PL89119B1 - - Google Patents
Download PDFInfo
- Publication number
- PL89119B1 PL89119B1 PL16266570A PL16266570A PL89119B1 PL 89119 B1 PL89119 B1 PL 89119B1 PL 16266570 A PL16266570 A PL 16266570A PL 16266570 A PL16266570 A PL 16266570A PL 89119 B1 PL89119 B1 PL 89119B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- methyl
- fluoro
- compound
- acetic acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- MLKXDPUZXIRXEP-UHFFFAOYSA-N 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-indenyl]acetic acid Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2C1=CC1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004185 ester group Chemical group 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- -1 3-diazo-5-fluoro-2-methyl-1- (4-methylsulfinylbenzyl) -indene Chemical compound 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- PTUSXMWNCXRKAX-UHFFFAOYSA-N 2-(1h-inden-1-yl)acetic acid Chemical compound C1=CC=C2C(CC(=O)O)C=CC2=C1 PTUSXMWNCXRKAX-UHFFFAOYSA-N 0.000 description 2
- 238000006680 Reformatsky reaction Methods 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- JPYUOLGNPMUDHV-UHFFFAOYSA-N 2-(3h-inden-1-yl)-3-phenylprop-2-enoic acid Chemical compound C=1CC2=CC=CC=C2C=1C(C(=O)O)=CC1=CC=CC=C1 JPYUOLGNPMUDHV-UHFFFAOYSA-N 0.000 description 1
- TYEYBOSBBBHJIV-UHFFFAOYSA-M 2-oxobutanoate Chemical compound CCC(=O)C([O-])=O TYEYBOSBBBHJIV-UHFFFAOYSA-M 0.000 description 1
- DNLFNKPOQAMIMG-UHFFFAOYSA-N 5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methyl]-1h-indene Chemical compound CC1=CC2=CC(F)=CC=C2C1CC1=CC=C(S(C)=O)C=C1 DNLFNKPOQAMIMG-UHFFFAOYSA-N 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PGTKVMVZBBZCKQ-UHFFFAOYSA-N Fulvene Chemical compound C=C1C=CC=C1 PGTKVMVZBBZCKQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 229910021549 Vanadium(II) chloride Inorganic materials 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- UZEDIBTVIIJELN-UHFFFAOYSA-N chromium(2+) Chemical compound [Cr+2] UZEDIBTVIIJELN-UHFFFAOYSA-N 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 description 1
- 229940109126 chromous chloride Drugs 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- SNWQUNCRDLUDEX-UHFFFAOYSA-N inden-1-one Chemical compound C1=CC=C2C(=O)C=CC2=C1 SNWQUNCRDLUDEX-UHFFFAOYSA-N 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012086 standard solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- NDLIRBZKZSDGSO-UHFFFAOYSA-N tosyl azide Chemical compound CC1=CC=C(S(=O)(=O)[N-][N+]#N)C=C1 NDLIRBZKZSDGSO-UHFFFAOYSA-N 0.000 description 1
- ITAKKORXEUJTBC-UHFFFAOYSA-L vanadium(ii) chloride Chemical compound Cl[V]Cl ITAKKORXEUJTBC-UHFFFAOYSA-L 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3397170A | 1970-05-01 | 1970-05-01 | |
| US3389070A | 1970-05-01 | 1970-05-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL89119B1 true PL89119B1 (enExample) | 1976-10-30 |
Family
ID=26710281
Family Applications (6)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16265970A PL89138B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266070A PL89135B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266370A PL89109B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266570A PL89119B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16265870A PL89242B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266470A PL89129B1 (enExample) | 1970-05-01 | 1970-11-18 |
Family Applications Before (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16265970A PL89138B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266070A PL89135B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266370A PL89109B1 (enExample) | 1970-05-01 | 1970-11-18 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16265870A PL89242B1 (enExample) | 1970-05-01 | 1970-11-18 | |
| PL16266470A PL89129B1 (enExample) | 1970-05-01 | 1970-11-18 |
Country Status (1)
| Country | Link |
|---|---|
| PL (6) | PL89138B1 (enExample) |
-
1970
- 1970-11-18 PL PL16265970A patent/PL89138B1/pl unknown
- 1970-11-18 PL PL16266070A patent/PL89135B1/pl unknown
- 1970-11-18 PL PL16266370A patent/PL89109B1/pl unknown
- 1970-11-18 PL PL16266570A patent/PL89119B1/pl unknown
- 1970-11-18 PL PL16265870A patent/PL89242B1/pl unknown
- 1970-11-18 PL PL16266470A patent/PL89129B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL89109B1 (enExample) | 1976-10-30 |
| PL89135B1 (enExample) | 1976-10-30 |
| PL89242B1 (enExample) | 1976-11-30 |
| PL89138B1 (enExample) | 1976-10-30 |
| PL89129B1 (enExample) | 1976-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3647858A (en) | Process for preparing 1-benzylidene-3-indenyl acetic acids | |
| US3822310A (en) | Substituted indenyl acetic acids | |
| US3829453A (en) | Octahydroanthracene-2-aminoacetic acids and esters and mixed anhydrides thereof | |
| US4247706A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| NO852981L (no) | Tricykliske dihydropyridazinoner og fremstilling derav. | |
| CA2107150C (fr) | Nouveaux derives chromeniques a chaine laterale trienique, leur procede de preparation et les compositions pharmaceutiques les renfermant | |
| SU1311618A3 (ru) | Способ получени производных азулена | |
| US3725470A (en) | Amino acid derivatives | |
| PL89119B1 (enExample) | ||
| WO1982001000A1 (en) | Disulfide type cysteine derivatives | |
| US4569945A (en) | Diarylindane-1,3-diones, their preparation and use | |
| US3663627A (en) | 1-indanmethanols | |
| EP0138765B1 (en) | 4H-benzo[4,5]cyclohepta[1,2-b]thiophene derivatives | |
| Geissman | Chromones. V. The Preparation of 2-Methyl-7-hydroxychromone and 2-Methyl-5, 8-dimethoxy-7-hydroxychromone | |
| US3892774A (en) | Cyclo pentathiophene derivatives | |
| SU1039439A3 (ru) | Способ получени 2-(3-феноксифенил)-пропионовой кислоты или ее кальциевой соли | |
| US3398188A (en) | And [4-(2-haloalkanoyl) phenylmercapto]-alkanoic acids | |
| US3870747A (en) | Intermediates and process for prostaglandin synthesis | |
| US4775691A (en) | 4H-benzo[4,5]cyclohepta[1,2-b]thiophene derivatives | |
| HU182436B (en) | Process for producing 2,3,4,5-tetrahydro-1-benzoxepine-3,5-dion derivatives | |
| US2853497A (en) | 6, 8-bis (hydrocarbon substituted mercapto) 5-hydroxycaprylic acids and delta-lactones thereof | |
| US3711513A (en) | 1-chlorothioxanthen-9-one preparation from 2,6-dichlorobenzonitrile | |
| US4100174A (en) | Process for the preparation of 2-(5H-dibenzo[a,d]cyclohepten-5-on-2-yl)acetic, propionic and butyric acids and intermediates | |
| US3962342A (en) | Bromination process | |
| US4208526A (en) | Process for the preparation of thiazolidin-4-one-acetic acid derivatives |