SE436031B - 1-((acyltio)-och (merkapto)-1-oxoalkyl)-1,2,3,4-tetrahydrokinolin-2-karboxylsyror samt natrium- och dicyklohexylaminsalterna derav - Google Patents
1-((acyltio)-och (merkapto)-1-oxoalkyl)-1,2,3,4-tetrahydrokinolin-2-karboxylsyror samt natrium- och dicyklohexylaminsalterna deravInfo
- Publication number
- SE436031B SE436031B SE8000209A SE8000209A SE436031B SE 436031 B SE436031 B SE 436031B SE 8000209 A SE8000209 A SE 8000209A SE 8000209 A SE8000209 A SE 8000209A SE 436031 B SE436031 B SE 436031B
- Authority
- SE
- Sweden
- Prior art keywords
- tetrahydro
- quinolinecarboxylic acid
- oxopropyl
- methyl
- acetylthio
- Prior art date
Links
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 title claims description 35
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title claims 2
- 239000011734 sodium Substances 0.000 title claims 2
- 229910052708 sodium Inorganic materials 0.000 title claims 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 title claims 2
- -1 methoxy, methyl Chemical group 0.000 claims description 22
- 159000000000 sodium salts Chemical class 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 11
- RSKSRARYJZRIKZ-UHFFFAOYSA-N 1-(3-benzoylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC=CC=C2N1C(=O)CCSC(=O)C1=CC=CC=C1 RSKSRARYJZRIKZ-UHFFFAOYSA-N 0.000 claims description 9
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- TXPAKRVLXBZXOC-UHFFFAOYSA-N 1-(3-acetylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CCSC(=O)C)C(C(O)=O)CCC2=C1 TXPAKRVLXBZXOC-UHFFFAOYSA-N 0.000 claims description 6
- YHIZQAMKACVEKZ-UHFFFAOYSA-N 1-(3-acetylsulfanylpropanoyl)-6-methyl-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound CC1=CC=C2N(C(=O)CCSC(=O)C)C(C(O)=O)CCC2=C1 YHIZQAMKACVEKZ-UHFFFAOYSA-N 0.000 claims description 3
- YGYNTRGPFBSTAZ-UHFFFAOYSA-N 1-(3-sulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CCS)C(C(=O)O)CCC2=C1 YGYNTRGPFBSTAZ-UHFFFAOYSA-N 0.000 claims description 3
- MIJSRBCOWWIIES-UHFFFAOYSA-N 1-(2-sulfanylacetyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CS)C(C(=O)O)CCC2=C1 MIJSRBCOWWIIES-UHFFFAOYSA-N 0.000 claims description 2
- SFGQCFIWPSAHJC-UHFFFAOYSA-N 6-methoxy-1-(3-sulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound SCCC(=O)N1C(C(O)=O)CCC2=CC(OC)=CC=C21 SFGQCFIWPSAHJC-UHFFFAOYSA-N 0.000 claims description 2
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 claims description 2
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 claims description 2
- 239000003112 inhibitor Substances 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims 8
- 229910052739 hydrogen Inorganic materials 0.000 claims 8
- 150000002431 hydrogen Chemical class 0.000 claims 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 2
- 239000000460 chlorine Substances 0.000 claims 2
- 229910052801 chlorine Inorganic materials 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- 125000005035 acylthio group Chemical group 0.000 claims 1
- 150000003946 cyclohexylamines Chemical class 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 87
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 66
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 66
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 63
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 54
- 239000000243 solution Substances 0.000 description 54
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- 238000002844 melting Methods 0.000 description 35
- 230000008018 melting Effects 0.000 description 35
- 239000000203 mixture Substances 0.000 description 35
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- 238000003756 stirring Methods 0.000 description 25
- 239000000047 product Substances 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 22
- QCFTXGXKUNDYFE-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=C2NC(C(=O)O)CCC2=C1 QCFTXGXKUNDYFE-UHFFFAOYSA-N 0.000 description 20
- 239000000499 gel Substances 0.000 description 19
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000001914 filtration Methods 0.000 description 18
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 17
- 239000000706 filtrate Substances 0.000 description 16
- 238000000034 method Methods 0.000 description 16
- 238000001816 cooling Methods 0.000 description 15
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 14
- 229910052938 sodium sulfate Inorganic materials 0.000 description 14
- 235000011152 sodium sulphate Nutrition 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 11
- 235000019341 magnesium sulphate Nutrition 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 10
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 239000000908 ammonium hydroxide Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- MNNMTFSPSVOWSF-UHFFFAOYSA-N dicyclohexylazanium;chloride Chemical compound Cl.C1CCCCC1NC1CCCCC1 MNNMTFSPSVOWSF-UHFFFAOYSA-N 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- LUYISICIYVKBTA-UHFFFAOYSA-N 6-methylquinoline Chemical compound N1=CC=CC2=CC(C)=CC=C21 LUYISICIYVKBTA-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- UKMWQYNJAVNCOZ-UHFFFAOYSA-N 6-chloroquinoline-2-carboxylic acid Chemical compound C1=C(Cl)C=CC2=NC(C(=O)O)=CC=C21 UKMWQYNJAVNCOZ-UHFFFAOYSA-N 0.000 description 3
- GPSSUARWYWJXCZ-UHFFFAOYSA-N 7-methylquinoline-2-carboxylic acid Chemical compound C1=CC(C(O)=O)=NC2=CC(C)=CC=C21 GPSSUARWYWJXCZ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 3
- LKFCPWBGBPJDRC-UHFFFAOYSA-M potassium;thiobenzate Chemical compound [K+].[O-]C(=S)C1=CC=CC=C1 LKFCPWBGBPJDRC-UHFFFAOYSA-M 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- SUWSCDKXOAADST-UHFFFAOYSA-N 1-phenylmethoxycarbonyl-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC=CC=C2N1C(=O)OCC1=CC=CC=C1 SUWSCDKXOAADST-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- GBTPHRQETQPQPA-UHFFFAOYSA-N 4-oxo-4-phenylbutanethioyl chloride Chemical compound ClC(=S)CCC(=O)C1=CC=CC=C1 GBTPHRQETQPQPA-UHFFFAOYSA-N 0.000 description 2
- UNUDUTMFKRKUIJ-UHFFFAOYSA-N 4-oxopentanethioyl chloride Chemical compound CC(=O)CCC(Cl)=S UNUDUTMFKRKUIJ-UHFFFAOYSA-N 0.000 description 2
- KVQARDYXZJGMFU-UHFFFAOYSA-N 6-hydroxyquinoline-2-carboxylic acid Chemical compound C1=C(O)C=CC2=NC(C(=O)O)=CC=C21 KVQARDYXZJGMFU-UHFFFAOYSA-N 0.000 description 2
- WPEQJEGNZGMHEZ-UHFFFAOYSA-N 6-methylquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=CC2=CC(C)=CC=C21 WPEQJEGNZGMHEZ-UHFFFAOYSA-N 0.000 description 2
- KDYVCOSVYOSHOL-UHFFFAOYSA-N 7-methylquinoline Chemical group C1=CC=NC2=CC(C)=CC=C21 KDYVCOSVYOSHOL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical class CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- MJZHAVYNYFDSMZ-UHFFFAOYSA-N s-(3-chloro-2-methyl-3-oxopropyl) benzenecarbothioate Chemical compound ClC(=O)C(C)CSC(=O)C1=CC=CC=C1 MJZHAVYNYFDSMZ-UHFFFAOYSA-N 0.000 description 2
- LUDPWTHDXSOXDX-UHFFFAOYSA-N s-(3-chloro-2-methyl-3-oxopropyl) ethanethioate Chemical compound ClC(=O)C(C)CSC(C)=O LUDPWTHDXSOXDX-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- PVOPOHONGIAXCW-UHFFFAOYSA-N 1-(2-benzoylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC=CC=C2N1C(=O)C(C)SC(=O)C1=CC=CC=C1 PVOPOHONGIAXCW-UHFFFAOYSA-N 0.000 description 1
- QPJUVLQUDFIVDB-UHFFFAOYSA-N 1-(2-methyl-4-oxo-4-phenylbutanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC=CC=C2N1C(=O)C(C)CC(=O)C1=CC=CC=C1 QPJUVLQUDFIVDB-UHFFFAOYSA-N 0.000 description 1
- PWPAZXPQQMJFNY-UHFFFAOYSA-N 1-(3-benzoylsulfanylpropanoyl)-6-methoxy-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC(OC)=CC=C2N1C(=O)CCSC(=O)C1=CC=CC=C1 PWPAZXPQQMJFNY-UHFFFAOYSA-N 0.000 description 1
- SNGZUYRHUVWKFZ-UHFFFAOYSA-N 1-[3-acetylsulfanyl-2-(acetylsulfanylmethyl)propanoyl]-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical class C1=CC=C2N(C(=O)C(CSC(C)=O)CSC(=O)C)C(C(O)=O)CCC2=C1 SNGZUYRHUVWKFZ-UHFFFAOYSA-N 0.000 description 1
- IDWQKWKMFSGLSX-UHFFFAOYSA-N 1-benzoyl-7-methyl-2h-quinoline-2-carbonitrile Chemical compound C12=CC(C)=CC=C2C=CC(C#N)N1C(=O)C1=CC=CC=C1 IDWQKWKMFSGLSX-UHFFFAOYSA-N 0.000 description 1
- WGFANPDXJKOMKO-UHFFFAOYSA-N 2-methyl-3-oxo-3-phenylpropanethioyl chloride Chemical compound ClC(=S)C(C)C(=O)C1=CC=CC=C1 WGFANPDXJKOMKO-UHFFFAOYSA-N 0.000 description 1
- BCAYPPFBOJCRPN-UHFFFAOYSA-N 3-benzoylsulfanyl-2-methylpropanoic acid Chemical compound OC(=O)C(C)CSC(=O)C1=CC=CC=C1 BCAYPPFBOJCRPN-UHFFFAOYSA-N 0.000 description 1
- INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
- LGXSVADISKHAOO-UHFFFAOYSA-N 6,7-dimethoxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CC(C(O)=O)NC2=C1C=C(OC)C(OC)=C2 LGXSVADISKHAOO-UHFFFAOYSA-N 0.000 description 1
- IWGBLROXONFBIE-UHFFFAOYSA-N 6,7-dimethoxyquinoline-2-carboxylic acid Chemical group C1=C(C(O)=O)N=C2C=C(OC)C(OC)=CC2=C1 IWGBLROXONFBIE-UHFFFAOYSA-N 0.000 description 1
- GKJSZXGYFJBYRQ-UHFFFAOYSA-N 6-chloroquinoline Chemical group N1=CC=CC2=CC(Cl)=CC=C21 GKJSZXGYFJBYRQ-UHFFFAOYSA-N 0.000 description 1
- BBORNXOFAFZZLM-UHFFFAOYSA-N 6-hydroxyquinoline-2-carboxylic acid 6-methoxyquinoline-2-carboxylic acid Chemical compound COC=1C=C2C=CC(=NC2=CC1)C(=O)O.OC=1C=C2C=CC(=NC2=CC1)C(=O)O BBORNXOFAFZZLM-UHFFFAOYSA-N 0.000 description 1
- YXPYIZUQEDQMPS-UHFFFAOYSA-N 6-methoxyquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=CC2=CC(OC)=CC=C21 YXPYIZUQEDQMPS-UHFFFAOYSA-N 0.000 description 1
- BUFYAOSRUFHHMC-UHFFFAOYSA-N 6-methyl-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.N1C(C(O)=O)CCC2=CC(C)=CC=C21 BUFYAOSRUFHHMC-UHFFFAOYSA-N 0.000 description 1
- QUSOPEFPDJIFLV-UHFFFAOYSA-N 6-methylquinoline 6-methylquinoline-2-carboxylic acid Chemical compound CC=1C=C2C=CC=NC2=CC1.CC=1C=C2C=CC(=NC2=CC1)C(=O)O QUSOPEFPDJIFLV-UHFFFAOYSA-N 0.000 description 1
- CVDDUQWNZIFAGD-UHFFFAOYSA-N 7-methyl-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CC(C(O)=O)NC2=CC(C)=CC=C21 CVDDUQWNZIFAGD-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- YCKYOYFWWOZOMB-UHFFFAOYSA-H S(=O)(=O)([O-])[O-].[Mg+2].[C+4].S(=O)(=O)([O-])[O-].S(=O)(=O)([O-])[O-] Chemical class S(=O)(=O)([O-])[O-].[Mg+2].[C+4].S(=O)(=O)([O-])[O-].S(=O)(=O)([O-])[O-] YCKYOYFWWOZOMB-UHFFFAOYSA-H 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 206010002906 aortic stenosis Diseases 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- BCUPGIHTCQJCSI-UHFFFAOYSA-N chloromethanol Chemical compound OCCl BCUPGIHTCQJCSI-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- DASZTFGYDXJWBT-UHFFFAOYSA-N quinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=CC2=NC(C(=O)O)=CC=C21 DASZTFGYDXJWBT-UHFFFAOYSA-N 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Peptides Or Proteins (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1016579A | 1979-02-07 | 1979-02-07 | |
| US06/090,862 US4461896A (en) | 1979-02-07 | 1979-11-02 | 1-[Acylthio) and (mercapto)-1-oxoalkyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8000209L SE8000209L (sv) | 1980-08-08 |
| SE436031B true SE436031B (sv) | 1984-11-05 |
Family
ID=26680853
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8000209A SE436031B (sv) | 1979-02-07 | 1980-01-10 | 1-((acyltio)-och (merkapto)-1-oxoalkyl)-1,2,3,4-tetrahydrokinolin-2-karboxylsyror samt natrium- och dicyklohexylaminsalterna derav |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4461896A (enExample) |
| AU (1) | AU527887B2 (enExample) |
| CH (1) | CH645355A5 (enExample) |
| DE (1) | DE3004370A1 (enExample) |
| DK (1) | DK152209C (enExample) |
| ES (1) | ES488313A0 (enExample) |
| FR (1) | FR2448533A1 (enExample) |
| GB (1) | GB2042535B (enExample) |
| GR (1) | GR74103B (enExample) |
| IE (1) | IE49350B1 (enExample) |
| IL (1) | IL59089A (enExample) |
| IT (1) | IT1145330B (enExample) |
| NL (1) | NL8000641A (enExample) |
| NZ (1) | NZ192613A (enExample) |
| PT (1) | PT70793A (enExample) |
| SE (1) | SE436031B (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3044236A1 (de) * | 1980-11-25 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Aminosaeurederivate und verfahren zu ihrer herstellung |
| US4595675A (en) * | 1979-09-19 | 1986-06-17 | Hoechst Aktiengesellschaft | Bicyclic α-iminocarboxylic acid compounds having hypotensive activity |
| DE2937779A1 (de) * | 1979-09-19 | 1981-04-09 | Hoechst Ag, 6000 Frankfurt | Aminosaeurederivate und verfahren zu ihrer herstellung |
| FR2503155A2 (fr) * | 1980-10-02 | 1982-10-08 | Science Union & Cie | Nouveaux imino diacides substitues, leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| FR2487829A2 (fr) | 1979-12-07 | 1982-02-05 | Science Union & Cie | Nouveaux imino acides substitues, leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| US4599357A (en) * | 1979-12-17 | 1986-07-08 | Ciba-Geigy Corporation | 1-mercaptoalkanoylindoline-2-carboxylic acids |
| US4350704A (en) | 1980-10-06 | 1982-09-21 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids |
| IE52663B1 (en) * | 1980-04-02 | 1988-01-20 | Warner Lambert Co | Substituted acyl derivatives of octahydro-1h-indole-2-carboxylic acids |
| EP0046953B1 (de) * | 1980-08-30 | 1989-12-06 | Hoechst Aktiengesellschaft | Aminosäurederivate, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und deren Verwendung |
| US4344949A (en) * | 1980-10-03 | 1982-08-17 | Warner-Lambert Company | Substituted acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids |
| US4390700A (en) | 1980-11-10 | 1983-06-28 | Ciba-Geigy Corporation | 1-Carboxyazaalkanoyl-tetrahydroquinoline-2-carboxylic acids |
| US4401818A (en) | 1980-12-24 | 1983-08-30 | Ciba-Geigy Corporation | 1-Carboxyalkanoyl-1,2,3,4-tetrahydroquinoline-2-carboxylic acids |
| EP0093805B1 (en) * | 1981-02-17 | 1987-05-13 | Warner-Lambert Company | Octahydro-2-(omega-mercaptoalkanoyl)3-oxo-1h-isoindole-1-carboxylic acids and esters |
| US4532342A (en) * | 1981-02-20 | 1985-07-30 | Warner-Lambert Company | N-substituted amino acids as intermediates in the preparation of acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids |
| US4374246A (en) * | 1981-06-18 | 1983-02-15 | Norwich Eaton Pharmaceuticals, Inc. | 1-N-[(1-Carboxy-3-phenylpropyl)glycyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid compounds |
| US5025001A (en) * | 1988-06-15 | 1991-06-18 | Brigham And Women's Hospital | S-nitroso derivatives of ACE inhibitors and the use thereof |
| US5356890A (en) * | 1988-06-15 | 1994-10-18 | Brigham And Women's Hospital | S-nitroso derivatives of ace inhibitors and the use thereof |
| US5187183A (en) * | 1988-06-15 | 1993-02-16 | Brigham & Women's Hospital | S-nitroso derivatives of ACE inhibitors and the use thereof |
| GB9010394D0 (en) * | 1990-05-09 | 1990-06-27 | Ici Plc | Heterocyclic compounds |
| US5504080A (en) * | 1992-10-28 | 1996-04-02 | Bristol-Myers Squibb Co. | Benzo-fused lactams |
| WO1995001353A1 (en) * | 1993-06-30 | 1995-01-12 | Ciba-Geigy Ag | Antihypertensive tricyclic azepine derivatives useful as inhibitors of enkephalinase and ace |
| ITMI20012060A1 (it) * | 2001-10-05 | 2003-04-05 | Recordati Chem Pharm | Nuovi eterocilcli n-acilati |
| EP1888575A2 (en) * | 2005-05-09 | 2008-02-20 | Hydra Biosciences, Inc. | Compounds for modulating trpv3 function |
| US8916550B2 (en) * | 2005-05-09 | 2014-12-23 | Hydra Biosciences, Inc. | Compounds for modulating TRPV3 function |
| US9259535B2 (en) | 2006-06-22 | 2016-02-16 | Excelsior Medical Corporation | Antiseptic cap equipped syringe |
| US11229746B2 (en) | 2006-06-22 | 2022-01-25 | Excelsior Medical Corporation | Antiseptic cap |
| WO2008033564A1 (en) | 2006-09-15 | 2008-03-20 | Hydra Biosciences Inc. | Compounds for modulating trpv3 function |
| US9078992B2 (en) | 2008-10-27 | 2015-07-14 | Pursuit Vascular, Inc. | Medical device for applying antimicrobial to proximal end of catheter |
| US10166381B2 (en) | 2011-05-23 | 2019-01-01 | Excelsior Medical Corporation | Antiseptic cap |
| ES2797649T3 (es) | 2011-07-12 | 2020-12-03 | Icu Medical Inc | Dispositivo para entrega de agente antimicrobiano en un catéter transdérmico |
| US10046156B2 (en) | 2014-05-02 | 2018-08-14 | Excelsior Medical Corporation | Strip package for antiseptic cap |
| WO2016182822A1 (en) | 2015-05-08 | 2016-11-17 | Icu Medical, Inc. | Medical connectors configured to receive emitters of therapeutic agents |
| EP3525865B1 (en) | 2016-10-14 | 2022-10-12 | ICU Medical, Inc. | Sanitizing caps for medical connectors |
| WO2018204206A2 (en) | 2017-05-01 | 2018-11-08 | Icu Medical, Inc. | Medical fluid connectors and methods for providing additives in medical fluid lines |
| US11517732B2 (en) | 2018-11-07 | 2022-12-06 | Icu Medical, Inc. | Syringe with antimicrobial properties |
| US11534595B2 (en) | 2018-11-07 | 2022-12-27 | Icu Medical, Inc. | Device for delivering an antimicrobial composition into an infusion device |
| US11400195B2 (en) | 2018-11-07 | 2022-08-02 | Icu Medical, Inc. | Peritoneal dialysis transfer set with antimicrobial properties |
| US11541220B2 (en) | 2018-11-07 | 2023-01-03 | Icu Medical, Inc. | Needleless connector with antimicrobial properties |
| US11541221B2 (en) | 2018-11-07 | 2023-01-03 | Icu Medical, Inc. | Tubing set with antimicrobial properties |
| EP3883638A1 (en) | 2018-11-21 | 2021-09-29 | ICU Medical, Inc. | Antimicrobial device comprising a cap with ring and insert |
| KR102735703B1 (ko) | 2020-01-29 | 2024-11-28 | 카마리 파마 리미티드 | 피부 장애 치료에서 사용을 위한 화합물 및 조성물 |
| CA3204371A1 (en) | 2020-12-07 | 2022-06-16 | Icu Medical, Inc. | Peritoneal dialysis caps, systems and methods |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR837847A (fr) * | 1937-05-13 | 1939-02-21 | Ste Ind Chim Bale | Agents auxiliaires pour l'impression |
| US4104392A (en) * | 1974-11-08 | 1978-08-01 | Mitsubishi Chemical Industries Ltd. | N2 -naphthalenesulfonyl-L-argininamides and the pharmaceutically acceptable salts thereof, and antithrombotic compositions and methods employing them |
| AU509899B2 (en) * | 1976-02-13 | 1980-05-29 | E.R. Squibb & Sons, Inc. | Proline derivatives and related compounds |
| AU4091178A (en) * | 1977-10-25 | 1980-04-24 | Merck & Co Inc | Substituted mercapto acid amides |
-
1979
- 1979-11-02 US US06/090,862 patent/US4461896A/en not_active Expired - Lifetime
-
1980
- 1980-01-04 IE IE14/80A patent/IE49350B1/en unknown
- 1980-01-07 IL IL59089A patent/IL59089A/xx unknown
- 1980-01-10 SE SE8000209A patent/SE436031B/sv not_active IP Right Cessation
- 1980-01-14 GR GR60950A patent/GR74103B/el unknown
- 1980-01-15 NZ NZ192613A patent/NZ192613A/xx unknown
- 1980-01-18 AU AU54727/80A patent/AU527887B2/en not_active Ceased
- 1980-01-28 IT IT47730/80A patent/IT1145330B/it active
- 1980-01-31 NL NL8000641A patent/NL8000641A/nl not_active Application Discontinuation
- 1980-02-05 GB GB8003806A patent/GB2042535B/en not_active Expired
- 1980-02-06 FR FR8002592A patent/FR2448533A1/fr active Granted
- 1980-02-06 DE DE19803004370 patent/DE3004370A1/de active Granted
- 1980-02-06 CH CH96180A patent/CH645355A5/de not_active IP Right Cessation
- 1980-02-06 PT PT70793A patent/PT70793A/pt unknown
- 1980-02-06 ES ES488313A patent/ES488313A0/es active Granted
- 1980-02-06 DK DK051280A patent/DK152209C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1145330B (it) | 1986-11-05 |
| FR2448533B1 (enExample) | 1983-01-07 |
| DK152209C (da) | 1988-06-20 |
| ES8102559A1 (es) | 1981-01-16 |
| GB2042535A (en) | 1980-09-24 |
| CH645355A5 (de) | 1984-09-28 |
| IE49350B1 (en) | 1985-09-18 |
| GB2042535B (en) | 1983-01-26 |
| DK51280A (da) | 1980-08-08 |
| ES488313A0 (es) | 1981-01-16 |
| AU5472780A (en) | 1980-08-14 |
| US4461896A (en) | 1984-07-24 |
| GR74103B (enExample) | 1984-06-06 |
| NL8000641A (nl) | 1980-08-11 |
| FR2448533A1 (fr) | 1980-09-05 |
| AU527887B2 (en) | 1983-03-31 |
| IE800014L (en) | 1980-08-07 |
| IL59089A (en) | 1982-08-31 |
| SE8000209L (sv) | 1980-08-08 |
| NZ192613A (en) | 1981-10-19 |
| IL59089A0 (en) | 1980-05-30 |
| DK152209B (da) | 1988-02-08 |
| DE3004370A1 (de) | 1980-08-14 |
| IT8047730A0 (it) | 1980-01-28 |
| PT70793A (en) | 1980-03-01 |
| DE3004370C2 (enExample) | 1989-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE436031B (sv) | 1-((acyltio)-och (merkapto)-1-oxoalkyl)-1,2,3,4-tetrahydrokinolin-2-karboxylsyror samt natrium- och dicyklohexylaminsalterna derav | |
| US4216220A (en) | Platelet aggregation inhibiting 2-oxyindoles, their compositions and method of use | |
| US4668686A (en) | Imidazoquinoline antithrombrogenic cardiotonic agents | |
| US5006534A (en) | Substituted ethers, thioethers and amines for use as lipoxygenase inhibitors | |
| US4309545A (en) | Oximino-1-hydroxyoctahydrobenzo[c]quinolines and derivatives thereof | |
| US4243666A (en) | 4-Amino-2-piperidino-quinazolines | |
| NL8005238A (nl) | Cyclohexaancarbonzuurderivaten. | |
| EP0053789B1 (en) | 2-pyridinecarboxamide derivative, process for preparing same and pharmaceutical composition, useful as an anti-allergic agent | |
| US4845100A (en) | Carbostyril derivatives and salts thereof, processes for preparing the same and cardiotonic composition containing the same | |
| US3126384A (en) | X-quinolyl-aminoalkylamino | |
| US4442109A (en) | 3-Methylthiomethyl-and 3-methylsulfinylmethyl-4-quinolinones useful for treating hypertension | |
| US4351833A (en) | 9-Amino-1-hydroxyoctahydrobenzo[c]quinolines and derivatives thereof as analgesics and anti-emetics | |
| NO162907B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive bis-(piperazinyl-resp. homopiperazinyl)-alkaner. | |
| IE55377B1 (en) | 1,5-diphenylpyrazolin-3-one compounds,method for preparing them,and pharmaceutical compositions containing these compounds | |
| CA1095914A (en) | 4-hydroxy-2-quinolinone-3-carboxylic acid compounds | |
| SE455701B (sv) | Svavelhaltiga isokinolinderivat samt farmaceutiska beredningar innehalllande dem | |
| EP0201085A2 (en) | 6-Phenyl-1,2,3,4,4a,5,6,10b-octahydrobenz(h) isoquinolines | |
| JPH083163A (ja) | 縮合ピリジン誘導体 | |
| US4576954A (en) | Anti-rheumatic 5-(substituted amino)-1,2-dithiol-3-one compounds and their use | |
| US4198512A (en) | 1-Oxo-1,2-dihydroisoquinoline derivatives | |
| US3865832A (en) | Substituted, 6,7 ethylenedioxy 4 hydroxy 3 non oxo carbonylic quinolines | |
| CA1088068A (en) | Piperidino-quinazolines | |
| EP0564648A1 (en) | Novel aconitine compound and analgesic/antiinflammatory agent | |
| CA1131636A (en) | Quinazoline antihypertensives | |
| US4291163A (en) | Decahydroquinoline-2-carboxylic acid compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8000209-0 Effective date: 19910805 Format of ref document f/p: F |