PT65878B - Improvement in process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilate - Google Patents
Improvement in process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilateInfo
- Publication number
- PT65878B PT65878B PT65878A PT6587876A PT65878B PT 65878 B PT65878 B PT 65878B PT 65878 A PT65878 A PT 65878A PT 6587876 A PT6587876 A PT 6587876A PT 65878 B PT65878 B PT 65878B
- Authority
- PT
- Portugal
- Prior art keywords
- chlorocarbanilate
- butynyl
- chloro
- improvement
- manufacturing
- Prior art date
Links
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/12—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C269/00—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C269/06—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups by reactions not involving the formation of carbamate groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/634,575 US4012433A (en) | 1975-11-24 | 1975-11-24 | Process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT65878A PT65878A (en) | 1976-12-01 |
| PT65878B true PT65878B (en) | 1978-05-18 |
Family
ID=24544360
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT65878A PT65878B (en) | 1975-11-24 | 1976-11-24 | Improvement in process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilate |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4012433A (enExample) |
| JP (1) | JPS5817458B2 (enExample) |
| AT (1) | AT346358B (enExample) |
| AU (1) | AU499597B2 (enExample) |
| BE (1) | BE848698A (enExample) |
| CA (1) | CA1074809A (enExample) |
| CH (1) | CH616405A5 (enExample) |
| DE (1) | DE2653150C2 (enExample) |
| DK (1) | DK526676A (enExample) |
| FI (1) | FI63219C (enExample) |
| FR (1) | FR2332262A1 (enExample) |
| GB (1) | GB1499311A (enExample) |
| GR (1) | GR61819B (enExample) |
| IE (1) | IE44314B1 (enExample) |
| IN (1) | IN143578B (enExample) |
| MX (1) | MX4020E (enExample) |
| NL (1) | NL7613112A (enExample) |
| PT (1) | PT65878B (enExample) |
| SE (1) | SE433611B (enExample) |
| TR (1) | TR19454A (enExample) |
| ZA (1) | ZA766998B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02118051U (enExample) * | 1989-03-07 | 1990-09-21 | ||
| US7346643B1 (en) * | 1999-07-30 | 2008-03-18 | Mips Technologies, Inc. | Processor with improved accuracy for multiply-add operations |
| WO2016202894A1 (en) | 2015-06-17 | 2016-12-22 | Universitaet Des Saarlandes | Method of converting alcohol to halide |
| CN110655446A (zh) * | 2019-10-22 | 2020-01-07 | 邹平铭兴化工有限公司 | 氯代异丁烷的化学合成方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE113716C (enExample) * | ||||
| ZA591098B (enExample) * | 1958-03-24 | |||
| DE1133716B (de) * | 1960-11-26 | 1962-07-26 | Basf Ag | Verfahren zur Herstellung von aliphatischen Di- und Polychlor-verbindungen |
| DE1135893B (de) * | 1961-05-19 | 1962-09-06 | Basf Ag | Verfahren zur Herstellung von Chlorkohlenwasserstoffen der Acetylenreihe |
-
1975
- 1975-11-24 US US05/634,575 patent/US4012433A/en not_active Expired - Lifetime
-
1976
- 1976-11-23 CA CA266,358A patent/CA1074809A/en not_active Expired
- 1976-11-23 ZA ZA766998A patent/ZA766998B/xx unknown
- 1976-11-23 DK DK526676A patent/DK526676A/da not_active Application Discontinuation
- 1976-11-23 DE DE2653150A patent/DE2653150C2/de not_active Expired
- 1976-11-24 FR FR7635337A patent/FR2332262A1/fr active Granted
- 1976-11-24 MX MX765151U patent/MX4020E/es unknown
- 1976-11-24 GB GB49044/76A patent/GB1499311A/en not_active Expired
- 1976-11-24 IE IE2585/76A patent/IE44314B1/en unknown
- 1976-11-24 JP JP51140273A patent/JPS5817458B2/ja not_active Expired
- 1976-11-24 NL NL7613112A patent/NL7613112A/xx not_active Application Discontinuation
- 1976-11-24 GR GR52253A patent/GR61819B/el unknown
- 1976-11-24 CH CH1479876A patent/CH616405A5/fr not_active IP Right Cessation
- 1976-11-24 PT PT65878A patent/PT65878B/pt unknown
- 1976-11-24 BE BE172655A patent/BE848698A/xx not_active IP Right Cessation
- 1976-11-24 TR TR19454A patent/TR19454A/xx unknown
- 1976-11-24 AT AT871876A patent/AT346358B/de not_active IP Right Cessation
- 1976-11-24 SE SE7613122A patent/SE433611B/xx unknown
- 1976-11-24 FI FI763383A patent/FI63219C/fi not_active IP Right Cessation
- 1976-11-24 IN IN2106/CAL/76A patent/IN143578B/en unknown
- 1976-11-24 AU AU19982/76A patent/AU499597B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IN143578B (enExample) | 1977-12-31 |
| IE44314L (en) | 1977-05-24 |
| GB1499311A (en) | 1978-02-01 |
| NL7613112A (nl) | 1977-05-26 |
| DE2653150C2 (de) | 1985-02-07 |
| CA1074809A (en) | 1980-04-01 |
| ZA766998B (en) | 1977-10-26 |
| FI763383A7 (enExample) | 1977-05-25 |
| DE2653150A1 (de) | 1977-06-02 |
| CH616405A5 (enExample) | 1980-03-31 |
| MX4020E (es) | 1981-11-03 |
| AU499597B2 (en) | 1979-04-26 |
| SE7613122L (sv) | 1977-05-25 |
| TR19454A (tr) | 1979-02-27 |
| JPS5817458B2 (ja) | 1983-04-07 |
| FI63219C (fi) | 1983-05-10 |
| GR61819B (en) | 1979-01-22 |
| AT346358B (de) | 1978-11-10 |
| ATA871876A (de) | 1978-03-15 |
| FR2332262B1 (enExample) | 1980-11-21 |
| FR2332262A1 (fr) | 1977-06-17 |
| DK526676A (da) | 1977-05-25 |
| AU1998276A (en) | 1978-06-01 |
| BE848698A (fr) | 1977-05-24 |
| PT65878A (en) | 1976-12-01 |
| IE44314B1 (en) | 1981-10-21 |
| FI63219B (fi) | 1983-01-31 |
| JPS5278850A (en) | 1977-07-02 |
| US4012433A (en) | 1977-03-15 |
| SE433611B (sv) | 1984-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU262076A (en) | Process for obtaining 2-phenyl-3-aroylbenzothiophene | |
| JPS527943A (en) | Process for preparing same | |
| JPS5276487A (en) | Brewing process | |
| JPS5233629A (en) | Process for manufacturing alkyloxysilane | |
| ZM7076A1 (en) | Process | |
| GB1550625A (en) | Balling process | |
| YU100676A (en) | Process for obtaining piperazinylpyrazine | |
| YU147976A (en) | Process for obtaining 11-deoxy-16-aryloxy-omega-tetranoprostaglandin | |
| GB1554153A (en) | Process for making 2-amino-2-alkylthionitroethylenes | |
| JPS5251321A (en) | Process for manufacturing 44alkyllthiosemicarbazides | |
| JPS5231033A (en) | Process for manufacturing phosphodichloridethiolate | |
| PT65878A (en) | Improvement in process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilate | |
| JPS51145557A (en) | Process for manufacturing tucky rubberrlike mixtures | |
| YU40131B (en) | Process for obtaining 6-methoxy-alpha-crboxy-penicillins | |
| YU262276A (en) | Process for obtaining aroyl-phenyl naphthalines | |
| JPS5251322A (en) | Process for manufacturing ssalkylphosphorodihalogenidedithioate | |
| JPS5215578A (en) | Process for manufacturing particleboard | |
| JPS51124174A (en) | Process for manufacturing particleboard | |
| GB1549646A (en) | Gelatin-hardening process | |
| HU172553B (hu) | Sposob poluchenija proizvodnykh -3-aciloksimetil-cefem- ili -3-tiometil-cefem- soedinenijj | |
| YU40278B (en) | Process for obtaining n-alkenyl-2-amino-pyrrolidine | |
| IL50143A (en) | Process for manufacturing chlorothianthrenes | |
| JPS5235279A (en) | Process for manufacturing particleboard | |
| AU1297176A (en) | Cold-grinding process | |
| JPS5281579A (en) | Crossslinking process |