PL82693B3 - - Google Patents
Download PDFInfo
- Publication number
- PL82693B3 PL82693B3 PL15526972A PL15526972A PL82693B3 PL 82693 B3 PL82693 B3 PL 82693B3 PL 15526972 A PL15526972 A PL 15526972A PL 15526972 A PL15526972 A PL 15526972A PL 82693 B3 PL82693 B3 PL 82693B3
- Authority
- PL
- Poland
- Prior art keywords
- formula
- methyl
- radical
- compound
- hydrogen atom
- Prior art date
Links
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 8
- -1 acyl radical Chemical class 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 238000005985 Hofmann elimination reaction Methods 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims 1
- 238000010586 diagram Methods 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- INAXVFBXDYWQFN-XHSDSOJGSA-N morphinan Chemical compound C1C2=CC=CC=C2[C@]23CCCC[C@H]3[C@@H]1NCC2 INAXVFBXDYWQFN-XHSDSOJGSA-N 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- DLKZLCYLOHSIOQ-HBMCJLEFSA-N (1R,9R,10R)-17-(furan-2-ylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene Chemical class O1C(=CC=C1)CN1[C@H]2[C@@H]3CCCC[C@@]3(C=3C=CC=CC=3C2)CC1 DLKZLCYLOHSIOQ-HBMCJLEFSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SLROTKFSBGWEDD-PDTFXZCISA-N (4r,4ar,7s,7ar,12bs)-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9,9-triol Chemical class O[C@H]([C@@H]1O2)C=C[C@H]3[C@]4([H])N(C)CC[C@@]31C1=C2C(O)(O)CC=C1C4 SLROTKFSBGWEDD-PDTFXZCISA-N 0.000 description 1
- WECUIJXZKLGURU-UHFFFAOYSA-N 3-(chloromethyl)furan Chemical compound ClCC=1C=COC=1 WECUIJXZKLGURU-UHFFFAOYSA-N 0.000 description 1
- IYNWSQDZXMGGGI-NUEKZKHPSA-N 3-hydroxymorphinan Chemical compound C1CCC[C@H]2[C@H]3CC4=CC=C(O)C=C4[C@]21CCN3 IYNWSQDZXMGGGI-NUEKZKHPSA-N 0.000 description 1
- RDALYHSEPOUIRE-CEWLAPEOSA-N C([C@]12CCCC[C@H]1[C@H]1CC3=CC=C(C=C32)O)CN1CC=1C=COC=1 Chemical compound C([C@]12CCCC[C@H]1[C@H]1CC3=CC=C(C=C32)O)CN1CC=1C=COC=1 RDALYHSEPOUIRE-CEWLAPEOSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001648 bromium Chemical class 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- YKASHPSKFYVZRC-UHFFFAOYSA-M furan-2-ylmethyl(trimethyl)azanium;iodide Chemical compound [I-].C[N+](C)(C)CC1=CC=CO1 YKASHPSKFYVZRC-UHFFFAOYSA-M 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL15526972A PL82693B3 (enExample) | 1972-05-09 | 1972-05-09 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL15526972A PL82693B3 (enExample) | 1972-05-09 | 1972-05-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82693B3 true PL82693B3 (enExample) | 1975-10-31 |
Family
ID=19958507
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL15526972A PL82693B3 (enExample) | 1972-05-09 | 1972-05-09 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL82693B3 (enExample) |
-
1972
- 1972-05-09 PL PL15526972A patent/PL82693B3/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69131636T2 (de) | (6,7-substituierte-8-Alkoxy-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolinkarbonsäure-03,04)-bis(acyloxy-0)-Borate und ihre Salze sowie Methoden zu ihrer Herstellung | |
| FI59991C (fi) | Foerfarande foer framstaellning av 2-arylamino-2-imidazolin-derivat och deras salter | |
| NO762661L (enExample) | ||
| PL97085B1 (pl) | Sposob wytwarzania pochodnych 2-aryloamino-2-imidazoliny | |
| CH632495A5 (de) | Verfahren zur herstellung neuer substituierter pyridine. | |
| PL84115B3 (en) | 2-(furfuryl-methyl)-6,7-benzomorphans and acid addition salts thereof[us3823150a] | |
| US3280130A (en) | Process for the preparation of sulfobetaines of heterocyclic bases of the aromatic type | |
| PL82693B3 (enExample) | ||
| PL101306B1 (pl) | Sposob wytwarzania nowych pochodnych dwuaminoandrostanu | |
| US3979397A (en) | Pharmaceutically effective novel 3,4-dihydro-1,2- and 1,3-thiozolo [4,3a] is | |
| US3187001A (en) | Certain 2, 1-benzisothiazole compounds | |
| US2485662A (en) | Alpha-(aminoalkyl)-stilbenes | |
| US3398155A (en) | 2, 6-dichloro-isonicotinamide derivatives and a method for their preparation | |
| US2971955A (en) | Cyclohexylcarbinol derivatives of piperazine | |
| PL115848B1 (en) | Process for preparing novel derivatives of vincane | |
| US3542799A (en) | 4,4a,6,7,12,12b,13,13a-octahydro-1h-pyrido(1,2-a:3,4-b')diindol-3(2h)-ones | |
| US3835141A (en) | Quinalythiohydroximic acids and their derivatives | |
| SU449485A3 (ru) | Способ получени -замещенных сложных эфиров 1,2,3,6-тетрагидро-4пиридилметилкарбоновой кислоты | |
| DE2755045A1 (de) | Dicarboximidamide und deren salze, verfahren zu ihrer herstellung und ihre verwendung bei der bekaempfung von entzuendungen | |
| DE2065854C3 (de) | Verfahren zur Herstellung von 2,3,5,6-Tetrahydroimidazo- eckige Klammer auf 2,1-b] -thiazol | |
| US2525927A (en) | 2-nitramino delta 2-1, 3 diazacycloalkenes | |
| US2704284A (en) | Therapeutic compounds | |
| US4549021A (en) | N-(β-Fluoroethyl)-nortropine | |
| PL164340B1 (pl) | Sposób wytwarzania nowych pochodnych benzotiazyny PL PL | |
| US3198835A (en) | Pyrenyl methyl tertiary amino amines |