PL42539B1 - - Google Patents
Download PDFInfo
- Publication number
- PL42539B1 PL42539B1 PL42539A PL4253956A PL42539B1 PL 42539 B1 PL42539 B1 PL 42539B1 PL 42539 A PL42539 A PL 42539A PL 4253956 A PL4253956 A PL 4253956A PL 42539 B1 PL42539 B1 PL 42539B1
- Authority
- PL
- Poland
- Prior art keywords
- briquettes
- shapes
- subjected
- degassing
- oxidation
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 9
- 230000003647 oxidation Effects 0.000 claims description 6
- 238000007254 oxidation reaction Methods 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 238000007872 degassing Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 3
- 239000004449 solid propellant Substances 0.000 claims description 3
- 238000007669 thermal treatment Methods 0.000 claims description 3
- 230000004907 flux Effects 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 238000005245 sintering Methods 0.000 claims description 2
- 239000000571 coke Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 3
- 239000011269 tar Substances 0.000 description 3
- RHZUVFJBSILHOK-UHFFFAOYSA-N anthracen-1-ylmethanolate Chemical compound C1=CC=C2C=C3C(C[O-])=CC=CC3=CC2=C1 RHZUVFJBSILHOK-UHFFFAOYSA-N 0.000 description 2
- 239000003830 anthracite Substances 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 239000004484 Briquette Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003546 flue gas Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000003077 lignite Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL42539B1 true PL42539B1 (enExample) | 1959-08-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3171720A (en) | Carbonaceous bodies useful for thermal insulation and processes for preparing same | |
| US3655350A (en) | Coal pellet and a method of manufacturing same | |
| DE2253454A1 (de) | Verfahren zum herstellen kohleund eisenhaltiger briketts | |
| PL42539B1 (enExample) | ||
| DE3335484C2 (enExample) | ||
| RU2078794C1 (ru) | Способ получения угольных брикетов | |
| DE1696509B1 (de) | Verfahren zum Herstellen von Brennstoffbriketts | |
| DE2218764C3 (de) | Verfahren zur Herstellung von Formkoks | |
| AT231402B (de) | Verfahren zur Herstellung von brikettierten Brennstoffen | |
| SU939574A1 (ru) | Способ приготовлени брикетов | |
| SU129723A1 (ru) | Способ приготовлени прессовочных масс дл электроугольных изделий | |
| US2025776A (en) | Method of manufacturing fuel briquettes | |
| US1233144A (en) | Smelting process. | |
| DE839791C (de) | Verfahren zum Verwerten von Petrolkoksgrus | |
| DE2407780A1 (de) | Verfahren zur herstellung von steinkohlenbriketts | |
| US1158363A (en) | Cohering mass and process or forming the same. | |
| DE1289857B (de) | Formlinge zur Herstellung von Ferrosilicium | |
| SU143708A1 (ru) | Способ изготовлени огнеупоров | |
| US1602273A (en) | Refractory products and their manufacture | |
| SU564347A1 (ru) | Способ получени брикетов из металлургического сырь | |
| DE1571711C (de) | Verfahren zur Herstellung von Brennstoffbriketts durch Heißbrikettierung. Ausscheidung aus: 1696509 | |
| SU35168A1 (ru) | Способ получени торф ного кокса | |
| Kovalik et al. | Oxidizing Pittsburgh-bed Coal: Effect of Processing Temperature and Time | |
| SU4514A1 (ru) | Способ перегонки, газификации или коксовани угл и углеродистых материалов | |
| SU151671A1 (ru) | Способ получени топливных брикетов |