PH23843A - N-substituted-arylalkyl and arylalkylene aminoheterocyclics as cardiovascular agents - Google Patents
N-substituted-arylalkyl and arylalkylene aminoheterocyclics as cardiovascular agentsInfo
- Publication number
- PH23843A PH23843A PH34083A PH34083A PH23843A PH 23843 A PH23843 A PH 23843A PH 34083 A PH34083 A PH 34083A PH 34083 A PH34083 A PH 34083A PH 23843 A PH23843 A PH 23843A
- Authority
- PH
- Philippines
- Prior art keywords
- aminoheterocyclics
- arylalkylene
- arylalkyl
- substituted
- cardiovascular agents
- Prior art date
Links
- 229940125692 cardiovascular agent Drugs 0.000 title 1
- 239000002327 cardiovascular agent Substances 0.000 title 1
- IMCGHZIGRANKHV-AJNGGQMLSA-N tert-butyl (3s,5s)-2-oxo-5-[(2s,4s)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidine-1-carboxylate Chemical compound O1C(=O)[C@H](C(C)C)C[C@H]1[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@H](C(C)C)C1 IMCGHZIGRANKHV-AJNGGQMLSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/04—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with only hydrogen atoms, halogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quinoline Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81970186A | 1986-01-17 | 1986-01-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH23843A true PH23843A (en) | 1989-11-23 |
Family
ID=25228814
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH34083A PH23843A (en) | 1986-01-17 | 1986-07-30 | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as cardiovascular agents |
| PH37224A PH24983A (en) | 1986-01-17 | 1988-07-14 | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as antihistaminic agents |
| PH37223A PH24904A (en) | 1986-01-17 | 1988-07-14 | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as antisectory agents |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH37224A PH24983A (en) | 1986-01-17 | 1988-07-14 | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as antihistaminic agents |
| PH37223A PH24904A (en) | 1986-01-17 | 1988-07-14 | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as antisectory agents |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPH0772171B2 (en:Method) |
| KR (1) | KR900005368B1 (en:Method) |
| AU (1) | AU594972B2 (en:Method) |
| DK (1) | DK347986A (en:Method) |
| GR (1) | GR862024B (en:Method) |
| IL (1) | IL78939A (en:Method) |
| IN (1) | IN163948B (en:Method) |
| NZ (1) | NZ217408A (en:Method) |
| PH (3) | PH23843A (en:Method) |
| PT (1) | PT84128B (en:Method) |
| ZA (1) | ZA864522B (en:Method) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PH23283A (en) * | 1986-02-26 | 1989-06-30 | Eisai Co Ltd | Piperidine derivative, pharmaceutical composition containing the same and method of use thereof |
| AU629535B2 (en) * | 1988-02-10 | 1992-10-08 | A.H. Robins Company, Incorporated | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as cardiovascular antihistaminic and antisecretory agents |
| AU629534B2 (en) * | 1988-02-24 | 1992-10-08 | A.H. Robins Company, Incorporated | New methods and related compounds |
| GB8825505D0 (en) * | 1988-11-01 | 1988-12-07 | Pfizer Ltd | Therapeutic agents |
| GB8906166D0 (en) * | 1989-03-17 | 1989-05-04 | Pfizer Ltd | Therapeutic agents |
| GB8928042D0 (en) * | 1989-12-12 | 1990-02-14 | Pfizer Ltd | Muscarinic receptor antagonists |
| US6004980A (en) * | 1990-06-01 | 1999-12-21 | Merrell Pharmaceuticals, Inc. | (+)-α-(2,3-dimethoxyphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-piperidinemethanol |
| PH31566A (en) * | 1990-10-10 | 1998-11-03 | Schering Corp | Pyridine and pyridine n-oxide derivatives for diaryl methyl piperidines or piperazines and compositions and methods of use thereof. |
| DE4111861A1 (de) * | 1991-04-11 | 1992-10-15 | Schwabe Willmar Gmbh & Co | Benzopyranone, verfahren zu ihrer herstellung und verwendung |
| WO1993011108A1 (fr) * | 1991-11-29 | 1993-06-10 | Zeria Pharmaceutical Co., Ltd. | Derive de piperidine et medicament contenant ledit derive |
| US5681830A (en) * | 1992-02-03 | 1997-10-28 | Delta Pharmaceuticals, Inc. | Opioid compounds |
| US5807858A (en) * | 1996-06-05 | 1998-09-15 | Delta Pharmaceutical, Inc. | Compositions and methods for reducing respiratory depression |
| US5561117A (en) * | 1992-03-27 | 1996-10-01 | Schering Corporation | Bridged bis-aryl carbinol derivatives, compositions and methods of use |
| AU3918993A (en) * | 1992-03-27 | 1993-11-08 | Schering Corporation | Unbridged bis-aryl carbinol derivatives, compositions and methods of use |
| ES2149881T3 (es) | 1993-07-30 | 2000-11-16 | Delta Pharmaceuticals Inc | Compuestos de piperazina usados en terapia. |
| JP4057088B2 (ja) * | 1996-04-22 | 2008-03-05 | 株式会社カネカ | ピロリジン誘導体の製造方法 |
| US6028083A (en) * | 1997-07-25 | 2000-02-22 | Hoechst Marion Roussel, Inc. | Esters of (+)-α-(2,3-dimethoxyphenyl)-1-[2-(4-fluorophenyl) ethyl]-4-piperidinemethanol |
| TW200510298A (en) * | 2003-06-13 | 2005-03-16 | Theravance Inc | Substituted pyrrolidine and related compounds |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4035372A (en) * | 1976-08-13 | 1977-07-12 | G. D. Searle & Co. | 4-{[4-(Diphenylmethyl)-1-piperidinyl]methyl}benzenamines |
| US4632925A (en) * | 1985-10-07 | 1986-12-30 | Hoffmann-La Roche Inc. | N-substituted diphenylpiperidines and antiobesity use thereof |
| US4810713A (en) * | 1985-12-20 | 1989-03-07 | A. H. Robins Company, Incorporated | Arylalkyl-heterocyclic amines, n-substituted by aryloxyalkyl groups used in a method for allergy treatment |
-
1986
- 1986-05-27 IL IL78939A patent/IL78939A/xx not_active IP Right Cessation
- 1986-05-27 IN IN407/MAS/86A patent/IN163948B/en unknown
- 1986-06-17 ZA ZA864522A patent/ZA864522B/xx unknown
- 1986-07-18 JP JP61169673A patent/JPH0772171B2/ja not_active Expired - Lifetime
- 1986-07-22 DK DK347986A patent/DK347986A/da not_active Application Discontinuation
- 1986-07-30 GR GR862024A patent/GR862024B/el unknown
- 1986-07-30 PH PH34083A patent/PH23843A/en unknown
- 1986-08-29 NZ NZ217408A patent/NZ217408A/xx unknown
- 1986-09-09 AU AU62473/86A patent/AU594972B2/en not_active Ceased
-
1987
- 1987-01-15 KR KR1019870000264A patent/KR900005368B1/ko not_active Expired
- 1987-01-16 PT PT84128A patent/PT84128B/pt not_active IP Right Cessation
-
1988
- 1988-07-14 PH PH37224A patent/PH24983A/en unknown
- 1988-07-14 PH PH37223A patent/PH24904A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL78939A0 (en) | 1986-09-30 |
| PH24983A (en) | 1990-12-26 |
| PH24904A (en) | 1990-12-26 |
| JPH0772171B2 (ja) | 1995-08-02 |
| NZ217408A (en) | 1990-03-27 |
| DK347986A (da) | 1987-07-18 |
| IL78939A (en) | 1990-04-29 |
| JPS62169763A (ja) | 1987-07-25 |
| AU6247386A (en) | 1987-07-23 |
| GR862024B (en) | 1986-12-24 |
| AU594972B2 (en) | 1990-03-22 |
| KR900005368B1 (ko) | 1990-07-28 |
| DK347986D0 (da) | 1986-07-22 |
| IN163948B (en:Method) | 1988-12-10 |
| ZA864522B (en) | 1987-02-25 |
| PT84128A (en) | 1987-02-01 |
| PT84128B (pt) | 1989-05-31 |
| KR870007131A (ko) | 1987-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH23843A (en) | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as cardiovascular agents | |
| GB8609331D0 (en) | Anti-arrythmia agents | |
| ZA87988B (en) | 3-alkoxy-2-aminopropylamines useful as cardiovascular agents | |
| EP0255801A3 (en) | Anilinotriazines and their use | |
| GB2195284B (en) | Racquets | |
| GB2190918B (en) | Polyanhydride-siloxanes and polyimide-siloxanes obtained therefrom | |
| GB2191409B (en) | Racket | |
| PH24914A (en) | 1h-pyrazole-1-alkanamides and preparation useful as antiarrhythmic agents | |
| GB2196537B (en) | Racket | |
| GB2199254B (en) | Modified domino game | |
| GR3002011T3 (en) | Novel derivatives based upon pyrido-menadione adducts and uses thereof | |
| GB8703982D0 (en) | Racket | |
| GB8620456D0 (en) | Racket | |
| GB8630493D0 (en) | Racket | |
| GB8712044D0 (en) | Circuitry | |
| EP0233740A3 (en) | Aerocavin and aerocyanidin - antibiotics | |
| GB8710554D0 (en) | Shuttlecock | |
| ZA875341B (en) | Novel phenoxyaliphatylphenyleneoxyalkyl esters and amides | |
| GB2191482B (en) | Substituted pyrimidoindoles and diazepinoindoles | |
| IE862030L (en) | N-substituted-arylalkyl and arylalkylene aminoheterocyclics¹as cardiovascular antihistaminic and antisecretory agents | |
| ZA891081B (en) | N-substituted-arylalkyl and arylalkylene aminoheterocyclics as cardiovascular antihistaminic and antisecretory agents | |
| DE3760571D1 (en) | Exerciser | |
| IE870349L (en) | 3-alkoxy-2-aminopropylamines useful as cardiovascular agents | |
| GB8308458D0 (en) | Builder's trestle and fastening arrangement | |
| IE852266L (en) | Cardiovascular agents |