PL83620B1 - - Google Patents
Download PDFInfo
- Publication number
- PL83620B1 PL83620B1 PL1970141454A PL14145470A PL83620B1 PL 83620 B1 PL83620 B1 PL 83620B1 PL 1970141454 A PL1970141454 A PL 1970141454A PL 14145470 A PL14145470 A PL 14145470A PL 83620 B1 PL83620 B1 PL 83620B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- formula
- compound
- compounds
- general formula
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 39
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 17
- -1 alkyl radicals Chemical class 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 17
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 9
- 150000008064 anhydrides Chemical class 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 8
- 239000011877 solvent mixture Substances 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 6
- 150000007530 organic bases Chemical class 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 5
- 150000001540 azides Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- ZAGRKAFMISFKIO-UHFFFAOYSA-N Isolysergic acid Natural products C1=CC(C2=CC(CN(C2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-UHFFFAOYSA-N 0.000 claims description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 3
- 150000001805 chlorine compounds Chemical class 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 230000011987 methylation Effects 0.000 claims description 3
- 238000007069 methylation reaction Methods 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 150000003840 hydrochlorides Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 230000007935 neutral effect Effects 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- VPZWPHLXULLNRZ-RHSMWYFYSA-N (6aR,9R)-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC(C2=C[C@](C)(CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 VPZWPHLXULLNRZ-RHSMWYFYSA-N 0.000 claims 1
- FSIZNIXUPRQTLZ-QMTHXVAHSA-N lysergic acid Chemical compound C1=CC=C2C3=C[C@@H](C(O)=O)CN(C)[C@@H]3CC3=CN=C1[C]32 FSIZNIXUPRQTLZ-QMTHXVAHSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- 239000000243 solution Substances 0.000 description 41
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 235000002639 sodium chloride Nutrition 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 13
- 229910000029 sodium carbonate Inorganic materials 0.000 description 10
- 239000012071 phase Substances 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 102000003946 Prolactin Human genes 0.000 description 5
- 108010057464 Prolactin Proteins 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 229940097325 prolactin Drugs 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- IVIUCVPWPODFER-UHFFFAOYSA-N 2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid Chemical compound CCOC(=O)C(C(O)=O)(C(C)C)OCC1=CC=CC=C1 IVIUCVPWPODFER-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- ZAGRKAFMISFKIO-QMTHXVAHSA-N lysergic acid Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-QMTHXVAHSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- KWGRBVOPPLSCSI-WCBMZHEXSA-N pseudoephedrine Chemical compound CN[C@@H](C)[C@@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WCBMZHEXSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- JXGVXCZADZNAMJ-NSHDSACASA-N (2s)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCCN1C(=O)OCC1=CC=CC=C1 JXGVXCZADZNAMJ-NSHDSACASA-N 0.000 description 1
- WGZBEDCLEXJQGW-IAQYHMDHSA-N (6ar,9r)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CN(C)C3=C1 WGZBEDCLEXJQGW-IAQYHMDHSA-N 0.000 description 1
- FXHKTXNWXVKCCJ-BWTUWSSMSA-N (6ar,9r)-7-methyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl chloride;hydrochloride Chemical compound Cl.C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(Cl)=O)=C3C2=CNC3=C1 FXHKTXNWXVKCCJ-BWTUWSSMSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- GXWNSJYVSIJRLS-UHFFFAOYSA-N 6-bromo-8-methylimidazo[1,2-a]pyrazine Chemical compound CC1=NC(Br)=CN2C=CN=C12 GXWNSJYVSIJRLS-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000124224 Claviceps paspali Species 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- HWBLTYHIEYOAOL-UHFFFAOYSA-N Diisopropyl sulfate Chemical compound CC(C)OS(=O)(=O)OC(C)C HWBLTYHIEYOAOL-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- LRMLTYOJCFBKLZ-UHFFFAOYSA-N diethyl 2-phenylmethoxy-2-propan-2-ylpropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)(C(C)C)OCC1=CC=CC=C1 LRMLTYOJCFBKLZ-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229960003133 ergot alkaloid Drugs 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000006651 lactation Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- VXGRMCZTYDXKQW-YFKPBYRVSA-N methyl (2s)-2-aminopentanoate Chemical compound CCC[C@H](N)C(=O)OC VXGRMCZTYDXKQW-YFKPBYRVSA-N 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 229960003908 pseudoephedrine Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
- C07D519/02—Ergot alkaloids of the cyclic peptide type
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH946269A CH517099A (de) | 1969-06-20 | 1969-06-20 | Verfahren zur Herstellung neuer Mutterkornpeptidalkaloide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83620B1 true PL83620B1 (en, 2012) | 1975-12-31 |
Family
ID=4352231
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141454A PL83620B1 (en, 2012) | 1969-06-20 | 1970-06-19 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3681355A (en, 2012) |
| AT (1) | AT317447B (en, 2012) |
| BE (1) | BE752197A (en, 2012) |
| CA (1) | CA947292A (en, 2012) |
| CH (1) | CH517099A (en, 2012) |
| CS (1) | CS163213B2 (en, 2012) |
| DE (1) | DE2029447A1 (en, 2012) |
| DK (1) | DK129454B (en, 2012) |
| ES (2) | ES380883A1 (en, 2012) |
| FR (1) | FR2052994B1 (en, 2012) |
| GB (1) | GB1309283A (en, 2012) |
| HU (1) | HU162311B (en, 2012) |
| IL (1) | IL34747A (en, 2012) |
| NL (1) | NL7008409A (en, 2012) |
| NO (1) | NO128995B (en, 2012) |
| PL (1) | PL83620B1 (en, 2012) |
| SU (1) | SU417944A3 (en, 2012) |
| ZA (1) | ZA704193B (en, 2012) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3846433A (en) * | 1969-05-06 | 1974-11-05 | Sandoz Ltd | Process for preparing ergot alkaloids |
| WO2011079313A1 (en) * | 2009-12-23 | 2011-06-30 | Map Pharmaceuticals, Inc. | Novel ergoline analogs |
| US8604035B2 (en) | 2011-06-23 | 2013-12-10 | Map Pharmaceuticals, Inc. | Fluoroergoline analogs |
| WO2013095707A1 (en) | 2011-12-19 | 2013-06-27 | Map Pharmaceuticals, Inc. | Novel iso-ergoline derivatives |
| EP2793583A4 (en) | 2011-12-21 | 2015-08-12 | Map Pharmaceuticals Inc | NOVEL NEUROMODULATORY CONNECTIONS |
| US9012640B2 (en) | 2012-06-22 | 2015-04-21 | Map Pharmaceuticals, Inc. | Cabergoline derivatives |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2997470A (en) * | 1956-03-05 | 1961-08-22 | Lilly Co Eli | Lysergic acid amides |
| CH344731A (de) * | 1956-05-18 | 1960-02-29 | Sandoz Ag | Verfahren zur Herstellung von neuen, am Indolstickstoff alkylierten Derivaten der Lysergsäure-Reihe |
| GB1011112A (en) * | 1961-05-10 | 1965-11-24 | Sandoz Ag | Improvements in or relating to ergot alkaloids |
| CH469006A (de) * | 1965-07-07 | 1969-02-28 | Sandoz Ag | Verfahren zur Herstellung neuer synthetischer Alkaloide |
| CH469735A (de) * | 1965-11-02 | 1969-03-15 | Sandoz Ag | Verfahren zur Herstellung heterocyclischer Verbindungen |
| FR1583797A (en, 2012) * | 1967-04-12 | 1969-12-05 |
-
1969
- 1969-06-20 CH CH946269A patent/CH517099A/de not_active IP Right Cessation
-
1970
- 1970-06-05 GB GB2714370A patent/GB1309283A/en not_active Expired
- 1970-06-10 NL NL7008409A patent/NL7008409A/xx unknown
- 1970-06-15 DE DE19702029447 patent/DE2029447A1/de active Pending
- 1970-06-15 US US46480A patent/US3681355A/en not_active Expired - Lifetime
- 1970-06-17 SU SU1451383A patent/SU417944A3/ru active
- 1970-06-18 ES ES380883A patent/ES380883A1/es not_active Expired
- 1970-06-18 BE BE752197D patent/BE752197A/xx unknown
- 1970-06-18 FR FR7022467A patent/FR2052994B1/fr not_active Expired
- 1970-06-18 IL IL34747A patent/IL34747A/en unknown
- 1970-06-18 CA CA85861A patent/CA947292A/en not_active Expired
- 1970-06-19 CS CS4317A patent/CS163213B2/cs unknown
- 1970-06-19 NO NO02386/70A patent/NO128995B/no unknown
- 1970-06-19 HU HUSA2105A patent/HU162311B/hu unknown
- 1970-06-19 ZA ZA704193A patent/ZA704193B/xx unknown
- 1970-06-19 PL PL1970141454A patent/PL83620B1/pl unknown
- 1970-06-19 DK DK317370AA patent/DK129454B/da unknown
- 1970-06-19 AT AT554170A patent/AT317447B/de not_active IP Right Cessation
-
1971
- 1971-01-28 ES ES387714A patent/ES387714A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SU417944A3 (ru) | 1974-02-28 |
| DK129454C (en, 2012) | 1975-03-03 |
| DE2029447A1 (de) | 1971-01-07 |
| DK129454B (da) | 1974-10-14 |
| HU162311B (en, 2012) | 1973-01-29 |
| IL34747A0 (en) | 1970-08-19 |
| NO128995B (en, 2012) | 1974-02-11 |
| BE752197A (fr) | 1970-12-18 |
| ZA704193B (en) | 1972-01-26 |
| CS163213B2 (en, 2012) | 1975-08-29 |
| GB1309283A (en) | 1973-03-07 |
| CH517099A (de) | 1971-12-31 |
| ES387714A1 (es) | 1974-01-01 |
| FR2052994B1 (en, 2012) | 1974-05-24 |
| ES380883A1 (es) | 1973-04-01 |
| AT317447B (de) | 1974-08-26 |
| FR2052994A1 (en, 2012) | 1971-04-16 |
| IL34747A (en) | 1973-07-30 |
| CA947292A (en) | 1974-05-14 |
| US3681355A (en) | 1972-08-01 |
| NL7008409A (en, 2012) | 1970-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL87735B1 (en) | Phthalide penicillin ester intermediates[USRE29650E] | |
| NZ336878A (en) | Imidazo pyridine compounds for inhibition of gastric acid secretion | |
| JPS582946B2 (ja) | ８− チオメチルエルゴリンルイノ セイホウ | |
| PL83620B1 (en, 2012) | ||
| US5049559A (en) | Thieno-triazolo-diazepine derivatives useful as anti-ischemic agents | |
| PL131618B1 (en) | Process for preparing novel inhibitors of dipeptase | |
| FI59254B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara ergopeptinderivat | |
| PL80112B1 (en, 2012) | ||
| NO135421B (en, 2012) | ||
| US4791115A (en) | 2,6-dimethyl-8α-pivaloylamino-9,10-didehydro-ergoline | |
| FI100970B (fi) | Menetelmä 2-dialkyyliaminoalkyyli-26-sulfonyylipristinamysiini IIB:n u usien suolojen valmistamiseksi | |
| PL124350B1 (en) | Process for preparing vindesin | |
| US4355166A (en) | Quinuclidinic ester and derivatives of phenoxycarboxylic acids | |
| US4035501A (en) | N-lysergyl-amino-pyridines | |
| PL81562B1 (en, 2012) | ||
| US4013644A (en) | [8 α(E), 13aβ]-5,8,13,13a-tetrahydro-2,3,10,11-tetramethoxy-8-(2-phenylethenyl)-6H-dibenzo[a,g]quinolizines and intermediates thereto | |
| US4098790A (en) | Ergoline chlorination process | |
| KR970004044B1 (ko) | 약물동력학적으로 개선된 세팔로스포린 유도체, 그의 제조방법, 그를 함유하는 약제학적 조성물 및 합성 중간체 | |
| US5183816A (en) | Bicyclic sulfur-containing compounds | |
| US4596830A (en) | Novel derivatives of 2-(2-thienyl)-imidazo[4,5-b]-pyridines and their pharmaceutically acceptable salts | |
| US4112102A (en) | Halopyridyl derivatives of m-aminotetramisole as anthelmintics | |
| US4421756A (en) | Quinolinoneimine carboxylic acid anti-inflammatory and analgesic composition containing the compound | |
| KR800000558B1 (ko) | 6-메틸-8-(치환) 메틸에르골린류의 제조방법 | |
| SU420175A3 (en, 2012) | ||
| DE2021706C2 (de) | Verfahren zur Herstellung von peptidartigen Mutterkornalkaloiden |