SE416205B - Forfarande for framstellning av 7-trifluormetylmerkaptoacetamidocefalosporiner - Google Patents
Forfarande for framstellning av 7-trifluormetylmerkaptoacetamidocefalosporinerInfo
- Publication number
- SE416205B SE416205B SE7309853A SE7309853A SE416205B SE 416205 B SE416205 B SE 416205B SE 7309853 A SE7309853 A SE 7309853A SE 7309853 A SE7309853 A SE 7309853A SE 416205 B SE416205 B SE 416205B
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- carboxylic acid
- ylthiomethyl
- cephem
- preparation
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 11
- -1 1,2,3-triazol-4-ylthiomethyl Chemical group 0.000 claims description 9
- CDXSCTQQQWTJNJ-UHFFFAOYSA-N 2-(trifluoromethylsulfanyl)acetic acid Chemical class OC(=O)CSC(F)(F)F CDXSCTQQQWTJNJ-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- MLOZJRLUNNFSGD-IOJJLOCKSA-N (6r)-7-amino-8-oxo-3-(2h-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC=1C=NNN=1 MLOZJRLUNNFSGD-IOJJLOCKSA-N 0.000 claims 1
- XUTQHTOXGKVJPN-UHFFFAOYSA-N 7-azaniumyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)C2SC1 XUTQHTOXGKVJPN-UHFFFAOYSA-N 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000001715 oxadiazolyl group Chemical group 0.000 claims 1
- 125000003831 tetrazolyl group Chemical group 0.000 claims 1
- 125000001113 thiadiazolyl group Chemical group 0.000 claims 1
- 125000001425 triazolyl group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 14
- 150000002148 esters Chemical class 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 2
- SLQXXIOWCNXPGY-QHDYGNBISA-N C1C(=C(N2[C@H](S1)C(C2=O)NC(=O)CSC(F)(F)F)C(=O)O)CSC3=NNN=C3 Chemical compound C1C(=C(N2[C@H](S1)C(C2=O)NC(=O)CSC(F)(F)F)C(=O)O)CSC3=NNN=C3 SLQXXIOWCNXPGY-QHDYGNBISA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- JDNTWHVOXJZDSN-UHFFFAOYSA-N iodoacetic acid Chemical compound OC(=O)CI JDNTWHVOXJZDSN-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- HJSGHKMSDOLGJJ-IOJJLOCKSA-N (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 HJSGHKMSDOLGJJ-IOJJLOCKSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- YBOOHBHYIGUUPF-UHFFFAOYSA-N 2-(trifluoromethylsulfanyl)acetyl chloride Chemical compound FC(F)(F)SCC(Cl)=O YBOOHBHYIGUUPF-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CWERGRDVMFNCDR-UHFFFAOYSA-M thioglycolate(1-) Chemical compound [O-]C(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-M 0.000 description 1
- RQYLOOVORNJDQX-UHFFFAOYSA-N trifluoromethyl thiohypochlorite Chemical compound FC(F)(F)SCl RQYLOOVORNJDQX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/46—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/26—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group
- C07D501/28—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group with the 7-amino radical acylated by an aliphatic carboxylic acid, which is substituted by hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00273571A US3828037A (en) | 1972-07-20 | 1972-07-20 | Trifluoromethylmercaptoacetamidocephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE416205B true SE416205B (sv) | 1980-12-08 |
Family
ID=23044497
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7309853A SE416205B (sv) | 1972-07-20 | 1973-07-13 | Forfarande for framstellning av 7-trifluormetylmerkaptoacetamidocefalosporiner |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3828037A (online.php) |
| JP (1) | JPS5919959B2 (online.php) |
| AR (1) | AR197514A1 (online.php) |
| AT (1) | AT324562B (online.php) |
| AU (1) | AU467469B2 (online.php) |
| BE (1) | BE802199A (online.php) |
| CA (1) | CA1023347A (online.php) |
| CH (1) | CH584227A5 (online.php) |
| CS (1) | CS168037B2 (online.php) |
| DD (1) | DD114088A5 (online.php) |
| DE (1) | DE2336345C2 (online.php) |
| ES (1) | ES416980A1 (online.php) |
| FI (1) | FI57110C (online.php) |
| FR (1) | FR2193574B1 (online.php) |
| GB (1) | GB1393348A (online.php) |
| HU (1) | HU169129B (online.php) |
| IE (1) | IE37916B1 (online.php) |
| IL (1) | IL42737A (online.php) |
| LU (1) | LU68041A1 (online.php) |
| NL (1) | NL7309869A (online.php) |
| PH (1) | PH9532A (online.php) |
| PL (1) | PL85513B1 (online.php) |
| SE (1) | SE416205B (online.php) |
| ZA (1) | ZA734129B (online.php) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE793448A (fr) * | 1971-12-31 | 1973-06-28 | Roussel Uclaf | Procede de preparation de nouveaux derives des cephalosporines et produits obtenus |
| US3898220A (en) * | 1972-07-20 | 1975-08-05 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3898221A (en) * | 1972-07-20 | 1975-08-05 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3943127A (en) * | 1973-06-18 | 1976-03-09 | Smithkline Corporation | 7-Trifluoromethylsulfinylacetamido cephalosporins |
| US3943128A (en) * | 1973-06-18 | 1976-03-09 | Smithkline Corporation | 7-Trifluoromethylsulfinylacetamido cephalosporins |
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| US3998818A (en) * | 1973-12-26 | 1976-12-21 | Smithkline Corporation | Trifluoroethylmercapto, -sulfinyl or -sulfonyl acetamidocephalosporins |
| US3998819A (en) * | 1973-12-26 | 1976-12-21 | Smithkline Corporation | Trifluoroethyl-mercapto, -sulfinyl or -sulfonyl acetamidocephalosporins |
| US4013765A (en) * | 1973-12-26 | 1977-03-22 | Smithkline Corporation | Compositions and methods for treating bacterial infections with substituted acetamidocephalosporins |
| US3957770A (en) * | 1973-12-26 | 1976-05-18 | Smithkline Corporation | Substituted acetamidocephalosporins |
| US3907788A (en) * | 1974-03-01 | 1975-09-23 | American Home Prod | Sulfenyl derivatives of 7-aminocephalosporanic acid |
| US3965099A (en) * | 1974-06-26 | 1976-06-22 | Smithkline Corporation | Cephalosporin esters with antibacterial activity |
| US4286089A (en) * | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US4020057A (en) * | 1975-06-18 | 1977-04-26 | Smithkline Corporation | 7β-Acyloxy cephalosporins |
| US4025626A (en) * | 1975-12-09 | 1977-05-24 | Smithkline Corporation | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins |
| US4075338A (en) * | 1975-12-29 | 1978-02-21 | Smithkline Corporation | Substituted acetamidocephalosporins |
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4034092A (en) * | 1976-05-03 | 1977-07-05 | Smithkline Corporation | 7-Acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4058609A (en) * | 1976-06-28 | 1977-11-15 | Smithkline Corporation | 7-Dithioacetamido cephalosporins |
| US4316017A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4316016A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4223135A (en) * | 1979-03-19 | 1980-09-16 | Bristol-Myers Company | Production of cephalosporins |
| JPS57109761A (en) * | 1980-12-26 | 1982-07-08 | Shionogi & Co Ltd | Fluoromethylthioacetic acid compound and its preparation |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
-
1972
- 1972-07-20 US US00273571A patent/US3828037A/en not_active Expired - Lifetime
-
1973
- 1973-06-19 ZA ZA734129A patent/ZA734129B/xx unknown
- 1973-07-06 GB GB3226173A patent/GB1393348A/en not_active Expired
- 1973-07-11 BE BE133356A patent/BE802199A/xx not_active IP Right Cessation
- 1973-07-13 SE SE7309853A patent/SE416205B/sv unknown
- 1973-07-13 IL IL42737A patent/IL42737A/en unknown
- 1973-07-16 FI FI2252/73A patent/FI57110C/fi active
- 1973-07-16 PH PH14825*UA patent/PH9532A/en unknown
- 1973-07-16 IE IE1197/73A patent/IE37916B1/xx unknown
- 1973-07-16 NL NL7309869A patent/NL7309869A/xx not_active Application Discontinuation
- 1973-07-17 DE DE2336345A patent/DE2336345C2/de not_active Expired
- 1973-07-17 ES ES416980A patent/ES416980A1/es not_active Expired
- 1973-07-18 JP JP48082606A patent/JPS5919959B2/ja not_active Expired
- 1973-07-18 FR FR7326268A patent/FR2193574B1/fr not_active Expired
- 1973-07-18 PL PL1973164143A patent/PL85513B1/pl unknown
- 1973-07-18 LU LU68041A patent/LU68041A1/xx unknown
- 1973-07-18 CA CA176,785A patent/CA1023347A/en not_active Expired
- 1973-07-19 HU HUSI1327A patent/HU169129B/hu unknown
- 1973-07-19 CH CH1060873A patent/CH584227A5/xx not_active IP Right Cessation
- 1973-07-19 AU AU58314/73A patent/AU467469B2/en not_active Expired
- 1973-07-20 AR AR249204A patent/AR197514A1/es active
- 1973-07-20 AT AT646873A patent/AT324562B/de not_active IP Right Cessation
- 1973-07-20 DD DD172415A patent/DD114088A5/xx unknown
- 1973-07-20 CS CS5237A patent/CS168037B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE802199A (fr) | 1974-01-11 |
| DE2336345C2 (de) | 1982-05-13 |
| FR2193574B1 (online.php) | 1977-07-15 |
| US3828037A (en) | 1974-08-06 |
| CS168037B2 (online.php) | 1976-05-28 |
| CA1023347A (en) | 1977-12-27 |
| ZA734129B (en) | 1974-05-29 |
| AR197514A1 (es) | 1974-04-15 |
| IL42737A (en) | 1977-03-31 |
| DD114088A5 (online.php) | 1975-07-12 |
| PH9532A (en) | 1976-01-09 |
| CH584227A5 (online.php) | 1977-01-31 |
| JPS4943997A (online.php) | 1974-04-25 |
| NL7309869A (online.php) | 1974-01-22 |
| AU467469B2 (en) | 1975-12-04 |
| GB1393348A (en) | 1975-05-07 |
| HU169129B (online.php) | 1976-09-28 |
| FI57110B (fi) | 1980-02-29 |
| FR2193574A1 (online.php) | 1974-02-22 |
| AT324562B (de) | 1975-09-10 |
| JPS5919959B2 (ja) | 1984-05-09 |
| IE37916B1 (en) | 1977-11-09 |
| FI57110C (fi) | 1980-06-10 |
| LU68041A1 (online.php) | 1973-09-26 |
| IE37916L (en) | 1974-01-20 |
| ES416980A1 (es) | 1976-03-01 |
| AU5831473A (en) | 1975-01-23 |
| IL42737A0 (en) | 1973-10-25 |
| PL85513B1 (online.php) | 1976-04-30 |
| DE2336345A1 (de) | 1974-02-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE416205B (sv) | Forfarande for framstellning av 7-trifluormetylmerkaptoacetamidocefalosporiner | |
| NO832387L (no) | Fremgangsmaate for fremstilling av cefem-karboksylsyre-estere | |
| JPS6016994A (ja) | セフアロスポリン誘導体 | |
| JP5680535B2 (ja) | 新規フラバノン誘導体 | |
| US4382932A (en) | Isoquinolinium substituted cephalosporins | |
| US3880848A (en) | 7-Trifluorome thylsulfinylacetamido cephalosporins | |
| SU847922A3 (ru) | Способ получени - - -( -окси- -метил-НиКОТиНАМидО)- -( -ОКСифЕНил)АцЕТАМидО - -( -МЕТилТЕТРАзОл- -ил)ТиОМЕТил- -цЕфЕМ- -КАРбОНОВОй КиСлОТы | |
| US3459746A (en) | 7 - heteromonocyclic-substituted acylamido derivatives of desacetyl cephalosporanic acid | |
| US3943128A (en) | 7-Trifluoromethylsulfinylacetamido cephalosporins | |
| US4051129A (en) | Process for preparing 7-methoxycephalosporin compounds | |
| US4243810A (en) | Pyridone-acetic acid derivative | |
| US2966484A (en) | Chemical compounds | |
| US4147701A (en) | 7-Acylamino-3-(1-carboxymethylthioethyltetrazolyl-5-thiomethyl)-3-cephem-4-carboxylic acids | |
| US3943129A (en) | 7-Amino-3-(1,3,4-thiadiazolinylthio-methyl) cephalosporins | |
| US3943131A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| US3943127A (en) | 7-Trifluoromethylsulfinylacetamido cephalosporins | |
| EP0000100B1 (en) | 7-acylamino-3-(1-(2-sulfamoylaminoethyl)-tetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids, a process for their preparation and compositions containing them | |
| US3898221A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| US4079134A (en) | 7-Acylamino-3-(5-sulfomethyl-1,3,4-thiadiazol-2-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| HU185685B (en) | Process for preparing new cefem-carboxylic acid derivatives | |
| US4128722A (en) | 7-Trifluoromethylthioacetamido-3-(3-sulfomethyl-1,2,4-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid | |
| US3898220A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| CA1041086A (en) | Substituted acetamidocephalosporins | |
| GB2100734A (en) | New organic compounds processes for their production and their use | |
| GB1604740A (en) | 7-isothiazolylthioacetamido-7-methoxycephalosporanic acid derivatives |