SE432591B - Integrerat forfarande for framstellning av karbamid och ammoniak - Google Patents
Integrerat forfarande for framstellning av karbamid och ammoniakInfo
- Publication number
- SE432591B SE432591B SE7903018A SE7903018A SE432591B SE 432591 B SE432591 B SE 432591B SE 7903018 A SE7903018 A SE 7903018A SE 7903018 A SE7903018 A SE 7903018A SE 432591 B SE432591 B SE 432591B
- Authority
- SE
- Sweden
- Prior art keywords
- urea
- ammonia
- carbamate
- solution
- aqueous solution
- Prior art date
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 title claims description 74
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title claims description 50
- 239000004202 carbamide Substances 0.000 title claims description 49
- 229910021529 ammonia Inorganic materials 0.000 title claims description 32
- 238000000034 method Methods 0.000 title claims description 13
- 235000013877 carbamide Nutrition 0.000 title 1
- 239000000243 solution Substances 0.000 claims description 26
- 230000015572 biosynthetic process Effects 0.000 claims description 18
- 238000003786 synthesis reaction Methods 0.000 claims description 18
- 239000007864 aqueous solution Substances 0.000 claims description 16
- 239000007789 gas Substances 0.000 claims description 15
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 14
- 238000010521 absorption reaction Methods 0.000 claims description 14
- 238000000354 decomposition reaction Methods 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 10
- BVCZEBOGSOYJJT-UHFFFAOYSA-N ammonium carbamate Chemical compound [NH4+].NC([O-])=O BVCZEBOGSOYJJT-UHFFFAOYSA-N 0.000 claims description 9
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 9
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 8
- 239000001099 ammonium carbonate Substances 0.000 claims description 7
- 235000012501 ammonium carbonate Nutrition 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 239000000284 extract Substances 0.000 claims description 2
- 239000012530 fluid Substances 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 239000011261 inert gas Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- 238000000629 steam reforming Methods 0.000 claims description 2
- GNFTZDOKVXKIBK-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzohydrazide Chemical compound COCCOC1=CC=CC(C(=O)NN)=C1 GNFTZDOKVXKIBK-UHFFFAOYSA-N 0.000 claims 1
- PPBAJDRXASKAGH-UHFFFAOYSA-N azane;urea Chemical compound N.NC(N)=O PPBAJDRXASKAGH-UHFFFAOYSA-N 0.000 claims 1
- 238000007599 discharging Methods 0.000 claims 1
- 239000012808 vapor phase Substances 0.000 claims 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- 239000006096 absorbing agent Substances 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 101150030061 Eloc gene Proteins 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/02—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of urea, its salts, complexes or addition compounds
- C07C273/04—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of urea, its salts, complexes or addition compounds from carbon dioxide and ammonia
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT21993/78A IT1094295B (it) | 1978-04-05 | 1978-04-05 | Procedimento integrato ammoniaca-urea |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7903018L SE7903018L (sv) | 1979-10-06 |
| SE432591B true SE432591B (sv) | 1984-04-09 |
Family
ID=11189914
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7903018A SE432591B (sv) | 1978-04-05 | 1979-04-04 | Integrerat forfarande for framstellning av karbamid och ammoniak |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS54132525A (cs) |
| AU (1) | AU519817B2 (cs) |
| BE (1) | BE875346A (cs) |
| BR (1) | BR7902122A (cs) |
| CA (1) | CA1110659A (cs) |
| CH (1) | CH637633A5 (cs) |
| CS (1) | CS230563B2 (cs) |
| DD (1) | DD142709A5 (cs) |
| DE (1) | DE2913793C3 (cs) |
| DK (1) | DK139179A (cs) |
| EG (1) | EG13847A (cs) |
| ES (1) | ES479940A1 (cs) |
| FR (1) | FR2421847A1 (cs) |
| GB (1) | GB2018249B (cs) |
| IE (1) | IE48099B1 (cs) |
| IN (1) | IN150631B (cs) |
| IT (1) | IT1094295B (cs) |
| LU (1) | LU81113A1 (cs) |
| MX (1) | MX151216A (cs) |
| NL (1) | NL7902566A (cs) |
| PL (1) | PL116665B1 (cs) |
| SE (1) | SE432591B (cs) |
| SU (1) | SU1225485A3 (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61109760A (ja) * | 1984-11-02 | 1986-05-28 | Toyo Eng Corp | 尿素製造法 |
| DE102016203277A1 (de) * | 2016-02-29 | 2017-08-31 | Thyssenkrupp Ag | Integrierte Synthese von Ammoniak und Harnstoff |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4832091B1 (cs) * | 1968-02-12 | 1973-10-04 | ||
| IT1014987B (it) * | 1974-06-12 | 1977-04-30 | Snam Progetti | Procedimento integrato urea am moniaca |
| IT1034674B (it) * | 1975-03-28 | 1979-10-10 | Snam Progetti | Processo flessibile intergrato per la produzione di ammoniaca edurea |
| IT1065422B (it) * | 1976-12-23 | 1985-02-25 | Snam Progetti | Processo ammoniaca-urea integrato per la produzione di urea |
-
1978
- 1978-04-05 IT IT21993/78A patent/IT1094295B/it active
-
1979
- 1979-03-07 AU AU44876/79A patent/AU519817B2/en not_active Ceased
- 1979-03-08 CA CA323,007A patent/CA1110659A/en not_active Expired
- 1979-03-15 GB GB7909086A patent/GB2018249B/en not_active Expired
- 1979-03-24 IN IN289/CAL/79A patent/IN150631B/en unknown
- 1979-03-28 EG EG195/79A patent/EG13847A/xx active
- 1979-03-28 FR FR7907848A patent/FR2421847A1/fr active Granted
- 1979-03-29 JP JP3633279A patent/JPS54132525A/ja active Pending
- 1979-03-30 ES ES479940A patent/ES479940A1/es not_active Expired
- 1979-04-02 NL NL7902566A patent/NL7902566A/xx not_active Application Discontinuation
- 1979-04-03 DD DD79211973A patent/DD142709A5/de unknown
- 1979-04-03 PL PL1979214649A patent/PL116665B1/pl unknown
- 1979-04-03 LU LU81113A patent/LU81113A1/xx unknown
- 1979-04-04 SE SE7903018A patent/SE432591B/sv not_active IP Right Cessation
- 1979-04-04 SU SU792749003A patent/SU1225485A3/ru active
- 1979-04-04 CH CH313979A patent/CH637633A5/it not_active IP Right Cessation
- 1979-04-04 DK DK139179A patent/DK139179A/da not_active IP Right Cessation
- 1979-04-04 CS CS792292A patent/CS230563B2/cs unknown
- 1979-04-04 MX MX177195A patent/MX151216A/es unknown
- 1979-04-05 BE BE0/194424A patent/BE875346A/xx not_active IP Right Cessation
- 1979-04-05 BR BR7902122A patent/BR7902122A/pt unknown
- 1979-04-05 DE DE2913793A patent/DE2913793C3/de not_active Expired
- 1979-08-08 IE IE706/79A patent/IE48099B1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7902566A (nl) | 1979-10-09 |
| SU1225485A3 (ru) | 1986-04-15 |
| GB2018249A (en) | 1979-10-17 |
| IT1094295B (it) | 1985-07-26 |
| DK139179A (da) | 1979-10-06 |
| CS230563B2 (en) | 1984-08-13 |
| FR2421847B1 (cs) | 1982-10-22 |
| MX151216A (es) | 1984-10-11 |
| PL116665B1 (en) | 1981-06-30 |
| CH637633A5 (it) | 1983-08-15 |
| DE2913793A1 (de) | 1979-10-11 |
| PL214649A1 (pl) | 1979-12-17 |
| AU519817B2 (en) | 1981-12-24 |
| DE2913793B2 (de) | 1980-06-04 |
| DE2913793C3 (de) | 1981-05-27 |
| ES479940A1 (es) | 1979-12-01 |
| FR2421847A1 (fr) | 1979-11-02 |
| BE875346A (fr) | 1979-10-05 |
| LU81113A1 (fr) | 1979-06-19 |
| CA1110659A (en) | 1981-10-13 |
| AU4487679A (en) | 1979-10-18 |
| IE790706L (en) | 1979-10-05 |
| EG13847A (en) | 1982-12-31 |
| JPS54132525A (en) | 1979-10-15 |
| IT7821993A0 (it) | 1978-04-05 |
| BR7902122A (pt) | 1979-12-04 |
| DD142709A5 (de) | 1980-07-09 |
| GB2018249B (en) | 1982-09-02 |
| IE48099B1 (en) | 1984-09-19 |
| SE7903018L (sv) | 1979-10-06 |
| IN150631B (cs) | 1982-11-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4314077A (en) | Method for the production of urea and purification of water | |
| US4138434A (en) | Integrated ammonia-urea producing process, for the production of urea | |
| AU592360B2 (en) | Process for the preparation of urea | |
| CN109890788B (zh) | 尿素与尿素-硝酸铵的集成工艺 | |
| CN105829289A (zh) | 尿素和三聚氰胺的一体化生产 | |
| HU180880B (en) | Process for preparing carbamide | |
| SU1494864A3 (ru) | Способ получени мочевины | |
| US10315925B2 (en) | Method and plant for producing urea-ammonium nitrate (UAN) | |
| HU180579B (en) | Process for cleaning urea-containing waste waters and for producing melamine | |
| US3155722A (en) | Recovery of residual ammonia and carbon dioxide in the synthesis of urea | |
| US4235816A (en) | Integrated ammonia-urea process | |
| CS238355B2 (en) | Method of ammonia and urea simultaneous production | |
| US3120563A (en) | Urea preparation | |
| EP3233792A1 (en) | Process for urea production | |
| US11236043B2 (en) | Ammonia-urea integrated process and plant | |
| SU1450735A3 (ru) | Способ получени мочевины | |
| CA2168505A1 (en) | High yield process for urea synthesis | |
| US4013718A (en) | Integrated process for the production of urea | |
| CN112028089B (zh) | 一种硝酸铵的生产装置和方法 | |
| SE432591B (sv) | Integrerat forfarande for framstellning av karbamid och ammoniak | |
| RU2050351C1 (ru) | Способ получения карбамида | |
| US3932504A (en) | Urea manufacture | |
| GB2087381A (en) | Urea production | |
| JPS59206033A (ja) | 重い同位体の分離方法 | |
| SU971093A3 (ru) | Способ получени мочевины |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7903018-5 Effective date: 19880822 Format of ref document f/p: F |