SE397355B - Analogiforfarande for framstellning av nya penicillansyraderivat - Google Patents
Analogiforfarande for framstellning av nya penicillansyraderivatInfo
- Publication number
- SE397355B SE397355B SE7015181A SE1518170A SE397355B SE 397355 B SE397355 B SE 397355B SE 7015181 A SE7015181 A SE 7015181A SE 1518170 A SE1518170 A SE 1518170A SE 397355 B SE397355 B SE 397355B
- Authority
- SE
- Sweden
- Prior art keywords
- acid derivatives
- penicillanic acid
- preparing new
- analogical procedure
- analogical
- Prior art date
Links
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB33211/70A GB1293590A (en) | 1969-11-11 | 1969-11-11 | New penicillanic acid derivatives |
| GB5520969 | 1969-11-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE397355B true SE397355B (sv) | 1977-10-31 |
Family
ID=26261769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7015181A SE397355B (sv) | 1969-11-11 | 1970-11-10 | Analogiforfarande for framstellning av nya penicillansyraderivat |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS518955B1 (OSRAM) |
| AT (1) | AT301026B (OSRAM) |
| BE (1) | BE758782A (OSRAM) |
| BG (1) | BG18619A3 (OSRAM) |
| CH (2) | CH559753A5 (OSRAM) |
| CS (1) | CS166020B2 (OSRAM) |
| DE (1) | DE2055531C3 (OSRAM) |
| DK (1) | DK135127B (OSRAM) |
| ES (1) | ES385437A1 (OSRAM) |
| FI (1) | FI54601C (OSRAM) |
| FR (1) | FR2073338A1 (OSRAM) |
| HU (1) | HU162440B (OSRAM) |
| IE (1) | IE34620B1 (OSRAM) |
| IL (1) | IL35490A (OSRAM) |
| IT (1) | IT1044209B (OSRAM) |
| LU (1) | LU62031A1 (OSRAM) |
| NL (1) | NL168227C (OSRAM) |
| NO (1) | NO137826C (OSRAM) |
| PL (1) | PL90581B1 (OSRAM) |
| RO (2) | RO60563A (OSRAM) |
| SE (1) | SE397355B (OSRAM) |
| SU (1) | SU406362A3 (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (OSRAM) * | 1970-12-22 | 1975-06-30 | ||
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1427139A (en) * | 1972-03-13 | 1976-03-10 | Astra Laekemedel Ab | Penicillins |
| GB1417099A (en) * | 1973-02-02 | 1975-12-10 | Leo Pharm Prod Ltd | Method for the production of derivatives of 6-aminopenicillanic acid |
| SU566843A1 (ru) * | 1975-01-06 | 1977-07-30 | Ордена Трудового Красного Знамени Институт Органической Синтеза Ан Латвийской Сср | Способ получени производных 6- -амидинопенициллановой кислоты |
| GB1579931A (en) * | 1976-04-15 | 1980-11-26 | Leo Pharm Prod Ltd | Bis-penicillanoyl-oxy-alkanes |
| TWI375678B (en) | 2005-06-09 | 2012-11-01 | Yakult Honsha Kk | A method of preparation of a tricyclic ketone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135755A (en) * | 1961-11-20 | 1964-06-02 | Hoffmann La Roche | Pyrimidine formamidines of primary amines |
| US3322781A (en) * | 1963-10-18 | 1967-05-30 | Bristol Myers Co | 6-(substituted-hydroxyamidino)-penicillanic acids |
| CH480792A (de) * | 1967-01-26 | 1969-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
-
0
- BE BE758782D patent/BE758782A/xx not_active IP Right Cessation
-
1970
- 1970-10-20 IL IL35490A patent/IL35490A/xx unknown
- 1970-10-22 IE IE1359/70A patent/IE34620B1/xx unknown
- 1970-11-05 CH CH1113074A patent/CH559753A5/xx not_active IP Right Cessation
- 1970-11-05 CH CH1644070A patent/CH559752A5/xx not_active IP Right Cessation
- 1970-11-05 AT AT995970A patent/AT301026B/de not_active IP Right Cessation
- 1970-11-06 DK DK565070AA patent/DK135127B/da not_active IP Right Cessation
- 1970-11-09 SU SU1489793A patent/SU406362A3/ru active
- 1970-11-10 FR FR7040428A patent/FR2073338A1/fr active Granted
- 1970-11-10 IT IT70739/70A patent/IT1044209B/it active
- 1970-11-10 RO RO72470A patent/RO60563A/ro unknown
- 1970-11-10 NL NLAANVRAGE7016435,A patent/NL168227C/xx not_active IP Right Cessation
- 1970-11-10 SE SE7015181A patent/SE397355B/xx unknown
- 1970-11-10 PL PL1970144350A patent/PL90581B1/pl unknown
- 1970-11-10 CS CS7560A patent/CS166020B2/cs unknown
- 1970-11-10 RO RO64921A patent/RO56878A/ro unknown
- 1970-11-10 NO NO4290/70A patent/NO137826C/no unknown
- 1970-11-10 LU LU62031D patent/LU62031A1/xx unknown
- 1970-11-11 FI FI3032/70A patent/FI54601C/fi active
- 1970-11-11 JP JP45099009A patent/JPS518955B1/ja active Pending
- 1970-11-11 ES ES385437A patent/ES385437A1/es not_active Expired
- 1970-11-11 HU HULO372A patent/HU162440B/hu not_active IP Right Cessation
- 1970-11-11 BG BG016025A patent/BG18619A3/xx unknown
- 1970-11-11 DE DE2055531A patent/DE2055531C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2055531A1 (de) | 1971-05-27 |
| FR2073338B1 (OSRAM) | 1974-02-15 |
| RO60563A (OSRAM) | 1977-01-15 |
| IT1044209B (it) | 1980-03-20 |
| AT301026B (de) | 1972-08-25 |
| NL7016435A (OSRAM) | 1971-05-13 |
| DE2055531B2 (de) | 1980-01-10 |
| JPS518955B1 (OSRAM) | 1976-03-22 |
| PL90581B1 (en) | 1977-01-31 |
| CH559752A5 (OSRAM) | 1975-03-14 |
| IL35490A (en) | 1974-11-29 |
| FI54601C (fi) | 1979-01-10 |
| DE2055531C3 (de) | 1982-02-25 |
| IL35490A0 (en) | 1970-12-24 |
| RO56878A (OSRAM) | 1975-02-15 |
| FI54601B (fi) | 1978-09-29 |
| LU62031A1 (OSRAM) | 1971-05-10 |
| SU406362A3 (OSRAM) | 1973-11-05 |
| CH559753A5 (OSRAM) | 1975-03-14 |
| IE34620B1 (en) | 1975-06-25 |
| BG18619A3 (bg) | 1975-02-25 |
| NO137826B (no) | 1978-01-23 |
| DK135127C (OSRAM) | 1977-08-15 |
| NO137826C (no) | 1982-02-16 |
| CS166020B2 (OSRAM) | 1976-01-29 |
| HU162440B (OSRAM) | 1973-02-28 |
| NL168227C (nl) | 1982-03-16 |
| FR2073338A1 (en) | 1971-10-01 |
| DK135127B (da) | 1977-03-07 |
| NL168227B (nl) | 1981-10-16 |
| BE758782A (fr) | 1971-05-10 |
| IE34620L (en) | 1971-05-11 |
| ES385437A1 (es) | 1973-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE383634B (sv) | Analogiforfarande for framstellning av 6-((-)-alfa-amino-p-hydroxifenylacetamido) penicillansyratrihydrat eller salter eller salthydrater av 6-((-)-alfa-amino-p-hydroxifenylacetamido) penicillansyra | |
| SE390415B (sv) | Forfarande for framstellning av ftalidestern av 6-(d-(-)-alfa-amino-fenylacetamido) penicillansyra | |
| SE7611410L (sv) | Forfarande for framstellning av nya derivat av penam-3-karboxylsyra | |
| NO138629C (no) | Fremgangsmaate for fremstilling av 7beta-acylamidometyl-ceph-3-em-4-karboksylsyre-estere. | |
| SE399268B (sv) | Forfarande for framstellning av nya purinnukleosidderivat | |
| SE385212B (sv) | Forfarande for framstellning av farmaceutiskt verdefulla pyrazol-4-ettiksyraderivat | |
| SE7700442L (sv) | Forfarande for framstellning av 6-aminopenicillansyra | |
| SE385698B (sv) | Forfarande for framstellning av kinolinettiksyraderivat | |
| SE415758B (sv) | Forfarande for framstellning av nya substituerade n-aminoalkylarylamino-imidazoliner-(2) | |
| SE396753B (sv) | Analogiforfarande for framstellning av en forening tillhorande dihydrolysergsyraserien | |
| SE382809B (sv) | Forfarande for framstellning av fenoxiettiksyraderivat | |
| SE386894B (sv) | Analogiforfarande for framstellning av morfinanderivat | |
| SE397355B (sv) | Analogiforfarande for framstellning av nya penicillansyraderivat | |
| SE386902B (sv) | Forfarande for framstellning av nya cefalosporiner | |
| SE399708B (sv) | Forfarande for framstellning av tioxanton-2-karboxylsyraderivat | |
| SE7511680L (sv) | Forfarande for framstellning av furanderivat | |
| SE392723B (sv) | Forfarande for framstellning av nya derivat av 6-aminopenicilliansyra | |
| SE395885B (sv) | Forfarande for framstellning av nya kortikotropinpeptider | |
| SE385883B (sv) | Forfarande for framstellning av nya pyridinkarbonsyraestrar | |
| SE384685B (sv) | Forfarande for framstellning av linkomycinderivat | |
| FI53814C (fi) | Foerfarande foer framstaellning av nya tuberkulostatiskt verkande alfa-aminoxikarbonyl-hydroxamsyra-derivat | |
| SE386674B (sv) | Forfarande for framstellning av nya penicilloinsyraderivat | |
| SE383631B (sv) | Forfarande for framstellning av nya 1-fenoxi-2-hydroxid-3-hydroxialkylaminopropaner | |
| ZA707347B (en) | New penicillanic acid derivatives | |
| FI47763C (fi) | Menetelmä uusien neriifoliini-johdannaisten valmistamiseksi. |