NO843292L - Fremgangsmaate for fremstilling av nye kinolon-derivater - Google Patents
Fremgangsmaate for fremstilling av nye kinolon-derivaterInfo
- Publication number
- NO843292L NO843292L NO843292A NO843292A NO843292L NO 843292 L NO843292 L NO 843292L NO 843292 A NO843292 A NO 843292A NO 843292 A NO843292 A NO 843292A NO 843292 L NO843292 L NO 843292L
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- formula
- mixture
- compound
- tetrazol
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 5
- 238000002360 preparation method Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 133
- -1 cyano, difluoromethoxy Chemical group 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 150000002431 hydrogen Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 claims description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 6
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000001204 N-oxides Chemical class 0.000 claims description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000003555 thioacetals Chemical class 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 150000007854 aminals Chemical class 0.000 claims 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims 1
- 230000022244 formylation Effects 0.000 claims 1
- 238000006170 formylation reaction Methods 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 134
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 105
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 71
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 56
- 239000011928 denatured alcohol Substances 0.000 description 51
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 49
- 239000000243 solution Substances 0.000 description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 43
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 238000001914 filtration Methods 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 30
- 238000003756 stirring Methods 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 239000012265 solid product Substances 0.000 description 27
- 239000007787 solid Substances 0.000 description 23
- 239000000047 product Substances 0.000 description 20
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 18
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 17
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 17
- 239000000284 extract Substances 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 15
- 229910000027 potassium carbonate Inorganic materials 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 14
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 14
- AULVVHLFKXNDDC-UHFFFAOYSA-N 7-fluoro-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(F)=CC=C2C1=O AULVVHLFKXNDDC-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 11
- 229910052744 lithium Inorganic materials 0.000 description 11
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- 238000010828 elution Methods 0.000 description 9
- HWHNFJYQDMSYAF-UHFFFAOYSA-N 1,5-dimethyltetrazole Chemical compound CC1=NN=NN1C HWHNFJYQDMSYAF-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- SYXKGGATRCNDOQ-UHFFFAOYSA-N (1-methyl-1h-tetrazol-5-yl)methyl lithium Chemical compound [Li+].CN1N=NN=C1[CH2-] SYXKGGATRCNDOQ-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- IMWCSLSXSSYLMO-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC=CC=C2C1=O IMWCSLSXSSYLMO-UHFFFAOYSA-N 0.000 description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 235000019260 propionic acid Nutrition 0.000 description 5
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- LCKCUPOYAWWNOX-UHFFFAOYSA-N 1-[2-(methylamino)phenyl]-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CNC1=CC=CC=C1C(=O)CC1=NN=NN1C LCKCUPOYAWWNOX-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ANZBQVRQOPAZDM-UHFFFAOYSA-N 1-[4-fluoro-2-(methylamino)phenyl]-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CNC1=CC(F)=CC=C1C(=O)CC1=NN=NN1C ANZBQVRQOPAZDM-UHFFFAOYSA-N 0.000 description 3
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 3
- CMLFRMDBDNHMRA-UHFFFAOYSA-N 2h-1,2-benzoxazine Chemical compound C1=CC=C2C=CNOC2=C1 CMLFRMDBDNHMRA-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- KNJHGBZGSGBVEU-UHFFFAOYSA-N 1,7-dimethyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound C=1C(C)=CC=C(C2=O)C=1N(C)C=C2C1=NN=NN1C KNJHGBZGSGBVEU-UHFFFAOYSA-N 0.000 description 2
- TXLSESVFVLLBPZ-UHFFFAOYSA-N 1-(2-amino-4-chloro-5-fluorophenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=CC(F)=C(Cl)C=C1N TXLSESVFVLLBPZ-UHFFFAOYSA-N 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 2
- RVWCNZFSOLGMSX-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-7-piperidin-1-ylquinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(N3CCCCC3)=CC=C2C1=O RVWCNZFSOLGMSX-UHFFFAOYSA-N 0.000 description 2
- HZFUIJPJTLTALE-UHFFFAOYSA-N 1-methyl-3-(2h-tetrazol-5-yl)quinolin-4-one Chemical compound O=C1C2=CC=CC=C2N(C)C=C1C1=NN=NN1 HZFUIJPJTLTALE-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- RHRTVUWLTSBVJH-UHFFFAOYSA-N 3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound CN1N=NN=C1C1=CN=C(C=CC=C2)C2=C1O RHRTVUWLTSBVJH-UHFFFAOYSA-N 0.000 description 2
- XZGLNCKSNVGDNX-UHFFFAOYSA-N 5-methyl-2h-tetrazole Chemical compound CC=1N=NNN=1 XZGLNCKSNVGDNX-UHFFFAOYSA-N 0.000 description 2
- AJVKTPKCOKFIAS-UHFFFAOYSA-N 7-(trifluoromethyl)-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C=2C1=CC(C(F)(F)F)=CC=2 AJVKTPKCOKFIAS-UHFFFAOYSA-N 0.000 description 2
- UXNYABUCCNUIIF-UHFFFAOYSA-N 7-fluoro-1-methyl-3,1-benzoxazine-2,4-dione Chemical compound FC1=CC=C2C(=O)OC(=O)N(C)C2=C1 UXNYABUCCNUIIF-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- KJMRWDHBVCNLTQ-UHFFFAOYSA-N N-methylisatoic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)N(C)C2=C1 KJMRWDHBVCNLTQ-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- NKDDWNXOKDWJAK-UHFFFAOYSA-N dimethoxymethane Chemical compound COCOC NKDDWNXOKDWJAK-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IOSTYTUPOTYMES-UHFFFAOYSA-N methyl 4-fluoro-2-(methylamino)benzoate Chemical compound CNC1=CC(F)=CC=C1C(=O)OC IOSTYTUPOTYMES-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000007660 quinolones Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 150000003536 tetrazoles Chemical group 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- CEMAWMOMDPGJMB-UHFFFAOYSA-N (+-)-Oxprenolol Chemical compound CC(C)NCC(O)COC1=CC=CC=C1OCC=C CEMAWMOMDPGJMB-UHFFFAOYSA-N 0.000 description 1
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 description 1
- WNFJCTUIBKPISJ-UHFFFAOYSA-N 1,6,7-trimethyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound O=C1C=2C=C(C)C(C)=CC=2N(C)C=C1C1=NN=NN1C WNFJCTUIBKPISJ-UHFFFAOYSA-N 0.000 description 1
- XTEVRJNKYYTSLF-UHFFFAOYSA-N 1,6-dimethyl-3,1-benzoxazine-2,4-dione Chemical compound CN1C(=O)OC(=O)C2=CC(C)=CC=C21 XTEVRJNKYYTSLF-UHFFFAOYSA-N 0.000 description 1
- QFDCJEWQWGGQLX-UHFFFAOYSA-N 1,6-dimethyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound O=C1C2=CC(C)=CC=C2N(C)C=C1C1=NN=NN1C QFDCJEWQWGGQLX-UHFFFAOYSA-N 0.000 description 1
- BGHVXDVBDJSDRY-UHFFFAOYSA-N 1,7-dimethyl-3-(1-methyltetrazol-5-yl)quinoline-4-thione Chemical compound C=1C(C)=CC=C(C2=S)C=1N(C)C=C2C1=NN=NN1C BGHVXDVBDJSDRY-UHFFFAOYSA-N 0.000 description 1
- XRAMLPVVYHXAKZ-UHFFFAOYSA-N 1-(2-amino-4,5-difluorophenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=CC(F)=C(F)C=C1N XRAMLPVVYHXAKZ-UHFFFAOYSA-N 0.000 description 1
- FLDYLAPKTPSKMP-UHFFFAOYSA-N 1-(2-amino-4,5-dimethylphenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound C1=C(C)C(C)=CC(N)=C1C(=O)CC1=NN=NN1C FLDYLAPKTPSKMP-UHFFFAOYSA-N 0.000 description 1
- NBHOAEHAJIHAHS-UHFFFAOYSA-N 1-(2-amino-4-bromophenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=CC=C(Br)C=C1N NBHOAEHAJIHAHS-UHFFFAOYSA-N 0.000 description 1
- JFGAETQLWDMBGZ-UHFFFAOYSA-N 1-(2-amino-4-chloro-5-methoxyphenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound C1=C(Cl)C(OC)=CC(C(=O)CC=2N(N=NN=2)C)=C1N JFGAETQLWDMBGZ-UHFFFAOYSA-N 0.000 description 1
- FDLPQLHWZKUQNI-UHFFFAOYSA-N 1-(2-amino-4-ethylphenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound NC1=CC(CC)=CC=C1C(=O)CC1=NN=NN1C FDLPQLHWZKUQNI-UHFFFAOYSA-N 0.000 description 1
- XABAATJGOAXPSP-UHFFFAOYSA-N 1-(2-amino-4-methylphenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound NC1=CC(C)=CC=C1C(=O)CC1=NN=NN1C XABAATJGOAXPSP-UHFFFAOYSA-N 0.000 description 1
- BAGHZKPJUGPGBO-UHFFFAOYSA-N 1-(2-amino-5-fluorophenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=CC(F)=CC=C1N BAGHZKPJUGPGBO-UHFFFAOYSA-N 0.000 description 1
- XNFBGOWZFFMDAB-UHFFFAOYSA-N 1-(2-amino-5-methoxyphenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound COC1=CC=C(N)C(C(=O)CC=2N(N=NN=2)C)=C1 XNFBGOWZFFMDAB-UHFFFAOYSA-N 0.000 description 1
- DUZQWHPVBOAJFK-UHFFFAOYSA-N 1-(2-aminophenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=CC=CC=C1N DUZQWHPVBOAJFK-UHFFFAOYSA-N 0.000 description 1
- KHLNJUIVJZKXQR-UHFFFAOYSA-N 1-(6-amino-2-chloro-3-fluorophenyl)-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=C(N)C=CC(F)=C1Cl KHLNJUIVJZKXQR-UHFFFAOYSA-N 0.000 description 1
- WQORRHVFTQRRJQ-UHFFFAOYSA-N 1-[2-(methylamino)phenyl]-2-(2h-tetrazol-5-yl)ethanone Chemical compound CNC1=CC=CC=C1C(=O)CC1=NN=NN1 WQORRHVFTQRRJQ-UHFFFAOYSA-N 0.000 description 1
- ZBIPGLMIHWHTMO-UHFFFAOYSA-N 1-[2-amino-4-(trifluoromethyl)phenyl]-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CN1N=NN=C1CC(=O)C1=CC=C(C(F)(F)F)C=C1N ZBIPGLMIHWHTMO-UHFFFAOYSA-N 0.000 description 1
- VJIIMWPEXIBYTI-UHFFFAOYSA-N 1-[4-fluoro-2-(methylamino)phenyl]-2-(2h-tetrazol-5-yl)ethanone Chemical compound CNC1=CC(F)=CC=C1C(=O)CC1=NN=NN1 VJIIMWPEXIBYTI-UHFFFAOYSA-N 0.000 description 1
- OPMGJBYFTBHUMD-UHFFFAOYSA-N 1-[5-methyl-2-(methylamino)phenyl]-2-(1-methyltetrazol-5-yl)ethanone Chemical compound CNC1=CC=C(C)C=C1C(=O)CC1=NN=NN1C OPMGJBYFTBHUMD-UHFFFAOYSA-N 0.000 description 1
- DWVWUHQHWUMEPO-UHFFFAOYSA-N 1-butyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound O=C1C2=CC=CC=C2N(CCCC)C=C1C1=NN=NN1C DWVWUHQHWUMEPO-UHFFFAOYSA-N 0.000 description 1
- REGSNLXSBDVWNZ-UHFFFAOYSA-N 1-ethyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound O=C1C2=CC=CC=C2N(CC)C=C1C1=NN=NN1C REGSNLXSBDVWNZ-UHFFFAOYSA-N 0.000 description 1
- AQGHYESMEAQQKQ-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-4-oxoquinoline-7-carbonitrile Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(C#N)=CC=C2C1=O AQGHYESMEAQQKQ-UHFFFAOYSA-N 0.000 description 1
- URGLASGRLVQDDU-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-7-(1-oxidopiperidin-1-ium-1-yl)quinolin-4-one;hydrate Chemical compound O.CN1N=NN=C1C1=CN(C)C2=CC([N+]3([O-])CCCCC3)=CC=C2C1=O URGLASGRLVQDDU-UHFFFAOYSA-N 0.000 description 1
- RQUWSUFBPQGGCV-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-7-(trifluoromethyl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(C(F)(F)F)=CC=C2C1=O RQUWSUFBPQGGCV-UHFFFAOYSA-N 0.000 description 1
- NIGKRYAEWLFGBW-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-7-morpholin-4-ylquinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(N3CCOCC3)=CC=C2C1=O NIGKRYAEWLFGBW-UHFFFAOYSA-N 0.000 description 1
- BBANDTXBZGOIDY-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-7-phenylquinoline-4-thione Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(C=3C=CC=CC=3)=CC=C2C1=S BBANDTXBZGOIDY-UHFFFAOYSA-N 0.000 description 1
- JJSNYGJJYUJJNG-UHFFFAOYSA-N 1-methyl-3-(1-methyltetrazol-5-yl)-7-pyrrolidin-1-ylquinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(N3CCCC3)=CC=C2C1=O JJSNYGJJYUJJNG-UHFFFAOYSA-N 0.000 description 1
- LDNGAPLPMXAJDN-UHFFFAOYSA-N 1-methyl-3-(2-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NC(C=2C(C3=CC=CC=C3N(C)C=2)=O)=N1 LDNGAPLPMXAJDN-UHFFFAOYSA-N 0.000 description 1
- XZGBWAIGBPFQSO-UHFFFAOYSA-N 1-methyl-7-methylsulfinyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(S(C)=O)=CC=C2C1=O XZGBWAIGBPFQSO-UHFFFAOYSA-N 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- TXJUTRJFNRYTHH-UHFFFAOYSA-N 1h-3,1-benzoxazine-2,4-dione Chemical compound C1=CC=C2C(=O)OC(=O)NC2=C1 TXJUTRJFNRYTHH-UHFFFAOYSA-N 0.000 description 1
- DGOZIZVTANAGCA-UHFFFAOYSA-N 2-amino-4,5-difluorobenzoic acid Chemical compound NC1=CC(F)=C(F)C=C1C(O)=O DGOZIZVTANAGCA-UHFFFAOYSA-N 0.000 description 1
- NQTLZJODEOHALT-UHFFFAOYSA-N 2-amino-4-(trifluoromethyl)benzoic acid Chemical compound NC1=CC(C(F)(F)F)=CC=C1C(O)=O NQTLZJODEOHALT-UHFFFAOYSA-N 0.000 description 1
- PDZNNLOPRRTCNP-UHFFFAOYSA-N 3-(1-methyltetrazol-5-yl)-7-(trifluoromethyl)-1H-quinolin-4-one Chemical compound CN1N=NN=C1C1=CN=C(C=C(C=C2)C(F)(F)F)C2=C1O PDZNNLOPRRTCNP-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 150000004331 4-hydroxyquinolines Chemical class 0.000 description 1
- KPBDDCHVARVOII-UHFFFAOYSA-N 5,5-dimethyltetrazole Chemical compound CC1(C)N=NN=N1 KPBDDCHVARVOII-UHFFFAOYSA-N 0.000 description 1
- USPYDUPOCUYHQL-VEVMSBRDSA-N 5beta-dihydrodeoxycorticosterone Chemical compound C1C(=O)CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CC[C@@H]21 USPYDUPOCUYHQL-VEVMSBRDSA-N 0.000 description 1
- AVZADIUILXLPTI-UHFFFAOYSA-N 6,7-difluoro-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(F)=C(F)C=C2C1=O AVZADIUILXLPTI-UHFFFAOYSA-N 0.000 description 1
- NQOJGQBTBYIIDE-UHFFFAOYSA-N 6,7-difluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=C(F)C(F)=C2 NQOJGQBTBYIIDE-UHFFFAOYSA-N 0.000 description 1
- VWWPQJRBGFUEPU-UHFFFAOYSA-N 6,7-difluoro-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound CN1N=NN=C1C1=CN=C(C=C(F)C(F)=C2)C2=C1O VWWPQJRBGFUEPU-UHFFFAOYSA-N 0.000 description 1
- DCHWHHMDRNGZBG-UHFFFAOYSA-N 6,7-dimethyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=C(C)C(C)=C2 DCHWHHMDRNGZBG-UHFFFAOYSA-N 0.000 description 1
- VCVPGWQWWXIJIL-UHFFFAOYSA-N 6,7-dimethyl-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound OC1=C2C=C(C)C(C)=CC2=NC=C1C1=NN=NN1C VCVPGWQWWXIJIL-UHFFFAOYSA-N 0.000 description 1
- JUOZDCBYORFDAJ-UHFFFAOYSA-N 6-fluoro-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC=C(F)C=C2C1=O JUOZDCBYORFDAJ-UHFFFAOYSA-N 0.000 description 1
- UBKGOWGNYKVYEF-UHFFFAOYSA-N 6-fluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(F)=CC=C21 UBKGOWGNYKVYEF-UHFFFAOYSA-N 0.000 description 1
- CMAMXSCXCJHUSS-UHFFFAOYSA-N 6-fluoro-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound CN1N=NN=C1C1=CN=C(C=CC(F)=C2)C2=C1O CMAMXSCXCJHUSS-UHFFFAOYSA-N 0.000 description 1
- FECHTSHDRPBILO-UHFFFAOYSA-N 6-methoxy-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound O=C1C2=CC(OC)=CC=C2N(C)C=C1C1=NN=NN1C FECHTSHDRPBILO-UHFFFAOYSA-N 0.000 description 1
- LDNGIORVDHXRLH-UHFFFAOYSA-N 6-methoxy-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound OC=1C2=CC(OC)=CC=C2N=CC=1C1=NN=NN1C LDNGIORVDHXRLH-UHFFFAOYSA-N 0.000 description 1
- IIXZSGIPOINDJO-UHFFFAOYSA-N 6-methyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(C)=CC=C21 IIXZSGIPOINDJO-UHFFFAOYSA-N 0.000 description 1
- UVUMPBVILKHRMA-UHFFFAOYSA-N 7-(benzenesulfinyl)-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(S(=O)C=3C=CC=CC=3)=CC=C2C1=O UVUMPBVILKHRMA-UHFFFAOYSA-N 0.000 description 1
- ZMOOSMIEIWBMND-UHFFFAOYSA-N 7-(difluoromethoxy)-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(OC(F)F)=CC=C2C1=O ZMOOSMIEIWBMND-UHFFFAOYSA-N 0.000 description 1
- KIHOABHLXKOYJE-UHFFFAOYSA-N 7-bromo-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(Br)=CC=C2C1=O KIHOABHLXKOYJE-UHFFFAOYSA-N 0.000 description 1
- PDGHWWQDMPEMKS-UHFFFAOYSA-N 7-bromo-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C=2C1=CC(Br)=CC=2 PDGHWWQDMPEMKS-UHFFFAOYSA-N 0.000 description 1
- LRRBEDVMQIURKQ-UHFFFAOYSA-N 7-bromo-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound CN1N=NN=C1C1=CN=C(C=C(Br)C=C2)C2=C1O LRRBEDVMQIURKQ-UHFFFAOYSA-N 0.000 description 1
- LNAJROCOIJIWPM-UHFFFAOYSA-N 7-butoxy-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound C=1C(OCCCC)=CC=C(C2=O)C=1N(C)C=C2C1=NN=NN1C LNAJROCOIJIWPM-UHFFFAOYSA-N 0.000 description 1
- CSNUEYUPCSCWHF-UHFFFAOYSA-N 7-chloro-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(Cl)=CC=C2C1=O CSNUEYUPCSCWHF-UHFFFAOYSA-N 0.000 description 1
- QRUPDIJQZCABTC-UHFFFAOYSA-N 7-chloro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C=2C1=CC(Cl)=CC=2 QRUPDIJQZCABTC-UHFFFAOYSA-N 0.000 description 1
- VBNFAXIYPBIKNV-UHFFFAOYSA-N 7-chloro-6-fluoro-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(Cl)=C(F)C=C2C1=O VBNFAXIYPBIKNV-UHFFFAOYSA-N 0.000 description 1
- SHJIGJHFUPTPGR-UHFFFAOYSA-N 7-chloro-6-fluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=C(Cl)C(F)=C2 SHJIGJHFUPTPGR-UHFFFAOYSA-N 0.000 description 1
- MSNFJEWKRXZZBY-UHFFFAOYSA-N 7-chloro-6-fluoro-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound CN1N=NN=C1C1=CN=C(C=C(Cl)C(F)=C2)C2=C1O MSNFJEWKRXZZBY-UHFFFAOYSA-N 0.000 description 1
- SUCZITLMDCNOOW-UHFFFAOYSA-N 7-chloro-6-methoxy-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound C1=C(Cl)C(OC)=CC(C2=O)=C1N(C)C=C2C1=NN=NN1C SUCZITLMDCNOOW-UHFFFAOYSA-N 0.000 description 1
- PESBODVNJSIJOY-UHFFFAOYSA-N 7-chloro-6-methoxy-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=C(Cl)C(OC)=C2 PESBODVNJSIJOY-UHFFFAOYSA-N 0.000 description 1
- KJBHLSLQUTZAMK-UHFFFAOYSA-N 7-chloro-6-methoxy-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound C=1N=C2C=C(Cl)C(OC)=CC2=C(O)C=1C1=NN=NN1C KJBHLSLQUTZAMK-UHFFFAOYSA-N 0.000 description 1
- XNWFTECXRBGRKF-UHFFFAOYSA-N 7-ethoxy-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound C=1C(OCC)=CC=C(C2=O)C=1N(C)C=C2C1=NN=NN1C XNWFTECXRBGRKF-UHFFFAOYSA-N 0.000 description 1
- WQTBUFJMYBSNQY-UHFFFAOYSA-N 7-ethyl-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound C=1C(CC)=CC=C(C2=O)C=1N(C)C=C2C1=NN=NN1C WQTBUFJMYBSNQY-UHFFFAOYSA-N 0.000 description 1
- VRBRFKROMNYVDH-UHFFFAOYSA-N 7-ethyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C=2C1=CC(CC)=CC=2 VRBRFKROMNYVDH-UHFFFAOYSA-N 0.000 description 1
- INDSBERKYXWBCR-UHFFFAOYSA-N 7-ethyl-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound C1=NC2=CC(CC)=CC=C2C(O)=C1C1=NN=NN1C INDSBERKYXWBCR-UHFFFAOYSA-N 0.000 description 1
- NDVUROQORWZIJX-UHFFFAOYSA-N 7-fluoro-1-methyl-3-(2h-tetrazol-5-yl)quinolin-4-one Chemical compound O=C1C2=CC=C(F)C=C2N(C)C=C1C1=NN=NN1 NDVUROQORWZIJX-UHFFFAOYSA-N 0.000 description 1
- JEVWCMDHSLNNDR-UHFFFAOYSA-N 7-fluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C=2C1=CC(F)=CC=2 JEVWCMDHSLNNDR-UHFFFAOYSA-N 0.000 description 1
- DAPHDGMQKBYHFP-UHFFFAOYSA-N 7-hydroxy-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound CN1N=NN=C1C1=CN(C)C2=CC(O)=CC=C2C1=O DAPHDGMQKBYHFP-UHFFFAOYSA-N 0.000 description 1
- YSRANZPXBYAEIQ-UHFFFAOYSA-N 7-methoxy-1-methyl-3-(1-methyltetrazol-5-yl)quinolin-4-one Chemical compound C=1C(OC)=CC=C(C2=O)C=1N(C)C=C2C1=NN=NN1C YSRANZPXBYAEIQ-UHFFFAOYSA-N 0.000 description 1
- FTOHSJGKIFDLQU-UHFFFAOYSA-N 7-methyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C=2C1=CC(C)=CC=2 FTOHSJGKIFDLQU-UHFFFAOYSA-N 0.000 description 1
- KYFKKFGOYJMSOT-UHFFFAOYSA-N 7-methyl-3-(1-methyltetrazol-5-yl)-1H-quinolin-4-one Chemical compound C1=NC2=CC(C)=CC=C2C(O)=C1C1=NN=NN1C KYFKKFGOYJMSOT-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LOCDPORVFVOGCR-UHFFFAOYSA-N Bis(methylthio)methane Chemical compound CSCSC LOCDPORVFVOGCR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001411 amidrazones Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- BIMDWYPWZNTWLE-UHFFFAOYSA-N chembl3304057 Chemical compound C1=NC2=CC=CC=C2C(O)=C1C1=NN=NN1 BIMDWYPWZNTWLE-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 208000028831 congenital heart disease Diseases 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- KLKFAASOGCDTDT-UHFFFAOYSA-N ethoxymethoxyethane Chemical compound CCOCOCC KLKFAASOGCDTDT-UHFFFAOYSA-N 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- SZQUEWJRBJDHSM-UHFFFAOYSA-N iron(3+);trinitrate;nonahydrate Chemical compound O.O.O.O.O.O.O.O.O.[Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O SZQUEWJRBJDHSM-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- MOVBJUGHBJJKOW-UHFFFAOYSA-N methyl 2-amino-5-methoxybenzoate Chemical compound COC(=O)C1=CC(OC)=CC=C1N MOVBJUGHBJJKOW-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- VGIVLIHKENZQHQ-UHFFFAOYSA-N n,n,n',n'-tetramethylmethanediamine Chemical compound CN(C)CN(C)C VGIVLIHKENZQHQ-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229960004570 oxprenolol Drugs 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000012306 spectroscopic technique Methods 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 229960004605 timolol Drugs 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/24—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in positions 2 and 4
- C07D265/26—Two oxygen atoms, e.g. isatoic anhydride
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838322470A GB8322470D0 (en) | 1983-08-20 | 1983-08-20 | Therapeutic agents |
| GB848413535A GB8413535D0 (en) | 1984-05-25 | 1984-05-25 | Therapeutic agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO843292L true NO843292L (no) | 1985-02-21 |
Family
ID=26286783
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO843292A NO843292L (no) | 1983-08-20 | 1984-08-17 | Fremgangsmaate for fremstilling av nye kinolon-derivater |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4659718A (cs) |
| EP (1) | EP0135367B1 (cs) |
| AU (1) | AU572177B2 (cs) |
| CA (1) | CA1244420A (cs) |
| CS (1) | CS248720B2 (cs) |
| DD (1) | DD223451A5 (cs) |
| DE (1) | DE3469898D1 (cs) |
| DK (1) | DK395084A (cs) |
| ES (3) | ES8701167A1 (cs) |
| FI (1) | FI843266A7 (cs) |
| GB (1) | GB2147581B (cs) |
| GR (1) | GR80122B (cs) |
| HU (1) | HUT35665A (cs) |
| JO (1) | JO1330B1 (cs) |
| NO (1) | NO843292L (cs) |
| NZ (1) | NZ209193A (cs) |
| PT (1) | PT79031B (cs) |
| RO (1) | RO89124A (cs) |
| ZW (1) | ZW13484A1 (cs) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ212209A (en) * | 1984-05-29 | 1988-08-30 | Pfizer | Quinolone derivatives and pharmaceutical compositions |
| EP0172004B1 (en) * | 1984-08-15 | 1990-03-21 | The Boots Company PLC | Quinolinones, process for their preparation and pharmaceutical compositions containing them |
| GB8515209D0 (en) * | 1985-06-15 | 1985-07-17 | Boots Co Plc | Therapeutic agents |
| GB8529362D0 (en) * | 1985-11-28 | 1986-01-02 | Pfizer Ltd | Quinolone cardiac stimulants |
| GB8627698D0 (en) * | 1986-11-20 | 1986-12-17 | Boots Co Plc | Therapeutic agents |
| GB8804016D0 (en) * | 1988-02-22 | 1988-03-23 | Boots Co Plc | Therapeutic agents |
| GB9026389D0 (en) * | 1990-12-05 | 1991-01-23 | Merck Sharp & Dohme | Therapeutic agents |
| WO2013104705A1 (de) | 2012-01-11 | 2013-07-18 | Bayer Intellectual Property Gmbh | Tetrazol-5-yl- und triazol-5-yl-arylverbindungen und ihre verwendung als herbizide |
| WO2015052173A1 (en) | 2013-10-10 | 2015-04-16 | Basf Se | Tetrazole and triazole compounds and their use as herbicides |
| WO2015052178A1 (en) | 2013-10-10 | 2015-04-16 | Basf Se | 1,2,5-oxadiazole compounds and their use as herbicides |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50106975A (cs) * | 1974-02-01 | 1975-08-22 | ||
| US4035368A (en) * | 1975-04-02 | 1977-07-12 | Riker Laboratories, Inc. | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds |
| US4474787A (en) * | 1977-05-04 | 1984-10-02 | Fisons Limited | 7,6 Dioxo-4H,6H-pyrano[3,2-g]quinoline dicarboxylic acids and anti-allergic use thereof |
| US4259437A (en) * | 1978-09-18 | 1981-03-31 | Ciba-Geigy Ag | Development inhibitor releasing compounds and their use in photographic materials |
| NZ193167A (en) * | 1979-03-27 | 1984-08-24 | Boots Co Plc | Quinoline derivatives and pharmaceutical compositions |
| IE51542B1 (en) * | 1980-09-26 | 1987-01-07 | Boots Co Ltd | Therapeutic agents |
| EP0104018A3 (en) * | 1982-09-21 | 1985-06-26 | FISONS plc | Benzopyran, benzothiapyran and quinoline compounds and pharmaceutical compositions containing them |
| US4735948A (en) * | 1983-03-25 | 1988-04-05 | Merrell Dow Pharmaceuticals Inc. | (1H-tetrazol-5-yl)-2(1H)-quinolinones and-naphthyridones and antiallergic use thereof |
-
1984
- 1984-08-06 PT PT79031A patent/PT79031B/pt unknown
- 1984-08-07 AU AU31667/84A patent/AU572177B2/en not_active Ceased
- 1984-08-13 JO JO19841330A patent/JO1330B1/en active
- 1984-08-13 NZ NZ209193A patent/NZ209193A/en unknown
- 1984-08-15 EP EP84305548A patent/EP0135367B1/en not_active Expired
- 1984-08-15 GB GB08420686A patent/GB2147581B/en not_active Expired
- 1984-08-15 DE DE8484305548T patent/DE3469898D1/de not_active Expired
- 1984-08-16 DD DD84266334A patent/DD223451A5/de unknown
- 1984-08-16 CS CS846210A patent/CS248720B2/cs unknown
- 1984-08-16 RO RO84115508A patent/RO89124A/ro unknown
- 1984-08-16 GR GR80122A patent/GR80122B/el unknown
- 1984-08-17 NO NO843292A patent/NO843292L/no unknown
- 1984-08-17 ES ES535273A patent/ES8701167A1/es not_active Expired
- 1984-08-17 DK DK395084A patent/DK395084A/da unknown
- 1984-08-17 HU HU843128A patent/HUT35665A/hu unknown
- 1984-08-17 CA CA000461302A patent/CA1244420A/en not_active Expired
- 1984-08-17 FI FI843266A patent/FI843266A7/fi not_active Application Discontinuation
- 1984-08-21 ZW ZW134/84A patent/ZW13484A1/xx unknown
-
1985
- 1985-06-26 US US06/749,015 patent/US4659718A/en not_active Expired - Fee Related
- 1985-08-01 ES ES545834A patent/ES8607279A1/es not_active Expired
- 1985-08-01 ES ES545835A patent/ES8607280A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES8607279A1 (es) | 1986-05-16 |
| CA1244420A (en) | 1988-11-08 |
| NZ209193A (en) | 1987-04-30 |
| ES545835A0 (es) | 1986-05-16 |
| GB2147581A (en) | 1985-05-15 |
| EP0135367B1 (en) | 1988-03-16 |
| RO89124A (ro) | 1986-04-30 |
| EP0135367A1 (en) | 1985-03-27 |
| FI843266A7 (fi) | 1985-02-21 |
| GB8420686D0 (en) | 1984-09-19 |
| GR80122B (en) | 1984-12-13 |
| GB2147581B (en) | 1987-04-01 |
| HUT35665A (en) | 1985-07-29 |
| AU572177B2 (en) | 1988-05-05 |
| ES535273A0 (es) | 1986-11-16 |
| DD223451A5 (de) | 1985-06-12 |
| JO1330B1 (en) | 1986-11-30 |
| DE3469898D1 (en) | 1988-04-21 |
| PT79031B (en) | 1986-08-22 |
| ES545834A0 (es) | 1986-05-16 |
| ZW13484A1 (en) | 1985-03-13 |
| PT79031A (en) | 1984-09-01 |
| ES8701167A1 (es) | 1986-11-16 |
| DK395084D0 (da) | 1984-08-17 |
| FI843266A0 (fi) | 1984-08-17 |
| CS248720B2 (en) | 1987-02-12 |
| ES8607280A1 (es) | 1986-05-16 |
| AU3166784A (en) | 1985-02-21 |
| US4659718A (en) | 1987-04-21 |
| DK395084A (da) | 1985-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU598299B2 (en) | 4-aminoquinoline derivatives | |
| KR940000828B1 (ko) | 항혈전성 강심제 이미다조 퀴놀린의 제조방법 | |
| EP0516392B1 (en) | Naphthyridine derivatives as angiotensin II inhibitors | |
| EP0235762A1 (en) | 8-Position substituted quinolone-carboxylic acid derivatives and process for their preparation | |
| WO1993012095A1 (en) | Quinazolinone antianginal agents | |
| WO2012143413A1 (en) | Tetrahydroquinoline derivatives useful as bromodomain inhibitors | |
| FI77026C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 3-(alkyltio, alkylsulfinyl eller alkylsulfonyl)-4-kinoloner. | |
| EP0597003A1 (en) | Quinoline derivatives as immunostimulants | |
| HUT55364A (en) | Process for producing quinoline derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| JPH0146514B2 (cs) | ||
| EP0135367B1 (en) | Therapeutic agents | |
| EP0172004B1 (en) | Quinolinones, process for their preparation and pharmaceutical compositions containing them | |
| KR900003650B1 (ko) | (1h-테트라졸-5-일)-2(1h)-퀴놀리논, 나프티리디논 및 그의 제조방법 | |
| NZ562541A (en) | Dihydropyridine derivatives | |
| IE51542B1 (en) | Therapeutic agents | |
| US4419357A (en) | 3-(1H-Tetrazol-5-yl)-4(3H)-quinazolinones | |
| NZ206224A (en) | 2-piperazinyl(or homopyperazinyl)-quinazoline derivatives and pharmaceutical compositions | |
| KR900003649B1 (ko) | (1H-테트라졸-5-일)테트라졸로[1,5-a]-퀴놀린의 제조방법 | |
| EP0015065B1 (en) | Pyrazolo (5,1-b) quinazolin-9(4h)-one derivatives, process for their preparation and pharmaceutical compositions containing them | |
| Wright et al. | (2-Carboxy-1, 4-dihydro-4-oxoquinolyl) oxamic acids and (2-carboxy-1, 4-dihydro-4-oxobenzo [h] quinolyl) oxamic acids as antiallergy agents | |
| Gould et al. | Predictive structure-activity relationships in a series of pyranoquinoline derivatives. A new primate model for the identification of antiallergic activity | |
| GB2085441A (en) | Therapeutic agents | |
| US4761474A (en) | 3-(1H-tetrazol-5-yl)thieno[2,3-d]pyrimidin-4(3H)-ones | |
| JP2002201172A (ja) | ベンズアミド誘導体及びその用途 | |
| KR860000650B1 (ko) | 퀴놀론 화합물의 제조방법 |