PL41470B1 - - Google Patents
Download PDFInfo
- Publication number
- PL41470B1 PL41470B1 PL41470A PL4147056A PL41470B1 PL 41470 B1 PL41470 B1 PL 41470B1 PL 41470 A PL41470 A PL 41470A PL 4147056 A PL4147056 A PL 4147056A PL 41470 B1 PL41470 B1 PL 41470B1
- Authority
- PL
- Poland
- Prior art keywords
- diaphragm
- condensation
- phenolsulfonic acid
- compound containing
- aldehyde groups
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 13
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 229940044654 phenolsulfonic acid Drugs 0.000 claims description 8
- 229920005989 resin Polymers 0.000 claims description 8
- 239000011347 resin Substances 0.000 claims description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000003172 aldehyde group Chemical group 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 239000004744 fabric Substances 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 229920003023 plastic Polymers 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 3
- 239000012670 alkaline solution Substances 0.000 claims description 2
- 239000010425 asbestos Substances 0.000 claims description 2
- 239000011521 glass Substances 0.000 claims description 2
- 229910052895 riebeckite Inorganic materials 0.000 claims description 2
- 229910001508 alkali metal halide Inorganic materials 0.000 claims 1
- 150000008045 alkali metal halides Chemical class 0.000 claims 1
- 230000003204 osmotic effect Effects 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 235000002639 sodium chloride Nutrition 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 229920002955 Art silk Polymers 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL41470B1 true PL41470B1 (enExample) | 1958-08-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4920193A (en) | Membranes | |
| DE3265373D1 (en) | Production of a liquid composition containing a perfluorinated ion exchange polymer, and the use of this polymer | |
| EP0008894A1 (en) | Sulphonated polyarylethersulphone copolymers and process for the manufacture thereof | |
| JPS6139083B2 (enExample) | ||
| GB489437A (en) | Application of base exchange artificial resins for purifying aqueous solutions | |
| NO124219B (enExample) | ||
| PL41470B1 (enExample) | ||
| US2228159A (en) | Manufacture of cation-exchanging bodies | |
| US2604456A (en) | For sulfonating | |
| FI60569B (fi) | Foerfarande foer tillverkning av regenererade cellulosaprodukter och aotervinning av loesningskemikalier | |
| US2334488A (en) | Manufacture of aromatic hydroxy compounds | |
| AT200587B (de) | Verfahren zur Entfernung von Alkalichloriden aus Alkalilaugen | |
| GB879944A (en) | Process for removing sodium chloride from aqueous caustic soda solutions | |
| SU124425A3 (ru) | Способ очистки щелочных растворов от щелочных хлоридов | |
| US2784173A (en) | Polymeric polyethers from bis-quaternary ammonium compounds and difunctional phenolic compounds | |
| US2763030A (en) | Method of precipitating and forming hydroxy alkyl cellulose into films | |
| NL77406C (enExample) | ||
| CH351259A (de) | Verfahren zur Herstellung einer praktisch alkalichloridfreien Alkalilauge | |
| US1681369A (en) | Purifying phenolaldehyde resins | |
| PL42172B3 (enExample) | ||
| AT203023B (de) | Verfahren zur Entfernung von Alkalichloriden aus Alkalilaugen | |
| CH362684A (de) | Verfahren zur Herstellung einer praktisch alkalichloridfreien Alkalilauge | |
| US1847709A (en) | Process of making sodium ligno-sulphonate | |
| JPS627404A (ja) | アニオン性多糖類系液体分離膜 | |
| US3678101A (en) | Process for making methylolated phenol-sulfonic acid |