IE49350B1 - Tetrahydroquinoline-2-carboxylic acids and their salts - Google Patents
Tetrahydroquinoline-2-carboxylic acids and their saltsInfo
- Publication number
- IE49350B1 IE49350B1 IE14/80A IE1480A IE49350B1 IE 49350 B1 IE49350 B1 IE 49350B1 IE 14/80 A IE14/80 A IE 14/80A IE 1480 A IE1480 A IE 1480A IE 49350 B1 IE49350 B1 IE 49350B1
- Authority
- IE
- Ireland
- Prior art keywords
- tetrahydro
- acid
- oxopropyl
- quinolinecarboxylic acid
- quinolinecarboxylic
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title abstract description 20
- OSJVTYVKQNOXPP-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline-2-carboxylic acid Chemical class C1=CC=C2NC(C(=O)O)CCC2=C1 OSJVTYVKQNOXPP-UHFFFAOYSA-N 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 81
- 239000000203 mixture Substances 0.000 claims description 36
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 16
- 159000000000 sodium salts Chemical class 0.000 claims description 10
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- -1 methoxy, methyl Chemical group 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- TXPAKRVLXBZXOC-ZDUSSCGKSA-N (2s)-1-(3-acetylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CCSC(=O)C)[C@H](C(O)=O)CCC2=C1 TXPAKRVLXBZXOC-ZDUSSCGKSA-N 0.000 claims description 2
- ZWFNTVVXWFIILY-UHFFFAOYSA-N 1-(2-benzoylsulfanylacetyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC=CC=C2N1C(=O)CSC(=O)C1=CC=CC=C1 ZWFNTVVXWFIILY-UHFFFAOYSA-N 0.000 claims description 2
- YGYNTRGPFBSTAZ-UHFFFAOYSA-N 1-(3-sulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CCS)C(C(=O)O)CCC2=C1 YGYNTRGPFBSTAZ-UHFFFAOYSA-N 0.000 claims description 2
- IWGBLROXONFBIE-UHFFFAOYSA-N 6,7-dimethoxyquinoline-2-carboxylic acid Chemical compound C1=C(C(O)=O)N=C2C=C(OC)C(OC)=CC2=C1 IWGBLROXONFBIE-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- RSKSRARYJZRIKZ-QGZVFWFLSA-N (2r)-1-(3-benzoylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C([C@@H]1C(=O)O)CC2=CC=CC=C2N1C(=O)CCSC(=O)C1=CC=CC=C1 RSKSRARYJZRIKZ-QGZVFWFLSA-N 0.000 claims 1
- YGYNTRGPFBSTAZ-NSHDSACASA-N (2s)-1-(3-sulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CCS)[C@H](C(=O)O)CCC2=C1 YGYNTRGPFBSTAZ-NSHDSACASA-N 0.000 claims 1
- MIJSRBCOWWIIES-UHFFFAOYSA-N 1-(2-sulfanylacetyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CS)C(C(=O)O)CCC2=C1 MIJSRBCOWWIIES-UHFFFAOYSA-N 0.000 claims 1
- TXPAKRVLXBZXOC-UHFFFAOYSA-N 1-(3-acetylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)CCSC(=O)C)C(C(O)=O)CCC2=C1 TXPAKRVLXBZXOC-UHFFFAOYSA-N 0.000 claims 1
- RSKSRARYJZRIKZ-UHFFFAOYSA-N 1-(3-benzoylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC=CC=C2N1C(=O)CCSC(=O)C1=CC=CC=C1 RSKSRARYJZRIKZ-UHFFFAOYSA-N 0.000 claims 1
- PWPAZXPQQMJFNY-UHFFFAOYSA-N 1-(3-benzoylsulfanylpropanoyl)-6-methoxy-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1CCC2=CC(OC)=CC=C2N1C(=O)CCSC(=O)C1=CC=CC=C1 PWPAZXPQQMJFNY-UHFFFAOYSA-N 0.000 claims 1
- PBCSDDOCZANXMI-UHFFFAOYSA-N 3-methylquinoline-2-carboxylic acid Chemical compound C1=CC=C2N=C(C(O)=O)C(C)=CC2=C1 PBCSDDOCZANXMI-UHFFFAOYSA-N 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 239000005541 ACE inhibitor Substances 0.000 abstract 1
- 125000005035 acylthio group Chemical group 0.000 abstract 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 abstract 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 87
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 80
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 58
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 54
- 239000000243 solution Substances 0.000 description 53
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 33
- 229960004592 isopropanol Drugs 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 22
- 238000003756 stirring Methods 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 238000001914 filtration Methods 0.000 description 18
- 238000000034 method Methods 0.000 description 17
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 238000001816 cooling Methods 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 11
- 235000019341 magnesium sulphate Nutrition 0.000 description 11
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- 235000011152 sodium sulphate Nutrition 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000000284 extract Substances 0.000 description 10
- 239000010410 layer Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- MNNMTFSPSVOWSF-UHFFFAOYSA-N dicyclohexylazanium;chloride Chemical compound Cl.C1CCCCC1NC1CCCCC1 MNNMTFSPSVOWSF-UHFFFAOYSA-N 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- QCFTXGXKUNDYFE-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=C2NC(C(=O)O)CCC2=C1 QCFTXGXKUNDYFE-UHFFFAOYSA-N 0.000 description 4
- LUYISICIYVKBTA-UHFFFAOYSA-N 6-methylquinoline Chemical compound N1=CC=CC2=CC(C)=CC=C21 LUYISICIYVKBTA-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- UKMWQYNJAVNCOZ-UHFFFAOYSA-N 6-chloroquinoline-2-carboxylic acid Chemical compound C1=C(Cl)C=CC2=NC(C(=O)O)=CC=C21 UKMWQYNJAVNCOZ-UHFFFAOYSA-N 0.000 description 3
- 102000005862 Angiotensin II Human genes 0.000 description 3
- 101800000733 Angiotensin-2 Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 3
- 229950006323 angiotensin ii Drugs 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- LKFCPWBGBPJDRC-UHFFFAOYSA-M potassium;thiobenzate Chemical compound [K+].[O-]C(=S)C1=CC=CC=C1 LKFCPWBGBPJDRC-UHFFFAOYSA-M 0.000 description 3
- XEYWOETXQNDSED-UHFFFAOYSA-N s-(3-chloro-3-oxopropyl) ethanethioate Chemical compound CC(=O)SCCC(Cl)=O XEYWOETXQNDSED-UHFFFAOYSA-N 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- KDYVCOSVYOSHOL-UHFFFAOYSA-N 7-methylquinoline Chemical group C1=CC=NC2=CC(C)=CC=C21 KDYVCOSVYOSHOL-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000005555 hypertensive agent Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- DASZTFGYDXJWBT-UHFFFAOYSA-N quinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=CC2=NC(C(=O)O)=CC=C21 DASZTFGYDXJWBT-UHFFFAOYSA-N 0.000 description 2
- TUJAHMBTEMTOMQ-UHFFFAOYSA-N s-(3-chloro-3-oxopropyl) benzenecarbothioate Chemical compound ClC(=O)CCSC(=O)C1=CC=CC=C1 TUJAHMBTEMTOMQ-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- SNGZUYRHUVWKFZ-UHFFFAOYSA-N 1-[3-acetylsulfanyl-2-(acetylsulfanylmethyl)propanoyl]-3,4-dihydro-2h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)C(CSC(C)=O)CSC(=O)C)C(C(O)=O)CCC2=C1 SNGZUYRHUVWKFZ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- XBLFXAJOXFWTSF-UHFFFAOYSA-N 4-oxo-4-phenylbutanethioic s-acid Chemical compound SC(=O)CCC(=O)C1=CC=CC=C1 XBLFXAJOXFWTSF-UHFFFAOYSA-N 0.000 description 1
- ZGVDOBRDNWJNDJ-UHFFFAOYSA-N 4-oxopentanethioic s-acid Chemical compound CC(=O)CCC(S)=O ZGVDOBRDNWJNDJ-UHFFFAOYSA-N 0.000 description 1
- OCPAMCDSQXIHLA-UHFFFAOYSA-N 6-hydroxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.OC1=CC=C2NC(C(=O)O)CCC2=C1 OCPAMCDSQXIHLA-UHFFFAOYSA-N 0.000 description 1
- KVQARDYXZJGMFU-UHFFFAOYSA-N 6-hydroxyquinoline-2-carboxylic acid Chemical compound C1=C(O)C=CC2=NC(C(=O)O)=CC=C21 KVQARDYXZJGMFU-UHFFFAOYSA-N 0.000 description 1
- ACJNIYDXIVOTQE-UHFFFAOYSA-N 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.N1C(C(O)=O)CCC2=CC(OC)=CC=C21 ACJNIYDXIVOTQE-UHFFFAOYSA-N 0.000 description 1
- BUFYAOSRUFHHMC-UHFFFAOYSA-N 6-methyl-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical group Cl.N1C(C(O)=O)CCC2=CC(C)=CC=C21 BUFYAOSRUFHHMC-UHFFFAOYSA-N 0.000 description 1
- QUSOPEFPDJIFLV-UHFFFAOYSA-N 6-methylquinoline 6-methylquinoline-2-carboxylic acid Chemical compound CC=1C=C2C=CC=NC2=CC1.CC=1C=C2C=CC(=NC2=CC1)C(=O)O QUSOPEFPDJIFLV-UHFFFAOYSA-N 0.000 description 1
- WPEQJEGNZGMHEZ-UHFFFAOYSA-N 6-methylquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=CC2=CC(C)=CC=C21 WPEQJEGNZGMHEZ-UHFFFAOYSA-N 0.000 description 1
- CVDDUQWNZIFAGD-UHFFFAOYSA-N 7-methyl-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CC(C(O)=O)NC2=CC(C)=CC=C21 CVDDUQWNZIFAGD-UHFFFAOYSA-N 0.000 description 1
- 101800000734 Angiotensin-1 Proteins 0.000 description 1
- 102400000344 Angiotensin-1 Human genes 0.000 description 1
- 208000026828 Aorta coarctation Diseases 0.000 description 1
- 208000006179 Aortic Coarctation Diseases 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 206010009807 Coarctation of the aorta Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 229910019020 PtO2 Inorganic materials 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000003946 cyclohexylamines Chemical class 0.000 description 1
- 231100000676 disease causative agent Toxicity 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- MJZHAVYNYFDSMZ-UHFFFAOYSA-N s-(3-chloro-2-methyl-3-oxopropyl) benzenecarbothioate Chemical compound ClC(=O)C(C)CSC(=O)C1=CC=CC=C1 MJZHAVYNYFDSMZ-UHFFFAOYSA-N 0.000 description 1
- LUDPWTHDXSOXDX-UHFFFAOYSA-N s-(3-chloro-2-methyl-3-oxopropyl) ethanethioate Chemical compound ClC(=O)C(C)CSC(C)=O LUDPWTHDXSOXDX-UHFFFAOYSA-N 0.000 description 1
- HGGZUPWPOAKANF-UHFFFAOYSA-N s-[2-(acetylsulfanylmethyl)-3-chloro-3-oxopropyl] ethanethioate Chemical compound CC(=O)SCC(C(Cl)=O)CSC(C)=O HGGZUPWPOAKANF-UHFFFAOYSA-N 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- LSIBBFLIMAUSBP-UNTBIKODSA-M sodium;(2r)-1-(3-benzoylsulfanylpropanoyl)-3,4-dihydro-2h-quinoline-2-carboxylate Chemical compound [Na+].C([C@@H]1C(=O)[O-])CC2=CC=CC=C2N1C(=O)CCSC(=O)C1=CC=CC=C1 LSIBBFLIMAUSBP-UNTBIKODSA-M 0.000 description 1
- PLTCLMZAIZEHGD-UHFFFAOYSA-M sodium;quinoline-2-carboxylate Chemical compound [Na+].C1=CC=CC2=NC(C(=O)[O-])=CC=C21 PLTCLMZAIZEHGD-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Peptides Or Proteins (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1016579A | 1979-02-07 | 1979-02-07 | |
| US06/090,862 US4461896A (en) | 1979-02-07 | 1979-11-02 | 1-[Acylthio) and (mercapto)-1-oxoalkyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE800014L IE800014L (en) | 1980-08-07 |
| IE49350B1 true IE49350B1 (en) | 1985-09-18 |
Family
ID=26680853
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE14/80A IE49350B1 (en) | 1979-02-07 | 1980-01-04 | Tetrahydroquinoline-2-carboxylic acids and their salts |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4461896A (enExample) |
| AU (1) | AU527887B2 (enExample) |
| CH (1) | CH645355A5 (enExample) |
| DE (1) | DE3004370A1 (enExample) |
| DK (1) | DK152209C (enExample) |
| ES (1) | ES8102559A1 (enExample) |
| FR (1) | FR2448533A1 (enExample) |
| GB (1) | GB2042535B (enExample) |
| GR (1) | GR74103B (enExample) |
| IE (1) | IE49350B1 (enExample) |
| IL (1) | IL59089A (enExample) |
| IT (1) | IT1145330B (enExample) |
| NL (1) | NL8000641A (enExample) |
| NZ (1) | NZ192613A (enExample) |
| PT (1) | PT70793A (enExample) |
| SE (1) | SE436031B (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3044236A1 (de) * | 1980-11-25 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Aminosaeurederivate und verfahren zu ihrer herstellung |
| DE2937779A1 (de) * | 1979-09-19 | 1981-04-09 | Hoechst Ag, 6000 Frankfurt | Aminosaeurederivate und verfahren zu ihrer herstellung |
| US4595675A (en) * | 1979-09-19 | 1986-06-17 | Hoechst Aktiengesellschaft | Bicyclic α-iminocarboxylic acid compounds having hypotensive activity |
| FR2487829A2 (fr) * | 1979-12-07 | 1982-02-05 | Science Union & Cie | Nouveaux imino acides substitues, leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| FR2503155A2 (fr) * | 1980-10-02 | 1982-10-08 | Science Union & Cie | Nouveaux imino diacides substitues, leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| US4599357A (en) * | 1979-12-17 | 1986-07-08 | Ciba-Geigy Corporation | 1-mercaptoalkanoylindoline-2-carboxylic acids |
| IE52663B1 (en) * | 1980-04-02 | 1988-01-20 | Warner Lambert Co | Substituted acyl derivatives of octahydro-1h-indole-2-carboxylic acids |
| US4350704A (en) | 1980-10-06 | 1982-09-21 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids |
| EP0278530A3 (de) * | 1980-08-30 | 1989-08-02 | Hoechst Aktiengesellschaft | Aminosäurederivate, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und deren Verwendung |
| US4344949A (en) | 1980-10-03 | 1982-08-17 | Warner-Lambert Company | Substituted acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids |
| US4390700A (en) | 1980-11-10 | 1983-06-28 | Ciba-Geigy Corporation | 1-Carboxyazaalkanoyl-tetrahydroquinoline-2-carboxylic acids |
| US4401818A (en) | 1980-12-24 | 1983-08-30 | Ciba-Geigy Corporation | 1-Carboxyalkanoyl-1,2,3,4-tetrahydroquinoline-2-carboxylic acids |
| DE3276311D1 (en) * | 1981-02-17 | 1987-06-19 | Warner Lambert Co | Octahydro-2-(omega-mercaptoalkanoyl)3-oxo-1h-isoindole-1-carboxylic acids and esters |
| US4532342A (en) * | 1981-02-20 | 1985-07-30 | Warner-Lambert Company | N-substituted amino acids as intermediates in the preparation of acyl derivatives of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acids |
| US4374246A (en) * | 1981-06-18 | 1983-02-15 | Norwich Eaton Pharmaceuticals, Inc. | 1-N-[(1-Carboxy-3-phenylpropyl)glycyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid compounds |
| US5187183A (en) * | 1988-06-15 | 1993-02-16 | Brigham & Women's Hospital | S-nitroso derivatives of ACE inhibitors and the use thereof |
| US5025001A (en) * | 1988-06-15 | 1991-06-18 | Brigham And Women's Hospital | S-nitroso derivatives of ACE inhibitors and the use thereof |
| US5356890A (en) * | 1988-06-15 | 1994-10-18 | Brigham And Women's Hospital | S-nitroso derivatives of ace inhibitors and the use thereof |
| GB9010394D0 (en) * | 1990-05-09 | 1990-06-27 | Ici Plc | Heterocyclic compounds |
| US5504080A (en) * | 1992-10-28 | 1996-04-02 | Bristol-Myers Squibb Co. | Benzo-fused lactams |
| JPH09500113A (ja) * | 1993-06-30 | 1997-01-07 | チバ−ガイギー アクチェンゲゼルシャフト | エンケファリナーゼ及びaceのインヒビターとして有用な抗高血圧性三環式アゼピン誘導体 |
| ITMI20012060A1 (it) * | 2001-10-05 | 2003-04-05 | Recordati Chem Pharm | Nuovi eterocilcli n-acilati |
| EP2392328A1 (en) * | 2005-05-09 | 2011-12-07 | Hydra Biosciences, Inc. | Compounds for modulating TRPV3 Function |
| US8916550B2 (en) * | 2005-05-09 | 2014-12-23 | Hydra Biosciences, Inc. | Compounds for modulating TRPV3 function |
| US11229746B2 (en) | 2006-06-22 | 2022-01-25 | Excelsior Medical Corporation | Antiseptic cap |
| US9259535B2 (en) | 2006-06-22 | 2016-02-16 | Excelsior Medical Corporation | Antiseptic cap equipped syringe |
| US7998980B2 (en) | 2006-09-15 | 2011-08-16 | Hydra Biosciences, Inc. | Compounds for modulating TRPV3 function |
| US9078992B2 (en) | 2008-10-27 | 2015-07-14 | Pursuit Vascular, Inc. | Medical device for applying antimicrobial to proximal end of catheter |
| US10166381B2 (en) | 2011-05-23 | 2019-01-01 | Excelsior Medical Corporation | Antiseptic cap |
| CA2841832C (en) | 2011-07-12 | 2019-06-04 | Icu Medical, Inc. | Device for delivery of antimicrobial agent into a trans-dermal catheter |
| CA2945406C (en) | 2014-05-02 | 2022-10-18 | Excelsior Medical Corporation | Strip package for antiseptic cap |
| EP3294404B1 (en) | 2015-05-08 | 2025-06-11 | ICU Medical, Inc. | Medical connectors configured to receive emitters of therapeutic agents |
| CA3040277C (en) | 2016-10-14 | 2025-08-12 | Icu Medical, Inc. | DISINFECTANT CAPS FOR MEDICAL FITTINGS |
| WO2018204206A2 (en) | 2017-05-01 | 2018-11-08 | Icu Medical, Inc. | Medical fluid connectors and methods for providing additives in medical fluid lines |
| US11541221B2 (en) | 2018-11-07 | 2023-01-03 | Icu Medical, Inc. | Tubing set with antimicrobial properties |
| US11400195B2 (en) | 2018-11-07 | 2022-08-02 | Icu Medical, Inc. | Peritoneal dialysis transfer set with antimicrobial properties |
| US11534595B2 (en) | 2018-11-07 | 2022-12-27 | Icu Medical, Inc. | Device for delivering an antimicrobial composition into an infusion device |
| US11517732B2 (en) | 2018-11-07 | 2022-12-06 | Icu Medical, Inc. | Syringe with antimicrobial properties |
| US11541220B2 (en) | 2018-11-07 | 2023-01-03 | Icu Medical, Inc. | Needleless connector with antimicrobial properties |
| AU2019384564B2 (en) | 2018-11-21 | 2023-11-23 | Icu Medical, Inc. | Antimicrobial device comprising a cap with ring and insert |
| NZ790364A (en) | 2020-01-29 | 2025-12-19 | Kamari Pharma Ltd | Compounds and compositions for use in treating skin disorders |
| CA3204371A1 (en) | 2020-12-07 | 2022-06-16 | Icu Medical, Inc. | Peritoneal dialysis caps, systems and methods |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR837847A (fr) * | 1937-05-13 | 1939-02-21 | Ste Ind Chim Bale | Agents auxiliaires pour l'impression |
| US4104392A (en) * | 1974-11-08 | 1978-08-01 | Mitsubishi Chemical Industries Ltd. | N2 -naphthalenesulfonyl-L-argininamides and the pharmaceutically acceptable salts thereof, and antithrombotic compositions and methods employing them |
| AU509899B2 (en) * | 1976-02-13 | 1980-05-29 | E.R. Squibb & Sons, Inc. | Proline derivatives and related compounds |
| AU4091178A (en) * | 1977-10-25 | 1980-04-24 | Merck & Co Inc | Substituted mercapto acid amides |
-
1979
- 1979-11-02 US US06/090,862 patent/US4461896A/en not_active Expired - Lifetime
-
1980
- 1980-01-04 IE IE14/80A patent/IE49350B1/en unknown
- 1980-01-07 IL IL59089A patent/IL59089A/xx unknown
- 1980-01-10 SE SE8000209A patent/SE436031B/sv not_active IP Right Cessation
- 1980-01-14 GR GR60950A patent/GR74103B/el unknown
- 1980-01-15 NZ NZ192613A patent/NZ192613A/xx unknown
- 1980-01-18 AU AU54727/80A patent/AU527887B2/en not_active Ceased
- 1980-01-28 IT IT47730/80A patent/IT1145330B/it active
- 1980-01-31 NL NL8000641A patent/NL8000641A/nl not_active Application Discontinuation
- 1980-02-05 GB GB8003806A patent/GB2042535B/en not_active Expired
- 1980-02-06 PT PT70793A patent/PT70793A/pt unknown
- 1980-02-06 CH CH96180A patent/CH645355A5/de not_active IP Right Cessation
- 1980-02-06 DE DE19803004370 patent/DE3004370A1/de active Granted
- 1980-02-06 FR FR8002592A patent/FR2448533A1/fr active Granted
- 1980-02-06 DK DK051280A patent/DK152209C/da not_active IP Right Cessation
- 1980-02-06 ES ES488313A patent/ES8102559A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1145330B (it) | 1986-11-05 |
| US4461896A (en) | 1984-07-24 |
| DE3004370A1 (de) | 1980-08-14 |
| IT8047730A0 (it) | 1980-01-28 |
| IE800014L (en) | 1980-08-07 |
| GR74103B (enExample) | 1984-06-06 |
| ES488313A0 (es) | 1981-01-16 |
| IL59089A (en) | 1982-08-31 |
| DE3004370C2 (enExample) | 1989-10-26 |
| DK51280A (da) | 1980-08-08 |
| SE436031B (sv) | 1984-11-05 |
| DK152209C (da) | 1988-06-20 |
| IL59089A0 (en) | 1980-05-30 |
| PT70793A (en) | 1980-03-01 |
| AU5472780A (en) | 1980-08-14 |
| GB2042535B (en) | 1983-01-26 |
| FR2448533A1 (fr) | 1980-09-05 |
| DK152209B (da) | 1988-02-08 |
| ES8102559A1 (es) | 1981-01-16 |
| FR2448533B1 (enExample) | 1983-01-07 |
| CH645355A5 (de) | 1984-09-28 |
| SE8000209L (sv) | 1980-08-08 |
| AU527887B2 (en) | 1983-03-31 |
| GB2042535A (en) | 1980-09-24 |
| NZ192613A (en) | 1981-10-19 |
| NL8000641A (nl) | 1980-08-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE49350B1 (en) | Tetrahydroquinoline-2-carboxylic acids and their salts | |
| EP0171372B1 (en) | Sulphenamides, processes for their preparation and their use in the manufacture of pharmaceutical preparations | |
| US4714762A (en) | Antiarteriosclerotic substituted benzimidazol-2-yl-and 3H-imidazo[4,5-b]pyridin-2-yl-phenoxy-alkanoic acids and salts and esters thereof | |
| US4866196A (en) | Phenoxyacetic acid derivatives and preparation thereof | |
| CA2098912A1 (en) | Benzoxa condensed ring compound, process for producing the same and pharmaceutical composition comprising the same | |
| EP0045171B1 (en) | 9-amino-1-hydroxyoctahydrobenzo(c)quinolines and derivatives thereof | |
| EP0066956A1 (en) | Enkephalinase enzyme inhibiting compounds | |
| US4450115A (en) | Amino-alcohol derivatives | |
| US4324796A (en) | Substituted oxiranecarboxylic acids, their use and medicaments containing them | |
| EP0003893B1 (en) | Novel dibenz (b,f) oxepin and dibenzo (b,f) thiepin compounds and pharmaceutically acceptable salts thereof, processes for their preparation and pharmaceutical compositions containing them | |
| NZ197582A (en) | Dextrorotatory trans-4a,9b-5phenyl-2,3,4,4a,5,9b-hexahydro-1h-pyrido(4,3-b) indoles | |
| HU192868B (en) | Process for producing particularly antiasthmatic medicine preparations | |
| US4134991A (en) | Derivatives of 2-(3-phenyl-2-aminopropionyloxy)-acetic acid | |
| US4814343A (en) | Substituted 1H-imidazoles | |
| US5965600A (en) | 3-(bis-substituted phenylmethylene) oxindole derivatives | |
| DK159441B (da) | 11-substituerede 5,11-dihydro-6h-dibenz(b,e)azepin-6-on-derivater, laegemidler indeholdende disse forbindelser og analogifremgangsmaade til forbindelsernes fremstilling | |
| JPH0660138B2 (ja) | ジ−及びテトラ−ヒドロナフタレン類,その製法及びそれを含む医薬組成物 | |
| PT91783B (pt) | Processo para a preparacao de {(diarilmetoxi) alquil}-1-pirrolidinas e piperidinas | |
| US5576327A (en) | Treatment of heart rhythym disorders by administration of 3-phenylsulfonyl-3, 7-diazabicyclo[3.3.1]nonane compounds | |
| US4461775A (en) | Hydroxythioether fatty acid derivatives | |
| EP0232089B1 (en) | Quinone amides, their production and use | |
| GB2077719A (en) | (N-(Cycloalkyl)amino acid compounds and compositions containing same | |
| US4341781A (en) | Pyridazopyridazine derivatives | |
| HU201521B (en) | Process for producing benzenethio or benzylsulfonyl derivatives with leukotriene antagonist activity and pharmaceutical compositions comprising same | |
| US4351833A (en) | 9-Amino-1-hydroxyoctahydrobenzo[c]quinolines and derivatives thereof as analgesics and anti-emetics |