PL66750B1 - - Google Patents
Download PDFInfo
- Publication number
- PL66750B1 PL66750B1 PL126110A PL12611068A PL66750B1 PL 66750 B1 PL66750 B1 PL 66750B1 PL 126110 A PL126110 A PL 126110A PL 12611068 A PL12611068 A PL 12611068A PL 66750 B1 PL66750 B1 PL 66750B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- benzyloxy
- formula
- general formula
- carbon atoms
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 6
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical class N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 3
- 229910052757 nitrogen Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- ASZLNPRMVCGYCI-UHFFFAOYSA-N 1$l^{2}-azolidine Chemical group C1CC[N]C1 ASZLNPRMVCGYCI-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 claims description 2
- 125000001570 methylene group Chemical class [H]C([H])([*:1])[*:2] 0.000 claims description 2
- 235000019796 monopotassium phosphate Nutrition 0.000 claims description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 2
- 229940113083 morpholine Drugs 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Chemical class 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical class O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000004434 sulfur atoms Chemical class 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 2
- 235000007466 Corylus avellana Nutrition 0.000 claims 1
- 240000007582 Corylus avellana Species 0.000 claims 1
- 229920005862 polyol Polymers 0.000 claims 1
- 150000003077 polyols Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 26
- -1 alkyl radical Chemical class 0.000 description 24
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 15
- ZPUCINDJVBIVPJ-BARDWOONSA-N cocaine Natural products O([C@@H]1C[C@H]2CC[C@H](N2C)[C@@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-BARDWOONSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 206010002091 Anaesthesia Diseases 0.000 description 11
- 230000037005 anaesthesia Effects 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- NNJVILVZKWQKPM-UHFFFAOYSA-N Xylocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 7
- 229940072358 Xylocaine Drugs 0.000 description 7
- 229960003920 cocaine Drugs 0.000 description 7
- 241000700159 Rattus Species 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- UDGSVBYJWHOHNN-UHFFFAOYSA-N N',N'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 4
- 230000003444 anaesthetic Effects 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K 2qpq Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 3
- MFDFERRIHVXMIY-UHFFFAOYSA-N Procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000001184 potassium carbonate Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 229960004919 procaine Drugs 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- KZKYRHRAVGWEAV-UHFFFAOYSA-N 2,3-dichlorobenzamide Chemical compound NC(=O)C1=CC=CC(Cl)=C1Cl KZKYRHRAVGWEAV-UHFFFAOYSA-N 0.000 description 2
- NSHCYKGCMPCBBA-UHFFFAOYSA-N 3,5-dichloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-phenylmethoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(Cl)=CC(Cl)=C1OCC1=CC=CC=C1 NSHCYKGCMPCBBA-UHFFFAOYSA-N 0.000 description 2
- BVSXVVJPFIZJAT-UHFFFAOYSA-N 3,5-dichloro-N-[2-(diethylamino)ethyl]-2-phenylmethoxybenzamide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=CC(Cl)=C1OCC1=CC=CC=C1 BVSXVVJPFIZJAT-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N Bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 210000004087 Cornea Anatomy 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N Thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- BELMZDGADRSOPN-UHFFFAOYSA-N 3,5-dichloro-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC(Cl)=C1OCC1=CC=CC=C1 BELMZDGADRSOPN-UHFFFAOYSA-N 0.000 description 1
- 229940100198 ALKYLATING AGENTS Drugs 0.000 description 1
- 210000004204 Blood Vessels Anatomy 0.000 description 1
- PBBKZRNYWYWHGR-UHFFFAOYSA-N C(C1=CC=CC=C1)OC1=C(C(=O)Cl)C=C(C=C1Cl)Cl Chemical compound C(C1=CC=CC=C1)OC1=C(C(=O)Cl)C=C(C=C1Cl)Cl PBBKZRNYWYWHGR-UHFFFAOYSA-N 0.000 description 1
- MYZGANZSQYWRSP-UHFFFAOYSA-N C(C1=CC=CC=C1)OC1=C(C(=O)N)C=C(C=C1Cl)Cl Chemical compound C(C1=CC=CC=C1)OC1=C(C(=O)N)C=C(C=C1Cl)Cl MYZGANZSQYWRSP-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N Carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- QIUMYUMHDNMHOE-UHFFFAOYSA-N ClC1=CC=C(COC2=C(C(=O)Cl)C=C(C=C2Cl)Cl)C=C1 Chemical compound ClC1=CC=C(COC2=C(C(=O)Cl)C=C(C=C2Cl)Cl)C=C1 QIUMYUMHDNMHOE-UHFFFAOYSA-N 0.000 description 1
- 210000000078 Claw Anatomy 0.000 description 1
- 229960003771 Cocaine Hydrochloride Drugs 0.000 description 1
- 208000002173 Dizziness Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N Ethyl iodide Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 210000000744 Eyelids Anatomy 0.000 description 1
- 210000003141 Lower Extremity Anatomy 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N N-Aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- 206010028813 Nausea Diseases 0.000 description 1
- 210000003491 Skin Anatomy 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- PIQVDUKEQYOJNR-VZXSFKIWSA-N cocaine hydrochloride Chemical compound [Cl-].O([C@H]1C[C@@H]2CC[C@@H]([NH+]2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 PIQVDUKEQYOJNR-VZXSFKIWSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- PTTGUMJPKGLRIW-UHFFFAOYSA-N ethanamine;piperidine Chemical compound CCN.C1CCNCC1 PTTGUMJPKGLRIW-UHFFFAOYSA-N 0.000 description 1
- UHIWBULTEZXYLI-UHFFFAOYSA-N ethanamine;pyrrolidine Chemical compound CCN.C1CCNC1 UHIWBULTEZXYLI-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000001225 therapeutic Effects 0.000 description 1
- 230000000699 topical Effects 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL66750B1 true PL66750B1 (fi) | 1972-08-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4959366A (en) | Anti-arrhythmic agents | |
| EP0004011B1 (de) | Phenoxyalkylcarbonsäure-Derivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2513916C2 (de) | N-(2-Piperidylmethyl)-2,5-bis (2,2,2-trifluoräthoxy)-benzamid | |
| EP0159566B1 (en) | Novel piperazine derivatives, processes for production thereof, and pharmaceutical compositions comprising said compounds as active ingredient | |
| AU569477B2 (en) | Aryl substituted aminomethyl benzene derivatives useful as antiarrhythmic agents | |
| DK158346B (da) | Analogifremgangsmaade til fremstilling af 4-amino-5-alkylsulfonyl-o-anisamid-derivater samt 2-methoxy-4-amino-5-alkylsulfonylbenzoesyrer til anvendelse som mellemprodukter ved fremgangsmaaden | |
| DE3632329A1 (de) | Substituierte phenylsulfonamide | |
| AT394363B (de) | Verfahren zur herstellung von neuen substituierten benzamiden | |
| EP0013894B1 (de) | Neue Arylether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| HU220592B1 (hu) | Eljárás diaminszármazékok és ezeket hatóanyagként tartalmazó gyógyszerkészítmények előállítására | |
| CH637130A5 (de) | Chinazolin-derivate, verfahren zu ihrer herstellung und verwendung dieser derivate in arzneimitteln. | |
| DE3034001A1 (de) | Isochinolinderivate, verfahren zu ihrer hersellung, sie enthaltende pharmazeutische zubereitungen und ihre verwendung | |
| CA1237129A (en) | Aminoguanidine derivatives and a process for the preparation thereof | |
| DK169129B1 (da) | 1-(4-Alkansulfonamidophenyl)-4-(4-alkansulfonamidophenylalkyl)piperazin-derivater, disse forbindelser til anvendelse som lægemidler, farmaceutiske præparater indeholdende forbindelserne og anvendelse af forbindelserne til fremstilling af antiarytmiske lægemidler samt mellemprodukter ved fremstilling af forbindelserne | |
| DE3610643A1 (de) | Neue phenoxyalkylcarbonsaeure-derivate, verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel | |
| DE1936721A1 (de) | Substituierte Benzo[b]thiophene | |
| EP0116360A1 (de) | 1-Phenyl-2-aminocarbonylindol-Verbindungen sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| JPS62267250A (ja) | 抗不整脈剤 | |
| US4731376A (en) | 2-(-(2,2,5,5-tetramethyl-3-pyrrolin-3-carbonyl))-amino derivatives | |
| JPH0215067A (ja) | イソキノリンスルホンアミド誘導体 | |
| DE3424586A1 (de) | 3-aminocarbonylmethoxy-5-phenyl-pyrazol-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| PL66750B1 (fi) | ||
| CA1094070A (en) | 1-phenyl-piperazine derivatives | |
| EP0123700A1 (de) | Substituierte Picolinsäuren, Verfahren zu ihrer Herstellung, ihre Verwendung und sie enthaltende Arzneimittel | |
| DE69531691T2 (de) | Neues amin-derivat, verfahren zur herstellung und dessen verwendung als anti-arrhythmisches mittel |