SE440364B - Forfarande for framstellning av en partikelformig detergentkomposition innehallande ett alkalimetallkarbonat, en tvettaktiv forening och finfordelat kalciumkarbonat - Google Patents
Forfarande for framstellning av en partikelformig detergentkomposition innehallande ett alkalimetallkarbonat, en tvettaktiv forening och finfordelat kalciumkarbonatInfo
- Publication number
- SE440364B SE440364B SE7805686A SE7805686A SE440364B SE 440364 B SE440364 B SE 440364B SE 7805686 A SE7805686 A SE 7805686A SE 7805686 A SE7805686 A SE 7805686A SE 440364 B SE440364 B SE 440364B
- Authority
- SE
- Sweden
- Prior art keywords
- alkali metal
- carbonate
- detergent
- calcium carbonate
- metal carbonate
- Prior art date
Links
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 title claims description 126
- 239000003599 detergent Substances 0.000 title claims description 83
- 239000000203 mixture Substances 0.000 title claims description 64
- 229910000019 calcium carbonate Inorganic materials 0.000 title claims description 59
- 229910000288 alkali metal carbonate Inorganic materials 0.000 title claims description 48
- 150000008041 alkali metal carbonates Chemical class 0.000 title claims description 47
- 238000000034 method Methods 0.000 title claims description 34
- 239000013543 active substance Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 39
- 230000008569 process Effects 0.000 claims description 24
- 239000002245 particle Substances 0.000 claims description 19
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical group [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 239000000843 powder Substances 0.000 claims description 13
- 239000004115 Sodium Silicate Substances 0.000 claims description 9
- 238000002156 mixing Methods 0.000 claims description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 9
- 229910021532 Calcite Inorganic materials 0.000 claims description 8
- -1 calcium carbonate carbonate alkali metal carbonate Chemical class 0.000 claims description 8
- 239000007844 bleaching agent Substances 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 3
- 239000007921 spray Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 235000011837 pasties Nutrition 0.000 claims description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 52
- 238000005406 washing Methods 0.000 description 17
- 239000000047 product Substances 0.000 description 13
- 230000000694 effects Effects 0.000 description 10
- 238000005469 granulation Methods 0.000 description 7
- 230000003179 granulation Effects 0.000 description 7
- 229940001593 sodium carbonate Drugs 0.000 description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 230000036571 hydration Effects 0.000 description 6
- 238000006703 hydration reaction Methods 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 238000001694 spray drying Methods 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000002304 perfume Substances 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 235000019832 sodium triphosphate Nutrition 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000005323 carbonate salts Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000007872 degassing Methods 0.000 description 3
- 238000010410 dusting Methods 0.000 description 3
- 150000004682 monohydrates Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 239000004141 Sodium laurylsulphate Substances 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229940071207 sesquicarbonate Drugs 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- 229940045872 sodium percarbonate Drugs 0.000 description 2
- 235000019351 sodium silicates Nutrition 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- 208000032484 Accidental exposure to product Diseases 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- GBFLZEXEOZUWRN-VKHMYHEASA-N S-carboxymethyl-L-cysteine Chemical compound OC(=O)[C@@H](N)CSCC(O)=O GBFLZEXEOZUWRN-VKHMYHEASA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000009388 chemical precipitation Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical class ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 238000001493 electron microscopy Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002979 fabric softener Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000000887 hydrating effect Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000001007 puffing effect Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/1233—Carbonates, e.g. calcite or dolomite
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/10—Carbonates ; Bicarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB20933/77A GB1583081A (en) | 1977-05-18 | 1977-05-18 | Production of detergent compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7805686L SE7805686L (sv) | 1978-11-19 |
| SE440364B true SE440364B (sv) | 1985-07-29 |
Family
ID=10154267
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7805686A SE440364B (sv) | 1977-05-18 | 1978-05-17 | Forfarande for framstellning av en partikelformig detergentkomposition innehallande ett alkalimetallkarbonat, en tvettaktiv forening och finfordelat kalciumkarbonat |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4196093A (OSRAM) |
| JP (1) | JPS6041120B2 (OSRAM) |
| AT (1) | AT365228B (OSRAM) |
| AU (1) | AU524887B2 (OSRAM) |
| BE (1) | BE867038A (OSRAM) |
| BR (1) | BR7803119A (OSRAM) |
| CA (1) | CA1121247A (OSRAM) |
| CH (1) | CH639418A5 (OSRAM) |
| DE (1) | DE2820990A1 (OSRAM) |
| ES (1) | ES469948A1 (OSRAM) |
| FR (1) | FR2391274A1 (OSRAM) |
| GB (1) | GB1583081A (OSRAM) |
| IN (1) | IN147962B (OSRAM) |
| IT (1) | IT1109058B (OSRAM) |
| NL (1) | NL191292C (OSRAM) |
| SE (1) | SE440364B (OSRAM) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PH17687A (en) * | 1979-03-06 | 1984-11-02 | Unilever Nv | Detergent compositions |
| US4434069A (en) | 1982-07-28 | 1984-02-28 | Purex Corporation | Plastic bottle cleaner |
| US4505836A (en) * | 1982-07-28 | 1985-03-19 | Tp Industrial, Inc. | Plastic bottle cleaner composition and method |
| US4512428A (en) * | 1983-05-05 | 1985-04-23 | K-Tron International, Inc. | Weighing apparatus and method |
| ES8607378A1 (es) * | 1984-08-06 | 1986-05-16 | Kao Corp | Una composicion detergente en polvo de gran densidad |
| JPS6189300A (ja) * | 1984-10-09 | 1986-05-07 | ライオン株式会社 | 非イオン界面活性剤を含む粒状洗剤組成物の製造方法 |
| GB8626691D0 (en) * | 1986-11-07 | 1986-12-10 | Unilever Plc | Detergent composition |
| GB8711423D0 (en) * | 1987-05-14 | 1987-06-17 | Unilever Plc | Detergent composition |
| TR24867A (tr) * | 1989-08-23 | 1992-07-01 | Unilever Nv | CAMASIR MUAMELE MAMULü |
| GB8926644D0 (en) * | 1989-11-24 | 1990-01-17 | Unilever Plc | Detergent composition |
| GB9112384D0 (en) * | 1991-06-10 | 1991-07-31 | Unilever Plc | Detergent compositions |
| WO1993004154A1 (de) * | 1991-08-20 | 1993-03-04 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung carbonathaltiger granulate |
| US5824630A (en) * | 1993-07-16 | 1998-10-20 | The Procter & Gamble Company | Machine dishwashing composition containing oxygen bleach and paraffin oil and nitrogen compound silver tarnishing inhibitors |
| US5496486A (en) * | 1994-06-30 | 1996-03-05 | Amway Corporation | Process for increasing liquid surfactant loading in free flowing powder detergents |
| US6194367B1 (en) | 1995-03-01 | 2001-02-27 | Charvid Limited Liability Co. | Non-caustic cleaning composition comprising peroxygen compound and specific silicate and method of making the same in free-flowing, particulate form |
| US5663132A (en) * | 1995-03-01 | 1997-09-02 | Charvid Limited Liability Company | Non-caustic composition comprising peroxygen compound and metasilicate and cleaning methods for using same |
| US5898024A (en) * | 1995-03-01 | 1999-04-27 | Charvid Limited Liability | Non-caustic cleaning composition comprising peroxygen compound and specific silicate, and method of making the same in free-flowing, particulate form |
| US6034048A (en) * | 1995-03-01 | 2000-03-07 | Charvid Limited Liability Co. | Non-caustic cleaning composition using an alkali salt |
| US5658867A (en) * | 1995-05-31 | 1997-08-19 | The Procter & Gamble Company | Cleaning compositions containing a crystalline builder material in selected particle size ranges for improved performance |
| US5707959A (en) * | 1995-05-31 | 1998-01-13 | The Procter & Gamble Company | Processes for making a granular detergent composition containing a crystalline builder |
| US5733865A (en) * | 1995-05-31 | 1998-03-31 | The Procter & Gamble Company | Processes for making a crystalline builder having improved performance |
| US5731279A (en) * | 1995-05-31 | 1998-03-24 | The Procter & Gamble Company | Cleaning compositions containing a crystalline builder material having improved performance |
| GB9513327D0 (en) * | 1995-06-30 | 1995-09-06 | Uniliver Plc | Process for the production of a detergent composition |
| DE19543162A1 (de) * | 1995-11-18 | 1997-05-22 | Basf Ag | Feste Textilwaschmittel-Formulierung aus anorganischen Buildern, Glycin-N,N-diessigsäure-Derivaten als organische Cobuilder sowie anionischen und nichtionischen Tensiden |
| US6013617A (en) * | 1996-01-19 | 2000-01-11 | Rhone-Poulenc Chimie | Q2 /Q3 alkali metal silicate/inorganic compound detergent builders |
| JP3810854B2 (ja) * | 1996-01-22 | 2006-08-16 | 花王株式会社 | 高密度粉末洗剤組成物 |
| AU2074397A (en) * | 1996-03-15 | 1997-10-01 | Amway Corporation | Powder detergent composition having improved solubility |
| AU2075097A (en) * | 1996-03-15 | 1997-10-01 | Amway Corporation | Discrete whitening agent particles, method of making, and powder detergent containing same |
| US5714450A (en) * | 1996-03-15 | 1998-02-03 | Amway Corporation | Detergent composition containing discrete whitening agent particles |
| US5714451A (en) * | 1996-03-15 | 1998-02-03 | Amway Corporation | Powder detergent composition and method of making |
| US6177397B1 (en) | 1997-03-10 | 2001-01-23 | Amway Corporation | Free-flowing agglomerated nonionic surfactant detergent composition and process for making same |
| US6114289A (en) * | 1997-03-11 | 2000-09-05 | The Procter & Gamble Company | Encapsulated crystalline calcium carbonate builder for use in detergent compositions |
| US6130194A (en) * | 1997-03-11 | 2000-10-10 | The Procter & Gamble Company | Crystalline calcium carbonate builder enrobed with a hydrotrope for use in detergent compositions |
| US6100232A (en) * | 1998-03-02 | 2000-08-08 | The Procter & Gamble Company | Process for making a granular detergent composition containing a selected crystalline calcium carbonate builder |
| US6610645B2 (en) | 1998-03-06 | 2003-08-26 | Eugene Joseph Pancheri | Selected crystalline calcium carbonate builder for use in detergent compositions |
| GB0228357D0 (en) * | 2002-12-05 | 2003-01-08 | Unilever Plc | Granular component for use in particulate detergent compositions |
| WO2010025452A1 (en) * | 2008-08-29 | 2010-03-04 | Micro Pure Solutions, Llc | Method for treating hydrogen sulfide-containing fluids |
| AU2017225964A1 (en) * | 2016-03-02 | 2018-09-20 | Harris Research, Inc. | Stain and odor treatment |
| WO2019115435A1 (en) * | 2017-12-12 | 2019-06-20 | Unilever N.V. | High moisture retaining structuring system for detergent composition |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1437950A (en) * | 1972-08-22 | 1976-06-03 | Unilever Ltd | Detergent compositions |
| GB1481685A (en) * | 1973-08-15 | 1977-08-03 | Unilever Ltd | Detergent ingredient |
| GB1485371A (en) * | 1973-10-01 | 1977-09-08 | Unilever Ltd | Detergent compositions |
| GB1515273A (en) * | 1974-09-06 | 1978-06-21 | Unilever Ltd | Production of detergent compositions |
-
1977
- 1977-05-18 GB GB20933/77A patent/GB1583081A/en not_active Expired
-
1978
- 1978-05-11 CA CA000303126A patent/CA1121247A/en not_active Expired
- 1978-05-12 DE DE19782820990 patent/DE2820990A1/de active Granted
- 1978-05-12 BE BE187662A patent/BE867038A/xx not_active IP Right Cessation
- 1978-05-15 US US05/905,681 patent/US4196093A/en not_active Expired - Lifetime
- 1978-05-15 IN IN149/BOM/78A patent/IN147962B/en unknown
- 1978-05-16 AU AU36136/78A patent/AU524887B2/en not_active Expired
- 1978-05-17 SE SE7805686A patent/SE440364B/sv not_active IP Right Cessation
- 1978-05-17 AT AT0357278A patent/AT365228B/de not_active IP Right Cessation
- 1978-05-17 BR BR7803119A patent/BR7803119A/pt unknown
- 1978-05-17 FR FR7814643A patent/FR2391274A1/fr active Granted
- 1978-05-17 JP JP53058687A patent/JPS6041120B2/ja not_active Expired
- 1978-05-17 ES ES469948A patent/ES469948A1/es not_active Expired
- 1978-05-17 IT IT68133/78A patent/IT1109058B/it active
- 1978-05-18 CH CH539578A patent/CH639418A5/de not_active IP Right Cessation
- 1978-05-18 NL NL7805365A patent/NL191292C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT365228B (de) | 1981-12-28 |
| FR2391274A1 (fr) | 1978-12-15 |
| US4196093A (en) | 1980-04-01 |
| DE2820990C2 (OSRAM) | 1987-10-15 |
| ATA357278A (de) | 1981-05-15 |
| AU524887B2 (en) | 1982-10-07 |
| BE867038A (fr) | 1978-11-13 |
| SE7805686L (sv) | 1978-11-19 |
| IN147962B (OSRAM) | 1980-08-23 |
| GB1583081A (en) | 1981-01-21 |
| DE2820990A1 (de) | 1978-11-23 |
| CH639418A5 (de) | 1983-11-15 |
| CA1121247A (en) | 1982-04-06 |
| NL7805365A (nl) | 1978-11-21 |
| JPS6041120B2 (ja) | 1985-09-13 |
| BR7803119A (pt) | 1979-01-02 |
| NL191292B (nl) | 1994-12-01 |
| IT7868133A0 (it) | 1978-05-17 |
| IT1109058B (it) | 1985-12-16 |
| ES469948A1 (es) | 1978-12-16 |
| AU3613678A (en) | 1979-11-22 |
| JPS53142411A (en) | 1978-12-12 |
| NL191292C (nl) | 1995-05-01 |
| FR2391274B1 (OSRAM) | 1983-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE440364B (sv) | Forfarande for framstellning av en partikelformig detergentkomposition innehallande ett alkalimetallkarbonat, en tvettaktiv forening och finfordelat kalciumkarbonat | |
| US4908159A (en) | Detergent granules containing simple sugars and a seed crystal for calcium carbonate | |
| JP2918991B2 (ja) | 漂白洗浄剤組成物 | |
| RU2143998C1 (ru) | Силикаты натрия в качестве структурообразователя, компаунд и моющие средства или детергенты, содержащие их | |
| EP0451894B2 (en) | High bulk density granular detergent compositions and process for preparing them | |
| US5354493A (en) | Process for the production of surfactant-containing granulates | |
| JPH0649879B2 (ja) | 洗剤組成物、その成分、およびその製造方法 | |
| JPH05202398A (ja) | 洗剤粉末及びその製造方法 | |
| US5663136A (en) | Process for making compact detergent compositions | |
| US4216125A (en) | Detergent compositions with silane-zeolite silicate builder | |
| EP0637628B1 (en) | Mix process for formulating detergents | |
| CA1303939C (en) | Detergent granules and a process for their preparation | |
| GB2169917A (en) | Built detergent composition containing stabilised polyethylene terephthalate-polyoxyethylene terephthalate soil release promoting polymer | |
| EP0061226A1 (en) | Spray-dried detergent compositions | |
| JPWO1997033969A1 (ja) | 衣料用洗剤組成物 | |
| US5736502A (en) | Process for preparing detergent compositions | |
| JPH05331497A (ja) | タブレット型洗剤組成物 | |
| CA1069013A (en) | Production of detergent compositions | |
| CA1094424A (en) | Granulate based on polymer phosphate and alkali aluminum silicate | |
| CA2248994C (en) | Free-flowing agglomerated nonionic surfactant detergent composition and process for making same | |
| EP1754779B1 (en) | A solid laundry detergent composition comprising anionic detersive surfactant and a highly porous carrier material | |
| KR950001687B1 (ko) | 점토를 함유하는 부피 밀도가 높은 세제 분말의 제조 방법 | |
| CA2030990C (en) | Process for preparing a high bulk density detergent composition having improved dispensing properties | |
| KR100267274B1 (ko) | 고농축 비이온성 과립형 세제조성물 및 그 제조방법 | |
| JP4694020B2 (ja) | 漂白洗浄剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7805686-8 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7805686-8 Format of ref document f/p: F |