SE434890B - Elektrokrom variabel ljusmodulerande anordning - Google Patents
Elektrokrom variabel ljusmodulerande anordningInfo
- Publication number
- SE434890B SE434890B SE7712070A SE7712070A SE434890B SE 434890 B SE434890 B SE 434890B SE 7712070 A SE7712070 A SE 7712070A SE 7712070 A SE7712070 A SE 7712070A SE 434890 B SE434890 B SE 434890B
- Authority
- SE
- Sweden
- Prior art keywords
- electrochromic
- viscoelastic
- variable light
- sulfonic acid
- pigment
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 8
- 239000000049 pigment Substances 0.000 claims description 8
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 6
- 239000004020 conductor Substances 0.000 claims description 5
- 150000002500 ions Chemical class 0.000 claims description 5
- 239000000758 substrate Substances 0.000 claims description 5
- 239000004698 Polyethylene Substances 0.000 claims description 4
- -1 polyethylene Polymers 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 229920000642 polymer Polymers 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000011521 glass Substances 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 5
- 238000005342 ion exchange Methods 0.000 description 5
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 5
- 229910001930 tungsten oxide Inorganic materials 0.000 description 5
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 4
- CMSGUKVDXXTJDQ-UHFFFAOYSA-N 4-(2-naphthalen-1-ylethylamino)-4-oxobutanoic acid Chemical compound C1=CC=C2C(CCNC(=O)CCC(=O)O)=CC=CC2=C1 CMSGUKVDXXTJDQ-UHFFFAOYSA-N 0.000 description 3
- 229910006404 SnO 2 Inorganic materials 0.000 description 3
- 239000003792 electrolyte Substances 0.000 description 3
- 239000011244 liquid electrolyte Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 3
- 229910001887 tin oxide Inorganic materials 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000010416 ion conductor Substances 0.000 description 2
- 239000003014 ion exchange membrane Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000005518 polymer electrolyte Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000001052 yellow pigment Substances 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- OIQPTROHQCGFEF-UHFFFAOYSA-L chembl1371409 Chemical compound [Na+].[Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 OIQPTROHQCGFEF-UHFFFAOYSA-L 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000013536 elastomeric material Substances 0.000 description 1
- 239000002001 electrolyte material Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229920006332 epoxy adhesive Polymers 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/15—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect
- G02F1/1514—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material
- G02F1/1523—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material comprising inorganic material
- G02F1/1525—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material comprising inorganic material characterised by a particular ion transporting layer, e.g. electrolyte
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Nonlinear Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Inorganic Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/735,939 US4116545A (en) | 1976-10-27 | 1976-10-27 | Polymeric electrolyte for electrochromic display devices |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7712070L SE7712070L (sv) | 1978-04-28 |
| SE434890B true SE434890B (sv) | 1984-08-20 |
Family
ID=24957845
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7712070A SE434890B (sv) | 1976-10-27 | 1977-10-26 | Elektrokrom variabel ljusmodulerande anordning |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4116545A (cs) |
| JP (1) | JPS5360255A (cs) |
| BE (1) | BE860105A (cs) |
| BR (1) | BR7707181A (cs) |
| CA (1) | CA1074429A (cs) |
| CH (1) | CH632599A5 (cs) |
| CS (1) | CS215103B2 (cs) |
| DD (1) | DD133603A5 (cs) |
| DE (1) | DE2746973A1 (cs) |
| DK (1) | DK474677A (cs) |
| ES (1) | ES463610A1 (cs) |
| FR (1) | FR2369585A1 (cs) |
| GB (1) | GB1584314A (cs) |
| IT (1) | IT1090177B (cs) |
| MX (1) | MX145635A (cs) |
| NL (1) | NL7711095A (cs) |
| SE (1) | SE434890B (cs) |
| SU (1) | SU707536A3 (cs) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1077608A (en) * | 1977-10-13 | 1980-05-13 | American Cyanamid Company | Preparation of improved electrochromic devices |
| US4174152A (en) * | 1978-02-13 | 1979-11-13 | American Cyanamid Company | Electrochromic devices with polymeric electrolytes |
| SU851320A1 (ru) * | 1978-05-16 | 1981-07-30 | Предприятие П/Я Р-6429 | Электрохромный индикатор |
| CH637978A5 (fr) * | 1979-05-03 | 1983-08-31 | Ebauches Sa | Electrolyte polymerique pour dispositif electro-optique. |
| US4335938A (en) * | 1979-08-30 | 1982-06-22 | American Cyanamid Company | Electrochromic cells with improved electrolyte system |
| US4361385A (en) * | 1980-10-23 | 1982-11-30 | American Cyanamid Company | Electrochromic device containing acid copolymer electrolyte |
| US4550982A (en) * | 1981-11-09 | 1985-11-05 | Nippon Electric Co., Ltd. | All-solid-state display including an organic electrochromic layer with ion donor/acceptor |
| US4519930A (en) * | 1982-01-11 | 1985-05-28 | Kabushiki Kaisha Daini Seikosha | Electrochromic display device |
| JPS61138925A (ja) * | 1984-12-12 | 1986-06-26 | Tokuyama Soda Co Ltd | エレクトロクロミツクデイスプレイ素子 |
| US4768865A (en) * | 1987-06-10 | 1988-09-06 | Ppg Industries, Inc. | Electrochromic window with metal grid counter electrode |
| FR2618570B1 (fr) * | 1987-07-24 | 1990-10-19 | Warszawski Bernard | Procede de modulation de la lumiere |
| FR2618571B1 (fr) * | 1987-07-24 | 1990-10-19 | Warszawski Bernard | Materiau pour la modulation de la lumiere et procedes de fabrication |
| FR2618568B1 (fr) * | 1987-07-24 | 1992-04-17 | Warszawski Bernard | Procede de fabrication d'un dispositif pour la modulation de la lumiere |
| FR2618569B1 (fr) * | 1987-07-24 | 1989-12-22 | Warszawski Bernard | Technique de fabrication d'un dispositif pour la modulation de la lumiere |
| FR2618567B1 (fr) * | 1987-07-24 | 1989-12-22 | Warszawski Bernard | Dispositifs pour la modulation de la lumiere |
| FR2618566B1 (fr) * | 1987-07-24 | 1992-04-17 | Warszawski Bernard | Cellule pour la modulation de la lumiere |
| FR2642890B1 (fr) * | 1989-02-09 | 1991-04-12 | Saint Gobain Vitrage | Materiau colloide conducteur de cations alcalins et applications a titre d'electrolytes |
| US5066111A (en) * | 1989-09-13 | 1991-11-19 | Ppg Industries, Inc. | Electrochromic window with integrated bus bars |
| US5124832A (en) * | 1989-09-29 | 1992-06-23 | Ppg Industries, Inc. | Laminated and sealed electrochromic window |
| WO1991014198A1 (en) * | 1990-03-06 | 1991-09-19 | The Dow Chemical Company | Electrochromic device |
| CA2056937C (en) * | 1990-12-26 | 1996-12-10 | Kuo-Chuan Ho | Solid-state electrochromic device with proton-conducting polymer electrolyte |
| US5161048A (en) * | 1990-12-26 | 1992-11-03 | Ppg Industries, Inc. | Electrochromic window with metal grid counter electrode and acidic polyelectrolyte |
| ES2048644B1 (es) * | 1992-04-03 | 1996-10-01 | Univ Valladolid | Dispositivo electromico con base monocapas de diftalocianinas de elementos de tierras raras y sus aplicaciones. |
| US5910854A (en) * | 1993-02-26 | 1999-06-08 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processes for making such solid films and devices |
| EP1004649A3 (en) * | 1993-02-26 | 2000-07-26 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processes for making such solid films and devices |
| US5668663A (en) | 1994-05-05 | 1997-09-16 | Donnelly Corporation | Electrochromic mirrors and devices |
| DE19622600C2 (de) | 1996-06-05 | 2001-08-02 | Fraunhofer Ges Forschung | Elektrochrome Einheit |
| US7167796B2 (en) | 2000-03-09 | 2007-01-23 | Donnelly Corporation | Vehicle navigation system for use with a telematics system |
| US7370983B2 (en) | 2000-03-02 | 2008-05-13 | Donnelly Corporation | Interior mirror assembly with display |
| US7446924B2 (en) | 2003-10-02 | 2008-11-04 | Donnelly Corporation | Mirror reflective element assembly including electronic component |
| WO2009002556A1 (en) * | 2007-06-27 | 2008-12-31 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8345345B2 (en) | 2007-06-27 | 2013-01-01 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| WO2014151083A1 (en) | 2013-03-15 | 2014-09-25 | Gentex Corporation | Fill port plugs for electrochromic devices |
| US9454054B2 (en) | 2013-11-18 | 2016-09-27 | Magna Mirrors Of America, Inc. | Electro-optic mirror element and process of making same |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2527300A (en) * | 1948-03-18 | 1950-10-24 | American Cyanamid Co | Copolymers of unsaturated sulfonic acids and polyunsaturated compounds |
| US2898311A (en) * | 1955-06-08 | 1959-08-04 | Asahi Chemical Ind | Sulfonic acid type cation exchange resin |
| US3320218A (en) * | 1963-04-05 | 1967-05-16 | Dow Chemical Co | Cross-linked sulfonated aliphatic hydrocarbon polymers |
| US3951521A (en) * | 1964-06-02 | 1976-04-20 | Xerox Corporation | Reversible radiant energy filter and process of using same |
| US3510418A (en) * | 1966-02-24 | 1970-05-05 | Tokuyama Soda Kk | Ion selective membrane |
| US3453038A (en) * | 1966-06-15 | 1969-07-01 | Du Pont | Compartmented electrochromic device |
| US3546142A (en) * | 1967-01-19 | 1970-12-08 | Amicon Corp | Polyelectrolyte structures |
| US3629082A (en) * | 1969-04-22 | 1971-12-21 | Valentin Alexeevich Kargin | Process for producing homogeneous polymeric cation-exchange materials |
| US3684747A (en) * | 1970-04-22 | 1972-08-15 | Du Pont | Method for increasing the liquid absorptive capacity of linear fluorocarbon sulfonic acid polymer |
| US3708220A (en) * | 1970-05-25 | 1973-01-02 | American Cyanamid Co | High conductivity electrolyte gel materials |
| US3704057A (en) * | 1971-06-02 | 1972-11-28 | American Cyanamid Co | Electrochromic device having identical display and counter electrode materials |
| US3819252A (en) * | 1972-12-21 | 1974-06-25 | American Cyanamid Co | Additives that increase the stability of electrochromic films in electrochromic devices |
| US3884871A (en) * | 1973-06-29 | 1975-05-20 | Nl Industries Inc | Process for coating pigment particles with organic polymers |
| US3840288A (en) * | 1973-07-30 | 1974-10-08 | Optel Corp | Electrochromic display having electro-catalyst |
| US3970365A (en) * | 1973-12-26 | 1976-07-20 | American Cyanamid Company | Additives that increase the stability of electrochromic films in electrochromic devices |
| US3892472A (en) * | 1973-12-26 | 1975-07-01 | American Cyanamid Co | Self-supporting pigment layers for electrochromic display |
| US3957352A (en) * | 1975-09-02 | 1976-05-18 | Timex Corporation | Electrochromic display having improved electrolyte |
| CH594263A5 (cs) * | 1975-11-29 | 1977-12-30 | Ebauches Sa |
-
1976
- 1976-10-27 US US05/735,939 patent/US4116545A/en not_active Expired - Lifetime
-
1977
- 1977-09-19 CA CA286,964A patent/CA1074429A/en not_active Expired
- 1977-09-23 GB GB39823/77A patent/GB1584314A/en not_active Expired
- 1977-09-29 IT IT51204/77A patent/IT1090177B/it active
- 1977-10-10 NL NL7711095A patent/NL7711095A/xx not_active Application Discontinuation
- 1977-10-19 CS CS776796A patent/CS215103B2/cs unknown
- 1977-10-19 DE DE19772746973 patent/DE2746973A1/de not_active Withdrawn
- 1977-10-25 FR FR7732088A patent/FR2369585A1/fr active Pending
- 1977-10-26 SU SU772536049A patent/SU707536A3/ru active
- 1977-10-26 CH CH1302477A patent/CH632599A5/de not_active IP Right Cessation
- 1977-10-26 BR BR7707181A patent/BR7707181A/pt unknown
- 1977-10-26 DK DK474677A patent/DK474677A/da not_active Application Discontinuation
- 1977-10-26 SE SE7712070A patent/SE434890B/sv unknown
- 1977-10-26 MX MX171093A patent/MX145635A/es unknown
- 1977-10-26 BE BE182052A patent/BE860105A/xx unknown
- 1977-10-27 JP JP12820777A patent/JPS5360255A/ja active Pending
- 1977-10-27 DD DD7700201738A patent/DD133603A5/xx unknown
- 1977-10-27 ES ES463610A patent/ES463610A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DD133603A5 (de) | 1979-01-10 |
| DK474677A (da) | 1978-04-28 |
| DE2746973A1 (de) | 1978-05-11 |
| JPS5360255A (en) | 1978-05-30 |
| GB1584314A (en) | 1981-02-11 |
| ES463610A1 (es) | 1979-01-01 |
| BE860105A (fr) | 1978-04-26 |
| NL7711095A (nl) | 1978-05-02 |
| MX145635A (es) | 1982-03-17 |
| CA1074429A (en) | 1980-03-25 |
| FR2369585A1 (fr) | 1978-05-26 |
| SU707536A3 (ru) | 1979-12-30 |
| IT1090177B (it) | 1985-06-18 |
| BR7707181A (pt) | 1978-07-18 |
| SE7712070L (sv) | 1978-04-28 |
| CH632599A5 (de) | 1982-10-15 |
| CS215103B2 (en) | 1982-07-30 |
| US4116545A (en) | 1978-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE434890B (sv) | Elektrokrom variabel ljusmodulerande anordning | |
| CA1180088A (en) | Electrochromic cell with improved electrolyte system | |
| EP0050734B1 (en) | Electrochromic device containing acid copolymer electrolyte | |
| Hardy et al. | Preparation and electrical response of solid polymer electrolytes with only one mobile species | |
| SE445496B (sv) | Elektrokromisk anordning | |
| Reiter et al. | Electrochromic devices employing methacrylate-based polymer electrolytes | |
| EP0519921A4 (en) | Electrochromic element, materials used in such an element, process for producing such an element and such materials and use of such an element in an electrochromic device. | |
| CA1154135A (en) | Ion exchange-electrolyte layer for electrochromic devices | |
| US4478991A (en) | Sulfonic acid copolymer electrolyte | |
| AU775485B2 (en) | Solidifying material for cell electrolyte solution, and cell comprising the solidifying material | |
| JPS61500618A (ja) | ポリマ−状物質 | |
| Inaba et al. | Electrochromic display device of tungsten trioxide and prussian blue films using polymer gel electrolyte of methacrylate | |
| SU1022669A3 (ru) | Электрохромное устройство | |
| Harris et al. | Lithium ion conductors and proton conductors: Effects of plasticizers and hydration | |
| JPS6040614B2 (ja) | 特に電気光学的装置用重合体電解質の製法 | |
| RU2075799C1 (ru) | Композиционная смесь для приготовления пленочного твердого полимерного электролита | |
| Sollner et al. | The The Electrochemistry of Permselective Protamine Collodion Membranes. II. Experimental Studies on the Concentration Potential across Various Types of Permselective Protamine Collodion Membranes with Solutions of Several Electrolytes. | |
| Anzai et al. | Photoinduced membrane potential changes. Poly (vinyl chloride) membranes entrapping a photoresponsive bis-(15-crown-5) derivative | |
| Ohno et al. | Preparation and ionic conductivity of poly (oligo (oxypropylene) methacrylate) | |
| Tsuchida | Ion Tunneling in Polymeric Solid Electrolytes for Batery and Electrochromic Display in the Dry State | |
| JP2613666B2 (ja) | エレクトロクロミック素子 | |
| JPS63280727A (ja) | 電解重合膜 | |
| JPS61143727A (ja) | エレクトロクロミツクデイスプレイ素子 | |
| CN116253830A (zh) | 一种聚电解质弹性体及其制备方法和应用 | |
| JPS5950486A (ja) | 電気発色表示素子 |