PL87037B1 - - Google Patents
Download PDFInfo
- Publication number
- PL87037B1 PL87037B1 PL1973160957A PL16095773A PL87037B1 PL 87037 B1 PL87037 B1 PL 87037B1 PL 1973160957 A PL1973160957 A PL 1973160957A PL 16095773 A PL16095773 A PL 16095773A PL 87037 B1 PL87037 B1 PL 87037B1
- Authority
- PL
- Poland
- Prior art keywords
- compound
- active ingredient
- general formula
- group
- ester
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 34
- 239000004480 active ingredient Substances 0.000 claims description 10
- -1 5- (4-chloraphenyl) -tetrazolyl-acetic acid ethyl ester Chemical group 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 239000013543 active substance Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 230000001105 regulatory effect Effects 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 230000008635 plant growth Effects 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- LEBWHRZEMNDASY-UHFFFAOYSA-N 2-[5-(4-chlorophenyl)tetrazol-1-yl]acetic acid Chemical group OC(=O)CN1N=NN=C1C1=CC=C(Cl)C=C1 LEBWHRZEMNDASY-UHFFFAOYSA-N 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 125000003107 substituted aryl group Chemical group 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 18
- 239000000203 mixture Substances 0.000 description 8
- 238000005507 spraying Methods 0.000 description 8
- 230000012010 growth Effects 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000282421 Canidae Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 235000011430 Malus pumila Nutrition 0.000 description 2
- 235000015103 Malus silvestris Nutrition 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000000837 carbohydrate group Chemical group 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- ILROLYQPRYHHFG-UHFFFAOYSA-N 1-$l^{1}-oxidanylprop-2-en-1-one Chemical group [O]C(=O)C=C ILROLYQPRYHHFG-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 108010039224 Amidophosphoribosyltransferase Proteins 0.000 description 1
- 235000004221 Brassica oleracea var gemmifera Nutrition 0.000 description 1
- 244000308368 Brassica oleracea var. gemmifera Species 0.000 description 1
- 101100231508 Caenorhabditis elegans ceh-5 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 244000141359 Malus pumila Species 0.000 description 1
- 101100293593 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) nar-1 gene Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 244000273256 Phragmites communis Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 244000107946 Spondias cytherea Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000005082 stem growth Effects 0.000 description 1
- 230000036435 stunted growth Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- 230000008511 vegetative development Effects 0.000 description 1
- 230000009105 vegetative growth Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cultivation Of Plants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB903572 | 1972-02-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL87037B1 true PL87037B1 (member.php) | 1976-06-30 |
Family
ID=9864144
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973160957A PL87037B1 (member.php) | 1972-02-28 | 1973-02-28 |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5828244B2 (member.php) |
| AU (1) | AU470451B2 (member.php) |
| BE (1) | BE795675A (member.php) |
| BR (1) | BR7301512D0 (member.php) |
| CA (1) | CA1013586A (member.php) |
| CH (1) | CH569406A5 (member.php) |
| CS (1) | CS172968B2 (member.php) |
| DD (1) | DD102561A5 (member.php) |
| DE (1) | DE2310049A1 (member.php) |
| DK (1) | DK133725B (member.php) |
| ES (1) | ES412139A1 (member.php) |
| FR (1) | FR2174085B1 (member.php) |
| GB (1) | GB1353699A (member.php) |
| HU (1) | HU165934B (member.php) |
| IL (1) | IL41552A (member.php) |
| IT (1) | IT983489B (member.php) |
| NL (1) | NL7302196A (member.php) |
| PL (1) | PL87037B1 (member.php) |
| SU (1) | SU525415A3 (member.php) |
| ZA (1) | ZA73832B (member.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59210263A (ja) * | 1983-05-14 | 1984-11-28 | Matsushita Electric Works Ltd | 浴槽への給湯装置 |
| JPS59178517U (ja) * | 1983-05-14 | 1984-11-29 | 松下電工株式会社 | 浴槽用給湯制御器 |
| JPS6017658A (ja) * | 1983-07-12 | 1985-01-29 | Matsushita Electric Ind Co Ltd | 自動給湯装置の制御装置 |
| JPS6023660U (ja) * | 1983-07-26 | 1985-02-18 | リンナイ株式会社 | 風呂装置 |
| JPS60130572A (ja) * | 1983-12-15 | 1985-07-12 | Sumitomo Chem Co Ltd | 5−(p−ニトロフエニル)テトラゾ−ル誘導体 |
| BR8506968A (pt) * | 1984-10-04 | 1986-12-23 | Ici Plc | Compostos de tetrazolila utilizaveis como inseticidas |
| WO1994013675A1 (fr) * | 1992-12-14 | 1994-06-23 | Yamanouchi Pharmaceutical Co., Ltd. | Nouveau procede de production pour un derive de pyrazolotriazole |
| US7572753B2 (en) | 2005-09-15 | 2009-08-11 | Chemtura Corporation | Tetrazole fungicides |
-
0
- BE BE795675D patent/BE795675A/xx not_active IP Right Cessation
-
1972
- 1972-02-28 GB GB903572A patent/GB1353699A/en not_active Expired
-
1973
- 1973-02-06 ZA ZA730832A patent/ZA73832B/xx unknown
- 1973-02-08 AU AU51967/73A patent/AU470451B2/en not_active Expired
- 1973-02-15 IL IL41552A patent/IL41552A/en unknown
- 1973-02-16 CA CA163,952A patent/CA1013586A/en not_active Expired
- 1973-02-16 NL NL7302196A patent/NL7302196A/xx not_active Application Discontinuation
- 1973-02-22 JP JP48020769A patent/JPS5828244B2/ja not_active Expired
- 1973-02-23 CS CS1327A patent/CS172968B2/cs unknown
- 1973-02-26 SU SU1885704A patent/SU525415A3/ru active
- 1973-02-27 HU HUIE558A patent/HU165934B/hu unknown
- 1973-02-27 FR FR7306884A patent/FR2174085B1/fr not_active Expired
- 1973-02-27 IT IT20938/73A patent/IT983489B/it active
- 1973-02-28 DE DE19732310049 patent/DE2310049A1/de not_active Withdrawn
- 1973-02-28 CH CH293173A patent/CH569406A5/xx not_active IP Right Cessation
- 1973-02-28 DD DD169171A patent/DD102561A5/xx unknown
- 1973-02-28 ES ES412139A patent/ES412139A1/es not_active Expired
- 1973-02-28 DK DK108873AA patent/DK133725B/da not_active IP Right Cessation
- 1973-02-28 PL PL1973160957A patent/PL87037B1/pl unknown
- 1973-02-28 BR BR731512A patent/BR7301512D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU470451B2 (en) | 1976-03-18 |
| BR7301512D0 (pt) | 1974-05-23 |
| FR2174085B1 (member.php) | 1977-02-04 |
| JPS5828244B2 (ja) | 1983-06-15 |
| BE795675A (fr) | 1973-08-20 |
| DD102561A5 (member.php) | 1973-12-20 |
| NL7302196A (member.php) | 1973-08-30 |
| DK133725B (da) | 1976-07-12 |
| HU165934B (member.php) | 1974-12-28 |
| IL41552A0 (en) | 1973-06-29 |
| IL41552A (en) | 1976-08-31 |
| DK133725C (member.php) | 1976-11-29 |
| SU525415A3 (ru) | 1976-08-15 |
| CS172968B2 (member.php) | 1977-01-28 |
| IT983489B (it) | 1974-10-31 |
| DE2310049A1 (de) | 1973-09-13 |
| CA1013586A (en) | 1977-07-12 |
| ZA73832B (en) | 1973-11-28 |
| AU5196773A (en) | 1974-08-08 |
| ES412139A1 (es) | 1976-05-01 |
| FR2174085A1 (member.php) | 1973-10-12 |
| GB1353699A (en) | 1974-05-22 |
| JPS4898029A (member.php) | 1973-12-13 |
| CH569406A5 (member.php) | 1975-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2002419C1 (ru) | Способ селективного подавлени нежелательной растительности | |
| PL110760B1 (en) | Agent accelerating plant growth and protecting plants | |
| US4518536A (en) | Compositions, which promote plant growth and protect plants, based on oxime ethers and oxime esters | |
| SU743561A3 (ru) | Микробицидное и регулирующее рост растений средство | |
| PL107799B1 (pl) | Fungicide srodek grzybobojczy | |
| SU518105A3 (ru) | Фунгицид | |
| RU2206993C2 (ru) | Новая фунгицидная композиция, содержащая 2-имидазолин-5-он, способ профилактики и лечения культур от фитопатогенных грибов | |
| US3865570A (en) | Plant growth stunting process | |
| PL87037B1 (member.php) | ||
| SU1435140A3 (ru) | Способ регулировани роста зерновых культур | |
| US2797181A (en) | Stabilized dithiocarbamate pesticidal composition | |
| JPH0472801B2 (member.php) | ||
| KR920003209B1 (ko) | 살진균 조성물 | |
| SU740141A3 (ru) | Гербицидна композици | |
| US3932458A (en) | Antimicrobial and plant-active 4,5-dihalopyrrole-2-carbonitriles | |
| IL35659A (en) | 9-azolylfluorene-9-carboxylic acid derivatives,their production and their use for the regulation of plant growth | |
| NO143704B (no) | Antimikrobielt aktivt dimetylditiokarbamatkompleks og anvendelse av dette i antimikrobielle, saerlig fungicide, preparater | |
| US3985539A (en) | 4,5-Dihalopyrrole-2-carbonitrile-containing terrestrial and aquatic hebicidal composition | |
| SU1181518A3 (ru) | Способ борьбы с сорн ками | |
| US3973034A (en) | Certain stabilized dithiocarbomate pesticidal compositions and methods of using same | |
| EP0064353B1 (en) | Use of 2,4-disubstituted-5-thiazolecarboxylic acids and derivatives for reducing injury to crop plants by acetamide herbicides | |
| SU589884A3 (ru) | Гербицидный состав | |
| US2774706A (en) | Fungicidal composition comprising shydrocarbyl isothiourea salts and method of applying the same | |
| SU579846A3 (ru) | Гербицидна композици | |
| US4584010A (en) | Method for controlling weeds in paddy rice |