SE441594B - Forfarande for framstellning av klordioxid - Google Patents
Forfarande for framstellning av klordioxidInfo
- Publication number
- SE441594B SE441594B SE7806663A SE7806663A SE441594B SE 441594 B SE441594 B SE 441594B SE 7806663 A SE7806663 A SE 7806663A SE 7806663 A SE7806663 A SE 7806663A SE 441594 B SE441594 B SE 441594B
- Authority
- SE
- Sweden
- Prior art keywords
- reaction
- chlorine dioxide
- chlorine
- sodium chloride
- sodium
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 title description 4
- 238000002360 preparation method Methods 0.000 title description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 119
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 claims description 114
- 238000006243 chemical reaction Methods 0.000 claims description 71
- 239000011780 sodium chloride Substances 0.000 claims description 58
- 239000004155 Chlorine dioxide Substances 0.000 claims description 57
- 235000019398 chlorine dioxide Nutrition 0.000 claims description 57
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 55
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 41
- 239000000203 mixture Substances 0.000 claims description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- 239000000243 solution Substances 0.000 claims description 28
- 238000004519 manufacturing process Methods 0.000 claims description 27
- 239000000460 chlorine Substances 0.000 claims description 26
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 25
- 229910052801 chlorine Inorganic materials 0.000 claims description 24
- 239000007864 aqueous solution Substances 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 11
- -1 hydrochloric acid sodium sodium chlorate Chemical compound 0.000 claims description 10
- 239000011261 inert gas Substances 0.000 claims description 7
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 238000007664 blowing Methods 0.000 claims description 3
- 239000002002 slurry Substances 0.000 claims description 3
- 238000007599 discharging Methods 0.000 claims description 2
- 239000002244 precipitate Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims 1
- 229960004889 salicylic acid Drugs 0.000 claims 1
- 239000008400 supply water Substances 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 14
- 238000005868 electrolysis reaction Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 9
- 239000007789 gas Substances 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000012429 reaction media Substances 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000004880 explosion Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 229910001902 chlorine oxide Inorganic materials 0.000 description 1
- 229910001430 chromium ion Inorganic materials 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- WLEGVBWDHBDGSY-UHFFFAOYSA-M sodium;chloric acid;chloride Chemical compound [Na+].[Cl-].OCl(=O)=O WLEGVBWDHBDGSY-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B11/00—Oxides or oxyacids of halogens; Salts thereof
- C01B11/02—Oxides of chlorine
- C01B11/022—Chlorine dioxide (ClO2)
- C01B11/023—Preparation from chlorites or chlorates
- C01B11/025—Preparation from chlorites or chlorates from chlorates without any other reaction reducing agent than chloride ions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Inorganic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52066607A JPS5951481B2 (ja) | 1977-06-08 | 1977-06-08 | 二酸化塩素の製造方法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7806663L SE7806663L (sv) | 1978-12-09 |
| SE441594B true SE441594B (sv) | 1985-10-21 |
Family
ID=13320749
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7806663A SE441594B (sv) | 1977-06-08 | 1978-06-07 | Forfarande for framstellning av klordioxid |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4176168A (enExample) |
| JP (1) | JPS5951481B2 (enExample) |
| AR (1) | AR215183A1 (enExample) |
| AT (1) | AT377741B (enExample) |
| BR (1) | BR7803575A (enExample) |
| CA (1) | CA1105877A (enExample) |
| DE (1) | DE2824325C3 (enExample) |
| DK (1) | DK253178A (enExample) |
| FI (1) | FI66580C (enExample) |
| FR (1) | FR2393761A1 (enExample) |
| GB (1) | GB1587610A (enExample) |
| NO (1) | NO152645C (enExample) |
| SE (1) | SE441594B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2917132A1 (de) * | 1979-04-27 | 1980-11-06 | Metallgesellschaft Ag | Verfahren zur herstellung von chlordioxid |
| FR2498585A1 (fr) | 1981-01-27 | 1982-07-30 | Ugine Kuhlmann | Procede de generation de dioxyde de chlore |
| DE3128817A1 (de) * | 1981-07-21 | 1983-02-10 | Dipl.-Ing. Hanns Fröhler KG, 8023 Pullach | Verfahren und vorrichtung zur herstellung von chlordioxid |
| CA1324976C (en) * | 1988-07-26 | 1993-12-07 | Zbigniew Twardowski | Combined process for production of chlorine dioxide and sodium hydroxide |
| US5324497A (en) * | 1992-02-26 | 1994-06-28 | Westerlund G Oscar | Integrated procedure for high yield production of chlorine dioxide and apparatus used therefor |
| CA2333247C (en) * | 2000-02-01 | 2010-07-20 | Sterling Canada, Inc. | A method of improving yield of chlorine dioxide generation processes |
| US6511644B1 (en) | 2000-08-28 | 2003-01-28 | The Chemithon Corporation | Method for removing contaminants in reactors |
| CN104261350B (zh) * | 2014-09-24 | 2016-02-17 | 广西大学 | 一种不产生固形物的二氧化氯制备方法 |
| CN109071220A (zh) | 2016-03-31 | 2018-12-21 | 本部三庆株式会社 | 将盐进行电解而得到的物质用于原材料的亚氯酸水的制造方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2484402A (en) * | 1946-01-04 | 1949-10-11 | Brown Co | Process for producing chlorine dioxide |
| GB672047A (en) * | 1948-10-01 | 1952-05-14 | Edelbert Kesting | Improvements in the manufacture of chlorine dioxide |
| US3864456A (en) * | 1964-08-13 | 1975-02-04 | Electric Reduction Co | Manufacture of chlorine dioxide, chlorine and anhydrous sodium sulphate |
| US3524728A (en) * | 1966-10-05 | 1970-08-18 | Chemech Eng Ltd | Closed cycle system for the generation of chlorine dioxide |
| FR2163818A5 (enExample) * | 1970-06-10 | 1973-07-27 | Electric Reduction Cy Ca |
-
1977
- 1977-06-08 JP JP52066607A patent/JPS5951481B2/ja not_active Expired
-
1978
- 1978-05-24 GB GB22147/78A patent/GB1587610A/en not_active Expired
- 1978-06-01 US US05/911,548 patent/US4176168A/en not_active Expired - Lifetime
- 1978-06-02 CA CA304,720A patent/CA1105877A/en not_active Expired
- 1978-06-02 DE DE2824325A patent/DE2824325C3/de not_active Expired
- 1978-06-05 BR BR787803575A patent/BR7803575A/pt unknown
- 1978-06-06 AT AT0409678A patent/AT377741B/de not_active IP Right Cessation
- 1978-06-06 NO NO781981A patent/NO152645C/no unknown
- 1978-06-07 AR AR272472A patent/AR215183A1/es active
- 1978-06-07 FI FI781819A patent/FI66580C/fi not_active IP Right Cessation
- 1978-06-07 SE SE7806663A patent/SE441594B/sv not_active IP Right Cessation
- 1978-06-07 DK DK253178A patent/DK253178A/da not_active Application Discontinuation
- 1978-06-08 FR FR787817196A patent/FR2393761A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AT377741B (de) | 1985-04-25 |
| ATA409678A (de) | 1984-09-15 |
| FI66580B (fi) | 1984-07-31 |
| FI66580C (fi) | 1984-11-12 |
| DK253178A (da) | 1978-12-09 |
| DE2824325B2 (enExample) | 1980-07-10 |
| BR7803575A (pt) | 1979-01-16 |
| AR215183A1 (es) | 1979-09-14 |
| SE7806663L (sv) | 1978-12-09 |
| DE2824325A1 (de) | 1978-12-14 |
| JPS5951481B2 (ja) | 1984-12-14 |
| CA1105877A (en) | 1981-07-28 |
| DE2824325C3 (de) | 1981-04-23 |
| NO152645B (no) | 1985-07-22 |
| FR2393761B1 (enExample) | 1982-09-10 |
| NO781981L (no) | 1978-12-11 |
| FI781819A7 (fi) | 1978-12-09 |
| US4176168A (en) | 1979-11-27 |
| FR2393761A1 (fr) | 1979-01-05 |
| NO152645C (no) | 1985-10-30 |
| GB1587610A (en) | 1981-04-08 |
| JPS542296A (en) | 1979-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2023733C (en) | Chlorine dioxide generation from chloric acid | |
| EP0498484B1 (en) | Process for electrolytic production of alkali metal chlorate and auxiliary chemicals | |
| US5198080A (en) | Electrochemical processing of aqueous solutions | |
| US5324497A (en) | Integrated procedure for high yield production of chlorine dioxide and apparatus used therefor | |
| JP6512362B2 (ja) | 過硫酸アンモニウムの製造方法 | |
| SE441594B (sv) | Forfarande for framstellning av klordioxid | |
| US4080436A (en) | Thermoelectrochemical cyclical process for production of hydrogen and oxygen from water | |
| US6235167B1 (en) | Electrolyzer for the production of sodium chlorate | |
| US3455797A (en) | Procedure for the preparation of olefin oxides | |
| US3929974A (en) | Production of chlorine dioxide | |
| CA2084183C (en) | Electrochemical processing of aqueous solutions | |
| CA1325787C (en) | Process for the production of alkali metal chlorate | |
| US4776930A (en) | Process for the preparation of potassium nitrate | |
| US3553088A (en) | Method of producing alkali metal chlorate | |
| GB757761A (en) | Preparation of alkali metal chlorates | |
| US3119757A (en) | Process and apparatus for the conversion of hydrochloric acid to chlorine | |
| US2315830A (en) | Production of alkali metals and their amides | |
| US3020124A (en) | Manufacture of perchlorates | |
| Slyuzar et al. | DESIGNING FEATURES OF THE CRYSTALLINE SODIUM CHLORATE INSTALLATION BY A PERIODICAL PROCESS | |
| US3464901A (en) | Production of chlorates | |
| FI121076B (fi) | Menetelmä alkalimetallikloraatin valmistamiseksi | |
| GEOFFREY MARTIN | MANUFACTURE OF CHLORATES AND PERCHLORATES | |
| NO119166B (enExample) | ||
| NO164831B (no) | Fremgangsmaate til fremstilling av vannfritt magnesiumklorid egnet for fremstilling av magnesium. | |
| IES69660B2 (en) | Hydrochloric acid recovery |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7806663-6 Effective date: 19880318 Format of ref document f/p: F |