SE408964B - Elektriskt tendmedel - Google Patents
Elektriskt tendmedelInfo
- Publication number
- SE408964B SE408964B SE7312504A SE7312504A SE408964B SE 408964 B SE408964 B SE 408964B SE 7312504 A SE7312504 A SE 7312504A SE 7312504 A SE7312504 A SE 7312504A SE 408964 B SE408964 B SE 408964B
- Authority
- SE
- Sweden
- Prior art keywords
- layer element
- inner sleeve
- ignition
- igniter
- housing
- Prior art date
Links
- 238000003825 pressing Methods 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 6
- 230000002093 peripheral effect Effects 0.000 claims description 5
- 229910000906 Bronze Inorganic materials 0.000 claims description 4
- 239000010974 bronze Substances 0.000 claims description 4
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910001369 Brass Inorganic materials 0.000 claims description 3
- 239000010951 brass Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 239000004698 Polyethylene Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 238000004049 embossing Methods 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- -1 polyethylene Polymers 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 239000000020 Nitrocellulose Substances 0.000 claims 1
- 229910000831 Steel Inorganic materials 0.000 claims 1
- 239000011324 bead Substances 0.000 claims 1
- 230000007423 decrease Effects 0.000 claims 1
- 239000011888 foil Substances 0.000 claims 1
- 239000004922 lacquer Substances 0.000 claims 1
- 229920001220 nitrocellulos Polymers 0.000 claims 1
- 239000010935 stainless steel Substances 0.000 claims 1
- 239000010959 steel Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 8
- 230000035939 shock Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000001133 acceleration Effects 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 229910021346 calcium silicide Inorganic materials 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- FVBUAEGBCNSCDD-UHFFFAOYSA-N silicide(4-) Chemical compound [Si-4] FVBUAEGBCNSCDD-UHFFFAOYSA-N 0.000 description 1
- 239000007779 soft material Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/12—Primers; Detonators electric
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Spark Plugs (AREA)
- Air Bags (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2245308A DE2245308C3 (de) | 1972-09-15 | 1972-09-15 | Elektrisches Brückenzündmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE408964B true SE408964B (sv) | 1979-07-16 |
Family
ID=5856438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7312504A SE408964B (sv) | 1972-09-15 | 1973-09-13 | Elektriskt tendmedel |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3867885A (member.php) |
| BE (1) | BE804857A (member.php) |
| CH (1) | CH555529A (member.php) |
| DE (1) | DE2245308C3 (member.php) |
| FR (1) | FR2200501B1 (member.php) |
| GB (1) | GB1401576A (member.php) |
| IT (1) | IT994251B (member.php) |
| SE (1) | SE408964B (member.php) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2443793C2 (de) * | 1974-09-13 | 1986-05-07 | Dynamit Nobel Ag, 5210 Troisdorf | Kombiniertes Anzündhütchen |
| DE2654087C3 (de) * | 1976-11-29 | 1981-07-16 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches Zündmittel |
| SE431681B (sv) * | 1977-04-19 | 1984-02-20 | Bofors Ab | Eltenddon |
| US4261263A (en) * | 1979-06-18 | 1981-04-14 | Special Devices, Inc. | RF-insensitive squib |
| DE3222765C2 (de) * | 1982-06-18 | 1986-01-02 | Comet GmbH Pyrotechnik - Apparatebau, 2850 Bremerhaven | Behälter zur Lagerung und Abschuß - aus der Hand - einer Signalrakete |
| DE3245187A1 (de) * | 1982-12-07 | 1984-06-07 | Dynamit Nobel Ag, 5210 Troisdorf | Kontaktierung von traegerelementen in elektrischen zuendmitteln |
| DE3472295D1 (de) * | 1983-11-09 | 1988-07-28 | Dynamit Nobel Ag | Electric primer |
| CH663089A5 (de) * | 1984-05-21 | 1987-11-13 | Inventa Ag | Polkoerper fuer eine elektrische zuendvorrichtung, verfahren zu seiner herstellung und dessen verwendung. |
| ZA852777B (en) * | 1984-05-24 | 1985-11-27 | Inventa Ag | Pole body for an electric fuze,method of manufacturing and method of using the pole body |
| CA1273242A (en) * | 1987-06-29 | 1990-08-28 | Donald Clinton True | Delay initiator for blasting |
| US5044278A (en) * | 1989-07-03 | 1991-09-03 | James E. Meagher | Electrically ignitible cartridge system |
| US5113764A (en) * | 1989-09-25 | 1992-05-19 | Olin Corporation | Semiconductor bridge (SCB) packaging system |
| US5293821A (en) * | 1990-06-22 | 1994-03-15 | Ici Canada Inc. | Delay initiator for blasting |
| US5454320A (en) * | 1992-10-23 | 1995-10-03 | Quantic Industries, Inc. | Air bag initiator |
| US5711531A (en) * | 1993-10-20 | 1998-01-27 | Quantic Industries, Inc. | Electrical initiator seal |
| US5648634A (en) * | 1993-10-20 | 1997-07-15 | Quantic Industries, Inc. | Electrical initiator |
| SI3030858T1 (sl) * | 2013-08-05 | 2018-12-31 | Ruag Ammotec Gmbh | Elektromehanska vžigalna kapica |
| WO2015018828A1 (de) * | 2013-08-05 | 2015-02-12 | Ruag Ammotec Gmbh | Elektrisches anzündhütchen für kleinkaliber-munition |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1084745A (en) * | 1913-09-08 | 1914-01-20 | Union Metallic Cartridge Co | Electric primer. |
| DE882970C (de) * | 1942-12-29 | 1953-07-13 | Dynamit Nobel Ag | Elektrisch zuendbare Sprengkapseln |
| US2972951A (en) * | 1952-05-06 | 1961-02-28 | Richard H Stresau | Electric initiator for fuze |
| US3018732A (en) * | 1954-09-30 | 1962-01-30 | Bendix Corp | Ignition means for ammunition primer or the like |
| DE1200171B (de) * | 1964-03-12 | 1965-09-02 | Rheinmetall Gmbh | Elektrische Zuendschraube |
| DE1446952B1 (de) * | 1964-07-02 | 1970-07-09 | Dynamit Nobel Ag | Elektrische Zuendvorrichtung |
| DE1771889A1 (de) * | 1968-07-25 | 1972-01-27 | Dynamit Nobel Ag | Elektrisches Zuendelement |
| SE339185B (member.php) * | 1970-01-26 | 1971-09-27 | Philips Svenska Ab | |
| DE2020016C3 (de) * | 1970-04-24 | 1974-12-12 | Dynamit Nobel Ag, 5210 Troisdorf | Metallschichtzündmittel |
-
1972
- 1972-09-15 DE DE2245308A patent/DE2245308C3/de not_active Expired
-
1973
- 1973-08-21 CH CH1202973A patent/CH555529A/xx not_active IP Right Cessation
- 1973-08-24 GB GB4033373A patent/GB1401576A/en not_active Expired
- 1973-09-12 US US396438A patent/US3867885A/en not_active Expired - Lifetime
- 1973-09-13 FR FR7332987A patent/FR2200501B1/fr not_active Expired
- 1973-09-13 IT IT52511/73A patent/IT994251B/it active
- 1973-09-13 SE SE7312504A patent/SE408964B/sv unknown
- 1973-09-14 BE BE135649A patent/BE804857A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH555529A (de) | 1974-10-31 |
| US3867885A (en) | 1975-02-25 |
| BE804857A (fr) | 1974-01-02 |
| FR2200501A1 (member.php) | 1974-04-19 |
| FR2200501B1 (member.php) | 1978-01-06 |
| DE2245308C3 (de) | 1981-05-07 |
| DE2245308A1 (de) | 1974-03-21 |
| DE2245308B2 (de) | 1980-07-31 |
| IT994251B (it) | 1975-10-20 |
| GB1401576A (en) | 1975-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE408964B (sv) | Elektriskt tendmedel | |
| US4014264A (en) | Combined igniter cap | |
| US6289813B1 (en) | Electropyrotechnic igniter with enhanced ignition reliability | |
| US6009809A (en) | Bridgewire initiator | |
| US3682096A (en) | Electric detonator element | |
| US4621578A (en) | Pyrotechnic initiator using a coaxial connector | |
| US4267567A (en) | Electric igniter | |
| JPS6233516B2 (member.php) | ||
| ATE330204T1 (de) | Elektrisches zündelement | |
| US3059576A (en) | Electrically fired detonator | |
| US2986090A (en) | Electric fuses for igniting explosive charges | |
| US2999460A (en) | Electric blasting cap | |
| US2721240A (en) | Explosive pressure operated switch | |
| GB1587858A (en) | Electric igniter | |
| KR20160078951A (ko) | 소구경 탄환용 전기적 점화 캡 | |
| US4335653A (en) | Electric igniter with conductive bodies and thin connector | |
| US3308758A (en) | Ignition device | |
| US4130060A (en) | Pyrotechnic devices | |
| US1084745A (en) | Electric primer. | |
| US2389086A (en) | Electric detonator | |
| US3719148A (en) | Primer for electric and percussion fuses for cartridge ammunition | |
| US3661085A (en) | Electrically actuated initiator | |
| US3295446A (en) | Electric primer | |
| US3125025A (en) | Pyrotechnic igniter | |
| US4951570A (en) | Electrically activated detonator with pyrotechnic device receiving terminals and method of making |