PL91583B1 - Arginine and lysine salts of acid cephalosporins[US3984403A] - Google Patents
Arginine and lysine salts of acid cephalosporins[US3984403A] Download PDFInfo
- Publication number
- PL91583B1 PL91583B1 PL1973163733A PL16373373A PL91583B1 PL 91583 B1 PL91583 B1 PL 91583B1 PL 1973163733 A PL1973163733 A PL 1973163733A PL 16373373 A PL16373373 A PL 16373373A PL 91583 B1 PL91583 B1 PL 91583B1
- Authority
- PL
- Poland
- Prior art keywords
- arginine
- lysine
- acid
- reacted
- methyl
- Prior art date
Links
- 239000004475 Arginine Substances 0.000 title claims abstract description 42
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 title claims abstract description 33
- 239000002253 acid Substances 0.000 title claims abstract description 29
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical class NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 title claims abstract description 22
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 title claims abstract description 21
- 229930186147 Cephalosporin Natural products 0.000 title claims abstract description 7
- 229940124587 cephalosporin Drugs 0.000 title claims abstract description 7
- 150000001780 cephalosporins Chemical class 0.000 title abstract description 5
- -1 cephalosporin salts Chemical class 0.000 claims abstract description 71
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 claims abstract description 10
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 claims abstract description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 claims abstract description 4
- RRYMAQUWDLIUPV-BXKDBHETSA-N cefacetrile Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CC#N)[C@@H]12 RRYMAQUWDLIUPV-BXKDBHETSA-N 0.000 claims abstract description 3
- 239000004472 Lysine Substances 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 28
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 3
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- LBXOVWWXGPSSJU-UHFFFAOYSA-N [H]S(=O)=O Chemical compound [H]S(=O)=O LBXOVWWXGPSSJU-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- MELPUYGGBBNTJI-LBXVMSDZSA-N 1-[[(6R)-8-oxo-7-[(2-phenyl-2-sulfoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylate Chemical class S(=O)(=O)(O)C(C(=O)NC1[C@@H]2N(C=C(CS2)C[N+]2=CC=C(C=C2)C(=O)[O-])C1=O)C1=CC=CC=C1 MELPUYGGBBNTJI-LBXVMSDZSA-N 0.000 abstract 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 abstract 1
- 238000010255 intramuscular injection Methods 0.000 abstract 1
- 239000007927 intramuscular injection Substances 0.000 abstract 1
- 229960003646 lysine Drugs 0.000 description 22
- 239000000243 solution Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 238000002347 injection Methods 0.000 description 14
- 239000007924 injection Substances 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 230000000694 effects Effects 0.000 description 10
- 230000003115 biocidal effect Effects 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 229920001429 chelating resin Polymers 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical group CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 206010022086 Injection site pain Diseases 0.000 description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001782 cephems Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 239000003589 local anesthetic agent Substances 0.000 description 2
- 229960005015 local anesthetics Drugs 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- UXTFKIJKRJJXNV-UHFFFAOYSA-N 1-$l^{1}-oxidanylethanone Chemical compound CC([O])=O UXTFKIJKRJJXNV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004287 Dehydroacetic acid Substances 0.000 description 1
- 206010024769 Local reaction Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- HCBIBCJNVBAKAB-UHFFFAOYSA-N Procaine hydrochloride Chemical compound Cl.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 HCBIBCJNVBAKAB-UHFFFAOYSA-N 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000002720 diazolyl group Chemical group 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-O hydron;pyrimidine Chemical compound C1=CN=C[NH+]=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-O 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 229960004393 lidocaine hydrochloride Drugs 0.000 description 1
- YECIFGHRMFEPJK-UHFFFAOYSA-N lidocaine hydrochloride monohydrate Chemical compound O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C YECIFGHRMFEPJK-UHFFFAOYSA-N 0.000 description 1
- 229960005337 lysine hydrochloride Drugs 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229960001309 procaine hydrochloride Drugs 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-O pyridin-1-ium-4-carboxamide Chemical compound NC(=O)C1=CC=[NH+]C=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-O 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP47066076A JPS4925118A (OSRAM) | 1972-06-30 | 1972-06-30 | |
| JP1263173A JPS557434B2 (OSRAM) | 1973-01-30 | 1973-01-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL91583B1 true PL91583B1 (en) | 1977-03-31 |
Family
ID=26348263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973163733A PL91583B1 (en) | 1972-06-30 | 1973-06-30 | Arginine and lysine salts of acid cephalosporins[US3984403A] |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3984403A (OSRAM) |
| AT (1) | AT325205B (OSRAM) |
| AU (1) | AU472943B2 (OSRAM) |
| CA (1) | CA1021321A (OSRAM) |
| CH (1) | CH592676A5 (OSRAM) |
| CS (1) | CS181244B2 (OSRAM) |
| DE (1) | DE2332878C2 (OSRAM) |
| FI (1) | FI57109C (OSRAM) |
| FR (1) | FR2190422B1 (OSRAM) |
| GB (1) | GB1418149A (OSRAM) |
| HU (1) | HU166161B (OSRAM) |
| NL (1) | NL7309126A (OSRAM) |
| PL (1) | PL91583B1 (OSRAM) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES412429A1 (es) * | 1973-03-08 | 1976-01-01 | Gallardo Antonio Sa | Un procedimiento para la obtencion de sales de antibioticoscon aminoacidos de naturaleza basica. |
| FR2308368A1 (fr) * | 1975-04-21 | 1976-11-19 | Gallardo Antonio Sa | Sel soluble de la cephalexine comme antibiotique injectable |
| CA1093997A (en) * | 1975-12-25 | 1981-01-20 | Shunichi Watanabe | Process of producing 7-methoxy cephalosporins |
| GB1575905A (en) * | 1976-04-28 | 1980-10-01 | Glaxo Lab Ltd | Salt of cefuroxime |
| US4165429A (en) * | 1976-06-28 | 1979-08-21 | Yamanouchi Pharmaceutical Co., Ltd. | 7α-METHOXY-CEPHALOSPORANIC ACID DERIVATIVES |
| FR2371923A1 (fr) * | 1976-11-30 | 1978-06-23 | Viridis Ets | Sels de lysine et d'arginine de l'acide 7-((cyanomethylthio)-acetamido)-3-(2-(5-methyl-1, 3, 4-thiadiazolyl)-thiomethyl)-d3-cepheme-4-carboxylique et procede pour leur preparation |
| GB1579533A (en) * | 1977-03-26 | 1980-11-19 | Farmaceutici Italia | Cephalosporins and their preparation |
| US4235900A (en) * | 1978-11-15 | 1980-11-25 | E. R. Squibb & Sons, Inc. | Cephradine compositions |
| SE458505B (sv) * | 1979-07-10 | 1989-04-10 | Lepetit Spa | Anvaendningen av rifamycin sv och salter daerav foer framstaellning av en beredning foer behandling av reumatoid artrit samt vissa av salterna och deras framstaellning |
| ES8101078A1 (es) * | 1980-02-05 | 1980-12-16 | Liofilizaciones Esterilizacion | Procedimiento para la obtencion de una sal soluble en agua de cefadroxilo |
| US4354023A (en) * | 1980-04-01 | 1982-10-12 | Dobfar S.P.A. | Cefadroxil acetylcysteinate salt |
| US4448958A (en) * | 1982-10-20 | 1984-05-15 | Bristol-Myers Company | Purification of ceforanide |
| US4994451A (en) * | 1988-01-19 | 1991-02-19 | Bristol-Myers Company | Cephalosporin salts and injectable compositions |
| US5244891A (en) * | 1985-08-05 | 1993-09-14 | Bristol-Myers Squibb Company | Injectable compositions of cefepime dihydrochloride hydrate |
| JPH0840907A (ja) | 1994-08-03 | 1996-02-13 | Meiji Seika Kaisha Ltd | セファロスポリン注射剤 |
| DE60040979D1 (de) * | 1999-05-07 | 2009-01-15 | Wockhardt Ltd | (s)-benzochinolizincarbonsäuren und ihre verwendung als antibakterielle mittel |
| US6514986B2 (en) | 2000-11-22 | 2003-02-04 | Wockhardt Limited | Chiral fluoroquinolone arginine salt forms |
| US6608078B2 (en) | 2000-05-08 | 2003-08-19 | Wockhardt Limited | Antibacterial chiral 8-(substituted piperidino)-benzo [i,j] quinolizines, processes, compositions and methods of treatment |
| US7098219B2 (en) | 2000-08-01 | 2006-08-29 | Wockhart Limited | Inhibitors of cellular efflux pumps of microbes |
| US7138419B2 (en) † | 2000-12-27 | 2006-11-21 | Corus Pharma, Inc. | Process for manufacturing bulk solutions and a lyophilized pure α-aztreonam lysinate |
| US6964966B2 (en) | 2001-04-25 | 2005-11-15 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US6878713B2 (en) * | 2001-04-25 | 2005-04-12 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US20030171424A1 (en) * | 2002-03-07 | 2003-09-11 | Lin Ai J. | Intravenous formulation of artelinic acid for treatment of severe and complicated malaria |
| US6664267B1 (en) * | 2002-05-28 | 2003-12-16 | Wockhardt Limited | Crystalline fluoroquinolone arginine salt form |
| CA2537066C (en) | 2003-09-04 | 2011-05-24 | Wockhardt Limited | Benzoquinolizine-2-carboxylic acid arginine salt tetrahydrate |
| WO2005094800A2 (en) * | 2004-03-31 | 2005-10-13 | Lupin Ltd. | A co-precipitated cefepime composition and process for preparation thereof |
| CN101830914B (zh) * | 2010-06-04 | 2012-03-21 | 深圳九福药业科技有限公司 | 头孢呋辛赖氨酸结晶化合物及其制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1052068A (OSRAM) * | 1963-11-04 | |||
| US3488730A (en) * | 1966-09-08 | 1970-01-06 | Lilly Co Eli | Salts of cephalosporin antibiotics |
| CH469021A (fr) * | 1967-05-05 | 1969-02-28 | Alpharm S A | Procédé de préparation de sels organiques de pénicillines sémisynthétiques |
| CA939265A (en) * | 1967-11-18 | 1974-01-01 | Yoshitaka Ikezuki | Injectable compositions for alleviating the pain incurred from administrations of injections |
| GB1316964A (en) * | 1969-07-24 | 1973-05-16 | Glaxo Lab Ltd | Antibiotics |
| US3676434A (en) * | 1970-07-29 | 1972-07-11 | Lilly Co Eli | Cephalosporin salts |
-
1973
- 1973-06-19 US US05/371,531 patent/US3984403A/en not_active Expired - Lifetime
- 1973-06-27 CS CS7300004631A patent/CS181244B2/cs unknown
- 1973-06-28 CA CA175,139A patent/CA1021321A/en not_active Expired
- 1973-06-28 DE DE2332878A patent/DE2332878C2/de not_active Expired
- 1973-06-28 HU HUTA1262A patent/HU166161B/hu unknown
- 1973-06-28 FR FR7323738A patent/FR2190422B1/fr not_active Expired
- 1973-06-29 CH CH955773A patent/CH592676A5/xx not_active IP Right Cessation
- 1973-06-29 GB GB3096973A patent/GB1418149A/en not_active Expired
- 1973-06-29 AT AT576373A patent/AT325205B/de not_active IP Right Cessation
- 1973-06-29 NL NL7309126A patent/NL7309126A/xx not_active Application Discontinuation
- 1973-06-29 FI FI2096/73A patent/FI57109C/fi active
- 1973-06-30 PL PL1973163733A patent/PL91583B1/pl unknown
- 1973-07-02 AU AU57599/73A patent/AU472943B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI57109C (fi) | 1981-06-22 |
| US3984403A (en) | 1976-10-05 |
| AT325205B (de) | 1975-10-10 |
| HU166161B (OSRAM) | 1975-01-28 |
| CH592676A5 (OSRAM) | 1977-10-31 |
| FR2190422A1 (OSRAM) | 1974-02-01 |
| FR2190422B1 (OSRAM) | 1977-02-25 |
| FI57109B (fi) | 1980-02-29 |
| NL7309126A (OSRAM) | 1974-01-02 |
| AU5759973A (en) | 1975-01-09 |
| CA1021321A (en) | 1977-11-22 |
| CS181244B2 (en) | 1978-03-31 |
| DE2332878A1 (de) | 1974-01-17 |
| DE2332878C2 (de) | 1983-07-28 |
| GB1418149A (en) | 1975-12-17 |
| AU472943B2 (en) | 1976-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL91583B1 (en) | Arginine and lysine salts of acid cephalosporins[US3984403A] | |
| DK163243B (da) | Fremgangsmaade til fremstilling af cephalosporinderivater | |
| JPH0369353B2 (OSRAM) | ||
| US3833568A (en) | Heterocyclic ureidocephalosporins | |
| US4286089A (en) | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins | |
| US3459746A (en) | 7 - heteromonocyclic-substituted acylamido derivatives of desacetyl cephalosporanic acid | |
| JPH09506100A (ja) | 抗炎症剤および抗変性剤としての2−スピロ(2’−スピロシクロアルキル)シクロプロピルセファロスポリンスルホン類 | |
| US3966719A (en) | 4-(Tetrazol-5-yl)-Δ3 -cephem compounds | |
| IE50225B1 (en) | Organic sulfoxides having a latent allyl group,process for preparing the same and pharmaceutical antibacterial composition comprising the same | |
| US4609654A (en) | Derivatives of cephalosporins substituted in 3 position by a thiomethyl heterocycle group; and pharmaceutical compositions containing them | |
| JP4028607B2 (ja) | 新規なセファロスポリン誘導体またはその塩 | |
| JPS625917B2 (OSRAM) | ||
| US3929782A (en) | 1,2,4-Oxadiazolonylacetyl cephalosporins | |
| US3884915A (en) | 7-Alkylmercaptoacetamido cephalosporins | |
| US4126682A (en) | 7-acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins and antibacterial compositions and methods employing them | |
| US4342758A (en) | Allylsulfoxide enzyme inhibitors | |
| IE44607B1 (en) | Cephalosporin compounds | |
| CA1089848A (en) | Arylmalonamido methoxycephalosporins | |
| US4045436A (en) | 4-(Tetrazol-5-yl)-Δ3 -cephem compounds | |
| US3422099A (en) | 7-(alpha-hydroxy-(2' or 3'-thienyl)-acetamido) cephalosporanic acids and related salts and derivatives | |
| US4045437A (en) | 4-(Tetrazol-5-yl)-Δ3 -cephem compounds | |
| IE54511B1 (en) | Z-omega-substituted thio-2-(2,2-dimethylcyclopropanecarboxamido)-2-alkenoic acids, a process for preparing and an antibacterial composition containing the same | |
| CA1064019A (en) | Cepham derivatives and preparation thereof | |
| US4003893A (en) | 3-Heterothio[(thioalkyl)thioacetyl]cephalosporanic derivatives | |
| US3962229A (en) | 2-(Thiocarbonylamino)acetamido-7α-methoxy cephalosporanic acid compounds |