PT77367B - Process for preparing leukotriene antagonists - Google Patents
Process for preparing leukotriene antagonists Download PDFInfo
- Publication number
- PT77367B PT77367B PT77367A PT7736783A PT77367B PT 77367 B PT77367 B PT 77367B PT 77367 A PT77367 A PT 77367A PT 7736783 A PT7736783 A PT 7736783A PT 77367 B PT77367 B PT 77367B
- Authority
- PT
- Portugal
- Prior art keywords
- hydroxy
- acetyl
- propylphenoxy
- gamma
- beta
- Prior art date
Links
- 239000003199 leukotriene receptor blocking agent Substances 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 271
- -1 C1-6 alkythio Chemical group 0.000 claims abstract description 175
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 58
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 34
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 16
- 229910052736 halogen Chemical group 0.000 claims abstract description 13
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 10
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 10
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 9
- 150000002367 halogens Chemical class 0.000 claims abstract description 8
- 125000002950 monocyclic group Chemical group 0.000 claims abstract description 8
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 7
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 6
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 5
- 150000003462 sulfoxides Chemical class 0.000 claims abstract description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 4
- 150000002617 leukotrienes Chemical class 0.000 claims abstract description 4
- 150000003457 sulfones Chemical class 0.000 claims abstract description 4
- 239000011593 sulfur Substances 0.000 claims abstract description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 3
- 230000002378 acidificating effect Effects 0.000 claims abstract description 3
- 125000002252 acyl group Chemical group 0.000 claims abstract description 3
- 125000004429 atom Chemical group 0.000 claims abstract description 3
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000003937 drug carrier Substances 0.000 claims abstract description 3
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 3
- 150000003536 tetrazoles Chemical class 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims abstract 2
- 239000002253 acid Substances 0.000 claims description 95
- 238000002360 preparation method Methods 0.000 claims description 84
- 238000000034 method Methods 0.000 claims description 83
- 150000002596 lactones Chemical class 0.000 claims description 39
- 230000008569 process Effects 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 159000000000 sodium salts Chemical class 0.000 claims description 9
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 claims description 8
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 8
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 4
- UNHYSJDWSGETTI-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-2-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C(F)=C1 UNHYSJDWSGETTI-UHFFFAOYSA-N 0.000 claims description 3
- AMUGZLWRHPCZJU-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1 AMUGZLWRHPCZJU-UHFFFAOYSA-N 0.000 claims description 3
- OLSIBARBMSAVNM-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]-3-propylphenyl]-4-oxobutanoic acid Chemical compound CCCC1=CC(C(=O)CCC(O)=O)=CC=C1S(=O)(=O)CCCOC1=CC=C(C(C)=O)C(O)=C1CCC OLSIBARBMSAVNM-UHFFFAOYSA-N 0.000 claims description 3
- 241000124008 Mammalia Species 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 125000004001 thioalkyl group Chemical group 0.000 claims description 3
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 claims description 2
- BAHJYSJQTFWVBK-UHFFFAOYSA-N 4-[2-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=C(F)C=CC=C1C(=O)CCC(O)=O BAHJYSJQTFWVBK-UHFFFAOYSA-N 0.000 claims description 2
- UWSWHNPCOXVTIB-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfanyl-2-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(O)CSC1=CC=C(C(=O)CCC(O)=O)C(F)=C1 UWSWHNPCOXVTIB-UHFFFAOYSA-N 0.000 claims description 2
- MJWMWZFELIIXTM-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfonyl-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(O)CS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1F MJWMWZFELIIXTM-UHFFFAOYSA-N 0.000 claims description 2
- YHROAZOSIWWEAF-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2,3-dichlorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C(Cl)=C1Cl YHROAZOSIWWEAF-UHFFFAOYSA-N 0.000 claims description 2
- XFRWXILXSBRRHM-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C(F)=C1 XFRWXILXSBRRHM-UHFFFAOYSA-N 0.000 claims description 2
- PBLQOVWNNHCABT-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-chlorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C=C1Cl PBLQOVWNNHCABT-UHFFFAOYSA-N 0.000 claims description 2
- YYHGNOXRCMENKZ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C=C1F YYHGNOXRCMENKZ-UHFFFAOYSA-N 0.000 claims description 2
- NQIXRWYUAFVRLD-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-methylphenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C=C1C NQIXRWYUAFVRLD-UHFFFAOYSA-N 0.000 claims description 2
- ADEDDGIQPCEJFG-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-2,2-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CC(C)(C)C(O)=O)C=C1 ADEDDGIQPCEJFG-UHFFFAOYSA-N 0.000 claims description 2
- JFABZGKGYKQRTP-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-3-methyl-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCOC1=CC=C(C(=O)C(C)CC(O)=O)C=C1 JFABZGKGYKQRTP-UHFFFAOYSA-N 0.000 claims description 2
- HEYIEJISYCVGPG-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1F HEYIEJISYCVGPG-UHFFFAOYSA-N 0.000 claims description 2
- GYDFMAMTFPETLY-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1F GYDFMAMTFPETLY-UHFFFAOYSA-N 0.000 claims description 2
- ALWPHBKAXZJGKI-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-chloro-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(Cl)=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1 ALWPHBKAXZJGKI-UHFFFAOYSA-N 0.000 claims description 2
- YCNNUIVTVCRQRQ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-fluoro-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(F)=C1OCCCOC1=CC=C(C(O)C(C)(C)CC(O)=O)C=C1 YCNNUIVTVCRQRQ-UHFFFAOYSA-N 0.000 claims description 2
- HKISFZRKKJUZLU-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-fluoro-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(F)=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1 HKISFZRKKJUZLU-UHFFFAOYSA-N 0.000 claims description 2
- HLFMZKCMELQARE-UHFFFAOYSA-N 4-[4-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)but-2-enoxy]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC=CCOC1=CC=C(C(=O)CCC(O)=O)C=C1F HLFMZKCMELQARE-UHFFFAOYSA-N 0.000 claims description 2
- JTYGEEYCQCXXAV-UHFFFAOYSA-M O.[Na+].C(C)(=O)C1=C(C(=C(OCC(COC2=C(C=C(C=C2)C(CCC(=O)[O-])=O)F)O)C=C1)CCC)O Chemical compound O.[Na+].C(C)(=O)C1=C(C(=C(OCC(COC2=C(C=C(C=C2)C(CCC(=O)[O-])=O)F)O)C=C1)CCC)O JTYGEEYCQCXXAV-UHFFFAOYSA-M 0.000 claims description 2
- 125000002015 acyclic group Chemical group 0.000 claims description 2
- 230000003042 antagnostic effect Effects 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims 2
- 230000005494 condensation Effects 0.000 claims 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims 2
- 229940084388 gammar Drugs 0.000 claims 2
- LDMFITQBHOPZHQ-UHFFFAOYSA-N 1-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-hydroxybutan-1-one Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCCO)C=C1 LDMFITQBHOPZHQ-UHFFFAOYSA-N 0.000 claims 1
- HBCHCAWEAHGZNQ-UHFFFAOYSA-N 4-[3-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=CC(C(=O)C(C)(C)CC(O)=O)=C1 HBCHCAWEAHGZNQ-UHFFFAOYSA-N 0.000 claims 1
- JQCOFSLLPSVPBJ-UHFFFAOYSA-N 4-[3-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=CC(C(=O)C(C)(C)CC(O)=O)=C1 JQCOFSLLPSVPBJ-UHFFFAOYSA-N 0.000 claims 1
- RNQKOGRFVUPYEJ-UHFFFAOYSA-N 4-[4-[2-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]prop-2-enoxy]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(=C)COC1=CC=C(C(=O)CCC(O)=O)C=C1F RNQKOGRFVUPYEJ-UHFFFAOYSA-N 0.000 claims 1
- GTJVGMMCOKVQGU-UHFFFAOYSA-N 4-[4-[2-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]prop-2-enylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(=C)CSC1=CC=C(C(=O)CCC(O)=O)C=C1 GTJVGMMCOKVQGU-UHFFFAOYSA-N 0.000 claims 1
- GELLENARZRGRMD-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-acetyloxy-2-propylphenoxy)propylsulfonyl]phenyl]-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(OC(C)=O)C(CCC)=C1OCCCS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1 GELLENARZRGRMD-UHFFFAOYSA-N 0.000 claims 1
- NFPSDVWNIUHHEZ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfonyl-2-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(O)CS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C(F)=C1 NFPSDVWNIUHHEZ-UHFFFAOYSA-N 0.000 claims 1
- OSCMCMCSUTZSPM-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfonylphenyl]-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)CS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1 OSCMCMCSUTZSPM-UHFFFAOYSA-N 0.000 claims 1
- AYCZZKXTWKEZDY-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-chlorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C(Cl)=C1 AYCZZKXTWKEZDY-UHFFFAOYSA-N 0.000 claims 1
- RNMUHZPCLGLOTL-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-bromophenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)C(C)(C)CC(O)=O)C=C1Br RNMUHZPCLGLOTL-UHFFFAOYSA-N 0.000 claims 1
- WKPYGLGIHMYYIS-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-propylphenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=CC(C(=O)C(C)(C)CC(O)=O)=CC=C1OCCCOC1=CC=C(C(C)=O)C(O)=C1CCC WKPYGLGIHMYYIS-UHFFFAOYSA-N 0.000 claims 1
- AWSADCRNHSUEMT-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCOC1=CC=C(C(O)C(C)(C)CC(O)=O)C=C1 AWSADCRNHSUEMT-UHFFFAOYSA-N 0.000 claims 1
- LNGWVDTZAWPYQU-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)C(C)(C)CC(O)=O)C=C1F LNGWVDTZAWPYQU-UHFFFAOYSA-N 0.000 claims 1
- ZHGGTMGOUFOFSI-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(O)C(C)(C)CC(O)=O)C=C1F ZHGGTMGOUFOFSI-UHFFFAOYSA-N 0.000 claims 1
- ZWCDJYCFCBIKPR-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-propylphenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound CCCC1=CC(C(O)C(C)(C)CC(O)=O)=CC=C1SCCCOC1=CC=C(C(C)=O)C(O)=C1CCC ZWCDJYCFCBIKPR-UHFFFAOYSA-N 0.000 claims 1
- QCKZVTHRYSFVFF-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-propylphenyl]-4-oxobutanoic acid Chemical compound CCCC1=CC(C(=O)CCC(O)=O)=CC=C1SCCCOC1=CC=C(C(C)=O)C(O)=C1CCC QCKZVTHRYSFVFF-UHFFFAOYSA-N 0.000 claims 1
- LMBDCXGLLVVBLT-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)C(C)(C)CC(O)=O)C=C1 LMBDCXGLLVVBLT-UHFFFAOYSA-N 0.000 claims 1
- YNHQJUJPBNEXHQ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-hydroxy-3-methylbutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCSC1=CC=C(C(O)C(C)CC(O)=O)C=C1 YNHQJUJPBNEXHQ-UHFFFAOYSA-N 0.000 claims 1
- JHIMCJHFCFXSTF-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-oxobutanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCC#N)C=C1 JHIMCJHFCFXSTF-UHFFFAOYSA-N 0.000 claims 1
- NCAQWQHBWKKCJB-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-n-methylsulfonyl-4-oxobutanamide Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCC(=O)NS(C)(=O)=O)C=C1 NCAQWQHBWKKCJB-UHFFFAOYSA-N 0.000 claims 1
- SGDMHGYVVOYUIC-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCS(=O)(=O)C1=CC=C(C(=O)C(C)(C)CC(O)=O)C=C1 SGDMHGYVVOYUIC-UHFFFAOYSA-N 0.000 claims 1
- NFUQSLYHMGKZNN-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-4-oxobutanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCS(=O)(=O)C1=CC=C(C(=O)CCC#N)C=C1 NFUQSLYHMGKZNN-UHFFFAOYSA-N 0.000 claims 1
- OFJAABUKTKNXTI-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropoxy]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1SCCCOC1=CC=C(C(=O)CCC(O)=O)C=C1F OFJAABUKTKNXTI-UHFFFAOYSA-N 0.000 claims 1
- FGKLRVVOYVASOT-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1SCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1 FGKLRVVOYVASOT-UHFFFAOYSA-N 0.000 claims 1
- FSDGNNWERULNJY-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropylsulfonyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1SCCCS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1 FSDGNNWERULNJY-UHFFFAOYSA-N 0.000 claims 1
- VGQAJDAZNXMJKQ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfonylpropoxy]-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1S(=O)(=O)CCCOC1=CC=C(C(=O)CCC(O)=O)C=C1F VGQAJDAZNXMJKQ-UHFFFAOYSA-N 0.000 claims 1
- ORIUOSIYKVMQKG-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-6-methyl-2-propylphenoxy)propylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(C)=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1 ORIUOSIYKVMQKG-UHFFFAOYSA-N 0.000 claims 1
- NGYKWLMLDWXZOZ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-bromo-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(Br)=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C=C1 NGYKWLMLDWXZOZ-UHFFFAOYSA-N 0.000 claims 1
- PPHGPDDVPLDIRW-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-bromo-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(Br)=C1OCCCS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1 PPHGPDDVPLDIRW-UHFFFAOYSA-N 0.000 claims 1
- IJJBWKVISPQRRY-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-chloro-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(Cl)=C1OCCCS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1 IJJBWKVISPQRRY-UHFFFAOYSA-N 0.000 claims 1
- IQOYDWPFKLSGIR-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-fluoro-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(F)=C1OCCCSC1=CC=C(C(O)C(C)(C)CC(O)=O)C=C1 IQOYDWPFKLSGIR-UHFFFAOYSA-N 0.000 claims 1
- KPQOOCVEKWNQOR-UHFFFAOYSA-N 5-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-3H-furan-2-one Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCS(=O)(=O)C1=CC=C(C=2OC(=O)CC=2)C=C1 KPQOOCVEKWNQOR-UHFFFAOYSA-N 0.000 claims 1
- DSQNRMKIVXUXKC-UHFFFAOYSA-N 6-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-fluorophenyl]-4-oxohexanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(CCC(=O)CCC(O)=O)C=C1F DSQNRMKIVXUXKC-UHFFFAOYSA-N 0.000 claims 1
- UMXGAMFWVVRONR-UHFFFAOYSA-N 6-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-6-oxohexanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCCCC(O)=O)C=C1 UMXGAMFWVVRONR-UHFFFAOYSA-N 0.000 claims 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 125000002619 bicyclic group Chemical group 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- ZTZNKZNWCPWOCE-UHFFFAOYSA-M sodium;4-[3-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]phenyl]-4-hydroxy-3,3-dimethylbutanoate Chemical compound [Na+].CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=CC(C(O)C(C)(C)CC([O-])=O)=C1 ZTZNKZNWCPWOCE-UHFFFAOYSA-M 0.000 claims 1
- WBCUDBPGVFFNHC-UHFFFAOYSA-M sodium;4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-4-hydroxy-3,3-dimethylbutanoate Chemical compound [Na+].CCCC1=C(O)C(C(C)=O)=CC=C1OCCCS(=O)(=O)C1=CC=C(C(O)C(C)(C)CC([O-])=O)C=C1 WBCUDBPGVFFNHC-UHFFFAOYSA-M 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract description 5
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 abstract description 2
- 239000005557 antagonist Substances 0.000 abstract description 2
- 125000002618 bicyclic heterocycle group Chemical group 0.000 abstract description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 6
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 238000006467 substitution reaction Methods 0.000 abstract 2
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 abstract 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 1
- 206010002198 Anaphylactic reaction Diseases 0.000 abstract 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 abstract 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 abstract 1
- 230000036783 anaphylactic response Effects 0.000 abstract 1
- 208000003455 anaphylaxis Diseases 0.000 abstract 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 114
- 239000000203 mixture Substances 0.000 description 113
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 90
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 87
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 68
- 239000000243 solution Substances 0.000 description 65
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- 239000011541 reaction mixture Substances 0.000 description 59
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 39
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- 150000002148 esters Chemical class 0.000 description 34
- 239000012267 brine Substances 0.000 description 33
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 33
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 32
- 235000019439 ethyl acetate Nutrition 0.000 description 31
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 239000007787 solid Substances 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- 239000000284 extract Substances 0.000 description 21
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Natural products CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 20
- 239000011734 sodium Substances 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 18
- 238000004587 chromatography analysis Methods 0.000 description 16
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 15
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 238000010898 silica gel chromatography Methods 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 12
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 12
- 229910004809 Na2 SO4 Inorganic materials 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 9
- 238000007127 saponification reaction Methods 0.000 description 9
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 239000012298 atmosphere Substances 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 210000003437 trachea Anatomy 0.000 description 8
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 7
- 150000004702 methyl esters Chemical class 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000003039 volatile agent Substances 0.000 description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 5
- 239000000920 calcium hydroxide Substances 0.000 description 5
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000651 prodrug Substances 0.000 description 5
- 229940002612 prodrug Drugs 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- 229940014800 succinic anhydride Drugs 0.000 description 5
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- HFEASCCDHUVYKU-UHFFFAOYSA-N 1,2-dichloro-3-methoxybenzene Chemical group COC1=CC=CC(Cl)=C1Cl HFEASCCDHUVYKU-UHFFFAOYSA-N 0.000 description 4
- QGGRBWUQXAFYEC-UHFFFAOYSA-N 1-(2,4-dihydroxy-3-propylphenyl)ethanone Chemical compound CCCC1=C(O)C=CC(C(C)=O)=C1O QGGRBWUQXAFYEC-UHFFFAOYSA-N 0.000 description 4
- OMTDIBZSUZNVJK-UHFFFAOYSA-N 4-(4-methoxyphenyl)-4-oxobutanoic acid Chemical compound COC1=CC=C(C(=O)CCC(O)=O)C=C1 OMTDIBZSUZNVJK-UHFFFAOYSA-N 0.000 description 4
- 241000700198 Cavia Species 0.000 description 4
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- ZVWCLYJTJQFOEZ-UHFFFAOYSA-N methyl 4-(3-fluoro-4-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(O)C(F)=C1 ZVWCLYJTJQFOEZ-UHFFFAOYSA-N 0.000 description 4
- NXDRSDPPZCVYBX-UHFFFAOYSA-N methyl 4-oxo-4-(4-sulfanylphenyl)butanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(S)C=C1 NXDRSDPPZCVYBX-UHFFFAOYSA-N 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 210000002966 serum Anatomy 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 3
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 3
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 3
- XJFZOSUFGSANIF-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)prop-1-ene Chemical compound ClCC(=C)CCl XJFZOSUFGSANIF-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000001261 hydroxy acids Chemical class 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- PVDDSSCYJCLGOD-UHFFFAOYSA-N methyl 4-(4-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(O)C=C1 PVDDSSCYJCLGOD-UHFFFAOYSA-N 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- JIXDOBAQOWOUPA-UHFFFAOYSA-N 1-fluoro-2-methoxybenzene Chemical compound COC1=CC=CC=C1F JIXDOBAQOWOUPA-UHFFFAOYSA-N 0.000 description 2
- DTFKRVXLBCAIOZ-UHFFFAOYSA-N 2-methylanisole Chemical group COC1=CC=CC=C1C DTFKRVXLBCAIOZ-UHFFFAOYSA-N 0.000 description 2
- SMFBODMWKWBFOK-UHFFFAOYSA-N 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one Chemical compound [O-][N+](=O)C1=CC=CC(C=CC(=O)C=2C=CC=CC=2)=C1 SMFBODMWKWBFOK-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- HPSBBRRZOMSMMY-UHFFFAOYSA-N 3-methyl-4-(4-methylsulfanylphenyl)-4-oxobutanoic acid Chemical compound CSC1=CC=C(C(=O)C(C)CC(O)=O)C=C1 HPSBBRRZOMSMMY-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- VVKJHSZNBWZTAS-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfanyl-2-methoxyphenyl]-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)CSC1=CC=C(C(=O)CCC(O)=O)C(OC)=C1 VVKJHSZNBWZTAS-UHFFFAOYSA-N 0.000 description 2
- QJIQAZQDUVUQCF-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfanyl-3-fluorophenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(O)CSC1=CC=C(C(=O)CCC(O)=O)C=C1F QJIQAZQDUVUQCF-UHFFFAOYSA-N 0.000 description 2
- GHCZBPNCHLQEBT-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-methylpropoxy]phenyl]-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(C)COC1=CC=C(C(=O)CCC(O)=O)C=C1 GHCZBPNCHLQEBT-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- DCOKMRYMESLCSI-UHFFFAOYSA-N 6-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-fluorophenyl]-6-oxohexanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCCCC(O)=O)C=C1F DCOKMRYMESLCSI-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- 206010006482 Bronchospasm Diseases 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 230000007885 bronchoconstriction Effects 0.000 description 2
- 239000001273 butane Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- XKUKSGPZAADMRA-UHFFFAOYSA-N glycyl-glycyl-glycine Chemical compound NCC(=O)NCC(=O)NCC(O)=O XKUKSGPZAADMRA-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229940046892 lead acetate Drugs 0.000 description 2
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 2
- DMLVPFUVUAIKLY-UHFFFAOYSA-N methyl 4-[4-(dimethylcarbamothioyloxy)phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(OC(=S)N(C)C)C=C1 DMLVPFUVUAIKLY-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 230000029058 respiratory gaseous exchange Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- ATWLRNODAYAMQS-UHFFFAOYSA-N 1,1-dibromopropane Chemical compound CCC(Br)Br ATWLRNODAYAMQS-UHFFFAOYSA-N 0.000 description 1
- GTQHJCOHNAFHRE-UHFFFAOYSA-N 1,10-dibromodecane Chemical compound BrCCCCCCCCCCBr GTQHJCOHNAFHRE-UHFFFAOYSA-N 0.000 description 1
- ZJJATABWMGVVRZ-UHFFFAOYSA-N 1,12-dibromododecane Chemical compound BrCCCCCCCCCCCCBr ZJJATABWMGVVRZ-UHFFFAOYSA-N 0.000 description 1
- UXAFLFGXSIWWMY-UHFFFAOYSA-N 1,3-dibromo-2,2-dimethylpropane Chemical compound BrCC(C)(C)CBr UXAFLFGXSIWWMY-UHFFFAOYSA-N 0.000 description 1
- SMGXHVWYXQYMNN-UHFFFAOYSA-N 1,3-dibromo-2-methylpropane Chemical compound BrCC(C)CBr SMGXHVWYXQYMNN-UHFFFAOYSA-N 0.000 description 1
- XZNGUVQDFJHPLU-UHFFFAOYSA-N 1,3-dibromobutane Chemical compound CC(Br)CCBr XZNGUVQDFJHPLU-UHFFFAOYSA-N 0.000 description 1
- QMDIZIDCORWBJK-UHFFFAOYSA-N 1,3-dichloro-2-(1,3-dichloropropan-2-yloxy)propane Chemical compound ClCC(CCl)OC(CCl)CCl QMDIZIDCORWBJK-UHFFFAOYSA-N 0.000 description 1
- VENSUTAUIFXSRD-UHFFFAOYSA-N 1,3-dichloro-2-methylpropane Chemical group ClCC(C)CCl VENSUTAUIFXSRD-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- SGRHVVLXEBNBDV-UHFFFAOYSA-N 1,6-dibromohexane Chemical compound BrCCCCCCBr SGRHVVLXEBNBDV-UHFFFAOYSA-N 0.000 description 1
- LVWSZGCVEZRFBT-UHFFFAOYSA-N 1,7-dibromoheptane Chemical compound BrCCCCCCCBr LVWSZGCVEZRFBT-UHFFFAOYSA-N 0.000 description 1
- DKEGCUDAFWNSSO-UHFFFAOYSA-N 1,8-dibromooctane Chemical compound BrCCCCCCCCBr DKEGCUDAFWNSSO-UHFFFAOYSA-N 0.000 description 1
- WGAXVZXBFBHLMC-UHFFFAOYSA-N 1,9-dibromononane Chemical compound BrCCCCCCCCCBr WGAXVZXBFBHLMC-UHFFFAOYSA-N 0.000 description 1
- FTJGECIARDVRJC-UHFFFAOYSA-N 1-(4-methylsulfanylphenyl)propan-1-one Chemical compound CCC(=O)C1=CC=C(SC)C=C1 FTJGECIARDVRJC-UHFFFAOYSA-N 0.000 description 1
- GMCUFZZWMZKWAC-UHFFFAOYSA-N 1-[4-(3-bromopropylsulfanyl)phenyl]-4-hydroxybutan-1-one Chemical compound OCCCC(=O)C1=CC=C(SCCCBr)C=C1 GMCUFZZWMZKWAC-UHFFFAOYSA-N 0.000 description 1
- ZJSZQQZMRFINAL-UHFFFAOYSA-N 1-[4-(3-bromopropylsulfanyl)phenyl]butane-1,4-diol Chemical compound OCCCC(O)C1=CC=C(SCCCBr)C=C1 ZJSZQQZMRFINAL-UHFFFAOYSA-N 0.000 description 1
- YUKILTJWFRTXGB-UHFFFAOYSA-N 1-chloro-3-methoxybenzene Chemical group COC1=CC=CC(Cl)=C1 YUKILTJWFRTXGB-UHFFFAOYSA-N 0.000 description 1
- MFJNOXOAIFNSBX-UHFFFAOYSA-N 1-fluoro-3-methoxybenzene Chemical group COC1=CC=CC(F)=C1 MFJNOXOAIFNSBX-UHFFFAOYSA-N 0.000 description 1
- RQUBLQRVLBWBLZ-UHFFFAOYSA-N 1-methoxy-2-propylbenzene Chemical group CCCC1=CC=CC=C1OC RQUBLQRVLBWBLZ-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- DUJLSOHRNWNABD-UHFFFAOYSA-N 3-(3-methoxyphenyl)sulfanyl-3-(3-nitrophenyl)-1-phenylpropan-1-one Chemical compound COC1=CC=CC(SC(CC(=O)C=2C=CC=CC=2)C=2C=C(C=CC=2)[N+]([O-])=O)=C1 DUJLSOHRNWNABD-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- QKGLUZCZUKTKCC-UHFFFAOYSA-N 3-bromopropylsulfanylbenzene Chemical compound BrCCCSC1=CC=CC=C1 QKGLUZCZUKTKCC-UHFFFAOYSA-N 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- BOWPOXMMFQIBQW-UHFFFAOYSA-N 4-(2,3-dichloro-4-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(O)C(Cl)=C1Cl BOWPOXMMFQIBQW-UHFFFAOYSA-N 0.000 description 1
- ZTGIHSPNBGGQOI-UHFFFAOYSA-N 4-(2,3-dimethylphenyl)butanoic acid Chemical compound CC1=CC=CC(CCCC(O)=O)=C1C ZTGIHSPNBGGQOI-UHFFFAOYSA-N 0.000 description 1
- JGMLVCAXEIUFBW-UHFFFAOYSA-N 4-(2-methoxy-4-sulfanylphenyl)-4-oxobutanoic acid Chemical compound COC1=CC(S)=CC=C1C(=O)CCC(O)=O JGMLVCAXEIUFBW-UHFFFAOYSA-N 0.000 description 1
- HLIAREKHQFODGA-UHFFFAOYSA-N 4-(4-methoxyphenyl)-3-methyl-4-oxobutanoic acid Chemical compound COC1=CC=C(C(=O)C(C)CC(O)=O)C=C1 HLIAREKHQFODGA-UHFFFAOYSA-N 0.000 description 1
- BIPGDLXONOPNHH-UHFFFAOYSA-N 4-(4-methylsulfanylphenyl)-4-oxobutanenitrile Chemical compound CSC1=CC=C(C(=O)CCC#N)C=C1 BIPGDLXONOPNHH-UHFFFAOYSA-N 0.000 description 1
- PBGAQNBHGWSYHY-UHFFFAOYSA-N 4-[4-(3-bromopropylsulfanyl)phenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound OC(=O)CC(C)(C)C(O)C1=CC=C(SCCCBr)C=C1 PBGAQNBHGWSYHY-UHFFFAOYSA-N 0.000 description 1
- CNNVXNCDEHBYQQ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfanyl-2-hydroxyphenyl]-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)CSC1=CC=C(C(=O)CCC(O)=O)C(O)=C1 CNNVXNCDEHBYQQ-UHFFFAOYSA-N 0.000 description 1
- IASYPKXTPFGCOP-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfanylphenyl]-4-oxobutanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)CSC1=CC=C(C(=O)CCC(O)=O)C=C1 IASYPKXTPFGCOP-UHFFFAOYSA-N 0.000 description 1
- MTXAWTKUKDJSFL-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-3,3-dimethyl-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)C(C)(C)CC(O)=O)C=C1 MTXAWTKUKDJSFL-UHFFFAOYSA-N 0.000 description 1
- BLSHQCBWUWPDDJ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC(O)=O)C=C1 BLSHQCBWUWPDDJ-UHFFFAOYSA-N 0.000 description 1
- QHKNHNZJOXJSCQ-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-2-hydroxyphenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC1=CC=C(C(=O)CCC(O)=O)C(O)=C1 QHKNHNZJOXJSCQ-UHFFFAOYSA-N 0.000 description 1
- ZAKKEARLDPTRLX-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfonyl]phenyl]-4-oxobutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCS(=O)(=O)C1=CC=C(C(=O)CCC(O)=O)C=C1 ZAKKEARLDPTRLX-UHFFFAOYSA-N 0.000 description 1
- SXEIGTRAWBUCBE-UHFFFAOYSA-N 4-[4-[3-(4-acetyl-6-chloro-3-hydroxy-2-propylphenoxy)propoxy]phenyl]-4-hydroxy-3,3-dimethylbutanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC(Cl)=C1OCCCOC1=CC=C(C(O)C(C)(C)CC(O)=O)C=C1 SXEIGTRAWBUCBE-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- PIMQQGJMDMAZGT-UHFFFAOYSA-N 4-methylthiobenzaldehyde Chemical compound CC1=CC=C(C=S)C=C1 PIMQQGJMDMAZGT-UHFFFAOYSA-N 0.000 description 1
- BCRKSUPBHILNFK-UHFFFAOYSA-N 4-oxo-4-(4-sulfanylphenyl)butanenitrile Chemical compound SC1=CC=C(C(=O)CCC#N)C=C1 BCRKSUPBHILNFK-UHFFFAOYSA-N 0.000 description 1
- NRJOGXQAYPTPJI-UHFFFAOYSA-N 4-oxo-4-(4-sulfanylphenyl)butanoic acid Chemical group OC(=O)CCC(=O)C1=CC=C(S)C=C1 NRJOGXQAYPTPJI-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- SCXJQBHZLHNPGA-UHFFFAOYSA-N 6-[2-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3-fluorophenyl]-6-oxohexanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCOC1=C(F)C=CC=C1C(=O)CCCCC(O)=O SCXJQBHZLHNPGA-UHFFFAOYSA-N 0.000 description 1
- NFLLKCVHYJRNRH-UHFFFAOYSA-N 8-chloro-1,3-dimethyl-7H-purine-2,6-dione 2-(diphenylmethyl)oxy-N,N-dimethylethanamine Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC(Cl)=N2.C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 NFLLKCVHYJRNRH-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229910016467 AlCl 4 Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- 206010006458 Bronchitis chronic Diseases 0.000 description 1
- XARPPACBJGCZBT-UHFFFAOYSA-N COC(C)C(C(O)=O)c1ccccc1 Chemical compound COC(C)C(C(O)=O)c1ccccc1 XARPPACBJGCZBT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- PWWVAXIEGOYWEE-UHFFFAOYSA-N Isophenergan Chemical compound C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 PWWVAXIEGOYWEE-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- MLLZRNLNEPZHOV-UHFFFAOYSA-N OC1=C(C=C(C=C1)C(CCC(=O)OC)=O)C Chemical compound OC1=C(C=C(C=C1)C(CCC(=O)OC)=O)C MLLZRNLNEPZHOV-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 101100027924 Petunia hybrida ODO1 gene Proteins 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- YTAHJIFKAKIKAV-XNMGPUDCSA-N [(1R)-3-morpholin-4-yl-1-phenylpropyl] N-[(3S)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamate Chemical compound O=C1[C@H](N=C(C2=C(N1)C=CC=C2)C1=CC=CC=C1)NC(O[C@H](CCN1CCOCC1)C1=CC=CC=C1)=O YTAHJIFKAKIKAV-XNMGPUDCSA-N 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- AWYXCKFKLYAERZ-UHFFFAOYSA-N [4-(3-cyanopropanoyl)phenyl]sulfanylmethyl 2,2,2-trifluoroacetate Chemical compound FC(F)(F)C(=O)OCSC1=CC=C(C(=O)CCC#N)C=C1 AWYXCKFKLYAERZ-UHFFFAOYSA-N 0.000 description 1
- PHENPABYBHPABM-UHFFFAOYSA-N acetic acid;octane Chemical compound CC(O)=O.CCCCCCCC PHENPABYBHPABM-UHFFFAOYSA-N 0.000 description 1
- KQNKJJBFUFKYFX-UHFFFAOYSA-N acetic acid;trihydrate Chemical compound O.O.O.CC(O)=O KQNKJJBFUFKYFX-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000001088 anti-asthma Effects 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 239000000924 antiasthmatic agent Substances 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 229940088007 benadryl Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- LQHZJDPVVDQIFQ-UHFFFAOYSA-M cesium;chloride;hydrate Chemical compound O.[Cl-].[Cs+] LQHZJDPVVDQIFQ-UHFFFAOYSA-M 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 238000011210 chromatographic step Methods 0.000 description 1
- 208000007451 chronic bronchitis Diseases 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- ZTHNOZQGTXKVNZ-UHFFFAOYSA-L dichloroaluminum Chemical compound Cl[Al]Cl ZTHNOZQGTXKVNZ-UHFFFAOYSA-L 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- HUPFGZXOMWLGNK-UHFFFAOYSA-N diflunisal Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C(=CC(F)=CC=2)F)=C1 HUPFGZXOMWLGNK-UHFFFAOYSA-N 0.000 description 1
- 229960000616 diflunisal Drugs 0.000 description 1
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 150000004252 dithioacetals Chemical class 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229940099182 dramamine Drugs 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- ZPAKPRAICRBAOD-UHFFFAOYSA-N fenbufen Chemical compound C1=CC(C(=O)CCC(=O)O)=CC=C1C1=CC=CC=C1 ZPAKPRAICRBAOD-UHFFFAOYSA-N 0.000 description 1
- 229960001395 fenbufen Drugs 0.000 description 1
- 125000000457 gamma-lactone group Chemical group 0.000 description 1
- 108010067216 glycyl-glycyl-glycine Proteins 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- HNJJXZKZRAWDPF-UHFFFAOYSA-N methapyrilene Chemical group C=1C=CC=NC=1N(CCN(C)C)CC1=CC=CS1 HNJJXZKZRAWDPF-UHFFFAOYSA-N 0.000 description 1
- QOECNVQCOVUOGO-UHFFFAOYSA-N methyl 4-(2-methoxy-4-sulfanylphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(S)C=C1OC QOECNVQCOVUOGO-UHFFFAOYSA-N 0.000 description 1
- LCPXCENJLOEIBX-UHFFFAOYSA-N methyl 4-(4-methoxyphenyl)-2,2-dimethyl-4-oxobutanoate Chemical compound COC(=O)C(C)(C)CC(=O)C1=CC=C(OC)C=C1 LCPXCENJLOEIBX-UHFFFAOYSA-N 0.000 description 1
- HOANBPILMOMINR-UHFFFAOYSA-N methyl 4-(4-methoxyphenyl)-3,3-dimethyl-4-oxobutanoate Chemical compound COC(=O)CC(C)(C)C(=O)C1=CC=C(OC)C=C1 HOANBPILMOMINR-UHFFFAOYSA-N 0.000 description 1
- GYQYFDCZPHPZLT-UHFFFAOYSA-N methyl 4-(4-methoxyphenyl)-3-methyl-4-oxobutanoate Chemical compound COC(=O)CC(C)C(=O)C1=CC=C(OC)C=C1 GYQYFDCZPHPZLT-UHFFFAOYSA-N 0.000 description 1
- VMGCRNNKDBFNLI-UHFFFAOYSA-N methyl 4-(4-methoxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(OC)C=C1 VMGCRNNKDBFNLI-UHFFFAOYSA-N 0.000 description 1
- GYTORKRCOBXRMT-UHFFFAOYSA-N methyl 4-[4-(3-bromopropoxy)phenyl]-3-methyl-4-oxobutanoate Chemical compound COC(=O)CC(C)C(=O)C1=CC=C(OCCCBr)C=C1 GYTORKRCOBXRMT-UHFFFAOYSA-N 0.000 description 1
- FRFGVDBMGQXPGM-UHFFFAOYSA-N methyl 4-[4-(dimethylcarbamoylsulfanyl)phenyl]-3-methyl-4-oxobutanoate Chemical compound COC(=O)CC(C)C(=O)C1=CC=C(SC(=O)N(C)C)C=C1 FRFGVDBMGQXPGM-UHFFFAOYSA-N 0.000 description 1
- IOPXSQGFUIXXCW-UHFFFAOYSA-N methyl 4-[4-(dimethylcarbamoylsulfanyl)phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(SC(=O)N(C)C)C=C1 IOPXSQGFUIXXCW-UHFFFAOYSA-N 0.000 description 1
- MATCFOJMMMWYDB-UHFFFAOYSA-N methyl 4-[4-[2-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]prop-2-enoxy]phenyl]-4-oxobutanoate Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(=C)COC1=CC=C(C(=O)CCC(=O)OC)C=C1 MATCFOJMMMWYDB-UHFFFAOYSA-N 0.000 description 1
- FYABIBNFJLDMJD-UHFFFAOYSA-N methyl 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropyl]sulfanyl-2-hydroxyphenyl]-4-oxobutanoate Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)CSC1=CC=C(C(=O)CCC(=O)OC)C(O)=C1 FYABIBNFJLDMJD-UHFFFAOYSA-N 0.000 description 1
- UUWVBHZDYFQMBU-UHFFFAOYSA-N methyl 6-[4-(3-bromopropylsulfanyl)phenyl]-6-oxohexanoate Chemical compound COC(=O)CCCCC(=O)C1=CC=C(SCCCBr)C=C1 UUWVBHZDYFQMBU-UHFFFAOYSA-N 0.000 description 1
- HDLGIEZOMYJKAK-UHFFFAOYSA-N methyl 6-chloro-6-oxohexanoate Chemical group COC(=O)CCCCC(Cl)=O HDLGIEZOMYJKAK-UHFFFAOYSA-N 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- ZJVAWPKTWVFKHG-UHFFFAOYSA-N p-Methoxypropiophenone Chemical compound CCC(=O)C1=CC=C(OC)C=C1 ZJVAWPKTWVFKHG-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229940107333 phenergan Drugs 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 239000002599 prostaglandin synthase inhibitor Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229940120904 succinylcholine chloride Drugs 0.000 description 1
- YOEWQQVKRJEPAE-UHFFFAOYSA-L succinylcholine chloride (anhydrous) Chemical compound [Cl-].[Cl-].C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C YOEWQQVKRJEPAE-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- MLKXDPUZXIRXEP-MFOYZWKCSA-N sulindac Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-MFOYZWKCSA-N 0.000 description 1
- 229960000894 sulindac Drugs 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- JKVRTUCVPZTEQZ-UHFFFAOYSA-N tributyltin azide Chemical compound CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] JKVRTUCVPZTEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/16—Otologicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/74—Two oxygen atoms, e.g. hydantoin with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to other ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/58—One oxygen atom, e.g. butenolide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/32—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D317/34—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Veterinary Medicine (AREA)
- Dermatology (AREA)
- Pulmonology (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Furan Compounds (AREA)
- Pyrrole Compounds (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42233882A | 1982-09-23 | 1982-09-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT77367A PT77367A (en) | 1983-10-01 |
| PT77367B true PT77367B (en) | 1986-04-21 |
Family
ID=23674451
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT77367A PT77367B (en) | 1982-09-23 | 1983-09-21 | Process for preparing leukotriene antagonists |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP0104885B1 (en:Method) |
| JP (1) | JPS59139342A (en:Method) |
| KR (1) | KR840006336A (en:Method) |
| AT (1) | ATE20233T1 (en:Method) |
| AU (1) | AU557953B2 (en:Method) |
| CA (1) | CA1210770A (en:Method) |
| DE (1) | DE3363942D1 (en:Method) |
| DK (1) | DK432783A (en:Method) |
| ES (1) | ES8503323A1 (en:Method) |
| GR (1) | GR79677B (en:Method) |
| IE (1) | IE55971B1 (en:Method) |
| IL (1) | IL69691A (en:Method) |
| NZ (1) | NZ205559A (en:Method) |
| PT (1) | PT77367B (en:Method) |
| ZA (1) | ZA837048B (en:Method) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5143931A (en) * | 1982-06-24 | 1992-09-01 | Smithkline Beecham Corporation | Leukotriene antagonists containing tetrazolyl groups |
| US5135940A (en) * | 1982-09-23 | 1992-08-04 | Merck Frosst Canada, Inc. | Leukotriene antagonists |
| DE3464903D1 (en) * | 1983-04-21 | 1987-08-27 | Merck Frosst Canada Inc | Leukotriene antagonists |
| US4820867A (en) * | 1983-04-21 | 1989-04-11 | Merck Frosst Canada, Inc. | Phenoxypropoxy halophenylacetic acids as leukotriene antagonists |
| US4539419A (en) * | 1983-05-02 | 1985-09-03 | Hoffmann-La Roche Inc. | Naphthalenyloxy substituted carboxylic acids |
| EP0156233A3 (en) * | 1984-03-19 | 1986-02-19 | Merck & Co. Inc. | Use of leukotriene antagonists for producing cytoprotective pharmaceutical compositions and process for producing cytoprotective pharmaceutical compositions |
| US4939279A (en) * | 1985-04-19 | 1990-07-03 | Smithkline Beecham Corporation | Leukotriene antagonists |
| US4937253A (en) * | 1985-04-19 | 1990-06-26 | Smithkline Beecham Corporation | Ester prodrugs |
| DE3515278A1 (de) * | 1985-04-27 | 1986-10-30 | Grünenthal GmbH, 5190 Stolberg | Neue benzoesaeurederivate, diese enthaltende arzneimittel und verfahren zur herstellung dieser verbindungen und arzneimittel |
| US4990526A (en) * | 1985-06-18 | 1991-02-05 | Merck Frosst Canada, Inc. | Leukotriene antagonists, compositions and methods of use thereof |
| CA1309557C (en) | 1985-06-18 | 1992-10-27 | Robert N. Young | Leukotriene antagonists |
| DE3786030T2 (de) | 1986-03-27 | 1993-12-02 | Merck Frosst Canada Inc | Tetrahydrocarbazole Ester. |
| US4857659A (en) * | 1986-04-28 | 1989-08-15 | Merck Frosst Canada, Inc. | Stereoselective synthesis of leukotriene antagonists |
| PT85110A (en) * | 1986-06-23 | 1987-07-01 | Merck Frosst Canada Inc | Process for preparing benzenealkanoic acid derivatives useful as leukotriene antagonists |
| GB8619956D0 (en) * | 1986-08-15 | 1986-09-24 | Roussel Lab Ltd | Chemical compounds |
| US4906658A (en) * | 1987-04-21 | 1990-03-06 | Merck Frosst Canada, Inc. | Fluoro-sulfones |
| PT87616B (pt) * | 1987-06-24 | 1992-09-30 | Smithkline Beecham Corp | Processo de preparacao de antagonistas do leucotrieno e de composicoes farmaceuticas |
| US4985585A (en) * | 1988-03-07 | 1991-01-15 | Kyorin Pharmaceutical Co., Ltd. | Phenoxyalkylcarboxylic acid derivatives and process for their preparations |
| US4954513A (en) * | 1988-12-23 | 1990-09-04 | Smithkline Beecham Corporation | Leukotriene antagonists |
| EP0480716A1 (en) | 1990-10-12 | 1992-04-15 | Merck Frosst Canada Inc. | Saturated hydroxyalkylquinoline acids as leukotriene antagonists |
| DE4228201A1 (de) * | 1992-08-25 | 1994-03-03 | Schering Ag | Neue Leukotrien-B¶4¶-Antagonisten, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| US5410054A (en) * | 1993-07-20 | 1995-04-25 | Merck Frosst Canada, Inc. | Heteroaryl quinolines as inhibitors of leukotriene biosynthesis |
| WO2015171765A2 (en) * | 2014-05-08 | 2015-11-12 | Medicinova, Inc. | Method of inhibiting or treating amyotrophic lateral sclerosis with phenoxyalkylcarboxylic acids |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1199871A (en) * | 1967-05-11 | 1970-07-22 | Consolidation Coal Co | Improvements in or relating to Sulfur-Containing Bisphenols |
| JPS508095B1 (en:Method) * | 1970-01-22 | 1975-04-02 | ||
| BE788749A (fr) * | 1971-09-13 | 1973-03-13 | Takeda Chemical Industries Ltd | Acide 3-(benzoyl trisubstitue)-propionique et son procede de preparation |
| GB2058785B (en) * | 1979-09-05 | 1983-05-25 | Glaxo Group Ltd | Phenol derivatives |
| US4410548A (en) * | 1980-07-09 | 1983-10-18 | Reckitt & Colman Products Limited | Propanolamine derivatives |
| DE3169761D1 (en) * | 1981-01-09 | 1985-05-09 | Fisons Plc | Phenoxy- and thiophenoxy compounds, methods for their preparation and pharmaceutical formulations containing them |
| FR2509725A1 (fr) * | 1981-07-15 | 1983-01-21 | Choay Sa | (hydroxyalkyl)phenylsulfures, leurs procedes de preparation et compositions pharmaceutiques les contenant |
-
1983
- 1983-09-12 IL IL69691A patent/IL69691A/xx unknown
- 1983-09-12 NZ NZ205559A patent/NZ205559A/en unknown
- 1983-09-16 AU AU19190/83A patent/AU557953B2/en not_active Ceased
- 1983-09-19 KR KR1019830004395A patent/KR840006336A/ko not_active Withdrawn
- 1983-09-21 AT AT83305588T patent/ATE20233T1/de not_active IP Right Cessation
- 1983-09-21 DE DE8383305588T patent/DE3363942D1/de not_active Expired
- 1983-09-21 IE IE2210/83A patent/IE55971B1/xx unknown
- 1983-09-21 CA CA000437216A patent/CA1210770A/en not_active Expired
- 1983-09-21 EP EP83305588A patent/EP0104885B1/en not_active Expired
- 1983-09-21 GR GR72486A patent/GR79677B/el unknown
- 1983-09-21 PT PT77367A patent/PT77367B/pt unknown
- 1983-09-22 DK DK432783A patent/DK432783A/da not_active Application Discontinuation
- 1983-09-22 ZA ZA837048A patent/ZA837048B/xx unknown
- 1983-09-22 ES ES525824A patent/ES8503323A1/es not_active Expired
- 1983-09-24 JP JP58175237A patent/JPS59139342A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| PT77367A (en) | 1983-10-01 |
| DK432783A (da) | 1984-05-04 |
| JPS59139342A (ja) | 1984-08-10 |
| AU1919083A (en) | 1984-03-29 |
| DE3363942D1 (en) | 1986-07-10 |
| ES525824A0 (es) | 1985-02-16 |
| KR840006336A (ko) | 1984-11-29 |
| EP0104885B1 (en) | 1986-06-04 |
| IL69691A (en) | 1988-01-31 |
| CA1210770A (en) | 1986-09-02 |
| AU557953B2 (en) | 1987-01-15 |
| ES8503323A1 (es) | 1985-02-16 |
| ATE20233T1 (de) | 1986-06-15 |
| EP0104885A1 (en) | 1984-04-04 |
| ZA837048B (en) | 1985-05-29 |
| GR79677B (en:Method) | 1984-10-31 |
| NZ205559A (en) | 1987-08-31 |
| IE832210L (en) | 1984-03-23 |
| DK432783D0 (da) | 1983-09-22 |
| IE55971B1 (en) | 1991-03-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT77367B (en) | Process for preparing leukotriene antagonists | |
| FI62821B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara hydroxamsyror | |
| DE69215965T2 (de) | Pyrazolopyridinverbindungen und Verfahren zu ihrer Herstellung | |
| US4191776A (en) | Biphenyl derivatives | |
| EP0228045B1 (de) | Aromatische Thioether | |
| JPS6391381A (ja) | ジヒドロベンゾピラン誘導体 | |
| FR2581993A1 (fr) | Derives de (benzoyl-4 piperidino)-2 phenyl-1 alcanols, leur preparation et leur application en therapeutique | |
| EP1509495A1 (en) | Anilino liver x-receptor modulators | |
| EP0106565B1 (en) | Leukotriene antagonists, their production, and compositions containing them | |
| US4472411A (en) | 1,4-Dihydropyridine derivatives and use as vasodilators | |
| FR2620121A1 (fr) | ((pyrimidinyl-2)-aminoalkyl)-1 piperidines, leur preparation et leur application en therapeutique | |
| DE69517433T2 (de) | Benzozykloalkenverbindungen, deren herstellung und verwendung | |
| DE68903531T2 (de) | Substituierte 1-(1h-imidazol-4-yl)alkyl-benzamide. | |
| SU1318161A3 (ru) | Способ получени пиперазиновых производных или их фармацевтически приемлемых солей (его варианты) | |
| US4134991A (en) | Derivatives of 2-(3-phenyl-2-aminopropionyloxy)-acetic acid | |
| DE69132082T2 (de) | Pyridin-Derivate, Verfahren zu deren Herstellung und Anwendung | |
| JP2777183B2 (ja) | 新規アルカノフェノン類 | |
| SU1468424A3 (ru) | Способ получени производных гидантоина | |
| DE3785104T2 (de) | Pharmazeutisch nuetzliche thiazolidin-4-karbonsaeure-derivate. | |
| EP0053017A1 (en) | Amide derivatives | |
| PT87615B (pt) | Processo de preparacao de antagonistas do leucotrieno e de composicoes farmaceuticasd | |
| DE60201264T2 (de) | Benzoaxathiepin-derivate und deren medizinische verwendung | |
| DE68907329T2 (de) | Leukotrien-Antagonisten. | |
| DD295846A5 (de) | Verfahren zur herstellung weiterer neuer alkanophenone | |
| US3689523A (en) | Substituted haloalkanesulfonanilides |