PL66668B1 - - Google Patents
Download PDFInfo
- Publication number
- PL66668B1 PL66668B1 PL134642A PL13464269A PL66668B1 PL 66668 B1 PL66668 B1 PL 66668B1 PL 134642 A PL134642 A PL 134642A PL 13464269 A PL13464269 A PL 13464269A PL 66668 B1 PL66668 B1 PL 66668B1
- Authority
- PL
- Poland
- Prior art keywords
- aminobutanol
- tartrate
- acid
- ethanol
- solution
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 35
- 239000002253 acid Substances 0.000 claims description 20
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 14
- UVRLVWTYHIFQPQ-UHFFFAOYSA-N 4-(2-aminobutoxy)-2,3-dihydroxy-4-oxobutanoic acid Chemical compound C(=O)(O)C(O)C(O)C(=O)OCC(CC)N UVRLVWTYHIFQPQ-UHFFFAOYSA-N 0.000 claims description 12
- 230000007935 neutral effect Effects 0.000 claims description 11
- 229940095064 tartrate Drugs 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 6
- 150000004682 monohydrates Chemical class 0.000 claims description 5
- 239000001358 L(+)-tartaric acid Substances 0.000 claims description 4
- 235000011002 L(+)-tartaric acid Nutrition 0.000 claims description 4
- FEWJPZIEWOKRBE-LWMBPPNESA-N L-(+)-Tartaric acid Natural products OC(=O)[C@@H](O)[C@H](O)C(O)=O FEWJPZIEWOKRBE-LWMBPPNESA-N 0.000 claims description 4
- 239000011975 tartaric acid Substances 0.000 claims description 3
- 239000000706 filtrate Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 235000002906 tartaric acid Nutrition 0.000 claims description 2
- ZMEGDKGDGOQGDK-UHFFFAOYSA-N 1-hydroxybutan-2-ylazanium;2,3,4-trihydroxy-4-oxobutanoate Chemical compound CCC(N)CO.OC(=O)C(O)C(O)C(O)=O ZMEGDKGDGOQGDK-UHFFFAOYSA-N 0.000 claims 1
- 101150001445 CSAD gene Proteins 0.000 claims 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 6
- UUDLQDCYDSATCH-UHFFFAOYSA-N 2,3-dihydroxybutanedioic acid;hydrate Chemical compound O.OC(=O)C(O)C(O)C(O)=O UUDLQDCYDSATCH-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 238000002955 isolation Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- JCBPETKZIGVZRE-SCSAIBSYSA-N (2r)-2-aminobutan-1-ol Chemical compound CC[C@@H](N)CO JCBPETKZIGVZRE-SCSAIBSYSA-N 0.000 description 1
- UUDLQDCYDSATCH-ZVGUSBNCSA-N (2r,3r)-2,3-dihydroxybutanedioic acid;hydrate Chemical compound O.OC(=O)[C@H](O)[C@@H](O)C(O)=O UUDLQDCYDSATCH-ZVGUSBNCSA-N 0.000 description 1
- JCBPETKZIGVZRE-BYPYZUCNSA-N (2s)-2-aminobutan-1-ol Chemical compound CC[C@H](N)CO JCBPETKZIGVZRE-BYPYZUCNSA-N 0.000 description 1
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL66668B1 true PL66668B1 (enrdf_load_stackoverflow) | 1972-08-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU460626A3 (ru) | Способ получени винкамина или его производных | |
| SU421187A3 (ru) | Способ получения 2-(фурилметил)-6,7- бензоморфанов | |
| Manske et al. | The Alkaloids of Fumariaceous Plants. XXXIX. The Constitution of Capaurine | |
| DE2248596A1 (de) | Neue derivate der aminoisophtalsaeure | |
| PL87801B1 (en) | Amino pyrimidines[us3635978a] | |
| US4721796A (en) | Nitrates of D-isoidide | |
| PL66668B1 (enrdf_load_stackoverflow) | ||
| US2755289A (en) | Anhydro derivatives of 2, 4b-dimethyl-2-hydroxy-4, 7-dioxo-1, 2, 3, 4, 4a, 4b, 5, 6,7, 9, 10, 10a-dodecahydrophenanthrene-1-propionic acid | |
| US2926167A (en) | Process of esterifying ib-hydroxy | |
| US3058992A (en) | Intermediates for the preparation of | |
| US4162255A (en) | Process for extracting aristolochic acids | |
| US3102116A (en) | Process for the purification of y-chloeo- | |
| SU52430A1 (ru) | Способ получени солей алкило-серной кислоты N,N'-алкилдиакридил-9-мочевины | |
| DE3633492A1 (de) | Verfahren zur herstellung von kristallinem monohydrat des 1-(3',4'-diaethoxybenzyl)-6,7-diaethoxy-3,4- dihydro-isochinolinium-theophyllin-7-acetats und von reinem 1-(3',4'-diaethoxybenzyl)-6,7-diaethoxy-3,4- dihydro-isochinolinium-theophyllin-7-acetat | |
| US2409455A (en) | Tetraacetyl ribonic acid and process of making it | |
| PL85506B1 (enrdf_load_stackoverflow) | ||
| SU456410A3 (ru) | Способ очистки производных 1,4-бензодиазепин-2-она | |
| Manske | THE ALKALOIDS OF FUMARIACEOUS PLANTS: XXX. AUROTENSINE | |
| JPS55144422A (en) | Purification of cis-dichlorodiammineplatinum(2) | |
| US3047578A (en) | Substituted reserpine and process of making the same | |
| SU405861A1 (ru) | Способ выделения янтарной и адипиновой кислот | |
| AT162912B (de) | Verfahren zur Herstellung neuer Hydrazinverbindungen und ihrer Derivate | |
| JPS6137798A (ja) | グリチルリチン酸の精製法 | |
| SU517256A3 (ru) | Способ получени кислотных солей инденопиридинов | |
| US617985A (en) | Emil fischer |