PL91404B1 - - Google Patents
Download PDFInfo
- Publication number
- PL91404B1 PL91404B1 PL1974172462A PL17246274A PL91404B1 PL 91404 B1 PL91404 B1 PL 91404B1 PL 1974172462 A PL1974172462 A PL 1974172462A PL 17246274 A PL17246274 A PL 17246274A PL 91404 B1 PL91404 B1 PL 91404B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- chloro
- compound
- phenyl
- isocyanate
- Prior art date
Links
- -1 sulfonyloxyphenyl ureas Chemical class 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 12
- 230000002363 herbicidal effect Effects 0.000 claims description 12
- 239000004009 herbicide Substances 0.000 claims description 10
- 239000013543 active substance Substances 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 7
- 239000000969 carrier Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 235000013877 carbamide Nutrition 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 230000000052 comparative effect Effects 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 16
- 241000196324 Embryophyta Species 0.000 description 10
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 10
- 239000012948 isocyanate Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 150000002513 isocyanates Chemical class 0.000 description 9
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- RNBIZKCNNFIJKC-UHFFFAOYSA-N (2-chloro-4-isocyanatophenyl) methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=C(N=C=O)C=C1Cl RNBIZKCNNFIJKC-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- HMKBKTADOAMDEG-UHFFFAOYSA-N (2-chloro-4-nitrophenyl) methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=C([N+]([O-])=O)C=C1Cl HMKBKTADOAMDEG-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000234642 Festuca Species 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- SKPUSIYRPPOAQG-UHFFFAOYSA-N (2-chloro-4-isocyanatophenyl) chloromethanesulfonate Chemical compound ClCS(=O)(=O)OC1=CC=C(N=C=O)C=C1Cl SKPUSIYRPPOAQG-UHFFFAOYSA-N 0.000 description 2
- ZJAMTDVXQMGHPU-UHFFFAOYSA-N (4-amino-2-chlorophenyl) methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=C(N)C=C1Cl ZJAMTDVXQMGHPU-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 241000723377 Coffea Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- 244000042664 Matricaria chamomilla Species 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000001804 emulsifying effect Effects 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- AXEJVYGYYBQOJL-UHFFFAOYSA-N (2-chloro-4-isocyanatophenyl) 3-chlorobenzenesulfonate Chemical compound ClC1=CC=CC(S(=O)(=O)OC=2C(=CC(=CC=2)N=C=O)Cl)=C1 AXEJVYGYYBQOJL-UHFFFAOYSA-N 0.000 description 1
- ATGZNGYDCRQBDC-UHFFFAOYSA-N (2-chloro-4-isocyanatophenyl) butane-1-sulfonate Chemical compound CCCCS(=O)(=O)OC1=CC=C(N=C=O)C=C1Cl ATGZNGYDCRQBDC-UHFFFAOYSA-N 0.000 description 1
- ARWZWLQDMUQXFU-UHFFFAOYSA-N (4-amino-3-chlorophenyl) methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=C(N)C(Cl)=C1 ARWZWLQDMUQXFU-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- BOFRXDMCQRTGII-UHFFFAOYSA-N 619-08-9 Chemical compound OC1=CC=C([N+]([O-])=O)C=C1Cl BOFRXDMCQRTGII-UHFFFAOYSA-N 0.000 description 1
- 241000258957 Asteroidea Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241001049165 Caria Species 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 240000006162 Chenopodium quinoa Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910020676 Co—N Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 101100310622 Mus musculus Soga1 gene Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241001310793 Podium Species 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 240000006661 Serenoa repens Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- NSWMEHNHPYNKTJ-UHFFFAOYSA-N [2-chloro-4-(dimethylcarbamoylamino)phenyl] methanesulfonate Chemical compound CN(C)C(=O)NC1=CC=C(OS(C)(=O)=O)C(Cl)=C1 NSWMEHNHPYNKTJ-UHFFFAOYSA-N 0.000 description 1
- QNRLYTMTDWVOEI-UHFFFAOYSA-N [2-chloro-4-[methyl(methylcarbamoyl)amino]phenyl] chloromethanesulfonate Chemical compound CNC(=O)N(C)C1=CC=C(OS(=O)(=O)CCl)C(Cl)=C1 QNRLYTMTDWVOEI-UHFFFAOYSA-N 0.000 description 1
- LLVVONDOASBKKE-UHFFFAOYSA-N [3-(dimethylcarbamoylamino)phenyl] n,n-dimethylsulfamate Chemical compound CN(C)C(=O)NC1=CC=CC(OS(=O)(=O)N(C)C)=C1 LLVVONDOASBKKE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/73—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C307/00—Amides of sulfuric acids, i.e. compounds having singly-bound oxygen atoms of sulfate groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C307/02—Monoamides of sulfuric acids or esters thereof, e.g. sulfamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/64—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms
- C07C309/65—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/64—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms
- C07C309/65—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms of a saturated carbon skeleton
- C07C309/66—Methanesulfonates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732334607 DE2334607A1 (de) | 1973-07-07 | 1973-07-07 | Sulfonyloxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL91404B1 true PL91404B1 (en:Method) | 1977-02-28 |
Family
ID=5886221
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974172462A PL91404B1 (en:Method) | 1973-07-07 | 1974-07-05 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3962306A (en:Method) |
| JP (2) | JPS5040543A (en:Method) |
| AT (1) | AT338037B (en:Method) |
| BE (1) | BE817294A (en:Method) |
| BR (1) | BR7405545D0 (en:Method) |
| CA (1) | CA1034135A (en:Method) |
| CH (1) | CH602615A5 (en:Method) |
| CS (1) | CS190428B2 (en:Method) |
| DD (1) | DD113989A5 (en:Method) |
| DE (1) | DE2334607A1 (en:Method) |
| DK (1) | DK136770C (en:Method) |
| FR (1) | FR2235918B1 (en:Method) |
| GB (1) | GB1418247A (en:Method) |
| IL (1) | IL45197A (en:Method) |
| LU (1) | LU70471A1 (en:Method) |
| NL (1) | NL7409072A (en:Method) |
| PL (1) | PL91404B1 (en:Method) |
| SU (1) | SU517228A3 (en:Method) |
| ZA (1) | ZA744344B (en:Method) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6127189U (ja) * | 1984-07-24 | 1986-02-18 | ヤマハ株式会社 | 電子楽器 |
| JPH0827629B2 (ja) * | 1986-11-12 | 1996-03-21 | ヤマハ株式会社 | 楽音制御装置 |
| ATE84302T1 (de) * | 1988-10-20 | 1993-01-15 | Ciba Geigy Ag | Sulfamoylphenylharnstoffe. |
| US4872685A (en) * | 1988-11-14 | 1989-10-10 | Sun Donald J C | Golf club head with impact insert member |
| AU7353300A (en) * | 1999-09-08 | 2001-04-10 | Guilford Pharmaceuticals Inc. | Non-peptidic cyclophilin binding compounds and their use |
| JP2004532187A (ja) | 2001-01-25 | 2004-10-21 | ギルフォード ファーマシュウティカルズ インコーポレイテッド | 三置換カルボサイクリックサイクロフィリン結合化合物とその用途 |
| US6773360B2 (en) * | 2002-11-08 | 2004-08-10 | Taylor Made Golf Company, Inc. | Golf club head having a removable weight |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3326663A (en) * | 1964-09-25 | 1967-06-20 | Shell Oil Co | Herbicidal phenylureas |
| US3576872A (en) * | 1968-05-03 | 1971-04-27 | Exxon Research Engineering Co | Herbicidal s-aryl arylamides |
| US3687998A (en) * | 1968-12-16 | 1972-08-29 | Robert D Trepka | Aliphatic sulfonoxyphenylureas |
-
1973
- 1973-07-07 DE DE19732334607 patent/DE2334607A1/de active Pending
-
1974
- 1974-06-14 US US05/479,389 patent/US3962306A/en not_active Expired - Lifetime
- 1974-06-27 CS CS744552A patent/CS190428B2/cs unknown
- 1974-07-04 NL NL7409072A patent/NL7409072A/xx not_active Application Discontinuation
- 1974-07-04 IL IL45197A patent/IL45197A/en unknown
- 1974-07-05 PL PL1974172462A patent/PL91404B1/pl unknown
- 1974-07-05 LU LU70471A patent/LU70471A1/xx unknown
- 1974-07-05 ZA ZA00744344A patent/ZA744344B/xx unknown
- 1974-07-05 CA CA204,130A patent/CA1034135A/en not_active Expired
- 1974-07-05 DK DK362474A patent/DK136770C/da active
- 1974-07-05 SU SU2042435A patent/SU517228A3/ru active
- 1974-07-05 BE BE146253A patent/BE817294A/xx unknown
- 1974-07-05 CH CH928674A patent/CH602615A5/xx not_active IP Right Cessation
- 1974-07-05 DD DD179741A patent/DD113989A5/xx unknown
- 1974-07-05 AT AT555174A patent/AT338037B/de not_active IP Right Cessation
- 1974-07-05 FR FR7423503A patent/FR2235918B1/fr not_active Expired
- 1974-07-05 GB GB2992774A patent/GB1418247A/en not_active Expired
- 1974-07-05 BR BR5545/74A patent/BR7405545D0/pt unknown
- 1974-07-06 JP JP49076927A patent/JPS5040543A/ja active Pending
- 1974-07-06 JP JP49076928A patent/JPS5036631A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK136770C (da) | 1978-07-10 |
| CA1034135A (en) | 1978-07-04 |
| GB1418247A (en) | 1975-12-17 |
| CH602615A5 (en:Method) | 1978-07-31 |
| IL45197A (en) | 1977-10-31 |
| CS190428B2 (en) | 1979-05-31 |
| LU70471A1 (en:Method) | 1975-03-27 |
| JPS5040543A (en:Method) | 1975-04-14 |
| JPS5036631A (en:Method) | 1975-04-05 |
| ATA555174A (de) | 1976-11-15 |
| FR2235918A1 (en:Method) | 1975-01-31 |
| BR7405545D0 (pt) | 1975-05-06 |
| DD113989A5 (de) | 1975-07-12 |
| DK362474A (en:Method) | 1975-03-03 |
| DK136770B (da) | 1977-11-21 |
| SU517228A3 (ru) | 1976-06-05 |
| IL45197A0 (en) | 1974-10-22 |
| FR2235918B1 (en:Method) | 1978-11-24 |
| BE817294A (fr) | 1975-01-06 |
| US3962306A (en) | 1976-06-08 |
| DE2334607A1 (de) | 1975-01-30 |
| ZA744344B (en) | 1975-07-30 |
| NL7409072A (nl) | 1975-01-09 |
| AT338037B (de) | 1977-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2753872B2 (ja) | スルファモイルフェニル尿素 | |
| PL103685B1 (pl) | Srodek ochrony roslin | |
| US3434822A (en) | M-ureidophenyl carbamates as herbicides | |
| DK145261B (da) | Benzoylureido-nitro-diphenylethere til anvendelse i insecticider til plantebeskyttelse og andre tekniske formaal,samt insecticide midler indeholdende saadanne ethere | |
| PL91404B1 (en:Method) | ||
| US3845069A (en) | 1-(2-benzothiazolyl)-1-ethyl-3-methyl-urea | |
| US3917478A (en) | Herbicidal compositions and methods utilizing thiadiazolis ureas | |
| US3639668A (en) | N-(2 2 4 4-tetrafluoro-1 3-benzodioxanyl)-ureas | |
| US4087272A (en) | 4-(3-Trifluoromethylphenoxy)-phenylurea compounds and herbicidal compositions | |
| US3823006A (en) | Method for selective weed control in beets | |
| US3937726A (en) | Urea derivatives and their use as herbicides | |
| CS196431B2 (en) | Herbicide and method of producing the active constituent | |
| US4080193A (en) | (Trifluoromet hylphenoxy)-phenylurea compounds and herbicidal compositions | |
| CA1166250A (en) | Substituted tetrahydropyrimidinone derivatives, process for their preparation and their use as herbicides | |
| JPH02258764A (ja) | フツ素含有置換基を有するn―アリール窒素複素環式化合物 | |
| US3984468A (en) | Herbicidal N-trifluoromethylmercaptophenyl ureas | |
| US3660436A (en) | Sulfamoylaryl ureas | |
| US3954785A (en) | Acylated urea compounds and herbicidal compositions | |
| US3962304A (en) | Alkoxy-substituted benzyl dithiocarbamic acid esters | |
| US3772372A (en) | N-aryl ureas | |
| US3763209A (en) | 2,4-dicyano-6-nitro-benzene amines | |
| CA1142535A (en) | Substituted carbanilic acid esters, processes for the manufacture of these compounds and herbicidal preparations containing them | |
| CS208667B2 (en) | Herbicide means and method of making the active substances | |
| US4075235A (en) | N-Aryl-urea compounds and herbicidal compositions | |
| US3943180A (en) | 2,4-Bis-(trifluoromethyl)-6-nitrophenol compounds and herbicidal compositions |