NO860230L - 1,6-naftyridin-2(1h)-oner med kardiotonisk aktivitet og fremgangsmaate for deres fremstilling. - Google Patents
1,6-naftyridin-2(1h)-oner med kardiotonisk aktivitet og fremgangsmaate for deres fremstilling.Info
- Publication number
- NO860230L NO860230L NO860230A NO860230A NO860230L NO 860230 L NO860230 L NO 860230L NO 860230 A NO860230 A NO 860230A NO 860230 A NO860230 A NO 860230A NO 860230 L NO860230 L NO 860230L
- Authority
- NO
- Norway
- Prior art keywords
- compound
- naphthyridin
- methyl
- formula
- prepared
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 32
- 238000000034 method Methods 0.000 title claims description 30
- 230000003177 cardiotonic effect Effects 0.000 title description 7
- 150000001875 compounds Chemical class 0.000 claims description 74
- 150000003839 salts Chemical class 0.000 claims description 57
- 239000002253 acid Substances 0.000 claims description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 125000002091 cationic group Chemical group 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 13
- 229910052794 bromium Inorganic materials 0.000 claims description 13
- 125000001246 bromo group Chemical group Br* 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- 239000000460 chlorine Chemical group 0.000 claims description 12
- 229910052801 chlorine Chemical group 0.000 claims description 12
- 239000012458 free base Substances 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 claims description 9
- BZFYYPFFELGRLN-UHFFFAOYSA-N 2-methyl-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CC=1NC(=O)C=CC=1C#N BZFYYPFFELGRLN-UHFFFAOYSA-N 0.000 claims description 8
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 8
- 150000002431 hydrogen Chemical group 0.000 claims description 7
- COQVGVKIHGUCRT-UHFFFAOYSA-N 5-(4-methylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(C)=CN1C1=NC=CC2=C1C=CC(=O)N2 COQVGVKIHGUCRT-UHFFFAOYSA-N 0.000 claims description 6
- ZDVDVDYVVWUZAP-UHFFFAOYSA-N 6-methoxy-2-methylpyridine-3-carbonitrile Chemical compound COC1=CC=C(C#N)C(C)=N1 ZDVDVDYVVWUZAP-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- XHTYQFMRBQUCPX-UHFFFAOYSA-N 1,1,3,3-tetramethoxypropane Chemical compound COC(OC)CC(OC)OC XHTYQFMRBQUCPX-UHFFFAOYSA-N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- LAPUCTDQSOSDRH-UHFFFAOYSA-N 1,1-dimethoxyethanamine Chemical compound COC(C)(N)OC LAPUCTDQSOSDRH-UHFFFAOYSA-N 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 81
- 239000000203 mixture Substances 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- 239000000047 product Substances 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 27
- HBOWEWFBGYLXNY-UHFFFAOYSA-N 5-bromo-1h-1,6-naphthyridin-2-one Chemical compound N1C(=O)C=CC2=C1C=CN=C2Br HBOWEWFBGYLXNY-UHFFFAOYSA-N 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 23
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 22
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 22
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- 238000002844 melting Methods 0.000 description 21
- 239000007787 solid Substances 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 17
- 239000011541 reaction mixture Substances 0.000 description 17
- 239000000543 intermediate Substances 0.000 description 16
- 239000002904 solvent Substances 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 12
- 235000011054 acetic acid Nutrition 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 11
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 10
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 10
- 125000003282 alkyl amino group Chemical group 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 230000000875 corresponding effect Effects 0.000 description 9
- 239000012265 solid product Substances 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000003610 charcoal Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 8
- HJLVUXNRXXEMHU-UHFFFAOYSA-N 5-imidazol-1-yl-1h-1,6-naphthyridin-2-one Chemical compound N1=CC=C2NC(=O)C=CC2=C1N1C=CN=C1 HJLVUXNRXXEMHU-UHFFFAOYSA-N 0.000 description 7
- BMXNJIMWIPKMMU-UHFFFAOYSA-N 5-pyrazol-1-yl-1h-1,6-naphthyridin-2-one Chemical compound N1=CC=C2NC(=O)C=CC2=C1N1C=CC=N1 BMXNJIMWIPKMMU-UHFFFAOYSA-N 0.000 description 7
- 241000700199 Cavia porcellus Species 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 210000003540 papillary muscle Anatomy 0.000 description 7
- XLODPSXDXUMZGN-UHFFFAOYSA-N 2-[2-(dimethylamino)ethenyl]-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CN(C)C=CC=1NC(=O)C=CC=1C#N XLODPSXDXUMZGN-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 229940098779 methanesulfonic acid Drugs 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 6
- 239000010452 phosphate Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000012258 stirred mixture Substances 0.000 description 6
- -1 4-substituted 1,6-naphthyridines Chemical class 0.000 description 5
- 241000282326 Felis catus Species 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000004310 lactic acid Substances 0.000 description 5
- 235000014655 lactic acid Nutrition 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 235000011118 potassium hydroxide Nutrition 0.000 description 5
- 229940093932 potassium hydroxide Drugs 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- CQVKMVQRSNNAGO-UHFFFAOYSA-N 2-[4-formyl-3-methyl-n-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate Chemical compound CC1=CC(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)=CC=C1C=O CQVKMVQRSNNAGO-UHFFFAOYSA-N 0.000 description 4
- XLSZMDLNRCVEIJ-UHFFFAOYSA-N 4-methylimidazole Chemical compound CC1=CNC=N1 XLSZMDLNRCVEIJ-UHFFFAOYSA-N 0.000 description 4
- OQPKBHLDKBMNEC-UHFFFAOYSA-N 5-bromo-7-methyl-1h-1,6-naphthyridin-2-one Chemical compound N1C(=O)C=CC2=C1C=C(C)N=C2Br OQPKBHLDKBMNEC-UHFFFAOYSA-N 0.000 description 4
- NVQMTLFXRAEMBG-UHFFFAOYSA-N 5-hydrazinyl-1h-1,6-naphthyridin-2-one Chemical compound N1C(=O)C=CC2=C1C=CN=C2NN NVQMTLFXRAEMBG-UHFFFAOYSA-N 0.000 description 4
- 239000000496 cardiotonic agent Substances 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- OGRZHFWNLNRXGT-UHFFFAOYSA-N 4-bromo-1h-1,6-naphthyridin-2-one Chemical compound C1=NC=C2C(Br)=CC(=O)NC2=C1 OGRZHFWNLNRXGT-UHFFFAOYSA-N 0.000 description 3
- CLSUCOYKBIKURC-UHFFFAOYSA-N 5-(1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=CC=C2NC(=O)C=CC2=C1N1C=NC=N1 CLSUCOYKBIKURC-UHFFFAOYSA-N 0.000 description 3
- GUXVFDONSZNZDH-UHFFFAOYSA-N 5-(3-methylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(C)C=CN1C1=NC=CC2=C1C=CC(=O)N2 GUXVFDONSZNZDH-UHFFFAOYSA-N 0.000 description 3
- MNZJOCYVDGMHPB-UHFFFAOYSA-N 5-(4-bromoimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(Br)=CN1C1=NC=CC2=C1C=CC(=O)N2 MNZJOCYVDGMHPB-UHFFFAOYSA-N 0.000 description 3
- PZKFSRWSQOQYNR-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazole Chemical compound CC1=NC=NN1 PZKFSRWSQOQYNR-UHFFFAOYSA-N 0.000 description 3
- XKVUYEYANWFIJX-UHFFFAOYSA-N 5-methyl-1h-pyrazole Chemical compound CC1=CC=NN1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000001746 atrial effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 210000002837 heart atrium Anatomy 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- DELJOESCKJGFML-RQOWECAXSA-N (z)-3-aminobut-2-enenitrile Chemical compound C\C(N)=C\C#N DELJOESCKJGFML-RQOWECAXSA-N 0.000 description 2
- FBZVZUSVGKOWHG-UHFFFAOYSA-N 1,1-dimethoxy-n,n-dimethylethanamine Chemical compound COC(C)(OC)N(C)C FBZVZUSVGKOWHG-UHFFFAOYSA-N 0.000 description 2
- LLPKQRMDOFYSGZ-UHFFFAOYSA-N 2,5-dimethyl-1h-imidazole Chemical compound CC1=CN=C(C)N1 LLPKQRMDOFYSGZ-UHFFFAOYSA-N 0.000 description 2
- KDENKAJSIDRPJK-UHFFFAOYSA-N 2-[2-(diethylamino)ethenyl]-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CCN(CC)C=CC=1NC(=O)C=CC=1C#N KDENKAJSIDRPJK-UHFFFAOYSA-N 0.000 description 2
- SIVNNPBXFLEBEI-UHFFFAOYSA-N 2-[2-(dimethylamino)prop-1-enyl]-6-methoxypyridine-3-carbonitrile Chemical compound COC1=CC=C(C#N)C(C=C(C)N(C)C)=N1 SIVNNPBXFLEBEI-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- IQPRTBZXSSEENH-UHFFFAOYSA-N 4-bromo-1,6-naphthyridine Chemical compound C1=NC=C2C(Br)=CC=NC2=C1 IQPRTBZXSSEENH-UHFFFAOYSA-N 0.000 description 2
- GKEOOUFCVWEWHA-UHFFFAOYSA-N 4-chloro-1,6-naphthyridine Chemical compound C1=NC=C2C(Cl)=CC=NC2=C1 GKEOOUFCVWEWHA-UHFFFAOYSA-N 0.000 description 2
- IBTOPYVMSRJVRI-UHFFFAOYSA-N 5-(2-methyl-5-nitroimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=NC=C([N+]([O-])=O)N1C1=NC=CC2=C1C=CC(=O)N2 IBTOPYVMSRJVRI-UHFFFAOYSA-N 0.000 description 2
- SIDWLHKHXRPIBU-UHFFFAOYSA-N 5-(2-methylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=NC=CN1C1=NC=CC2=C1C=CC(=O)N2 SIDWLHKHXRPIBU-UHFFFAOYSA-N 0.000 description 2
- RXYCJAJEWKLWMO-UHFFFAOYSA-N 5-(3-methyl-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(C)N=CN1C1=NC=CC2=C1C=CC(=O)N2 RXYCJAJEWKLWMO-UHFFFAOYSA-N 0.000 description 2
- YTSPRSHHNIYOOF-UHFFFAOYSA-N 5-(4,5-dimethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=C(C)N=CN1C1=NC=CC2=C1C=CC(=O)N2 YTSPRSHHNIYOOF-UHFFFAOYSA-N 0.000 description 2
- JSZFPBFOMQDYKA-UHFFFAOYSA-N 5-(4-nitroimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC([N+](=O)[O-])=CN1C1=NC=CC2=C1C=CC(=O)N2 JSZFPBFOMQDYKA-UHFFFAOYSA-N 0.000 description 2
- OKUDPOZHQDAYMA-UHFFFAOYSA-N 5-(4-phenylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=CC=C2NC(=O)C=CC2=C1N(C=1)C=NC=1C1=CC=CC=C1 OKUDPOZHQDAYMA-UHFFFAOYSA-N 0.000 description 2
- DFLGRTIPTPCKPJ-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-imidazole Chemical compound FC(F)(F)C1=CN=CN1 DFLGRTIPTPCKPJ-UHFFFAOYSA-N 0.000 description 2
- FHZALEJIENDROK-UHFFFAOYSA-N 5-bromo-1h-imidazole Chemical compound BrC1=CN=CN1 FHZALEJIENDROK-UHFFFAOYSA-N 0.000 description 2
- PHGKXQAAOMDZTR-UHFFFAOYSA-N 5-hydrazinyl-1h-1,6-naphthyridin-2-one;hydrate;hydrochloride Chemical compound O.Cl.N1C(=O)C=CC2=C1C=CN=C2NN PHGKXQAAOMDZTR-UHFFFAOYSA-N 0.000 description 2
- QZONGAULXRRJKQ-UHFFFAOYSA-N 5-hydrazinyl-7-methyl-1h-1,6-naphthyridin-2-one Chemical compound N1C(=O)C=CC2=C1C=C(C)N=C2NN QZONGAULXRRJKQ-UHFFFAOYSA-N 0.000 description 2
- VYDWQPKRHOGLPA-UHFFFAOYSA-N 5-nitroimidazole Chemical compound [O-][N+](=O)C1=CN=CN1 VYDWQPKRHOGLPA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 230000002861 ventricular Effects 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- FZTLLUYFWAOGGB-UHFFFAOYSA-N 1,4-dioxane dioxane Chemical compound C1COCCO1.C1COCCO1 FZTLLUYFWAOGGB-UHFFFAOYSA-N 0.000 description 1
- DEMHDNYPWNIVBJ-UHFFFAOYSA-N 1,6-naphthyridin-4-ylhydrazine Chemical compound C1=NC=C2C(NN)=CC=NC2=C1 DEMHDNYPWNIVBJ-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-CVMUNTFWSA-N 1h-1,2,4-triazole Chemical class [13CH]=1[15N]=[13CH][15NH][15N]=1 NSPMIYGKQJPBQR-CVMUNTFWSA-N 0.000 description 1
- ZQKMVHXJWJNEQG-UHFFFAOYSA-N 1h-1,6-naphthyridin-2-one Chemical class C1=NC=CC2=NC(O)=CC=C21 ZQKMVHXJWJNEQG-UHFFFAOYSA-N 0.000 description 1
- WFLDCLHOLPDVCP-UHFFFAOYSA-N 1h-1,6-naphthyridin-4-one Chemical compound C1=NC=C2C(O)=CC=NC2=C1 WFLDCLHOLPDVCP-UHFFFAOYSA-N 0.000 description 1
- ZFRUGZMCGCYBRC-UHFFFAOYSA-N 1h-1,8-naphthyridin-2-one Chemical class C1=CC=NC2=NC(O)=CC=C21 ZFRUGZMCGCYBRC-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- PTBPTNCGZUOCBK-UHFFFAOYSA-N 2,4,5-trimethyl-1h-imidazole Chemical compound CC1=NC(C)=C(C)N1 PTBPTNCGZUOCBK-UHFFFAOYSA-N 0.000 description 1
- LOYONBRKTYDBDP-UHFFFAOYSA-N 2,4-dibromo-1,6-naphthyridine Chemical compound C1=NC=CC2=NC(Br)=CC(Br)=C21 LOYONBRKTYDBDP-UHFFFAOYSA-N 0.000 description 1
- AOMLRRHQNFDHCO-UHFFFAOYSA-N 2-[2-(dipropylamino)ethenyl]-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CCCN(CCC)C=CC=1NC(=O)C=CC=1C#N AOMLRRHQNFDHCO-UHFFFAOYSA-N 0.000 description 1
- OFXMWHDBSVVQAL-UHFFFAOYSA-N 2-bromo-4,5-dimethyl-1h-imidazole Chemical compound CC=1N=C(Br)NC=1C OFXMWHDBSVVQAL-UHFFFAOYSA-N 0.000 description 1
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical compound N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 1
- PQAMFDRRWURCFQ-UHFFFAOYSA-N 2-ethyl-1h-imidazole Chemical compound CCC1=NC=CN1 PQAMFDRRWURCFQ-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- XKGAKWNFVDYMEL-UHFFFAOYSA-N 2-methyl-4,5-dipropyl-1h-imidazole Chemical compound CCCC=1N=C(C)NC=1CCC XKGAKWNFVDYMEL-UHFFFAOYSA-N 0.000 description 1
- HUVAAOZUPLEYBH-UHFFFAOYSA-N 3,4,5-trimethyl-1h-pyrazole Chemical compound CC1=NNC(C)=C1C HUVAAOZUPLEYBH-UHFFFAOYSA-N 0.000 description 1
- VQTVFIMEENGCJA-UHFFFAOYSA-N 3,4-dimethyl-1H-pyrazole Chemical compound CC=1C=NNC=1C VQTVFIMEENGCJA-UHFFFAOYSA-N 0.000 description 1
- UGERGYDWQOPISO-UHFFFAOYSA-N 3,5-diethyl-1h-1,2,4-triazole Chemical compound CCC1=NNC(CC)=N1 UGERGYDWQOPISO-UHFFFAOYSA-N 0.000 description 1
- XYYXDARQOHWBPO-UHFFFAOYSA-N 3,5-dimethyl-1h-1,2,4-triazole Chemical compound CC1=NNC(C)=N1 XYYXDARQOHWBPO-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- DELJOESCKJGFML-UHFFFAOYSA-N 3-aminobut-2-enenitrile Chemical compound CC(N)=CC#N DELJOESCKJGFML-UHFFFAOYSA-N 0.000 description 1
- BMTIGKUJWSEHHI-UHFFFAOYSA-N 3-bromo-5-methyl-1h-1,2,4-triazole Chemical compound CC1=NC(Br)=NN1 BMTIGKUJWSEHHI-UHFFFAOYSA-N 0.000 description 1
- SFMFACMIOWQIPR-UHFFFAOYSA-N 3-ethoxyprop-2-enoyl chloride Chemical compound CCOC=CC(Cl)=O SFMFACMIOWQIPR-UHFFFAOYSA-N 0.000 description 1
- XEGJWGYVNFWAHG-UHFFFAOYSA-N 4,5-dibutyl-1h-imidazole Chemical compound CCCCC=1N=CNC=1CCCC XEGJWGYVNFWAHG-UHFFFAOYSA-N 0.000 description 1
- CMBRSAKTEQFDPC-UHFFFAOYSA-N 4,5-diethyl-1h-imidazole Chemical compound CCC=1N=CNC=1CC CMBRSAKTEQFDPC-UHFFFAOYSA-N 0.000 description 1
- YSWBFLWKAIRHEI-UHFFFAOYSA-N 4,5-dimethyl-1h-imidazole Chemical compound CC=1N=CNC=1C YSWBFLWKAIRHEI-UHFFFAOYSA-N 0.000 description 1
- JRMKJOOJKCAEJK-UHFFFAOYSA-N 4-Hydroxymethylpyrazole Chemical compound OCC=1C=NNC=1 JRMKJOOJKCAEJK-UHFFFAOYSA-N 0.000 description 1
- BADSZRMNXWLUKO-UHFFFAOYSA-N 4-chloro-1h-pyrazole Chemical compound ClC=1C=NNC=1 BADSZRMNXWLUKO-UHFFFAOYSA-N 0.000 description 1
- QJHGJSHNFXKDQH-UHFFFAOYSA-N 4-chloro-5-methyl-1h-imidazole Chemical compound CC=1NC=NC=1Cl QJHGJSHNFXKDQH-UHFFFAOYSA-N 0.000 description 1
- MGSZBMLUKBKFIH-UHFFFAOYSA-N 4-ethyl-3,5-dimethyl-1h-pyrazole Chemical compound CCC=1C(C)=NNC=1C MGSZBMLUKBKFIH-UHFFFAOYSA-N 0.000 description 1
- JMJRYEKHKSVHLD-UHFFFAOYSA-N 4-hydrazinyl-1h-1,6-naphthyridin-2-one Chemical compound C1=NC=C2C(NN)=CC(=O)NC2=C1 JMJRYEKHKSVHLD-UHFFFAOYSA-N 0.000 description 1
- XORHNJQEWQGXCN-UHFFFAOYSA-N 4-nitro-1h-pyrazole Chemical compound [O-][N+](=O)C=1C=NNC=1 XORHNJQEWQGXCN-UHFFFAOYSA-N 0.000 description 1
- SAWTYWWMIILHDS-UHFFFAOYSA-N 4-piperidin-1-yl-1,6-naphthyridine Chemical compound C1CCCCN1C1=CC=NC2=CC=NC=C12 SAWTYWWMIILHDS-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- MKEZIWHETOYHPH-UHFFFAOYSA-N 5-(2,4,5-trimethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=C(C)N=C(C)N1C1=NC=CC2=C1C=CC(=O)N2 MKEZIWHETOYHPH-UHFFFAOYSA-N 0.000 description 1
- OVCJCSHUFIYJID-UHFFFAOYSA-N 5-(2,4-dimethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=NC(C)=CN1C1=NC=CC2=C1C=CC(=O)N2 OVCJCSHUFIYJID-UHFFFAOYSA-N 0.000 description 1
- YTZLGOSFDAYIJV-UHFFFAOYSA-N 5-(2-bromo-4,5-dimethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=C(C)N=C(Br)N1C1=NC=CC2=C1C=CC(=O)N2 YTZLGOSFDAYIJV-UHFFFAOYSA-N 0.000 description 1
- PIQPDVJASYTDMW-UHFFFAOYSA-N 5-(2-ethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CCC1=NC=CN1C1=NC=CC2=C1C=CC(=O)N2 PIQPDVJASYTDMW-UHFFFAOYSA-N 0.000 description 1
- FHHXCBADNOHODA-UHFFFAOYSA-N 5-(2-methyl-4,5-dipropylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CCCC1=C(CCC)N=C(C)N1C1=NC=CC2=C1C=CC(=O)N2 FHHXCBADNOHODA-UHFFFAOYSA-N 0.000 description 1
- DLDMUFUHXMYCAD-UHFFFAOYSA-N 5-(2-propan-2-ylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC(C)C1=NC=CN1C1=NC=CC2=C1C=CC(=O)N2 DLDMUFUHXMYCAD-UHFFFAOYSA-N 0.000 description 1
- HBNULULVYKCEAW-UHFFFAOYSA-N 5-(3,4,5-trimethylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=C(C)C(C)=NN1C1=NC=CC2=C1C=CC(=O)N2 HBNULULVYKCEAW-UHFFFAOYSA-N 0.000 description 1
- YEOGAMFKSDELPS-UHFFFAOYSA-N 5-(3,4-dimethylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(C)C(C)=CN1C1=NC=CC2=C1C=CC(=O)N2 YEOGAMFKSDELPS-UHFFFAOYSA-N 0.000 description 1
- JGHREHSJJQOYHH-UHFFFAOYSA-N 5-(3,5-dimethylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(C)C=C(C)N1C1=NC=CC2=C1C=CC(=O)N2 JGHREHSJJQOYHH-UHFFFAOYSA-N 0.000 description 1
- IADJNGWCXWOSEQ-UHFFFAOYSA-N 5-(3-bromo-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(Br)N=CN1C1=NC=CC2=C1C=CC(=O)N2 IADJNGWCXWOSEQ-UHFFFAOYSA-N 0.000 description 1
- BOSCKKRYJBDZGY-UHFFFAOYSA-N 5-(3-bromo-5-methyl-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=NC(Br)=NN1C1=NC=CC2=C1C=CC(=O)N2 BOSCKKRYJBDZGY-UHFFFAOYSA-N 0.000 description 1
- NSHNZFMZTULICF-UHFFFAOYSA-N 5-(3-ethyl-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(CC)N=CN1C1=NC=CC2=C1C=CC(=O)N2 NSHNZFMZTULICF-UHFFFAOYSA-N 0.000 description 1
- GQJQCZUJXOAEEP-UHFFFAOYSA-N 5-(3-phenyl-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=CC=C2NC(=O)C=CC2=C1N(N=1)C=NC=1C1=CC=CC=C1 GQJQCZUJXOAEEP-UHFFFAOYSA-N 0.000 description 1
- UZWGCDFONZBOOE-UHFFFAOYSA-N 5-(3-phenylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=CC=C2NC(=O)C=CC2=C1N(N=1)C=CC=1C1=CC=CC=C1 UZWGCDFONZBOOE-UHFFFAOYSA-N 0.000 description 1
- PTSPNJBHNKMUNV-UHFFFAOYSA-N 5-(3-propyl-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(CCC)N=CN1C1=NC=CC2=C1C=CC(=O)N2 PTSPNJBHNKMUNV-UHFFFAOYSA-N 0.000 description 1
- FOFFYZXKTQHDJL-UHFFFAOYSA-N 5-(3-propylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound N1=C(CCC)C=CN1C1=NC=CC2=C1C=CC(=O)N2 FOFFYZXKTQHDJL-UHFFFAOYSA-N 0.000 description 1
- KAQBYCHJZHXXPE-UHFFFAOYSA-N 5-(4,5-dibutylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CCCCC1=C(CCCC)N=CN1C1=NC=CC2=C1C=CC(=O)N2 KAQBYCHJZHXXPE-UHFFFAOYSA-N 0.000 description 1
- NEQXYRHDRODVIB-UHFFFAOYSA-N 5-(4,5-diethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CCC1=C(CC)N=CN1C1=NC=CC2=C1C=CC(=O)N2 NEQXYRHDRODVIB-UHFFFAOYSA-N 0.000 description 1
- VELDKSSCKYYSRU-UHFFFAOYSA-N 5-(4-chloro-5-methylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=C(Cl)N=CN1C1=NC=CC2=C1C=CC(=O)N2 VELDKSSCKYYSRU-UHFFFAOYSA-N 0.000 description 1
- LFWPRCRZXKHODP-UHFFFAOYSA-N 5-(4-chloroimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(Cl)=CN1C1=NC=CC2=C1C=CC(=O)N2 LFWPRCRZXKHODP-UHFFFAOYSA-N 0.000 description 1
- JIFYYMGKIFCZPR-UHFFFAOYSA-N 5-(4-chloropyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=C(Cl)C=NN1C1=NC=CC2=C1C=CC(=O)N2 JIFYYMGKIFCZPR-UHFFFAOYSA-N 0.000 description 1
- IXZTVNLUYHSTIS-UHFFFAOYSA-N 5-(4-ethyl-3,5-dimethylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound CC1=C(CC)C(C)=NN1C1=NC=CC2=C1C=CC(=O)N2 IXZTVNLUYHSTIS-UHFFFAOYSA-N 0.000 description 1
- CISYBXIJKCQHBS-UHFFFAOYSA-N 5-(4-ethylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(CC)=CN1C1=NC=CC2=C1C=CC(=O)N2 CISYBXIJKCQHBS-UHFFFAOYSA-N 0.000 description 1
- NVWVLOMOFIHBIG-UHFFFAOYSA-N 5-(4-methyl-5-nitroimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound [O-][N+](=O)C1=C(C)N=CN1C1=NC=CC2=C1C=CC(=O)N2 NVWVLOMOFIHBIG-UHFFFAOYSA-N 0.000 description 1
- IJRSYRFAMGQUGV-UHFFFAOYSA-N 5-(4-methylpyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=C(C)C=NN1C1=NC=CC2=C1C=CC(=O)N2 IJRSYRFAMGQUGV-UHFFFAOYSA-N 0.000 description 1
- FSMCDCVXPVIOME-UHFFFAOYSA-N 5-(4-nitropyrazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=C([N+](=O)[O-])C=NN1C1=NC=CC2=C1C=CC(=O)N2 FSMCDCVXPVIOME-UHFFFAOYSA-N 0.000 description 1
- HSSJNUIKHOKIRM-UHFFFAOYSA-N 5-(4-tert-butylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(C(C)(C)C)=CN1C1=NC=CC2=C1C=CC(=O)N2 HSSJNUIKHOKIRM-UHFFFAOYSA-N 0.000 description 1
- DKHNXNXJAVJNJZ-UHFFFAOYSA-N 5-(5-chloro-1,2,4-triazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound ClC1=NC=NN1C1=NC=CC2=C1C=CC(=O)N2 DKHNXNXJAVJNJZ-UHFFFAOYSA-N 0.000 description 1
- KZAQTVQJVOALDK-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-1,2,4-triazole Chemical compound FC(F)(F)C=1N=CNN=1 KZAQTVQJVOALDK-UHFFFAOYSA-N 0.000 description 1
- PYXNITNKYBLBMW-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-pyrazole Chemical compound FC(F)(F)C1=CC=NN1 PYXNITNKYBLBMW-UHFFFAOYSA-N 0.000 description 1
- QRINCMXXRDEVLG-UHFFFAOYSA-N 5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]-1h-1,6-naphthyridin-2-one Chemical compound N1=C(C(F)(F)F)N=CN1C1=NC=CC2=C1C=CC(=O)N2 QRINCMXXRDEVLG-UHFFFAOYSA-N 0.000 description 1
- GBNBEDDIICLXOI-UHFFFAOYSA-N 5-[3-(trifluoromethyl)pyrazol-1-yl]-1h-1,6-naphthyridin-2-one Chemical compound N1=C(C(F)(F)F)C=CN1C1=NC=CC2=C1C=CC(=O)N2 GBNBEDDIICLXOI-UHFFFAOYSA-N 0.000 description 1
- RUTLVKZLOLDCRT-UHFFFAOYSA-N 5-[4-(hydroxymethyl)imidazol-1-yl]-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(CO)=CN1C1=NC=CC2=C1C=CC(=O)N2 RUTLVKZLOLDCRT-UHFFFAOYSA-N 0.000 description 1
- GRHFOOUELVXCPI-UHFFFAOYSA-N 5-[4-(hydroxymethyl)pyrazol-1-yl]-1h-1,6-naphthyridin-2-one Chemical compound C1=C(CO)C=NN1C1=NC=CC2=C1C=CC(=O)N2 GRHFOOUELVXCPI-UHFFFAOYSA-N 0.000 description 1
- XEIZKIMTKMHBBB-UHFFFAOYSA-N 5-[4-(trifluoromethyl)imidazol-1-yl]-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(C(F)(F)F)=CN1C1=NC=CC2=C1C=CC(=O)N2 XEIZKIMTKMHBBB-UHFFFAOYSA-N 0.000 description 1
- HHIZISRHAQPAMY-UHFFFAOYSA-N 5-bromo-1h-1,2,4-triazole Chemical compound BrC1=NC=NN1 HHIZISRHAQPAMY-UHFFFAOYSA-N 0.000 description 1
- QUKQVRJDSBOBFC-UHFFFAOYSA-N 5-bromo-2-methoxy-7-methyl-6h-1,7-naphthyridine Chemical compound C1N(C)C=C2N=C(OC)C=CC2=C1Br QUKQVRJDSBOBFC-UHFFFAOYSA-N 0.000 description 1
- QGOUKZPSCTVYLX-UHFFFAOYSA-N 5-chloro-1h-1,2,4-triazole Chemical compound ClC1=NC=NN1 QGOUKZPSCTVYLX-UHFFFAOYSA-N 0.000 description 1
- BQRBAXFOPZRMCU-UHFFFAOYSA-N 5-chloro-1h-imidazole Chemical compound ClC1=CN=CN1 BQRBAXFOPZRMCU-UHFFFAOYSA-N 0.000 description 1
- JDIPHBYZUMQFQV-UHFFFAOYSA-N 5-ethyl-1h-1,2,4-triazole Chemical compound CCC1=NC=NN1 JDIPHBYZUMQFQV-UHFFFAOYSA-N 0.000 description 1
- NJQHZENQKNIRSY-UHFFFAOYSA-N 5-ethyl-1h-imidazole Chemical compound CCC1=CNC=N1 NJQHZENQKNIRSY-UHFFFAOYSA-N 0.000 description 1
- WSYOWIMKNNMEMZ-UHFFFAOYSA-N 5-methyl-4-nitro-1h-imidazole Chemical compound CC=1NC=NC=1[N+]([O-])=O WSYOWIMKNNMEMZ-UHFFFAOYSA-N 0.000 description 1
- KUEFXPHXHHANKS-UHFFFAOYSA-N 5-nitro-1h-1,2,4-triazole Chemical compound [O-][N+](=O)C1=NC=NN1 KUEFXPHXHHANKS-UHFFFAOYSA-N 0.000 description 1
- NYMLZIFRPNYAHS-UHFFFAOYSA-N 5-phenyl-1h-1,2,4-triazole Chemical compound C1=NNC(C=2C=CC=CC=2)=N1 NYMLZIFRPNYAHS-UHFFFAOYSA-N 0.000 description 1
- XHLKOHSAWQPOFO-UHFFFAOYSA-N 5-phenyl-1h-imidazole Chemical compound N1C=NC=C1C1=CC=CC=C1 XHLKOHSAWQPOFO-UHFFFAOYSA-N 0.000 description 1
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1h-pyrazole Chemical compound N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 description 1
- ZFWJVKLPEZPKNL-UHFFFAOYSA-N 5-propyl-1h-1,2,4-triazole Chemical compound CCCC1=NC=NN1 ZFWJVKLPEZPKNL-UHFFFAOYSA-N 0.000 description 1
- ULKZTFQDSPKNMV-UHFFFAOYSA-N 5-tert-butyl-1h-imidazole Chemical compound CC(C)(C)C1=CN=CN1 ULKZTFQDSPKNMV-UHFFFAOYSA-N 0.000 description 1
- UZAIUYNSLJSQFP-UHFFFAOYSA-N 6-(1h-imidazol-2-yl)-1,8-naphthyridin-2-amine Chemical compound C1=NC2=NC(N)=CC=C2C=C1C1=NC=CN1 UZAIUYNSLJSQFP-UHFFFAOYSA-N 0.000 description 1
- HPQCPAAKZBMFNW-UHFFFAOYSA-N 6-(1h-imidazol-2-yl)-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)C=CC2=CC=1C1=NC=CN1 HPQCPAAKZBMFNW-UHFFFAOYSA-N 0.000 description 1
- PCDPITLPCWBXRB-UHFFFAOYSA-N 6-chloro-2-methylpyridine-3-carbonitrile Chemical compound CC1=NC(Cl)=CC=C1C#N PCDPITLPCWBXRB-UHFFFAOYSA-N 0.000 description 1
- GQBZQJSNOYHASS-UHFFFAOYSA-N 7-methyl-5-(4-methylimidazol-1-yl)-1h-1,6-naphthyridin-2-one Chemical compound C1=NC(C)=CN1C1=NC(C)=CC2=C1C=CC(=O)N2 GQBZQJSNOYHASS-UHFFFAOYSA-N 0.000 description 1
- OFSRJMGFLXJJAJ-UHFFFAOYSA-N 7-methyl-5-pyrazol-1-yl-1h-1,6-naphthyridin-2-one Chemical compound N=1C(C)=CC=2NC(=O)C=CC=2C=1N1C=CC=N1 OFSRJMGFLXJJAJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910019201 POBr3 Inorganic materials 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- PQUGCKBLVKJMNT-UHFFFAOYSA-N SC560 Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC(Cl)=CC=2)=CC(C(F)(F)F)=N1 PQUGCKBLVKJMNT-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- 230000003182 bronchodilatating effect Effects 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical compound CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- RIKMMFOAQPJVMX-UHFFFAOYSA-N fomepizole Chemical compound CC=1C=NNC=1 RIKMMFOAQPJVMX-UHFFFAOYSA-N 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- VPZNCKZYMQQSDW-UHFFFAOYSA-N n,n,n',n'-tetraethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CCN(CC)C(OC(C)(C)C)N(CC)CC VPZNCKZYMQQSDW-UHFFFAOYSA-N 0.000 description 1
- BVIROGXYGCFCFP-UHFFFAOYSA-N n,n-dimethyl-1,6-naphthyridin-4-amine Chemical compound C1=NC=C2C(N(C)C)=CC=NC2=C1 BVIROGXYGCFCFP-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- ZHNFLHYOFXQIOW-LPYZJUEESA-N quinine sulfate dihydrate Chemical compound [H+].[H+].O.O.[O-]S([O-])(=O)=O.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 ZHNFLHYOFXQIOW-LPYZJUEESA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US69560385A | 1985-01-28 | 1985-01-28 | |
| US76590085A | 1985-08-14 | 1985-08-14 | |
| US81104085A | 1985-12-19 | 1985-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO860230L true NO860230L (no) | 1986-07-29 |
Family
ID=27418622
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO860230A NO860230L (no) | 1985-01-28 | 1986-01-22 | 1,6-naftyridin-2(1h)-oner med kardiotonisk aktivitet og fremgangsmaate for deres fremstilling. |
Country Status (12)
| Country | Link |
|---|---|
| EP (1) | EP0189853A3 (da) |
| KR (1) | KR870006046A (da) |
| AU (1) | AU590870B2 (da) |
| DK (1) | DK32086A (da) |
| ES (1) | ES8800221A1 (da) |
| FI (1) | FI860305A7 (da) |
| GR (1) | GR860180B (da) |
| IL (1) | IL77670A (da) |
| NO (1) | NO860230L (da) |
| NZ (1) | NZ214837A (da) |
| PH (1) | PH22347A (da) |
| PT (1) | PT81894B (da) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4567186A (en) * | 1985-01-14 | 1986-01-28 | Sterling Drug Inc. | 5-Heteryl-1,6-naphthyridin-2(1H)-ones, cardiotonic use thereof and intermediates therefor |
| MXPA05008612A (es) * | 2003-02-14 | 2005-12-05 | Smithkline Beecham Corp | Compuestos novedosos. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4415580A (en) * | 1982-08-02 | 1983-11-15 | Sterling Drug Inc. | Certain 2-(1H)-pyridinones cardiotonic compositions containing same and method of using same |
| PT79699B (en) * | 1983-12-22 | 1986-12-10 | Pfizer | Process for preparing quinolone inotropic agents |
| US4560691A (en) * | 1984-07-13 | 1985-12-24 | Sterling Drug Inc. | 5-(Phenyl)-1,6-naphthyridin-2(1H)-ones, their cardiotonic use and preparation |
-
1986
- 1986-01-15 NZ NZ214837A patent/NZ214837A/xx unknown
- 1986-01-17 AU AU52447/86A patent/AU590870B2/en not_active Expired - Fee Related
- 1986-01-21 IL IL77670A patent/IL77670A/xx unknown
- 1986-01-22 KR KR1019860000391A patent/KR870006046A/ko not_active Ceased
- 1986-01-22 FI FI860305A patent/FI860305A7/fi not_active Application Discontinuation
- 1986-01-22 NO NO860230A patent/NO860230L/no unknown
- 1986-01-22 DK DK32086A patent/DK32086A/da not_active Application Discontinuation
- 1986-01-22 GR GR860180A patent/GR860180B/el unknown
- 1986-01-23 PT PT81894A patent/PT81894B/pt unknown
- 1986-01-23 EP EP86100903A patent/EP0189853A3/en not_active Withdrawn
- 1986-01-23 PH PH33318A patent/PH22347A/en unknown
- 1986-01-27 ES ES551258A patent/ES8800221A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU5244786A (en) | 1986-07-31 |
| ES551258A0 (es) | 1987-11-01 |
| AU590870B2 (en) | 1989-11-23 |
| EP0189853A2 (en) | 1986-08-06 |
| NZ214837A (en) | 1988-10-28 |
| PT81894A (en) | 1986-02-01 |
| IL77670A (en) | 1989-05-15 |
| GR860180B (en) | 1986-05-29 |
| PT81894B (en) | 1987-05-05 |
| FI860305A0 (fi) | 1986-01-22 |
| EP0189853A3 (en) | 1987-12-16 |
| FI860305A7 (fi) | 1986-07-29 |
| DK32086A (da) | 1986-07-29 |
| KR870006046A (ko) | 1987-07-08 |
| PH22347A (en) | 1988-08-12 |
| DK32086D0 (da) | 1986-01-22 |
| ES8800221A1 (es) | 1987-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI92697C (fi) | Menetelmä lääkeaineina käyttökelpoisten imidatso/4,5-b/kinolinyylioksialkaanihappoamidien valmistamiseksi | |
| US5656629A (en) | 6-substituted pyrazolo (3,4-d)pyrimidin-4-ones and compositions and methods of use thereof | |
| AU723098B2 (en) | Substituted triazolo-pyridazine derivatives as ligands for GABA receptors | |
| CZ287772B6 (en) | Thienopyrimidine derivative, process of its preparation and pharmaceutical preparation in which it is comprised | |
| PT87623B (pt) | Processo para a preparacao de derivados do benzotriazole substituido com (1h-azol-1-ilmetil) e de composicoes farmaceuticas que os contem | |
| HU210814A9 (en) | Pyrido pyridazinone and pyridazinthione compounds | |
| NO841106L (no) | Fremgangsmaate for fremstilling av kondenserte imidazolderivater | |
| CZ302374B6 (cs) | Derivát 1,2-anelovaného chinolinu, zpusob a meziprodukt pro jeho prípravu a farmaceutický prostredek s jeho obsahem | |
| US5068337A (en) | 1,4-dihydropyridines and their ability to inhibit blood platelet aggregation, inhibit thromboxane synthetase and phospholipase | |
| CZ292792B6 (cs) | Chinoxalindiony, způsob a meziprodukty pro jejich výrobu, jejich použití a farmaceutické kompozice na jejich bázi | |
| NO159930B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive indeno-pyridazinon-derivater. | |
| KR19990028390A (ko) | 트리아졸 항진균제 | |
| PH26046A (en) | Dihydropyridine PAF antagonists | |
| JPH05503095A (ja) | イミダゾール類 | |
| NO852677L (no) | Fremgangsmaate for fremstilling av 1,6-naftyridin-2(ih)-oner for bruk som kardiotoniske midler. | |
| US4667033A (en) | Substituted 6-(thien-2-yl)-3(2H)-pyridazinones | |
| JPH05247038A (ja) | 複素環式誘導体 | |
| US4697021A (en) | 1,6-dihydro-6-oxo-3-pyridinecarbonitriles, intermediates for cardiotonic agents | |
| US4657915A (en) | 1,6-naphthyridine-2(1H)-ones and their use as cardiotonic agents | |
| NO820036L (no) | Pyridinyl-substituerte benzimidazolderivater og fremgangsmaate for deres fremstilling | |
| US4716170A (en) | 5-[1H-(5-membered-N-aromatic heteryl)-1-yl]-1,6-naphthyridin-2(1H)-ones and their cardiotonic use | |
| NO810834L (no) | Fremgangsmaate til fremstilling av pyrazolpyridinderivater | |
| CZ289658B6 (cs) | Deriváty 2,3-benzodiazepinu, způsob jejich výroby, meziprodukty pro jejich výrobu a farmaceutický prostředek tyto látky obsahující | |
| US4634772A (en) | 2-[2-(di-lower-alkylamino)-1-propenyl]-6-methoxy-3-pyridinecarbonitriles, intermediates for cardiotonic agents | |
| EP0189853A2 (en) | 1,6-Naphthyridin-2(1H)-ones having cardiotonic activity and preparation |