PL59419B1 - - Google Patents
Download PDFInfo
- Publication number
- PL59419B1 PL59419B1 PL112916A PL11291666A PL59419B1 PL 59419 B1 PL59419 B1 PL 59419B1 PL 112916 A PL112916 A PL 112916A PL 11291666 A PL11291666 A PL 11291666A PL 59419 B1 PL59419 B1 PL 59419B1
- Authority
- PL
- Poland
- Prior art keywords
- parts
- temperature
- phenol
- acid
- chlorophenols
- Prior art date
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 15
- 229920001864 tannin Polymers 0.000 claims description 8
- 239000001648 tannin Substances 0.000 claims description 8
- 235000018553 tannin Nutrition 0.000 claims description 8
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 6
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical class OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 3
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical class [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 claims description 3
- 238000006277 sulfonation reaction Methods 0.000 claims description 2
- 239000003929 acidic solution Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 description 6
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical class O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical class C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- -1 for example Chemical compound 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL59419B1 true PL59419B1 (enExample) | 1969-12-29 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1069526A (en) | Condensation products of urea and aldehydes and process for making them | |
| US2171806A (en) | Tanning material | |
| PL59419B1 (enExample) | ||
| DE1142173B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte aus Phenolsulfonsaeuren, Phenolen, Harnstoff und Formaldehyd | |
| EP0008032B1 (de) | Kondensationsprodukte aus Terphenylsulfonsäuren, Naphthalinsulfonsäuren, Bis-(4-hydroxyphenyl)-sulfon und Formaldehyd und ihre Verwendung als Gerbstoffe | |
| PL64434B3 (enExample) | ||
| PL56721B3 (enExample) | ||
| DE733679C (de) | Verfahren zur Herstellung von kationenaustauschenden Kunstharzen auf Phenolgrundlage | |
| PL66474B1 (enExample) | ||
| SU54203A1 (ru) | Способ получени синтетических дубителей | |
| CH160662A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| CH160653A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| SU59417A1 (ru) | Способ дублени шкур | |
| PL37685B1 (enExample) | ||
| DE702575C (de) | Verfahren zur Herstellung lichtechter synthetischer Gerbstoffe | |
| CH160658A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| SU6805A1 (ru) | Способ получени продуктов конденсации фенолов с альдегидами | |
| CH160661A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| SU59368A1 (ru) | Способ получени синтетических дубителей | |
| CS203700B1 (cs) | Způsob výroby chemických pomocných prostředků | |
| CH160649A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| AT138005B (de) | Verfahren zum Gerben tierischer Häute. | |
| CH160660A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| PL179374B1 (pl) | Sposób wytwarzania garbników syntetycznych | |
| CH160665A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. |