) | 2004-03-02 |
Family
ID=23833925
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK684-96A SK283842B6 (sk) | 1995-06-05 | 1996-05-28 | Substituované chinolíny ako herbicídne medziprodukty a spôsob ich prípravy |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US5633380A (cs) |
| EP (1) | EP0747362B1 (cs) |
| JP (1) | JPH0925266A (cs) |
| KR (1) | KR970001328A (cs) |
| CN (1) | CN1130344C (cs) |
| AR (1) | AR002304A1 (cs) |
| AT (1) | ATE226941T1 (cs) |
| AU (1) | AU712554B2 (cs) |
| BR (1) | BR9602617A (cs) |
| CA (1) | CA2178060A1 (cs) |
| CZ (1) | CZ289952B6 (cs) |
| DE (1) | DE69624531T2 (cs) |
| DK (1) | DK0747362T3 (cs) |
| ES (1) | ES2185748T3 (cs) |
| HU (1) | HUP9601520A3 (cs) |
| IL (1) | IL118503A (cs) |
| PT (1) | PT747362E (cs) |
| RU (1) | RU2130929C1 (cs) |
| SG (1) | SG43373A1 (cs) |
| SI (1) | SI0747362T1 (cs) |
| SK (1) | SK283842B6 (cs) |
| TR (1) | TR199600442A1 (cs) |
| TW (1) | TW328903B (cs) |
| YU (1) | YU49499B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ314904A (en) * | 1996-06-10 | 1998-06-26 | American Cyanamid Co | Preparation of a herbicidal [(5,6-dicarboxy-3-pyridyl)methyl]ammonium halide |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1223393B (de) * | 1958-09-02 | 1966-08-25 | Metalsalts Corp | Verfahren zur Herstellung von Carbonsaeuresalzen von Carbonsaeureestern des gegebenenfalls substituierten 8-Hydroxychinolins |
| US3297525A (en) * | 1962-10-19 | 1967-01-10 | Merck & Co Inc | Fungicidal compositions comprising salicylates of 8 hydroxy quinoline carboxylic esters |
| CH438307A (de) * | 1964-06-04 | 1967-06-30 | Agripat Sa | Verfahren zur Herstellung neuer heterocyclischer Carbaminsäureester und ihre Verwendung zur Bekämpfung phytopathogener Pilze |
| GB2192877A (en) * | 1986-07-22 | 1988-01-27 | Shell Int Research | Herbicidal imidazolinyl compounds |
| US5294622A (en) * | 1988-01-29 | 1994-03-15 | Dowelanco | Substituted quinolines and cinnolines |
| US5281713A (en) * | 1991-12-20 | 1994-01-25 | American Cyanamid Company | Process for the manufacture of 2-alkoxymethylacrolein |
| US5288866A (en) * | 1991-12-20 | 1994-02-22 | American Cyanamid Company | 5,6-disubstituted-3-pyridylmethyl ammonium halide compounds useful for the preparation of 5- (substituted methyl)-2,3-pyridinedicarboxylic acids |
| US5312922A (en) * | 1992-04-06 | 1994-05-17 | Nordion International Inc. | Europium and terbium chelators for time-resolved fluorometric assays |
| US5410054A (en) * | 1993-07-20 | 1995-04-25 | Merck Frosst Canada, Inc. | Heteroaryl quinolines as inhibitors of leukotriene biosynthesis |
-
1995
- 1995-06-05 US US08/461,786 patent/US5633380A/en not_active Expired - Lifetime
-
1996
- 1996-05-21 CZ CZ19961465A patent/CZ289952B6/cs not_active IP Right Cessation
- 1996-05-24 CN CN96106657A patent/CN1130344C/zh not_active Expired - Lifetime
- 1996-05-28 SK SK684-96A patent/SK283842B6/sk not_active IP Right Cessation
- 1996-05-30 TR TR96/00442A patent/TR199600442A1/xx unknown
- 1996-05-31 IL IL11850396A patent/IL118503A/xx not_active IP Right Cessation
- 1996-06-03 CA CA002178060A patent/CA2178060A1/en not_active Abandoned
- 1996-06-03 JP JP8160483A patent/JPH0925266A/ja active Pending
- 1996-06-04 ES ES96304057T patent/ES2185748T3/es not_active Expired - Lifetime
- 1996-06-04 AU AU54744/96A patent/AU712554B2/en not_active Ceased
- 1996-06-04 PT PT96304057T patent/PT747362E/pt unknown
- 1996-06-04 BR BR9602617A patent/BR9602617A/pt not_active IP Right Cessation
- 1996-06-04 YU YU33296A patent/YU49499B/sh unknown
- 1996-06-04 KR KR1019960019816A patent/KR970001328A/ko not_active Ceased
- 1996-06-04 SI SI9630538T patent/SI0747362T1/xx unknown
- 1996-06-04 AT AT96304057T patent/ATE226941T1/de active
- 1996-06-04 AR ARP960102907A patent/AR002304A1/es unknown
- 1996-06-04 DE DE69624531T patent/DE69624531T2/de not_active Expired - Fee Related
- 1996-06-04 RU RU96111816A patent/RU2130929C1/ru not_active IP Right Cessation
- 1996-06-04 EP EP96304057A patent/EP0747362B1/en not_active Expired - Lifetime
- 1996-06-04 HU HU9601520A patent/HUP9601520A3/hu unknown
- 1996-06-04 DK DK96304057T patent/DK0747362T3/da active
- 1996-06-05 SG SG1996009969A patent/SG43373A1/en unknown
- 1996-07-09 TW TW085108314A patent/TW328903B/zh not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CZ289952B6 (cs) | 2002-05-15 |
| AU712554B2 (en) | 1999-11-11 |
| RU2130929C1 (ru) | 1999-05-27 |
| ES2185748T3 (es) | 2003-05-01 |
| IL118503A (en) | 2001-01-11 |
| DE69624531D1 (de) | 2002-12-05 |
| KR970001328A (ko) | 1997-01-24 |
| HUP9601520A3 (en) | 1999-03-01 |
| DK0747362T3 (da) | 2003-01-06 |
| DE69624531T2 (de) | 2003-03-20 |
| AR002304A1 (es) | 1998-03-11 |
| JPH0925266A (ja) | 1997-01-28 |
| ATE226941T1 (de) | 2002-11-15 |
| EP0747362A1 (en) | 1996-12-11 |
| TW328903B (en) | 1998-04-01 |
| YU33296A (sh) | 1998-12-23 |
| SG43373A1 (en) | 1997-10-17 |
| HUP9601520A2 (en) | 1997-03-28 |
| CN1130344C (zh) | 2003-12-10 |
| YU49499B (sh) | 2006-08-17 |
| SI0747362T1 (en) | 2003-04-30 |
| US5633380A (en) | 1997-05-27 |
| AU5474496A (en) | 1996-12-19 |
| SK68496A3 (en) | 1997-01-08 |
| CA2178060A1 (en) | 1996-12-06 |
| PT747362E (pt) | 2003-03-31 |
| CZ146596A3 (en) | 1997-01-15 |
| EP0747362B1 (en) | 2002-10-30 |
| CN1138034A (zh) | 1996-12-18 |
| TR199600442A1 (tr) | 1996-12-21 |
| IL118503A0 (en) | 1996-09-12 |
| BR9602617A (pt) | 1998-09-01 |
| HU9601520D0 (en) | 1996-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK283842B6 (sk) | Substituované chinolíny ako herbicídne medziprodukty a spôsob ich prípravy | |
| US5354864A (en) | 3-(9-acridinylamino)-5-hydroxymethylaniline derivatives as anticancer agents | |
| US6288271B1 (en) | Process for the preparation of (2,2,2-trifluoroethoxy)benzoic acids | |
| JP2771994B2 (ja) | プロペン酸誘導体の製造法 | |
| US4990620A (en) | Halogen substituted pyridylalkyl ketones | |
| US4720572A (en) | Process for the preparation of 4-acyloxy-3-oxo-butyric acid esters | |
| US4692545A (en) | Method for preparation of mercaptobenzoates | |
| CZ294764B6 (cs) | Způsoby přípravy kyseliny D(+)-2-[4-(6-chlor-2-chinoxalyloxy)fenoxy]propionové a jejích derivátů | |
| SU764609A3 (ru) | Способ получени производных бензимидазолкарбамата | |
| US6002012A (en) | Process for the preparation of [(5,6-dicarboxy-3-pyridyl) methyl] ammonium halides | |
| US4091095A (en) | Phosphinyl compounds | |
| US5359089A (en) | Process for the preparation of 2,4,5-tribromopyrrole-3-carbonitrile | |
| US5578728A (en) | Process for the preparation of a benzo(a)quinolizione derivative | |
| US5001264A (en) | N-phenyl-2,2,6,6-tetrahalocyclohexaneimine and processes for preparing 2,2,6,6-tetrahalocyclohexaneimine derivative and 2,6-dihaloaniline derivative | |
| RU2161605C2 (ru) | Замещенные хинолины в качестве полупродуктов для производства гербицида и способ их получения | |
| CZ25494A3 (en) | Process for preparing phenylbenzamide derivatives | |
| US4960893A (en) | 7-bromomethyl-5-halo-8-hydroxyquinoline and method of preparation | |
| JPH0623168B2 (ja) | ベンゼンスルホニルクロリド誘導体の製造方法 | |
| US5233043A (en) | 2-alkoxy-5-alkoxymethyl-pyridines and a process for their preparation | |
| US4182761A (en) | Acyloxy-substituted aryloxyalkyl diketones | |
| JP2536756B2 (ja) | ５−アルコキシアントラニル酸エステル | |
| JPH0272140A (ja) | 光学活性なカルボン酸エステル類およびその製造方法 | |
| JPS642102B2 (cs) | ||
| US5329011A (en) | Process for the preparation of 2-chloro-5-chloromethyl-pyridine, and new intermediates | |
| JPH0478632B2 (cs) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed due to non-payment of maintenance fees |
Effective date: 20100528 |