SA99200395B1 - طريقة لانتاج احادي خلات الفينيل vinyl acetate monomer من خلال اكسدة oxidizaing الايثانethane او الاثيلينethylene - Google Patents
طريقة لانتاج احادي خلات الفينيل vinyl acetate monomer من خلال اكسدة oxidizaing الايثانethane او الاثيلينethylene Download PDFInfo
- Publication number
- SA99200395B1 SA99200395B1 SA99200395A SA99200395A SA99200395B1 SA 99200395 B1 SA99200395 B1 SA 99200395B1 SA 99200395 A SA99200395 A SA 99200395A SA 99200395 A SA99200395 A SA 99200395A SA 99200395 B1 SA99200395 B1 SA 99200395B1
- Authority
- SA
- Saudi Arabia
- Prior art keywords
- catalyst
- ethylene
- equals
- vinyl acetate
- acetic acid
- Prior art date
Links
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical group CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 title claims abstract description 87
- 239000005977 Ethylene Substances 0.000 title claims abstract description 72
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 title claims abstract description 71
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 title claims abstract description 63
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 28
- 230000001590 oxidative effect Effects 0.000 title claims description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims abstract description 172
- 239000003054 catalyst Substances 0.000 claims abstract description 120
- 238000000034 method Methods 0.000 claims abstract description 73
- 239000000203 mixture Substances 0.000 claims abstract description 60
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims abstract description 34
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 28
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 25
- 230000003647 oxidation Effects 0.000 claims abstract description 20
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 20
- 229910052763 palladium Inorganic materials 0.000 claims abstract description 19
- 229910052720 vanadium Inorganic materials 0.000 claims abstract description 18
- 229910052750 molybdenum Inorganic materials 0.000 claims abstract description 17
- 229910052758 niobium Inorganic materials 0.000 claims abstract description 15
- 239000010955 niobium Substances 0.000 claims abstract description 15
- 239000000463 material Substances 0.000 claims abstract description 11
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000011733 molybdenum Substances 0.000 claims abstract description 10
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052796 boron Inorganic materials 0.000 claims abstract description 8
- -1 vanarium Chemical compound 0.000 claims abstract description 8
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical group [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052785 arsenic Inorganic materials 0.000 claims abstract description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 5
- 229910052714 tellurium Inorganic materials 0.000 claims abstract description 5
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims abstract description 4
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims abstract description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052733 gallium Inorganic materials 0.000 claims abstract description 4
- 229910052735 hafnium Inorganic materials 0.000 claims abstract description 4
- 239000011574 phosphorus Substances 0.000 claims abstract description 4
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 4
- 239000010703 silicon Substances 0.000 claims abstract description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical group [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims abstract description 3
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical group [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims abstract description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims abstract 7
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical group [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims abstract 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 56
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 33
- 229910052760 oxygen Inorganic materials 0.000 claims description 33
- 239000001301 oxygen Substances 0.000 claims description 33
- 239000001569 carbon dioxide Substances 0.000 claims description 28
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 230000008569 process Effects 0.000 claims description 23
- 239000007789 gas Substances 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 229910001868 water Inorganic materials 0.000 claims description 16
- 238000006555 catalytic reaction Methods 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 238000000926 separation method Methods 0.000 claims description 7
- UPZFLZYXYGBAPL-UHFFFAOYSA-N 2-ethyl-2-methyl-1,3-dioxolane Chemical compound CCC1(C)OCCO1 UPZFLZYXYGBAPL-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 238000012986 modification Methods 0.000 claims description 4
- 230000004048 modification Effects 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- 229910001882 dioxygen Inorganic materials 0.000 claims description 3
- 229910052732 germanium Inorganic materials 0.000 claims description 3
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 3
- 239000004411 aluminium Substances 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229940117927 ethylene oxide Drugs 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 229910052746 lanthanum Inorganic materials 0.000 claims 4
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims 3
- 101100184147 Caenorhabditis elegans mix-1 gene Proteins 0.000 claims 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 claims 1
- 229910000413 arsenic oxide Inorganic materials 0.000 claims 1
- 229910002090 carbon oxide Inorganic materials 0.000 claims 1
- 239000007809 chemical reaction catalyst Substances 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- CBJHPWGNQLOEPT-UHFFFAOYSA-N ethenyl acetate Chemical compound CC(=O)OC=C.CC(=O)OC=C CBJHPWGNQLOEPT-UHFFFAOYSA-N 0.000 claims 1
- 239000012530 fluid Substances 0.000 claims 1
- 235000008001 rakum palm Nutrition 0.000 claims 1
- 238000010517 secondary reaction Methods 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 claims 1
- 230000009977 dual effect Effects 0.000 abstract description 3
- 239000007788 liquid Substances 0.000 description 14
- 239000000178 monomer Substances 0.000 description 12
- 230000003197 catalytic effect Effects 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 8
- 150000001335 aliphatic alkanes Chemical class 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- 230000008901 benefit Effects 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000005038 ethylene vinyl acetate Substances 0.000 description 3
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- PROZFBRPPCAADD-UHFFFAOYSA-N ethenyl but-3-enoate Chemical compound C=CCC(=O)OC=C PROZFBRPPCAADD-UHFFFAOYSA-N 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 2
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- 239000000052 vinegar Substances 0.000 description 2
- 235000021419 vinegar Nutrition 0.000 description 2
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 1
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 244000187656 Eucalyptus cornuta Species 0.000 description 1
- 102100026459 POU domain, class 3, transcription factor 2 Human genes 0.000 description 1
- 101710133394 POU domain, class 3, transcription factor 2 Proteins 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- BQODPTQLXVVEJG-UHFFFAOYSA-N [O].C=C Chemical compound [O].C=C BQODPTQLXVVEJG-UHFFFAOYSA-N 0.000 description 1
- DFGMFVYRMVYRRA-UHFFFAOYSA-N [O].CC Chemical compound [O].CC DFGMFVYRMVYRRA-UHFFFAOYSA-N 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000005056 cell body Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- LGPMBEHDKBYMNU-UHFFFAOYSA-N ethane;ethene Chemical group CC.C=C LGPMBEHDKBYMNU-UHFFFAOYSA-N 0.000 description 1
- KHJXMKRLFAYKFP-UHFFFAOYSA-N ethane;ethenyl acetate Chemical compound CC.CC(=O)OC=C KHJXMKRLFAYKFP-UHFFFAOYSA-N 0.000 description 1
- DKQVJMREABFYNT-UHFFFAOYSA-N ethene Chemical group C=C.C=C DKQVJMREABFYNT-UHFFFAOYSA-N 0.000 description 1
- HDERJYVLTPVNRI-UHFFFAOYSA-N ethene;ethenyl acetate Chemical group C=C.CC(=O)OC=C HDERJYVLTPVNRI-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- 239000003317 industrial substance Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- KOWXKIHEBFTVRU-UHFFFAOYSA-N nga2 glycan Chemical compound CC.CC KOWXKIHEBFTVRU-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 1
- 239000003348 petrochemical agent Substances 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 210000000582 semen Anatomy 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 230000009469 supplementation Effects 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
- C07C67/055—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation in the presence of platinum group metals or their compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/312,683 US6143921A (en) | 1999-05-14 | 1999-05-14 | Method for producing vinyl acetate monomer from ethane or ethylene oxidation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SA99200395B1 true SA99200395B1 (ar) | 2006-04-04 |
Family
ID=23212532
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SA99200395A SA99200395B1 (ar) | 1999-05-14 | 1999-07-28 | طريقة لانتاج احادي خلات الفينيل vinyl acetate monomer من خلال اكسدة oxidizaing الايثانethane او الاثيلينethylene |
Country Status (10)
| Country | Link |
|---|---|
| US (3) | US6143921A (https=) |
| EP (1) | EP1180092B1 (https=) |
| JP (1) | JP2002544250A (https=) |
| KR (1) | KR100609203B1 (https=) |
| CN (1) | CN1188387C (https=) |
| AT (1) | ATE306467T1 (https=) |
| DE (1) | DE60023132T2 (https=) |
| ES (1) | ES2250137T3 (https=) |
| SA (1) | SA99200395B1 (https=) |
| WO (1) | WO2000069802A1 (https=) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7189377B1 (en) | 1996-08-07 | 2007-03-13 | Bp Chemicals Limited | Apparatus for performing integrated process for reproduction of vinyl acetate and/or acetic acid using a fluidized bed |
| US6143921A (en) | 1999-05-14 | 2000-11-07 | Saudi Basic Industries Corporation | Method for producing vinyl acetate monomer from ethane or ethylene oxidation |
| US6258992B1 (en) * | 1999-09-17 | 2001-07-10 | Saudi Basic Industries Corporation | Gas phase catalytic oxidation of hydrocarbons to carboxylic acids and dehydrogenated products |
| EP1286945B2 (en) | 2000-05-19 | 2010-03-10 | Celanese International Corporation | Integrated process for the production of vinyl acetate |
| WO2002030569A1 (de) * | 2000-10-10 | 2002-04-18 | Basf Aktiengesellschaft | Verfahren zur herstellung eines ringförmigen schalenkatalysators und verwendung davon zur herstellung von acrolein |
| GB0026243D0 (en) * | 2000-10-26 | 2000-12-13 | Bp Chem Int Ltd | Process |
| GB0026241D0 (en) | 2000-10-26 | 2000-12-13 | Bp Chem Int Ltd | Process |
| US7425647B2 (en) * | 2001-03-30 | 2008-09-16 | Shell Oil Company | Process for preparing a group V111-metal containing catalyst, use thereof for preparing an alkenyl carboxylate |
| US6642173B2 (en) * | 2001-04-25 | 2003-11-04 | Rohm And Haas Company | Catalyst |
| TW574071B (en) * | 2001-06-14 | 2004-02-01 | Rohm & Haas | Mixed metal oxide catalyst |
| RU2184725C1 (ru) * | 2001-10-26 | 2002-07-10 | Государственное образовательное учреждение Воронежская государственная технологическая академия | Способ автоматического контроля и управления процессом получения винилацетата на основе этилена |
| GB0200021D0 (en) * | 2002-01-02 | 2002-02-13 | Bp Chem Int Ltd | Process |
| GB0205014D0 (en) * | 2002-03-04 | 2002-04-17 | Bp Chem Int Ltd | Process |
| GB0205016D0 (en) * | 2002-03-04 | 2002-04-17 | Bp Chem Int Ltd | Process |
| JP4421201B2 (ja) * | 2002-03-27 | 2010-02-24 | シエル・インターナシヨナル・リサーチ・マートスハツペイ・ベー・ヴエー | 触媒を調製する方法、触媒、および触媒の使用 |
| US7038082B2 (en) | 2002-10-17 | 2006-05-02 | Basf Aktiengesellschaft | Preparation of a multimetal oxide material |
| US7294734B2 (en) * | 2003-05-02 | 2007-11-13 | Velocys, Inc. | Process for converting a hydrocarbon to an oxygenate or a nitrile |
| US7220390B2 (en) | 2003-05-16 | 2007-05-22 | Velocys, Inc. | Microchannel with internal fin support for catalyst or sorption medium |
| GB0312965D0 (en) | 2003-06-05 | 2003-07-09 | Bp Chem Int Ltd | Process |
| TW201236755A (en) | 2003-12-19 | 2012-09-16 | Celanese Int Corp | Halide free precursors for catalysts |
| US7465823B2 (en) * | 2004-03-17 | 2008-12-16 | Celanese International Corporation | Utilization of acetic acid reaction heat in other process plants |
| ZA200704864B (en) * | 2004-12-20 | 2008-08-27 | Celanese Int Corp | Modified support materials for catalysts |
| US8227369B2 (en) * | 2005-05-25 | 2012-07-24 | Celanese International Corp. | Layered composition and processes for preparing and using the composition |
| BRPI0611208A2 (pt) * | 2005-06-01 | 2010-08-24 | Celanese Int Corp | processo para preparar etileno a partir de alimentaÇço gasosa que compreende etano e oxigÊnio e processo para oxidar etano para produzir etileno e Ácido acÉtico |
| DE102007025443A1 (de) | 2007-05-31 | 2008-12-04 | Süd-Chemie AG | Pd/Au-Schalenkatalysator enthaltend HfO2, Verfahren zu dessen Herstellung sowie dessen Verwendung |
| DE102007025442B4 (de) * | 2007-05-31 | 2023-03-02 | Clariant International Ltd. | Verwendung einer Vorrichtung zur Herstellung eines Schalenkatalysators und Schalenkatalysator |
| DE102007025444A1 (de) * | 2007-05-31 | 2008-12-11 | Süd-Chemie AG | VAM-Schalenkatalysator, Verfahren zu dessen Herstellung sowie dessen Verwendung |
| DE102007025315A1 (de) * | 2007-05-31 | 2008-12-11 | Süd-Chemie AG | Katalysator zur selektiven Hydrierung acetylenischer Kohlenwasserstoffe und Verfahren zu seiner Herstellung |
| DE102007025223A1 (de) * | 2007-05-31 | 2008-12-04 | Süd-Chemie AG | Zirkoniumoxid-dotierter VAM-Schalenkatalysator, Verfahren zu dessen Herstellung sowie dessen Verwendung |
| DE102007025362A1 (de) * | 2007-05-31 | 2008-12-11 | Süd-Chemie AG | Dotierter Pd/Au-Schalenkatalysator, Verfahren zu dessen Herstellung sowie dessen Verwendung |
| DE102008059341A1 (de) | 2008-11-30 | 2010-06-10 | Süd-Chemie AG | Katalysatorträger, Verfahren zu seiner Herstellung sowie Verwendung |
| US9676695B2 (en) | 2011-03-02 | 2017-06-13 | Aither Chemical LLC | Methods for integrated natural gas purification and products produced therefrom |
| DE102012205444A1 (de) | 2012-04-03 | 2013-10-10 | Wacker Chemie Ag | Verfahren zur Herstellung von Vinylacetat |
| AU2017384130B2 (en) | 2016-12-19 | 2020-03-05 | Shell Internationale Research Maatschappij B.V. | Ethane oxidative dehydrogenation with co-production of vinyl acetate |
| WO2018114747A1 (en) | 2016-12-19 | 2018-06-28 | Shell Internationale Research Maatschappij B.V. | Ethane oxidative dehydrogenation with co-production of vinyl acetate |
| WO2020058843A1 (en) * | 2018-09-17 | 2020-03-26 | Sabic Global Technologies B.V. | A selective oxidation catalyst and a method for oxidizing c2 hydrocarbons in the presence of the selective oxidation catalyst |
| WO2020194228A1 (en) * | 2019-03-26 | 2020-10-01 | Sabic Global Technologies B.V. | Method of reactivating catalyst |
| EP4059916A1 (de) | 2021-03-15 | 2022-09-21 | Linde GmbH | Verfahren und anlage zur erzeugung eines produktkohlenwasserstoffs |
| EP4116283A1 (de) | 2021-07-06 | 2023-01-11 | Linde GmbH | Verfahren und anlage zur herstellung von vinylacetat |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3190912A (en) * | 1962-05-02 | 1965-06-22 | Nat Distillers Chem Corp | Process for preparing esters |
| US3637819A (en) * | 1967-12-30 | 1972-01-25 | Knapsack Ag | Process for the manufacture of unsaturated esters of carboxylic acids |
| US3650896A (en) * | 1969-10-09 | 1972-03-21 | Atomic Energy Commission | Nuclear fuel particles |
| US3792087A (en) * | 1971-11-10 | 1974-02-12 | Nat Distillers Chem Corp | Vapor phase oxidation of ethylene to acetic acid |
| US3970697A (en) * | 1974-07-01 | 1976-07-20 | National Distillers And Chemical Corporation | Oxidation of ethylene to acetic acid |
| US4188490A (en) * | 1977-05-27 | 1980-02-12 | National Distillers And Chemical Corporation | Catalytic oxidation of ethylene to mixtures of acetic acid and vinyl acetate |
| DE2811115A1 (de) * | 1978-03-15 | 1979-09-27 | Hoechst Ag | Traeger-katalysator fuer die herstellung von vinylacetat aus ethylen, essigsaeure und sauerstoff in der gasphase |
| DE3803900A1 (de) * | 1988-02-09 | 1989-08-17 | Hoechst Ag | Verfahren zur herstellung von vinylacetat |
| US5185308A (en) * | 1991-05-06 | 1993-02-09 | Bp Chemicals Limited | Catalysts and processes for the manufacture of vinyl acetate |
| DE19630832A1 (de) | 1996-07-31 | 1998-02-05 | Hoechst Ag | Verfahren zur selektiven Herstellung von Essigsäure |
| GB9616573D0 (en) * | 1996-08-07 | 1996-09-25 | Bp Chem Int Ltd | Process |
| US7189377B1 (en) * | 1996-08-07 | 2007-03-13 | Bp Chemicals Limited | Apparatus for performing integrated process for reproduction of vinyl acetate and/or acetic acid using a fluidized bed |
| DE19717075A1 (de) | 1997-04-23 | 1998-10-29 | Hoechst Ag | Verfahren zur Herstellung von Essigsäure in einer Reaktorkaskade |
| US6013597A (en) | 1997-09-17 | 2000-01-11 | Saudi Basic Industries Corporation | Catalysts for the oxidation of ethane to acetic acid processes of making same and, processes of using same |
| DE19745902A1 (de) | 1997-10-17 | 1999-04-22 | Hoechst Ag | Verfahren zur selektiven Herstellung von Essigsäure durch katalytische Oxidation von Ethan |
| US6030920A (en) | 1997-12-24 | 2000-02-29 | Saudi Basic Industries Corporation | Catalysts for producing acetic acid from ethane oxidation, processes of making same and method of using same |
| US6028221A (en) | 1998-06-29 | 2000-02-22 | Saudi Basic Industries Corporation | Catalyst systems for the one step gas phase production of acetic acid from ethylene and methods of making and using the same |
| US6060421A (en) | 1998-12-23 | 2000-05-09 | Saudi Basic Industries Corporation | Catalysts for the oxidation of ethane to acetic acid, methods of making and using the same |
| US6143921A (en) | 1999-05-14 | 2000-11-07 | Saudi Basic Industries Corporation | Method for producing vinyl acetate monomer from ethane or ethylene oxidation |
-
1999
- 1999-05-14 US US09/312,683 patent/US6143921A/en not_active Ceased
- 1999-07-28 SA SA99200395A patent/SA99200395B1/ar unknown
-
2000
- 2000-05-09 DE DE60023132T patent/DE60023132T2/de not_active Expired - Lifetime
- 2000-05-09 KR KR1020017014540A patent/KR100609203B1/ko not_active Expired - Fee Related
- 2000-05-09 JP JP2000618222A patent/JP2002544250A/ja active Pending
- 2000-05-09 WO PCT/EP2000/004234 patent/WO2000069802A1/en not_active Ceased
- 2000-05-09 EP EP00936733A patent/EP1180092B1/en not_active Revoked
- 2000-05-09 AT AT00936733T patent/ATE306467T1/de not_active IP Right Cessation
- 2000-05-09 ES ES00936733T patent/ES2250137T3/es not_active Expired - Lifetime
- 2000-05-09 CN CNB008101868A patent/CN1188387C/zh not_active Expired - Fee Related
- 2000-05-09 US US10/031,808 patent/US6605739B1/en not_active Expired - Lifetime
-
2006
- 2006-02-08 US US11/363,148 patent/USRE43859E1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US6605739B1 (en) | 2003-08-12 |
| WO2000069802A9 (en) | 2001-11-29 |
| ES2250137T3 (es) | 2006-04-16 |
| DE60023132D1 (de) | 2006-02-23 |
| WO2000069802A1 (en) | 2000-11-23 |
| JP2002544250A (ja) | 2002-12-24 |
| KR100609203B1 (ko) | 2006-08-02 |
| CN1360565A (zh) | 2002-07-24 |
| EP1180092B1 (en) | 2005-10-12 |
| ATE306467T1 (de) | 2005-10-15 |
| US6143921A (en) | 2000-11-07 |
| DE60023132T2 (de) | 2006-06-29 |
| USRE43859E1 (en) | 2012-12-11 |
| EP1180092A1 (en) | 2002-02-20 |
| CN1188387C (zh) | 2005-02-09 |
| KR20020015689A (ko) | 2002-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SA99200395B1 (ar) | طريقة لانتاج احادي خلات الفينيل vinyl acetate monomer من خلال اكسدة oxidizaing الايثانethane او الاثيلينethylene | |
| US6143928A (en) | Catalysts for low temperature selective oxidation of propylene, methods of making and using the same | |
| US8212070B2 (en) | Method for preparing acrylic acid from glycerol | |
| EP2830758B1 (en) | Process for making ethylene and acetic acid | |
| CN101260034B (zh) | 一种将烷烃转化为不饱和羧酸的改进的方法 | |
| WO2017119966A1 (en) | Ethylbenzene production with ethylene from oxidative coupling of methane | |
| WO2000029105A1 (en) | Catalytic oxidation of alkanes to corresponding acids | |
| EP1989161B1 (en) | Integrated process for the production of acetic acid and vinyl acetate | |
| US20050245751A1 (en) | Integrated method for synthesis propylene oxide | |
| EP0891316B1 (en) | Processes for the manufacture of methylmercaptopropanal | |
| TW201012781A (en) | Two-stage, gas phase process for the manufacture of alkylene glycol | |
| US12071400B2 (en) | Process of selective oxidation of glycerol | |
| US6028221A (en) | Catalyst systems for the one step gas phase production of acetic acid from ethylene and methods of making and using the same | |
| JP2005513152A (ja) | アルケニルカルボキシレート製造の統合的方法 | |
| CA2640631A1 (en) | Use of chemical reaction to separate ethylene from ethane in ethane-based processes to produce acetic acid | |
| EP2768794B1 (en) | Method for preparing acrylic acid from propane and propylene | |
| Armbruster et al. | Heterogeneously catalysed partial oxidation of cyclohexane in supercritical carbon dioxide | |
| JP2024532448A (ja) | エタノールを用いたエタンodh生成物流からの酸素除去 | |
| EP4074408A1 (en) | Improved cycle gas process for preparation of ethylene oxide from ethanol | |
| Qi et al. | One-step catalytic oxidation of methanol to Dimethoxymethane: The effect of titanium dioxide on catalysis Performance, process conceptual design and evaluation | |
| Soliman et al. | Acetic Acid Production by Partial Oxidation of Ethane: Recent Developments and Economics | |
| JP2002537220A (ja) | エチレンからの酢酸の一段気相製造用触媒システム | |
| Dinse et al. | Reaction engineering of oxidation reactions | |
| EP3197598A1 (en) | Cobalt-based catalyst and methods related thereto | |
| SA99200361B1 (ar) | حفاز catalyst يعتمد على المولبيدنيوم molybdenum - الفاناديوم vanadium للأكسدة oxidationالانتقائية للبروبيلين propyleneعند درجة حرارة منخفضة ، طرق لتصنيعه واستخدامه |