PL83669B1 - Analogs of lincomycin and process[us3787390a] - Google Patents
Analogs of lincomycin and process[us3787390a] Download PDFInfo
- Publication number
- PL83669B1 PL83669B1 PL1972156175A PL15617572A PL83669B1 PL 83669 B1 PL83669 B1 PL 83669B1 PL 1972156175 A PL1972156175 A PL 1972156175A PL 15617572 A PL15617572 A PL 15617572A PL 83669 B1 PL83669 B1 PL 83669B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- radical
- halo
- formula
- scheme
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- OJMMVQQUTAEWLP-KIDUDLJLSA-N lincomycin Chemical compound CN1C[C@H](CCC)C[C@H]1C(=O)N[C@H]([C@@H](C)O)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O1 OJMMVQQUTAEWLP-KIDUDLJLSA-N 0.000 title abstract description 6
- OJMMVQQUTAEWLP-UHFFFAOYSA-N Lincomycin Natural products CN1CC(CCC)CC1C(=O)NC(C(C)O)C1C(O)C(O)C(O)C(SC)O1 OJMMVQQUTAEWLP-UHFFFAOYSA-N 0.000 title description 4
- 229960005287 lincomycin Drugs 0.000 title description 4
- 239000002253 acid Substances 0.000 claims abstract description 33
- 150000001875 compounds Chemical class 0.000 claims abstract description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims abstract description 8
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 6
- 229940100198 alkylating agent Drugs 0.000 claims abstract description 4
- 239000002168 alkylating agent Substances 0.000 claims abstract description 4
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 3
- 125000001475 halogen functional group Chemical group 0.000 claims abstract 4
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N Glycolaldehyde Chemical compound OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 238000005932 reductive alkylation reaction Methods 0.000 claims description 2
- 229910014033 C-OH Inorganic materials 0.000 claims 1
- 229910014570 C—OH Inorganic materials 0.000 claims 1
- 150000003839 salts Chemical class 0.000 abstract description 12
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 4
- 125000000217 alkyl group Chemical group 0.000 abstract description 3
- 150000002170 ethers Chemical class 0.000 abstract description 3
- 125000001118 alkylidene group Chemical group 0.000 abstract description 2
- 150000002148 esters Chemical class 0.000 abstract description 2
- 239000000203 mixture Substances 0.000 abstract description 2
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- -1 2-hydroxyethyl radical Chemical class 0.000 description 48
- 150000007513 acids Chemical class 0.000 description 14
- KDLRVYVGXIQJDK-AWPVFWJPSA-N clindamycin Chemical class CN1C[C@H](CCC)C[C@H]1C(=O)N[C@H]([C@H](C)Cl)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O1 KDLRVYVGXIQJDK-AWPVFWJPSA-N 0.000 description 11
- 229960002227 clindamycin Drugs 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical class O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000000845 anti-microbial effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- YJVWPNSZWZRJBB-UHFFFAOYSA-N 2,3-dimethylcyclohexene-1-carboxylic acid Chemical compound CC1CCCC(C(O)=O)=C1C YJVWPNSZWZRJBB-UHFFFAOYSA-N 0.000 description 2
- YQCGUVOBEYLABU-UHFFFAOYSA-N 2-butyl-3-methylbenzoic acid Chemical compound CCCCC1=C(C)C=CC=C1C(O)=O YQCGUVOBEYLABU-UHFFFAOYSA-N 0.000 description 2
- CVKWTXIHKCVONR-UHFFFAOYSA-N 4,5-dibromo-2-methylcyclohexane-1-carboxylic acid Chemical compound CC1CC(Br)C(Br)CC1C(O)=O CVKWTXIHKCVONR-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YVHAIVPPUIZFBA-UHFFFAOYSA-N Cyclopentylacetic acid Chemical compound OC(=O)CC1CCCC1 YVHAIVPPUIZFBA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000192125 Firmicutes Species 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 238000005649 metathesis reaction Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JBTLVYOJEHEFSK-UHFFFAOYSA-N 1,2,3,4,5,6-hexachlorocyclohexane-1-carboxylic acid Chemical compound OC(=O)C1(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JBTLVYOJEHEFSK-UHFFFAOYSA-N 0.000 description 1
- AZQCKYMBIZWHHL-UHFFFAOYSA-N 1-methyl-2-nitrocyclobutane-1-carboxylic acid Chemical compound OC(=O)C1(C)CCC1[N+]([O-])=O AZQCKYMBIZWHHL-UHFFFAOYSA-N 0.000 description 1
- REHQLKUNRPCYEW-UHFFFAOYSA-N 1-methylcyclohexane-1-carboxylic acid Chemical compound OC(=O)C1(C)CCCCC1 REHQLKUNRPCYEW-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- HXIPROAUVNYFJQ-UHFFFAOYSA-N 2,3-dibromo-2-methylcyclohexane-1-carboxylic acid Chemical compound CC1(Br)C(Br)CCCC1C(O)=O HXIPROAUVNYFJQ-UHFFFAOYSA-N 0.000 description 1
- CBGCMFGCROCYIA-UHFFFAOYSA-N 2,3-dibromo-6-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCC(Br)C(Br)C1C(O)=O CBGCMFGCROCYIA-UHFFFAOYSA-N 0.000 description 1
- JLIFDNPDBPWAOR-UHFFFAOYSA-N 2,5-dibromo-2-methylcyclohexane-1-carboxylic acid Chemical compound CC1(Br)CCC(Br)CC1C(O)=O JLIFDNPDBPWAOR-UHFFFAOYSA-N 0.000 description 1
- UOYCVJQBIVUXEK-UHFFFAOYSA-N 2-chlorocyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCCCC1Cl UOYCVJQBIVUXEK-UHFFFAOYSA-N 0.000 description 1
- CGMMPMYKMDITEA-UHFFFAOYSA-N 2-ethylbenzoic acid Chemical compound CCC1=CC=CC=C1C(O)=O CGMMPMYKMDITEA-UHFFFAOYSA-N 0.000 description 1
- QXKNDUSXGFIHHU-UHFFFAOYSA-N 2-methylcyclopentene-1-carboxylic acid Chemical compound CC1=C(C(O)=O)CCC1 QXKNDUSXGFIHHU-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- UQEASRXNMLAPSW-UHFFFAOYSA-N 3-bromo-2-methylcyclohexane-1-carboxylic acid Chemical compound CC1C(Br)CCCC1C(O)=O UQEASRXNMLAPSW-UHFFFAOYSA-N 0.000 description 1
- HSDLTSRULFFTGK-UHFFFAOYSA-N 3-bromo-3-methylcyclohexane-1-carboxylic acid Chemical compound CC1(Br)CCCC(C(O)=O)C1 HSDLTSRULFFTGK-UHFFFAOYSA-N 0.000 description 1
- MBUZJHOJWSDHAX-UHFFFAOYSA-N 3-iodopentanoic acid Chemical compound CCC(I)CC(O)=O MBUZJHOJWSDHAX-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HCNHIDFPSXEDAV-UHFFFAOYSA-N 4-chlorocyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(Cl)CC1 HCNHIDFPSXEDAV-UHFFFAOYSA-N 0.000 description 1
- DYIVJVIWWVFCAA-UHFFFAOYSA-N 5-bromo-2-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCC(Br)CC1C(O)=O DYIVJVIWWVFCAA-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N Camphoric acid Natural products CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- 244000168525 Croton tiglium Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 235000007265 Myrrhis odorata Nutrition 0.000 description 1
- 240000004760 Pimpinella anisum Species 0.000 description 1
- 235000012550 Pimpinella anisum Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- OOFSWSFNFSYBKE-UHFFFAOYSA-N acetic acid;methylcyclohexane Chemical compound CC(O)=O.CC1CCCCC1 OOFSWSFNFSYBKE-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- LSPHULWDVZXLIL-QUBYGPBYSA-N camphoric acid Chemical compound CC1(C)[C@H](C(O)=O)CC[C@]1(C)C(O)=O LSPHULWDVZXLIL-QUBYGPBYSA-N 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- RFMQOHXWHFHOJF-UHFFFAOYSA-N cyano thiocyanate Chemical compound N#CSC#N RFMQOHXWHFHOJF-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- TXWOGHSRPAYOML-UHFFFAOYSA-N cyclobutanecarboxylic acid Chemical compound OC(=O)C1CCC1 TXWOGHSRPAYOML-UHFFFAOYSA-N 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- FPIQZBQZKBKLEI-UHFFFAOYSA-N ethyl 1-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylate Chemical compound ClCCN(N=O)C(=O)NC1(C(=O)OCC)CCCCC1 FPIQZBQZKBKLEI-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GECNIOWBEXHZNM-UHFFFAOYSA-N hexyl hydrogen carbonate Chemical compound CCCCCCOC(O)=O GECNIOWBEXHZNM-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000622 liquid--liquid extraction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000013310 margarine Nutrition 0.000 description 1
- 239000003264 margarine Substances 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000590 parasiticidal effect Effects 0.000 description 1
- 239000002297 parasiticide Substances 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N pentadecanoic acid Chemical compound CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000021110 pickles Nutrition 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- PNGLEYLFMHGIQO-UHFFFAOYSA-M sodium;3-(n-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate;dihydrate Chemical compound O.O.[Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC=CC(OC)=C1 PNGLEYLFMHGIQO-UHFFFAOYSA-M 0.000 description 1
- STZCRXQWRGQSJD-UHFFFAOYSA-M sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate Chemical compound [Na+].C1=CC(N(C)C)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 STZCRXQWRGQSJD-UHFFFAOYSA-M 0.000 description 1
- WSWCOQWTEOXDQX-MQQKCMAXSA-N sorbic acid group Chemical group C(\C=C\C=C\C)(=O)O WSWCOQWTEOXDQX-MQQKCMAXSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- SZHOJFHSIKHZHA-UHFFFAOYSA-N tridecanoic acid Chemical compound CCCCCCCCCCCCC(O)=O SZHOJFHSIKHZHA-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/02—Acyclic radicals, not substituted by cyclic structures
- C07H15/14—Acyclic radicals, not substituted by cyclic structures attached to a sulfur, selenium or tellurium atom of a saccharide radical
- C07H15/16—Lincomycin; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Biotechnology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Crystallography & Structural Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US15609971A | 1971-06-23 | 1971-06-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83669B1 true PL83669B1 (en) | 1975-12-31 |
Family
ID=22558082
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972156175A PL83669B1 (en) | 1971-06-23 | 1972-06-21 | Analogs of lincomycin and process[us3787390a] |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3787390A (enExample) |
| JP (1) | JPS5527073B1 (enExample) |
| AR (1) | AR192647A1 (enExample) |
| AT (1) | AT316748B (enExample) |
| AU (1) | AU461036B2 (enExample) |
| BE (1) | BE785372A (enExample) |
| CA (1) | CA959050A (enExample) |
| CH (1) | CH571536A5 (enExample) |
| CS (1) | CS190369B2 (enExample) |
| DK (1) | DK138748B (enExample) |
| ES (1) | ES403871A1 (enExample) |
| FI (1) | FI55850C (enExample) |
| FR (1) | FR2143288B1 (enExample) |
| GB (1) | GB1347598A (enExample) |
| HU (1) | HU165760B (enExample) |
| IL (1) | IL39596A (enExample) |
| NL (1) | NL157312B (enExample) |
| NO (1) | NO138285C (enExample) |
| OA (1) | OA04111A (enExample) |
| PH (1) | PH9346A (enExample) |
| PL (1) | PL83669B1 (enExample) |
| SE (1) | SE385706B (enExample) |
| YU (1) | YU36742B (enExample) |
| ZA (1) | ZA723849B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7199105B2 (en) * | 2002-08-15 | 2007-04-03 | Vicuron Pharmaceuticals, Inc. | Lincomycin derivatives possessing antibacterial activity |
| ZA200501012B (en) * | 2002-08-15 | 2006-10-25 | Vicuron Pharm Inc | Lincomycin derivatives possessing antibacterial activity |
| OA13179A (en) * | 2003-06-17 | 2006-12-13 | Vicuron Pharm Inc | Novel lincomycin derivatives possessing antimicrobial activity. |
| US7256177B2 (en) | 2003-06-17 | 2007-08-14 | Vicuron Pharmaceuticals, Inc. | Lincomycin derivatives possessing antibacterial activity |
| US7199106B2 (en) | 2003-06-17 | 2007-04-03 | Vicuron Pharmaceuticals, Inc. | Lincomycin derivatives possessing antimicrobial activity |
| US7361743B2 (en) * | 2004-02-11 | 2008-04-22 | Pfizer Inc | Lincomycin derivatives possessing antibacterial activity |
-
1971
- 1971-06-23 US US00156099A patent/US3787390A/en not_active Expired - Lifetime
-
1972
- 1972-05-16 CA CA142,280A patent/CA959050A/en not_active Expired
- 1972-05-29 FI FI1504/72A patent/FI55850C/fi active
- 1972-06-01 PH PH13594*UA patent/PH9346A/en unknown
- 1972-06-02 IL IL39596A patent/IL39596A/xx unknown
- 1972-06-06 ZA ZA723849A patent/ZA723849B/xx unknown
- 1972-06-07 AU AU43186/72A patent/AU461036B2/en not_active Expired
- 1972-06-07 AR AR242412A patent/AR192647A1/es active
- 1972-06-08 GB GB2686372A patent/GB1347598A/en not_active Expired
- 1972-06-14 JP JP5866172A patent/JPS5527073B1/ja active Pending
- 1972-06-14 ES ES403871A patent/ES403871A1/es not_active Expired
- 1972-06-20 AT AT531172A patent/AT316748B/de not_active IP Right Cessation
- 1972-06-21 CH CH929372A patent/CH571536A5/xx not_active IP Right Cessation
- 1972-06-21 PL PL1972156175A patent/PL83669B1/pl unknown
- 1972-06-21 CS CS724364A patent/CS190369B2/cs unknown
- 1972-06-22 SE SE7208317A patent/SE385706B/xx unknown
- 1972-06-22 OA OA54612A patent/OA04111A/xx unknown
- 1972-06-22 NO NO2229/72A patent/NO138285C/no unknown
- 1972-06-22 NL NL7208545.A patent/NL157312B/xx not_active IP Right Cessation
- 1972-06-22 YU YU1659/72A patent/YU36742B/xx unknown
- 1972-06-22 FR FR7222555A patent/FR2143288B1/fr not_active Expired
- 1972-06-22 DK DK312272AA patent/DK138748B/da not_active IP Right Cessation
- 1972-06-23 HU HUUO79A patent/HU165760B/hu unknown
- 1972-06-23 BE BE785372A patent/BE785372A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU4318672A (en) | 1973-12-13 |
| AR192647A1 (es) | 1973-02-28 |
| JPS5527073B1 (enExample) | 1980-07-17 |
| BE785372A (fr) | 1972-12-27 |
| FR2143288B1 (enExample) | 1976-04-16 |
| DK138748C (enExample) | 1979-04-02 |
| YU165972A (en) | 1982-02-25 |
| YU36742B (en) | 1984-08-31 |
| DK138748B (da) | 1978-10-23 |
| CS190369B2 (en) | 1979-05-31 |
| AU461036B2 (en) | 1975-04-28 |
| NO138285B (no) | 1978-05-02 |
| IL39596A (en) | 1975-08-31 |
| CA959050A (en) | 1974-12-10 |
| GB1347598A (en) | 1974-02-27 |
| IL39596A0 (en) | 1972-08-30 |
| HU165760B (enExample) | 1974-10-28 |
| CH571536A5 (enExample) | 1976-01-15 |
| FR2143288A1 (enExample) | 1973-02-02 |
| ZA723849B (en) | 1973-03-28 |
| OA04111A (fr) | 1979-11-15 |
| FI55850C (fi) | 1979-10-10 |
| PH9346A (en) | 1975-10-06 |
| NL157312B (nl) | 1978-07-17 |
| SE385706B (sv) | 1976-07-19 |
| ES403871A1 (es) | 1975-05-16 |
| NL7208545A (enExample) | 1972-12-28 |
| NO138285C (no) | 1978-08-09 |
| FI55850B (fi) | 1979-06-29 |
| US3787390A (en) | 1974-01-22 |
| AT316748B (de) | 1974-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3544551A (en) | 7-mercapto-7-deoxylincomycins and process for preparing the same | |
| US3475407A (en) | Process for preparing 7(r)- and 7(s)-halolincomycins | |
| DK164664B (da) | Pleuromutilinderivater, fremgangsmaade til fremstilling deraf, kemoterapeutisk praeparat samt foder- eller drikkevandsadditivpraeparat indeholdende et pleuromutilinderivat | |
| PL83669B1 (en) | Analogs of lincomycin and process[us3787390a] | |
| US3079378A (en) | Acylated psicofuranosyladenines | |
| US3513155A (en) | Sulfoxides of 7-halo-7-deoxylincomycins and process | |
| US4021601A (en) | Paromomycin derivatives and process for the preparation thereof | |
| US3915954A (en) | Derivatives of lincomycin and its analogs and process | |
| DE2229950C2 (de) | 7-Desoxy-7 (S) -thio-lincomycine, deren Säureadditionssalze und Verfahren zu deren Herstellung | |
| US3549615A (en) | Lincomycin derivatives and process for producing the same | |
| US3853843A (en) | Derivatives of thiolincosaminide compounds | |
| PL118573B1 (en) | Process for preparing novel derivatives of oleandomycin,erythromycin a or b,erythromycyloamine or erythromycin carbonateitromiciny a ili b,ehritromicilamina ili karbonata ehritromicina | |
| US4048202A (en) | 3-O-Alkanoylglyceric acids | |
| US4228179A (en) | 3-Oxo-2-azaspiro-2-(N-methyl)-acetamides | |
| US3580904A (en) | 7-halo-7-deoxy-lincomycin derivatives | |
| US3502648A (en) | 7-halo-7-deoxythiolincosaminides and process for preparing the same | |
| CH667094A5 (de) | Substituierte 7-oxomitosane. | |
| DE2321752A1 (de) | Neue aldonsaeureamide und verfahren zu ihrer herstellung | |
| US3655885A (en) | Antibacterial compositions and methods of treating bacterial infections | |
| US3767649A (en) | Process for making derivatives of lincomycin and its analogs | |
| CH632519A5 (de) | Verfahren zur herstellung von alkyl-(7r,s)-7-deoxy-7-(omega-substituiert-alkylthio)-alpha-thiolincosaminiden. | |
| US3382230A (en) | Oxygenated derivatives of methyl 6-amino-6, 8-dideoxy-1-thio-d-erythro-alpha-d-galacto-octopyranoside and ethyl 6-amino-6, 8-dideoxy-1-thio-d-erythro-alpha-d-galacto-octo-pyranoside and process for producing the same | |
| US3326891A (en) | Lincomycin acylates | |
| US2838552A (en) | New chloramphenicol esters and method of synthesizing same | |
| DE2230427A1 (de) | Clindamycinanaloge und Verfahren zu deren Herstellung |