AT301026B - Verfahren zur Herstellung von neuen Aminopenicillansäurederivaten - Google Patents
Verfahren zur Herstellung von neuen AminopenicillansäurederivatenInfo
- Publication number
- AT301026B AT301026B AT995970A AT995970A AT301026B AT 301026 B AT301026 B AT 301026B AT 995970 A AT995970 A AT 995970A AT 995970 A AT995970 A AT 995970A AT 301026 B AT301026 B AT 301026B
- Authority
- AT
- Austria
- Prior art keywords
- preparation
- new
- acid derivatives
- aminopenicillanic acid
- aminopenicillanic
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5520969 | 1969-11-11 | ||
| GB33211/70A GB1293590A (en) | 1969-11-11 | 1969-11-11 | New penicillanic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT301026B true AT301026B (de) | 1972-08-25 |
Family
ID=26261769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT995970A AT301026B (de) | 1969-11-11 | 1970-11-05 | Verfahren zur Herstellung von neuen Aminopenicillansäurederivaten |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS518955B1 (OSRAM) |
| AT (1) | AT301026B (OSRAM) |
| BE (1) | BE758782A (OSRAM) |
| BG (1) | BG18619A3 (OSRAM) |
| CH (2) | CH559752A5 (OSRAM) |
| CS (1) | CS166020B2 (OSRAM) |
| DE (1) | DE2055531C3 (OSRAM) |
| DK (1) | DK135127B (OSRAM) |
| ES (1) | ES385437A1 (OSRAM) |
| FI (1) | FI54601C (OSRAM) |
| FR (1) | FR2073338A1 (OSRAM) |
| HU (1) | HU162440B (OSRAM) |
| IE (1) | IE34620B1 (OSRAM) |
| IL (1) | IL35490A (OSRAM) |
| IT (1) | IT1044209B (OSRAM) |
| LU (1) | LU62031A1 (OSRAM) |
| NL (1) | NL168227C (OSRAM) |
| NO (1) | NO137826C (OSRAM) |
| PL (1) | PL90581B1 (OSRAM) |
| RO (2) | RO56878A (OSRAM) |
| SE (1) | SE397355B (OSRAM) |
| SU (1) | SU406362A3 (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (OSRAM) * | 1970-12-22 | 1975-06-30 | ||
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1427139A (en) * | 1972-03-13 | 1976-03-10 | Astra Laekemedel Ab | Penicillins |
| GB1417099A (en) * | 1973-02-02 | 1975-12-10 | Leo Pharm Prod Ltd | Method for the production of derivatives of 6-aminopenicillanic acid |
| SU566843A1 (ru) * | 1975-01-06 | 1977-07-30 | Ордена Трудового Красного Знамени Институт Органической Синтеза Ан Латвийской Сср | Способ получени производных 6- -амидинопенициллановой кислоты |
| GB1579931A (en) * | 1976-04-15 | 1980-11-26 | Leo Pharm Prod Ltd | Bis-penicillanoyl-oxy-alkanes |
| TWI375678B (en) | 2005-06-09 | 2012-11-01 | Yakult Honsha Kk | A method of preparation of a tricyclic ketone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135755A (en) * | 1961-11-20 | 1964-06-02 | Hoffmann La Roche | Pyrimidine formamidines of primary amines |
| US3322781A (en) * | 1963-10-18 | 1967-05-30 | Bristol Myers Co | 6-(substituted-hydroxyamidino)-penicillanic acids |
| CH480792A (de) * | 1967-01-26 | 1969-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
-
0
- BE BE758782D patent/BE758782A/xx not_active IP Right Cessation
-
1970
- 1970-10-20 IL IL35490A patent/IL35490A/xx unknown
- 1970-10-22 IE IE1359/70A patent/IE34620B1/xx unknown
- 1970-11-05 AT AT995970A patent/AT301026B/de not_active IP Right Cessation
- 1970-11-05 CH CH1644070A patent/CH559752A5/xx not_active IP Right Cessation
- 1970-11-05 CH CH1113074A patent/CH559753A5/xx not_active IP Right Cessation
- 1970-11-06 DK DK565070AA patent/DK135127B/da not_active IP Right Cessation
- 1970-11-09 SU SU1489793A patent/SU406362A3/ru active
- 1970-11-10 IT IT70739/70A patent/IT1044209B/it active
- 1970-11-10 CS CS7560A patent/CS166020B2/cs unknown
- 1970-11-10 SE SE7015181A patent/SE397355B/xx unknown
- 1970-11-10 RO RO64921A patent/RO56878A/ro unknown
- 1970-11-10 NL NLAANVRAGE7016435,A patent/NL168227C/xx not_active IP Right Cessation
- 1970-11-10 RO RO72470A patent/RO60563A/ro unknown
- 1970-11-10 PL PL1970144350A patent/PL90581B1/pl unknown
- 1970-11-10 NO NO4290/70A patent/NO137826C/no unknown
- 1970-11-10 FR FR7040428A patent/FR2073338A1/fr active Granted
- 1970-11-10 LU LU62031D patent/LU62031A1/xx unknown
- 1970-11-11 HU HULO372A patent/HU162440B/hu not_active IP Right Cessation
- 1970-11-11 FI FI3032/70A patent/FI54601C/fi active
- 1970-11-11 BG BG016025A patent/BG18619A3/xx unknown
- 1970-11-11 ES ES385437A patent/ES385437A1/es not_active Expired
- 1970-11-11 JP JP45099009A patent/JPS518955B1/ja active Pending
- 1970-11-11 DE DE2055531A patent/DE2055531C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH559752A5 (OSRAM) | 1975-03-14 |
| ES385437A1 (es) | 1973-11-01 |
| PL90581B1 (en) | 1977-01-31 |
| HU162440B (OSRAM) | 1973-02-28 |
| BE758782A (fr) | 1971-05-10 |
| BG18619A3 (bg) | 1975-02-25 |
| NL168227C (nl) | 1982-03-16 |
| FR2073338A1 (en) | 1971-10-01 |
| RO56878A (OSRAM) | 1975-02-15 |
| NL168227B (nl) | 1981-10-16 |
| NO137826B (no) | 1978-01-23 |
| DK135127C (OSRAM) | 1977-08-15 |
| IT1044209B (it) | 1980-03-20 |
| FR2073338B1 (OSRAM) | 1974-02-15 |
| FI54601B (fi) | 1978-09-29 |
| IL35490A0 (en) | 1970-12-24 |
| LU62031A1 (OSRAM) | 1971-05-10 |
| DE2055531A1 (de) | 1971-05-27 |
| DK135127B (da) | 1977-03-07 |
| SE397355B (sv) | 1977-10-31 |
| NO137826C (no) | 1982-02-16 |
| IE34620L (en) | 1971-05-11 |
| IE34620B1 (en) | 1975-06-25 |
| FI54601C (fi) | 1979-01-10 |
| CS166020B2 (OSRAM) | 1976-01-29 |
| SU406362A3 (OSRAM) | 1973-11-05 |
| NL7016435A (OSRAM) | 1971-05-13 |
| IL35490A (en) | 1974-11-29 |
| RO60563A (OSRAM) | 1977-01-15 |
| DE2055531B2 (de) | 1980-01-10 |
| JPS518955B1 (OSRAM) | 1976-03-22 |
| CH559753A5 (OSRAM) | 1975-03-14 |
| DE2055531C3 (de) | 1982-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT303254B (de) | Verfahren zur Herstellung von neuen 5-Halogen-salicylsäurederivaten | |
| AT317249B (de) | Verfahren zur Herstellung von neuen Dialkyl-xanthin-Derivaten | |
| CH520706A (de) | Verfahren zur Herstellung von neuen Bezothiazepinderivaten | |
| CH533620A (de) | Verfahren zur Herstellung von neuen Derivaten der Thiocarbamidsäure | |
| AT308969B (de) | Verfahren zur Herstellung von neuen 6-Aminopenicillansäurederivaten | |
| AT303733B (de) | Verfahren zur Herstellung von neuen Chinoxalinderivaten | |
| AT301026B (de) | Verfahren zur Herstellung von neuen Aminopenicillansäurederivaten | |
| CH517064A (de) | Verfahren zur Herstellung von neuen Aryloxy- und Arylthioessigsäurederivaten | |
| AT301534B (de) | Verfahren zur Herstellung von neuen [(Thernylidenamino)-oxyd]-alkylcarbonsäurederivaten | |
| AT322738B (de) | Verfahren zur herstellung von neuen 6-aminopenicillansaeurederivaten | |
| AT297733B (de) | Verfahren zur Herstellung von neuen Benzimidazol-Derivaten | |
| AT297923B (de) | Verfahren zur Herstellung von 6-Aminopenicillansäure | |
| CH540899A (de) | Verfahren zur Herstellung von neuen Neriifolin-Derivaten | |
| CH513189A (de) | Verfahren zur Herstellung von neuen Imidazolidinonderivaten | |
| AT296995B (de) | Verfahren zur Herstellung von neuen Aminopyrimidinderivaten | |
| AT312173B (de) | Verfahren zur Herstellung von Lumilysergsäurederivaten | |
| AT309676B (de) | Verfahren zur Herstellung von 7-Aminocephalosporansäure-Derivaten | |
| CH531513A (de) | Verfahren zur Herstellung von neuen 2-Indolylessigsäurederivaten | |
| AT313263B (de) | Verfahren zur Herstellung von neuen Indenylessigsäurederivaten | |
| AT268520B (de) | Verfahren zur Herstellung von neuen 6 Aminopenicillansäure Derivaten | |
| CH526581A (de) | Verfahren zur Herstellung von neuen 5-Nitrofuryl-Derivaten | |
| CH518943A (de) | Verfahren zur Herstellung von neuen Derivaten des p-Aminoalkyl-benzolsulfonamids | |
| AT305292B (de) | Verfahren zur Herstellung von neuen Thiepinderivaten | |
| AT294826B (de) | Verfahren zur Herstellung von neuen Azido-isothiazol-derivaten | |
| AT301029B (de) | Verfahren zur Herstellung von neuen N-Arylidenderivaten von Erythromycylamin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELA | Expired due to lapse of time |