PL83205B1 - - Google Patents
Download PDFInfo
- Publication number
- PL83205B1 PL83205B1 PL1971149810A PL14981071A PL83205B1 PL 83205 B1 PL83205 B1 PL 83205B1 PL 1971149810 A PL1971149810 A PL 1971149810A PL 14981071 A PL14981071 A PL 14981071A PL 83205 B1 PL83205 B1 PL 83205B1
- Authority
- PL
- Poland
- Prior art keywords
- radical
- dinitro
- carbon atoms
- alkyl radical
- methoxy
- Prior art date
Links
- -1 alkyl radical Chemical class 0.000 claims description 74
- 150000001875 compounds Chemical class 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 230000002363 herbicidal effect Effects 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 239000004009 herbicide Substances 0.000 claims description 6
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- CGNBQYFXGQHUQP-UHFFFAOYSA-N 2,3-dinitroaniline Chemical class NC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O CGNBQYFXGQHUQP-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- KTHQZVGFYJIYDM-UHFFFAOYSA-N 3-methoxy-2,6-dinitro-N-pentan-3-yl-4-(trifluoromethyl)aniline Chemical group CCC(CC)NC1=C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)OC)[N+](=O)[O-] KTHQZVGFYJIYDM-UHFFFAOYSA-N 0.000 claims 1
- NELVKRRREKWBII-UHFFFAOYSA-N 3-methoxy-2,6-dinitro-n,n-dipropyl-4-(trifluoromethyl)aniline Chemical group CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(OC)=C1[N+]([O-])=O NELVKRRREKWBII-UHFFFAOYSA-N 0.000 claims 1
- 101100127656 Caenorhabditis elegans lam-2 gene Proteins 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 13
- 239000004094 surface-active agent Substances 0.000 description 6
- 239000000969 carrier Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000544034 Limnocharis Species 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 241000282461 Canis lupus Species 0.000 description 2
- 206010011878 Deafness Diseases 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 235000019713 millet Nutrition 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical class [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SVYOXGBINYWSDQ-UHFFFAOYSA-N 1,4-dioxane;ethanol Chemical compound CCO.C1COCCO1 SVYOXGBINYWSDQ-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- WPMDQFVNGNGFNS-UHFFFAOYSA-N 3-methoxy-N,N-bis(2-methoxyethyl)-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound COCCN(CCOC)C1=C(C(OC)=C(C=C1[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O WPMDQFVNGNGFNS-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003568 4-hydroxy-2-butynyl group Chemical group [H]OC([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- HJQXVTKHJLEPIS-UHFFFAOYSA-N N,N-diethyl-3-methylsulfanyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound CCN(CC)C1=C(C(SC)=C(C=C1[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O HJQXVTKHJLEPIS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000243774 Trichinella Species 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 230000009194 climbing Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000005016 hydroxyalkynyl group Chemical group 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- CRVVHBFLWWQMPT-UHFFFAOYSA-N naphthalene-1-sulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 CRVVHBFLWWQMPT-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N33/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic nitrogen compounds
- A01N33/16—Biocides, pest repellants or attractants, or plant growth regulators containing organic nitrogen compounds containing nitrogen-to-oxygen bonds
- A01N33/18—Nitro compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US6142870A | 1970-08-05 | 1970-08-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83205B1 true PL83205B1 (enEXAMPLES) | 1975-12-31 |
Family
ID=22035710
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971149810A PL83205B1 (enEXAMPLES) | 1970-08-05 | 1971-08-03 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3764624A (enEXAMPLES) |
| AT (1) | AT311315B (enEXAMPLES) |
| AU (1) | AU459328B2 (enEXAMPLES) |
| BE (1) | BE770936A (enEXAMPLES) |
| BR (1) | BR7104999D0 (enEXAMPLES) |
| CA (1) | CA943957A (enEXAMPLES) |
| CH (1) | CH565739A5 (enEXAMPLES) |
| DD (1) | DD96136A5 (enEXAMPLES) |
| DE (1) | DE2135140B2 (enEXAMPLES) |
| ES (1) | ES393862A1 (enEXAMPLES) |
| FR (1) | FR2101862A5 (enEXAMPLES) |
| GB (1) | GB1308841A (enEXAMPLES) |
| IL (1) | IL37406A (enEXAMPLES) |
| IT (1) | IT941655B (enEXAMPLES) |
| NL (1) | NL150659B (enEXAMPLES) |
| OA (1) | OA03772A (enEXAMPLES) |
| PL (1) | PL83205B1 (enEXAMPLES) |
| SU (1) | SU370753A3 (enEXAMPLES) |
| ZA (1) | ZA715199B (enEXAMPLES) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4227913A (en) * | 1971-06-30 | 1980-10-14 | American Cyanamid Company | Inhibiting plant bud growth with substituted 2,6-dinitroanilines |
| US3920742A (en) * | 1971-08-25 | 1975-11-18 | American Cyanamid Co | N-sec-alkyl-2,6-dinitro-3,4-xylidine herbicides |
| US4165231A (en) * | 1971-08-25 | 1979-08-21 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4166908A (en) * | 1971-08-25 | 1979-09-04 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4066441A (en) * | 1971-08-25 | 1978-01-03 | American Cyanamid Company | Preemergence herbicidal methods and compositions using 2,6-dinitroxylidine compounds |
| US4251264A (en) * | 1971-08-25 | 1981-02-17 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4057419A (en) * | 1972-02-29 | 1977-11-08 | Bayer Aktiengesellschaft | 2,4-Bis-(trifluoromethyl)-6-nitrophenol compounds and herbicidal compositions |
| US4123250A (en) * | 1972-04-19 | 1978-10-31 | American Cyanamid Company | Inhibiting plant bud growth with substituted 2,6-di-nitroanilines |
| US3950377A (en) * | 1972-12-20 | 1976-04-13 | Imperial Chemical Industries Limited | Diphenylamine derivatives |
| US4041172A (en) * | 1972-12-20 | 1977-08-09 | Imperial Chemical Industries Limited | Compositions and methods for combating insect pests or fungal pests of plants |
| US4046758A (en) * | 1974-03-05 | 1977-09-06 | United States Borax & Chemical Corporation | 3-Halo-2,6-dinitro-4-trifluoromethylanilines |
| US4192670A (en) * | 1974-10-15 | 1980-03-11 | Eli Lilly And Company | Acetal derivatives of 4-(substituted amino)-3,5-dinitrobenzaldehydes |
| CA1106390A (en) * | 1974-12-04 | 1981-08-04 | Don L. Hunter | Nitrophenylhydrazine compounds |
| US3958974A (en) * | 1974-12-20 | 1976-05-25 | Velsicol Chemical Corporation | Herbicidal N-aryl substituted azetidinones |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| US4180568A (en) * | 1975-06-23 | 1979-12-25 | Eli Lilly And Company | Control of phytopathogens with certain 2,6-dinitroanilines |
| US4124639A (en) * | 1975-12-22 | 1978-11-07 | America Cyanamid Company | N-alkoxyalkyl-2,6-dinitroaniline herbicides |
| US4101582A (en) * | 1975-12-22 | 1978-07-18 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4045466A (en) * | 1976-03-19 | 1977-08-30 | Eli Lilly And Company | 3-Cyanoalkylthio- or 3-alkoxycarbonylmethylthio-2,6-di-nitroanilines |
| US4133672A (en) * | 1977-02-07 | 1979-01-09 | United States Borax & Chemical Corporation | (Aminophenyl)morpholines and use thereof |
| US4297127A (en) * | 1977-03-11 | 1981-10-27 | American Cyanamid Company | Herbicidal use of 2,6-dinitroaniline herbicides |
| US4152460A (en) * | 1978-01-30 | 1979-05-01 | Eli Lilly And Company | 3-Chloro-2,6-dinitro-N-(substituted phenyl)-4-(trifluoromethyl)benzenamines |
| US4259347A (en) * | 1978-02-16 | 1981-03-31 | Eli Lilly And Company | Control of phytopathogens using dinitroaniline compounds |
| US4391992A (en) * | 1979-08-24 | 1983-07-05 | American Cyanamid Company | N-Denitration of N,2,6-trinitroanilines with phase transfer catalysts |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU36400A1 (enEXAMPLES) * | 1957-09-17 | |||
| BE628133A (enEXAMPLES) * | 1962-02-08 | |||
| US3257190A (en) * | 1962-12-10 | 1966-06-21 | Lilly Co Eli | Method of eliminating weed grasses and broadleaf weeds |
| US3403180A (en) * | 1963-10-07 | 1968-09-24 | Lilly Co Eli | 4-trifluoromethyl-2, 6-dinitroanilines |
| US3518076A (en) * | 1967-05-17 | 1970-06-30 | Lilly Co Eli | Method of fliminating weed species with herbicidal combination |
| US3546295A (en) * | 1968-08-01 | 1970-12-08 | Exxon Research Engineering Co | N-cycloalkyl anilines |
-
1970
- 1970-08-05 US US00061428A patent/US3764624A/en not_active Expired - Lifetime
-
1971
- 1971-06-10 CA CA115,378A patent/CA943957A/en not_active Expired
- 1971-07-14 DE DE2135140A patent/DE2135140B2/de not_active Withdrawn
- 1971-07-20 FR FR7126470A patent/FR2101862A5/fr not_active Expired
- 1971-07-22 GB GB3488971A patent/GB1308841A/en not_active Expired
- 1971-07-26 AT AT646271A patent/AT311315B/de not_active IP Right Cessation
- 1971-07-28 IL IL37406A patent/IL37406A/en unknown
- 1971-07-28 CH CH1114071A patent/CH565739A5/xx not_active IP Right Cessation
- 1971-08-03 DD DD161898A patent/DD96136A5/xx unknown
- 1971-08-03 PL PL1971149810A patent/PL83205B1/pl unknown
- 1971-08-03 ES ES393862A patent/ES393862A1/es not_active Expired
- 1971-08-04 BR BR4999/71A patent/BR7104999D0/pt unknown
- 1971-08-04 IT IT27180/71A patent/IT941655B/it active
- 1971-08-04 AU AU32014/71A patent/AU459328B2/en not_active Expired
- 1971-08-04 ZA ZA715199A patent/ZA715199B/xx unknown
- 1971-08-04 BE BE770936A patent/BE770936A/xx unknown
- 1971-08-05 NL NL717110826A patent/NL150659B/xx unknown
- 1971-08-05 SU SU1689351A patent/SU370753A3/ru active
- 1971-08-05 OA OA54323A patent/OA03772A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH565739A5 (enEXAMPLES) | 1975-08-29 |
| NL150659B (nl) | 1976-09-15 |
| IL37406A0 (en) | 1971-10-20 |
| CA943957A (en) | 1974-03-19 |
| ES393862A1 (es) | 1974-07-16 |
| NL7110826A (enEXAMPLES) | 1972-02-08 |
| SU370753A3 (enEXAMPLES) | 1973-02-15 |
| IT941655B (it) | 1973-03-10 |
| IL37406A (en) | 1976-02-29 |
| DE2135140A1 (de) | 1972-02-10 |
| DD96136A5 (enEXAMPLES) | 1973-03-12 |
| FR2101862A5 (enEXAMPLES) | 1972-03-31 |
| AU3201471A (en) | 1973-02-08 |
| ZA715199B (en) | 1972-04-26 |
| GB1308841A (en) | 1973-03-07 |
| AU459328B2 (en) | 1975-03-20 |
| OA03772A (fr) | 1971-12-24 |
| BR7104999D0 (pt) | 1973-02-15 |
| US3764624A (en) | 1973-10-09 |
| AT311315B (de) | 1973-11-12 |
| BE770936A (fr) | 1971-12-16 |
| DE2135140B2 (de) | 1980-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL83205B1 (enEXAMPLES) | ||
| US3131509A (en) | Compositions and methods for reducing herbicidal injury | |
| PL107473B1 (pl) | Srodek do ochrony roslin uprawnych przed agresywnoscia chwastobojczych chloroacetanilidow i tiolokarbaminianow | |
| DE1643313A1 (de) | Neue herbicid wirksame Verbindungen und Zusammensetzungen | |
| IL67457A0 (en) | Herbicidal cyclohexane-1,2-dione derivatives | |
| US4149872A (en) | N-pyridinyl urea and cyclopropanecarboxamide herbicides | |
| US3930835A (en) | Pesticidal compositions and methods employing substituted oxirane compounds | |
| CS226434B2 (en) | Herbicide and method of preparing its active substance | |
| US3189428A (en) | Method for inhibiting plant growth | |
| DE2422807C3 (de) | Salze von Phosphonsäuren | |
| DE2534993A1 (de) | 1-thiadiazolylimidazolidinone | |
| PL93536B1 (enEXAMPLES) | ||
| US4738711A (en) | Diphenyl ether carboxylic acids and salts and esters thereof useful as herbicides | |
| EP0122231B1 (de) | Herbizides Mittel | |
| PL124375B1 (en) | Insecticide | |
| GB1594172A (en) | Quaternary ammonium salts of substituted (-nitrovinyl) benzylamines and their paraciticidal compositions | |
| JPS61103873A (ja) | 新規な2‐シアノベンズイミダゾール誘導体 | |
| US3461133A (en) | Thioparabanic acid derivatives | |
| US4201724A (en) | N3 -(Cycloalkyl)alkyl-2,4-dinitro-6-trifluoromethyl-1,3-phenylenediamine compounds | |
| PL94958B1 (enEXAMPLES) | ||
| US4780128A (en) | Herbicides | |
| US3085930A (en) | Nematocides | |
| US3959330A (en) | Substituted dichloromethyl thiocyanates and their manufacture | |
| US3516817A (en) | Herbicidal compositions and methods utilizing alkyleneiminoquinazoline-4-imino-2-one compounds | |
| US4066438A (en) | Substituted aminodi- or trihalopyridines and method of use |