PL96687B1 - Sposob wytwarzania kwasu 3-amino-2,5-dwuchlorobenzoesowego,ewentualnie w postaci estrow alkilowych i soli - Google Patents
Sposob wytwarzania kwasu 3-amino-2,5-dwuchlorobenzoesowego,ewentualnie w postaci estrow alkilowych i soli Download PDFInfo
- Publication number
- PL96687B1 PL96687B1 PL17895375A PL17895375A PL96687B1 PL 96687 B1 PL96687 B1 PL 96687B1 PL 17895375 A PL17895375 A PL 17895375A PL 17895375 A PL17895375 A PL 17895375A PL 96687 B1 PL96687 B1 PL 96687B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- amino
- solution
- mixture
- dichlorobenzoic acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- 150000003839 salts Chemical class 0.000 title claims description 12
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 32
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 7
- 125000005907 alkyl ester group Chemical group 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 230000002829 reductive effect Effects 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000047 product Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- 150000004702 methyl esters Chemical class 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- AUAXYMOBWXOEQD-UHFFFAOYSA-N 2,5-dichloro-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl AUAXYMOBWXOEQD-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000014413 iron hydroxide Nutrition 0.000 description 3
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000005873 2,5-Dichlorobenzoic acid methylester Substances 0.000 description 1
- RSINFFVFOTUDEC-UHFFFAOYSA-N 2,5-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC=C1Cl RSINFFVFOTUDEC-UHFFFAOYSA-N 0.000 description 1
- PCALPXHVQPTOER-UHFFFAOYSA-N 3,6-dichloro-2-nitrobenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(Cl)=C1[N+]([O-])=O PCALPXHVQPTOER-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- DFAQGXDIXJVBAQ-UHFFFAOYSA-N ethyl 2,3-dichlorobenzoate Chemical compound CCOC(=O)C1=CC=CC(Cl)=C1Cl DFAQGXDIXJVBAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- SPJQBGGHUDNAIC-UHFFFAOYSA-N methyl 2,5-dichlorobenzoate Chemical compound COC(=O)C1=CC(Cl)=CC=C1Cl SPJQBGGHUDNAIC-UHFFFAOYSA-N 0.000 description 1
- KJWHRMZKJXOWFC-UHFFFAOYSA-N methyl 5-chloro-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(Cl)=CC=C1O KJWHRMZKJXOWFC-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012256 powdered iron Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001464 | 1974-03-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL96687B1 true PL96687B1 (pl) | 1978-01-31 |
Family
ID=10994514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL17895375A PL96687B1 (pl) | 1974-03-22 | 1975-03-21 | Sposob wytwarzania kwasu 3-amino-2,5-dwuchlorobenzoesowego,ewentualnie w postaci estrow alkilowych i soli |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS50157332A (https=) |
| AT (1) | AT343633B (https=) |
| BG (1) | BG24665A3 (https=) |
| DD (1) | DD119212A1 (https=) |
| GB (1) | GB1453405A (https=) |
| PL (1) | PL96687B1 (https=) |
| SU (1) | SU584762A3 (https=) |
-
1975
- 1975-03-12 BG BG029241A patent/BG24665A3/xx unknown
- 1975-03-20 JP JP3304775A patent/JPS50157332A/ja active Pending
- 1975-03-20 DD DD18490675A patent/DD119212A1/xx unknown
- 1975-03-21 AT AT217475A patent/AT343633B/de not_active IP Right Cessation
- 1975-03-21 PL PL17895375A patent/PL96687B1/pl unknown
- 1975-03-21 SU SU7502115543A patent/SU584762A3/ru active
- 1975-03-21 GB GB1198575A patent/GB1453405A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BG24665A3 (en) | 1978-04-12 |
| DD119212A1 (https=) | 1976-04-12 |
| JPS50157332A (https=) | 1975-12-19 |
| SU584762A3 (ru) | 1977-12-15 |
| ATA217475A (de) | 1977-10-15 |
| GB1453405A (en) | 1976-10-20 |
| AT343633B (de) | 1978-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2394230A (en) | Methods of preparing alpha-amino acids and nu-substituted-alpha-amino acids | |
| PL96687B1 (pl) | Sposob wytwarzania kwasu 3-amino-2,5-dwuchlorobenzoesowego,ewentualnie w postaci estrow alkilowych i soli | |
| Johnson et al. | Researches on pyrimidines. CXXII. Improved methods for the synthesis of orotic acid | |
| NO157733B (no) | Fremgangsmte for fremstilling av d-2-(6-metoksy-2-naftyl)-propionsyre. | |
| US3009942A (en) | Production of trichlorobenzoic acids | |
| Pyman | XIX.—Meta-substituted aromatic selenium compounds | |
| DE2752287B2 (de) | Verfahren zur Gewinnung von Salzen der Asparaginsäure | |
| CN101823973A (zh) | 一种分离亚氨基二乙酸的方法 | |
| US2858341A (en) | Producing bis-(dichlormethyl) sulfone | |
| US4243614A (en) | Process for producing hexanitrostilbene | |
| JPH069683A (ja) | 製薬等級高純度イオデオキシコール酸の製造法 | |
| Hodgson et al. | 54. Preparation of 1: 5-and 1: 8-naphthylenediamine and related compounds | |
| Sudborough et al. | XII.—α-Chlorocinnamic acids | |
| US2717907A (en) | Preparation of 2, 4, 5-trichlorophenoxy acetic acid | |
| CN105622570B (zh) | 一种Cu2+催化制备2-氨基-5-硝基噻吩类化合物的方法 | |
| US5395964A (en) | Preparation process for hydroxyphenylacetic acids | |
| SU188975A1 (ru) | Способ получения 5-сульфокислот-8-меркаптохинолинов | |
| DE3638364A1 (de) | Verfahren zur herstellung von 5-aminosalicylsaeure | |
| EP0092487A1 (en) | Process for the preparation of 3-carboxy-1,4-dimethylpyrrol-2-acetic acid | |
| US1150579A (en) | Metal salts of polymethylenebisimino acids. | |
| US4328160A (en) | Process for the preparation of 1-aminoanthraquinones | |
| SU131354A1 (ru) | Способ получени 2-амино-1-нафтол-4-сульфамида | |
| Johnson et al. | HYDANTOINS: SYNTHESIS OF THE HYDANTOIN OF 3-AMINO-TYROSINE.[SEVENTEENTH PAPER.] | |
| US3236890A (en) | 2-benzoyl-3, 4, 5, 6-tetra-bromo-and chloro-anilines | |
| Stephen et al. | XXXII.—αδ-Derivatives of adipic and β-methyladipic acids, and the preparation of muconic and β-methylmuconic acids |