PL82184B1 - - Google Patents
Download PDFInfo
- Publication number
- PL82184B1 PL82184B1 PL1971149583A PL14958371A PL82184B1 PL 82184 B1 PL82184 B1 PL 82184B1 PL 1971149583 A PL1971149583 A PL 1971149583A PL 14958371 A PL14958371 A PL 14958371A PL 82184 B1 PL82184 B1 PL 82184B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- group
- chlorophenyl
- ethyl
- prepared
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 28
- 239000000203 mixture Substances 0.000 claims description 26
- -1 dimethylene chain Chemical group 0.000 claims description 17
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 125000005907 alkyl ester group Chemical group 0.000 claims description 10
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 229960003692 gamma aminobutyric acid Drugs 0.000 claims description 8
- 238000011065 in-situ storage Methods 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 238000010531 catalytic reduction reaction Methods 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- UIUJIQZEACWQSV-UHFFFAOYSA-N succinic semialdehyde Chemical compound OC(=O)CCC=O UIUJIQZEACWQSV-UHFFFAOYSA-N 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 3
- BXYQHDXDCJQOFD-UHFFFAOYSA-N 3-cyanopropanoic acid Chemical compound OC(=O)CCC#N BXYQHDXDCJQOFD-UHFFFAOYSA-N 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000002923 oximes Chemical class 0.000 claims description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 229910017464 nitrogen compound Inorganic materials 0.000 claims 1
- 150000002830 nitrogen compounds Chemical class 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 96
- 238000009835 boiling Methods 0.000 description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 238000002844 melting Methods 0.000 description 20
- 230000008018 melting Effects 0.000 description 20
- 239000000243 solution Substances 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 241000700159 Rattus Species 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 238000007363 ring formation reaction Methods 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 230000035939 shock Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000000049 anti-anxiety effect Effects 0.000 description 3
- 239000002249 anxiolytic agent Substances 0.000 description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 3
- LJQMBZHQVCOYKP-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyano-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=C(Cl)C=C1 LJQMBZHQVCOYKP-UHFFFAOYSA-N 0.000 description 3
- DDYVCYGUNKXLID-UHFFFAOYSA-N ethyl 4-amino-3-(4-chlorophenyl)-2-phenylbutanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(CN)C1=CC=C(Cl)C=C1 DDYVCYGUNKXLID-UHFFFAOYSA-N 0.000 description 3
- 238000001640 fractional crystallisation Methods 0.000 description 3
- 238000004508 fractional distillation Methods 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 150000003385 sodium Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 230000000949 anxiolytic effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- MHZFMMSRIDAQIB-VMPITWQZSA-N ethyl (e)-3-(4-chlorophenyl)prop-2-enoate Chemical compound CCOC(=O)\C=C\C1=CC=C(Cl)C=C1 MHZFMMSRIDAQIB-VMPITWQZSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 150000003254 radicals Chemical group 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- UCCTWLQOBSQILV-UHFFFAOYSA-N 1-(2-chlorophenyl)pyrrolidin-2-one Chemical compound ClC1=CC=CC=C1N1C(=O)CCC1 UCCTWLQOBSQILV-UHFFFAOYSA-N 0.000 description 1
- RKBUYMHZOVVQJR-UHFFFAOYSA-N 1-chloro-4-(2-nitrobut-1-enyl)benzene Chemical compound CCC([N+]([O-])=O)=CC1=CC=C(Cl)C=C1 RKBUYMHZOVVQJR-UHFFFAOYSA-N 0.000 description 1
- VDQQJMHXZCMNMU-UHFFFAOYSA-N 1-phenylpyrrolidine Chemical class C1CCCN1C1=CC=CC=C1 VDQQJMHXZCMNMU-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- UCFURURGGMKGCC-UHFFFAOYSA-N 4-(4-chlorophenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 UCFURURGGMKGCC-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010003591 Ataxia Diseases 0.000 description 1
- MYMCBWTXLBEHLI-UHFFFAOYSA-N C(C)OC(CC1=CC=CC=C1)=O.[Na] Chemical compound C(C)OC(CC1=CC=CC=C1)=O.[Na] MYMCBWTXLBEHLI-UHFFFAOYSA-N 0.000 description 1
- LHTNAPYEMAQTHY-UHFFFAOYSA-N CC1=C(C=CC(=C1)C)C1CC(C(N1)=O)C Chemical compound CC1=C(C=CC(=C1)C)C1CC(C(N1)=O)C LHTNAPYEMAQTHY-UHFFFAOYSA-N 0.000 description 1
- OFSDKUJMALTZQD-UHFFFAOYSA-N CCOC(=O)C(C(CN)C1=CC=CC=C1)C1=CC=C(C)C=C1 Chemical compound CCOC(=O)C(C(CN)C1=CC=CC=C1)C1=CC=C(C)C=C1 OFSDKUJMALTZQD-UHFFFAOYSA-N 0.000 description 1
- FZRLFJMXMKLYBE-UHFFFAOYSA-N CCOC(C(C(C1=CC(C)=CC=C1)C#N)C1=CC=CC=C1)=O Chemical compound CCOC(C(C(C1=CC(C)=CC=C1)C#N)C1=CC=CC=C1)=O FZRLFJMXMKLYBE-UHFFFAOYSA-N 0.000 description 1
- KKFPLRZSRDLHGD-UHFFFAOYSA-N CCOC(C(C(C1=CC=C(C)C=C1)C#N)C1=CC=CC=C1)=O Chemical compound CCOC(C(C(C1=CC=C(C)C=C1)C#N)C1=CC=CC=C1)=O KKFPLRZSRDLHGD-UHFFFAOYSA-N 0.000 description 1
- UXWPBRWDDNOUOW-UHFFFAOYSA-N CCOC(C(C)C(C(C=CC=C1)=C1OC)C#N)=O Chemical compound CCOC(C(C)C(C(C=CC=C1)=C1OC)C#N)=O UXWPBRWDDNOUOW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- OBMQTXZOWBACKO-UHFFFAOYSA-N NC(CC(C(=O)O)C)C1=C(C=C(C=C1)C)C Chemical compound NC(CC(C(=O)O)C)C1=C(C=C(C=C1)C)C OBMQTXZOWBACKO-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000003712 anti-aging effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- UEKBMHTZKUMANN-UHFFFAOYSA-N diethyl 2-[(4-methylphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(C)C=C1 UEKBMHTZKUMANN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- HMWQPUXBOXLRFQ-UHFFFAOYSA-N ethyl 2-(2-chlorophenyl)-3-(4-chlorophenyl)-3-cyanopropanoate Chemical compound C=1C=CC=C(Cl)C=1C(C(=O)OCC)C(C#N)C1=CC=C(Cl)C=C1 HMWQPUXBOXLRFQ-UHFFFAOYSA-N 0.000 description 1
- AFYSKWNJUGJXGJ-UHFFFAOYSA-N ethyl 2-(4-chlorophenyl)-3-cyano-3-phenylpropanoate Chemical compound C=1C=C(Cl)C=CC=1C(C(=O)OCC)C(C#N)C1=CC=CC=C1 AFYSKWNJUGJXGJ-UHFFFAOYSA-N 0.000 description 1
- YZSRIMLQVZPGBW-UHFFFAOYSA-N ethyl 2-[(4-chlorophenyl)-cyanomethyl]butanoate Chemical compound CCOC(=O)C(CC)C(C#N)C1=CC=C(Cl)C=C1 YZSRIMLQVZPGBW-UHFFFAOYSA-N 0.000 description 1
- BKTKLDMYHTUESO-UHFFFAOYSA-N ethyl 2-bromo-2-phenylacetate Chemical compound CCOC(=O)C(Br)C1=CC=CC=C1 BKTKLDMYHTUESO-UHFFFAOYSA-N 0.000 description 1
- CJKLAPYKSMQHMS-UHFFFAOYSA-N ethyl 3-(2-chlorophenyl)-3-cyano-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=CC=C1Cl CJKLAPYKSMQHMS-UHFFFAOYSA-N 0.000 description 1
- SEQCOERBKGIFMR-UHFFFAOYSA-N ethyl 3-(3-chlorophenyl)-3-cyano-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=CC(Cl)=C1 SEQCOERBKGIFMR-UHFFFAOYSA-N 0.000 description 1
- WYVFQENIMKHPQK-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyano-2,2-dimethylpropanoate Chemical compound CCOC(=O)C(C)(C)C(C#N)C1=CC=C(Cl)C=C1 WYVFQENIMKHPQK-UHFFFAOYSA-N 0.000 description 1
- KOHAUDOASSKMLM-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyano-2-methylpropanoate Chemical compound CCOC(=O)C(C)C(C#N)C1=CC=C(Cl)C=C1 KOHAUDOASSKMLM-UHFFFAOYSA-N 0.000 description 1
- DZNQBPRDDXGPLI-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyano-2-phenylbutanoate Chemical compound C=1C=C(Cl)C=CC=1C(C)(C#N)C(C(=O)OCC)C1=CC=CC=C1 DZNQBPRDDXGPLI-UHFFFAOYSA-N 0.000 description 1
- SFTWMHSJWDPETD-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyano-3-phenylpropanoate Chemical compound C=1C=C(Cl)C=CC=1C(C#N)(CC(=O)OCC)C1=CC=CC=C1 SFTWMHSJWDPETD-UHFFFAOYSA-N 0.000 description 1
- XXJPFLHDZCYOGL-UHFFFAOYSA-N ethyl 3-cyano-3-(3-fluorophenyl)-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=CC(F)=C1 XXJPFLHDZCYOGL-UHFFFAOYSA-N 0.000 description 1
- WIHIOBOKUAAUCJ-UHFFFAOYSA-N ethyl 3-cyano-3-(4-fluorophenyl)-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=C(F)C=C1 WIHIOBOKUAAUCJ-UHFFFAOYSA-N 0.000 description 1
- WPFYUDXHBPDJMI-UHFFFAOYSA-N ethyl 4-amino-3-(4-chlorophenyl)-2-phenylbutanoate hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(C(=O)OCC)C(CN)C1=CC=C(Cl)C=C1 WPFYUDXHBPDJMI-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000010575 fractional recrystallization Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000007954 hypoxia Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical compound [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000002582 psychostimulating effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/267—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3594870 | 1970-07-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82184B1 true PL82184B1 (en, 2012) | 1975-10-31 |
Family
ID=10383283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971149583A PL82184B1 (en, 2012) | 1970-07-24 | 1971-07-23 |
Country Status (26)
| Country | Link |
|---|---|
| JP (1) | JPS5417734B1 (en, 2012) |
| AT (2) | AT310150B (en, 2012) |
| AU (1) | AU461836B2 (en, 2012) |
| BE (1) | BE770308A (en, 2012) |
| BG (2) | BG21025A3 (en, 2012) |
| CA (1) | CA954870A (en, 2012) |
| CH (2) | CH538474A (en, 2012) |
| CS (2) | CS174822B2 (en, 2012) |
| DE (1) | DE2136571C2 (en, 2012) |
| DK (1) | DK135584B (en, 2012) |
| ES (1) | ES393496A1 (en, 2012) |
| FI (1) | FI55184C (en, 2012) |
| FR (1) | FR2100946B1 (en, 2012) |
| GB (1) | GB1350582A (en, 2012) |
| HU (1) | HU162344B (en, 2012) |
| IL (1) | IL37147A (en, 2012) |
| IN (1) | IN132195B (en, 2012) |
| IT (1) | IT1046928B (en, 2012) |
| MY (1) | MY7500123A (en, 2012) |
| NL (1) | NL7109930A (en, 2012) |
| PL (1) | PL82184B1 (en, 2012) |
| RO (2) | RO61127A (en, 2012) |
| SE (1) | SE379347B (en, 2012) |
| SU (2) | SU488410A3 (en, 2012) |
| YU (1) | YU34671B (en, 2012) |
| ZA (1) | ZA714911B (en, 2012) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2413935A1 (de) * | 1974-03-20 | 1975-10-16 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone |
| NL7412694A (nl) * | 1974-09-26 | 1976-03-30 | Stamicarbon | Werkwijze voor de bereiding van een pyrrolidon- -2. |
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| AU518986B2 (en) * | 1977-10-11 | 1981-10-29 | Takeda Chemical Industries Ltd. | Lactams |
| IL57266A (en) * | 1978-06-12 | 1982-12-31 | Mundipharma Ag | Production of pyrrolidin-2-ones and of 3-pyrrolin-2-ones |
| US4548947A (en) * | 1984-05-07 | 1985-10-22 | Warner-Lambert Company | 1-(Substituted-aryl)-dihydro-1H-pyrrolizine-3,5-[2H,6H-]diones and use for reversing amnesia |
| DE3823299A1 (de) * | 1988-07-07 | 1990-01-11 | Schering Ag | Substituierte phenyl-pyrrolidin-2-one, -oxazolidin-2-one und -imidazolidin-2-one, ihre herstellung sowie verwendung in arzneimitteln |
| YU162789A (en) * | 1988-09-01 | 1990-12-31 | Lonza Ag | 2-aza-4-(alcoxycarbonyl) spiro/4,5/decan-3-ones |
| JP2833817B2 (ja) * | 1989-03-15 | 1998-12-09 | 三井化学株式会社 | 4―エチル―3―(置換フェニル)―1―(3―トリフルオロメチルフェニル)―2―ピロリジノン誘導体、その製造法およびこれらを有効成分とする除草剤 |
| PT100441A (pt) * | 1991-05-02 | 1993-09-30 | Smithkline Beecham Corp | Pirrolidinonas, seu processo de preparacao, composicoes farmaceuticas que as contem e uso |
| AU2869092A (en) * | 1991-10-11 | 1993-05-03 | Smithkline Beecham Corporation | Heterocyclic 3-phenylpyrrolidin-2-ones, their preparation and use for the manufacture of a medicament for inhibiting tumor necrosis factor production |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| HU215648B (hu) * | 1993-11-19 | 1999-01-28 | E.I. Du Pont De Nemours And Company | Ciklusos amidszármazékok, hatóanyagként ezeket tartalmazó fungicid készítmények és alkalmazásuk |
| US6022870A (en) * | 1998-01-14 | 2000-02-08 | E. I. Du Pont De Nemours And Company | Fungicidal cyclic amides |
| DE10205862A1 (de) * | 2002-02-13 | 2003-08-21 | Bayer Cropscience Ag | DELTA1-Pyrroline |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR67024E (fr) * | 1954-10-22 | 1957-11-04 | Anciens Ets Barbier | Appareil d'éclairage |
| US2984672A (en) * | 1958-05-14 | 1961-05-16 | Rohm & Haas | Method for the preparation of pyrrolinones |
-
1970
- 1970-07-24 GB GB3594870A patent/GB1350582A/en not_active Expired
-
1971
- 1971-06-24 IL IL37147A patent/IL37147A/xx unknown
- 1971-07-19 NL NL7109930A patent/NL7109930A/xx unknown
- 1971-07-20 FR FR7126784A patent/FR2100946B1/fr not_active Expired
- 1971-07-21 RO RO67732A patent/RO61127A/ro unknown
- 1971-07-21 RO RO7181864A patent/RO71354A/ro unknown
- 1971-07-21 CS CS5382A patent/CS174822B2/cs unknown
- 1971-07-21 HU HUUI178A patent/HU162344B/hu unknown
- 1971-07-21 CS CS6089A patent/CS174849B2/cs unknown
- 1971-07-21 ES ES393496A patent/ES393496A1/es not_active Expired
- 1971-07-21 FI FI2068/71A patent/FI55184C/fi active
- 1971-07-21 YU YU1921/71A patent/YU34671B/xx unknown
- 1971-07-21 DK DK358071AA patent/DK135584B/da unknown
- 1971-07-22 BG BG018136A patent/BG21025A3/xx unknown
- 1971-07-22 IT IT51830/71A patent/IT1046928B/it active
- 1971-07-22 JP JP5490271A patent/JPS5417734B1/ja active Pending
- 1971-07-22 CA CA118,906A patent/CA954870A/en not_active Expired
- 1971-07-22 IN IN132195A patent/IN132195B/en unknown
- 1971-07-22 DE DE2136571A patent/DE2136571C2/de not_active Expired
- 1971-07-22 BG BG019868A patent/BG20582A3/xx unknown
- 1971-07-22 BE BE770308A patent/BE770308A/xx not_active IP Right Cessation
- 1971-07-23 CH CH1085771A patent/CH538474A/fr not_active IP Right Cessation
- 1971-07-23 CH CH1016072A patent/CH537921A/fr not_active IP Right Cessation
- 1971-07-23 PL PL1971149583A patent/PL82184B1/pl unknown
- 1971-07-23 SU SU1689301A patent/SU488410A3/ru active
- 1971-07-23 AT AT180572A patent/AT310150B/de not_active IP Right Cessation
- 1971-07-23 AU AU31575/71A patent/AU461836B2/en not_active Expired
- 1971-07-23 AT AT643071A patent/AT304530B/de not_active IP Right Cessation
- 1971-07-23 SU SU1891416A patent/SU479293A3/ru active
- 1971-07-23 SE SE7109515A patent/SE379347B/xx unknown
- 1971-07-23 ZA ZA714911A patent/ZA714911B/xx unknown
-
1975
- 1975-12-31 MY MY1975123A patent/MY7500123A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL82184B1 (en, 2012) | ||
| DE60033689T2 (de) | Inhibitoren von serinproteasen | |
| CA1120928A (en) | Acetohydroxamic acids | |
| GB2048852A (en) | Derivatives of glycinamide | |
| NO179944B (no) | Analogifremgangsmåte for fremstilling av N-fenylalkyl-substituerte -aminokarboksamidderivater | |
| CS258149B2 (en) | Method of arylcyclobutylalkylamines production | |
| CA2522214A1 (en) | 4-phenyl-piperidine compounds and their use as modulators of opioid receptors | |
| DE68908392T2 (de) | Aminomethyl-chroman- und -thiochroman-verbindungen. | |
| CA1253148A (en) | 1-piperazinecarboxamide derivatives | |
| US4021567A (en) | 2-Methoxy-benzamide derivatives | |
| NO171060B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive n-cykloalkylalkyl-benzylaminer | |
| JPS599540B2 (ja) | 薬剤としての有効な新活性インダン誘導体の製法 | |
| IE42945B1 (en) | 1-acylamino methyl-1,2,3,4-tetrahydroisoquinolines | |
| US3267110A (en) | Trifluoromethyl substituted o-aminophenyl ketones | |
| EP0646110B1 (de) | N-substituierte 3-azabicyclo[3.2.0]heptan-derivate als neuroleptika | |
| US2662886A (en) | Substituted phenylpropylamines | |
| US3989722A (en) | 1-Aminomethyl-2,2-diaryl-cyclopropane carboxamides | |
| US4056540A (en) | 4-Phenyl-1,3-benzodioxans | |
| Thyrum et al. | p-Amino-N-[2-(substituted amino) ethyl] benzamides. Potential antifibrillatory drugs | |
| US3956314A (en) | Derivatives of 2-pyrrolidinone | |
| US4189495A (en) | 2-Methoxy-benzamide derivatives | |
| US3953449A (en) | 2-(4-M-CF3 or -SCF3 phenylpiperazino)-ethyl benzoates | |
| CH619683A5 (en, 2012) | ||
| EP0128120A2 (de) | Trisubstituierte Oxazolidinone | |
| US4158060A (en) | 2-Methoxy-benzamide derivatives |