NO831651L - Aluminiumelektrolysecelle. - Google Patents
Aluminiumelektrolysecelle.Info
- Publication number
- NO831651L NO831651L NO831651A NO831651A NO831651L NO 831651 L NO831651 L NO 831651L NO 831651 A NO831651 A NO 831651A NO 831651 A NO831651 A NO 831651A NO 831651 L NO831651 L NO 831651L
- Authority
- NO
- Norway
- Prior art keywords
- aluminum
- molten
- cell
- coating
- component
- Prior art date
Links
- 229910052782 aluminium Inorganic materials 0.000 title claims abstract description 187
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 title claims abstract description 185
- 238000005868 electrolysis reaction Methods 0.000 title claims description 25
- 210000004027 cell Anatomy 0.000 claims abstract description 108
- 239000000463 material Substances 0.000 claims abstract description 72
- 239000010936 titanium Substances 0.000 claims abstract description 45
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 41
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 37
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims abstract description 31
- 229910052796 boron Inorganic materials 0.000 claims abstract description 29
- 238000000034 method Methods 0.000 claims abstract description 23
- 210000003850 cellular structure Anatomy 0.000 claims abstract description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 48
- 238000000576 coating method Methods 0.000 claims description 46
- 229910001610 cryolite Inorganic materials 0.000 claims description 46
- 239000011248 coating agent Substances 0.000 claims description 42
- 239000000758 substrate Substances 0.000 claims description 39
- 239000004411 aluminium Substances 0.000 claims description 32
- 239000000080 wetting agent Substances 0.000 claims description 18
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 238000009736 wetting Methods 0.000 claims description 9
- 238000011065 in-situ storage Methods 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 229910052582 BN Inorganic materials 0.000 claims description 4
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052581 Si3N4 Inorganic materials 0.000 claims description 3
- 229910003564 SiAlON Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 150000004645 aluminates Chemical class 0.000 claims description 3
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 claims description 3
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 claims description 3
- 229910017109 AlON Inorganic materials 0.000 claims 2
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 claims 2
- 229910010271 silicon carbide Inorganic materials 0.000 claims 2
- 238000005363 electrowinning Methods 0.000 abstract 1
- 238000009877 rendering Methods 0.000 abstract 1
- QYEXBYZXHDUPRC-UHFFFAOYSA-N B#[Ti]#B Chemical compound B#[Ti]#B QYEXBYZXHDUPRC-UHFFFAOYSA-N 0.000 description 29
- 229910033181 TiB2 Inorganic materials 0.000 description 26
- 238000012856 packing Methods 0.000 description 26
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 239000011148 porous material Substances 0.000 description 10
- 229910052799 carbon Inorganic materials 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000011819 refractory material Substances 0.000 description 6
- 238000000605 extraction Methods 0.000 description 5
- 229910002804 graphite Inorganic materials 0.000 description 5
- 239000010439 graphite Substances 0.000 description 5
- 230000009471 action Effects 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- -1 refractory TiB2 Chemical compound 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- 238000007654 immersion Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 229910000048 titanium hydride Inorganic materials 0.000 description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CAVCGVPGBKGDTG-UHFFFAOYSA-N alumanylidynemethyl(alumanylidynemethylalumanylidenemethylidene)alumane Chemical compound [Al]#C[Al]=C=[Al]C#[Al] CAVCGVPGBKGDTG-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000004566 building material Substances 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 235000011148 calcium chloride Nutrition 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000011530 conductive current collector Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000011833 salt mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 150000003608 titanium Chemical class 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DJOYTAUERRJRAT-UHFFFAOYSA-N 2-(n-methyl-4-nitroanilino)acetonitrile Chemical compound N#CCN(C)C1=CC=C([N+]([O-])=O)C=C1 DJOYTAUERRJRAT-UHFFFAOYSA-N 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminium flouride Chemical compound F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- 101100004392 Arabidopsis thaliana BHLH147 gene Proteins 0.000 description 1
- 229910004261 CaF 2 Inorganic materials 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 239000010405 anode material Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 229910021523 barium zirconate Inorganic materials 0.000 description 1
- DQBAOWPVHRWLJC-UHFFFAOYSA-N barium(2+);dioxido(oxo)zirconium Chemical compound [Ba+2].[O-][Zr]([O-])=O DQBAOWPVHRWLJC-UHFFFAOYSA-N 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 239000010406 cathode material Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- DXNVUKXMTZHOTP-UHFFFAOYSA-N dialuminum;dimagnesium;barium(2+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Mg+2].[Mg+2].[Al+3].[Al+3].[Ba+2].[Ba+2] DXNVUKXMTZHOTP-UHFFFAOYSA-N 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000005672 electromagnetic field Effects 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000028161 membrane depolarization Effects 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25C—PROCESSES FOR THE ELECTROLYTIC PRODUCTION, RECOVERY OR REFINING OF METALS; APPARATUS THEREFOR
- C25C3/00—Electrolytic production, recovery or refining of metals by electrolysis of melts
- C25C3/06—Electrolytic production, recovery or refining of metals by electrolysis of melts of aluminium
- C25C3/16—Electric current supply devices, e.g. bus bars
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25C—PROCESSES FOR THE ELECTROLYTIC PRODUCTION, RECOVERY OR REFINING OF METALS; APPARATUS THEREFOR
- C25C3/00—Electrolytic production, recovery or refining of metals by electrolysis of melts
- C25C3/06—Electrolytic production, recovery or refining of metals by electrolysis of melts of aluminium
- C25C3/08—Cell construction, e.g. bottoms, walls, cathodes
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37662982A | 1982-05-10 | 1982-05-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO831651L true NO831651L (no) | 1983-11-11 |
Family
ID=23485808
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO831651A NO831651L (no) | 1982-05-10 | 1983-05-10 | Aluminiumelektrolysecelle. |
Country Status (7)
| Country | Link |
|---|---|
| EP (1) | EP0094353B1 (de) |
| JP (1) | JPS58207385A (de) |
| AT (1) | ATE32107T1 (de) |
| AU (1) | AU572092B2 (de) |
| CA (1) | CA1233781A (de) |
| DE (1) | DE3375409D1 (de) |
| NO (1) | NO831651L (de) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3472973D1 (en) * | 1983-08-16 | 1988-09-01 | Alcan Int Ltd | Method of filtering molten metal |
| AU4095185A (en) * | 1984-04-27 | 1985-10-31 | Aluminium Company Of America | Refractory hard metal interwoven matrix cathode for electrolytic production of aluminum |
| WO1988001313A1 (en) * | 1986-08-21 | 1988-02-25 | Eltech Systems Corporation | Molten salt electrowinning electrode, method and cell |
| US4828008A (en) * | 1987-05-13 | 1989-05-09 | Lanxide Technology Company, Lp | Metal matrix composites |
| US5141819A (en) * | 1988-01-07 | 1992-08-25 | Lanxide Technology Company, Lp | Metal matrix composite with a barrier |
| US4935055A (en) * | 1988-01-07 | 1990-06-19 | Lanxide Technology Company, Lp | Method of making metal matrix composite with the use of a barrier |
| US5277989A (en) * | 1988-01-07 | 1994-01-11 | Lanxide Technology Company, Lp | Metal matrix composite which utilizes a barrier |
| US5165463A (en) * | 1988-11-10 | 1992-11-24 | Lanxide Technology Company, Lp | Directional solidification of metal matrix composites |
| US5016703A (en) * | 1988-11-10 | 1991-05-21 | Lanxide Technology Company, Lp | Method of forming a metal matrix composite body by a spontaneous infiltration technique |
| US5518061A (en) * | 1988-11-10 | 1996-05-21 | Lanxide Technology Company, Lp | Method of modifying the properties of a metal matrix composite body |
| US5301738A (en) * | 1988-11-10 | 1994-04-12 | Lanxide Technology Company, Lp | Method of modifying the properties of a metal matrix composite body |
| US5240062A (en) * | 1988-11-10 | 1993-08-31 | Lanxide Technology Company, Lp | Method of providing a gating means, and products thereby |
| US5267601A (en) * | 1988-11-10 | 1993-12-07 | Lanxide Technology Company, Lp | Method for forming a metal matrix composite body by an outside-in spontaneous infiltration process, and products produced thereby |
| US5163499A (en) * | 1988-11-10 | 1992-11-17 | Lanxide Technology Company, Lp | Method of forming electronic packages |
| US5287911A (en) * | 1988-11-10 | 1994-02-22 | Lanxide Technology Company, Lp | Method for forming metal matrix composites having variable filler loadings and products produced thereby |
| US5040588A (en) * | 1988-11-10 | 1991-08-20 | Lanxide Technology Company, Lp | Methods for forming macrocomposite bodies and macrocomposite bodies produced thereby |
| US5526867A (en) * | 1988-11-10 | 1996-06-18 | Lanxide Technology Company, Lp | Methods of forming electronic packages |
| US5303763A (en) * | 1988-11-10 | 1994-04-19 | Lanxide Technology Company, Lp | Directional solidification of metal matrix composites |
| US5119864A (en) * | 1988-11-10 | 1992-06-09 | Lanxide Technology Company, Lp | Method of forming a metal matrix composite through the use of a gating means |
| US5172747A (en) * | 1988-11-10 | 1992-12-22 | Lanxide Technology Company, Lp | Method of forming a metal matrix composite body by a spontaneous infiltration technique |
| US5224533A (en) * | 1989-07-18 | 1993-07-06 | Lanxide Technology Company, Lp | Method of forming metal matrix composite bodies by a self-generated vaccum process, and products produced therefrom |
| US5188164A (en) * | 1989-07-21 | 1993-02-23 | Lanxide Technology Company, Lp | Method of forming macrocomposite bodies by self-generated vacuum techniques using a glassy seal |
| US5247986A (en) * | 1989-07-21 | 1993-09-28 | Lanxide Technology Company, Lp | Method of forming macrocomposite bodies by self-generated vacuum techniques, and products produced therefrom |
| US5487420A (en) * | 1990-05-09 | 1996-01-30 | Lanxide Technology Company, Lp | Method for forming metal matrix composite bodies by using a modified spontaneous infiltration process and products produced thereby |
| US5505248A (en) * | 1990-05-09 | 1996-04-09 | Lanxide Technology Company, Lp | Barrier materials for making metal matrix composites |
| DE69123143T2 (de) * | 1990-05-09 | 1997-04-03 | Lanxide Technology Co Ltd | Dünne mmc's und deren herstellung |
| US5329984A (en) * | 1990-05-09 | 1994-07-19 | Lanxide Technology Company, Lp | Method of forming a filler material for use in various metal matrix composite body formation processes |
| WO1991017129A1 (en) * | 1990-05-09 | 1991-11-14 | Lanxide Technology Company, Lp | Macrocomposite bodies and production methods |
| JPH05507319A (ja) * | 1990-05-09 | 1993-10-21 | ランキサイド テクノロジー カンパニー，リミティド パートナーシップ | 金属マトリックス複合物用硬化フィラー材料 |
| AU8084191A (en) * | 1990-05-09 | 1991-11-27 | Lanxide Technology Company, Lp | Barrier materials for making metal matrix composites |
| US5851686A (en) * | 1990-05-09 | 1998-12-22 | Lanxide Technology Company, L.P. | Gating mean for metal matrix composite manufacture |
| US5361824A (en) * | 1990-05-10 | 1994-11-08 | Lanxide Technology Company, Lp | Method for making internal shapes in a metal matrix composite body |
| US5652723A (en) * | 1991-04-18 | 1997-07-29 | Mitsubishi Denki Kabushiki Kaisha | Semiconductor memory device |
| EP0675974B1 (de) * | 1992-12-17 | 1999-07-21 | Comalco Aluminium, Ltd. | Elektrolysezelle für die herstellung von metallen |
| US5848349A (en) * | 1993-06-25 | 1998-12-08 | Lanxide Technology Company, Lp | Method of modifying the properties of a metal matrix composite body |
| US5560809A (en) * | 1995-05-26 | 1996-10-01 | Saint-Gobain/Norton Industrial Ceramics Corporation | Improved lining for aluminum production furnace |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ194195A (en) * | 1979-07-02 | 1982-03-30 | United States Borax Chem | Alumina reduction cell with floor coated with titanium diboride |
| CH643600A5 (de) * | 1979-12-05 | 1984-06-15 | Alusuisse | Elektrolysezelle zur herstellung von aluminium. |
| GB2069530B (en) * | 1980-01-28 | 1984-05-16 | Diamond Shamrock Corp | Packed cathode bed for electrowinning metals from fused salts |
| US4349427A (en) * | 1980-06-23 | 1982-09-14 | Kaiser Aluminum & Chemical Corporation | Aluminum reduction cell electrode |
| US4308115A (en) * | 1980-08-15 | 1981-12-29 | Aluminum Company Of America | Method of producing aluminum using graphite cathode coated with refractory hard metal |
| ZA824255B (en) * | 1981-06-25 | 1983-05-25 | Alcan Int Ltd | Electrolytic reduction cells |
| CH648870A5 (de) * | 1981-10-23 | 1985-04-15 | Alusuisse | Kathode fuer eine schmelzflusselektrolysezelle zur herstellung von aluminium. |
-
1983
- 1983-05-09 DE DE8383810197T patent/DE3375409D1/de not_active Expired
- 1983-05-09 AT AT83810197T patent/ATE32107T1/de not_active IP Right Cessation
- 1983-05-09 EP EP83810197A patent/EP0094353B1/de not_active Expired
- 1983-05-10 JP JP58081616A patent/JPS58207385A/ja active Pending
- 1983-05-10 NO NO831651A patent/NO831651L/no unknown
- 1983-05-10 CA CA000427851A patent/CA1233781A/en not_active Expired
- 1983-05-10 AU AU14390/83A patent/AU572092B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| EP0094353A3 (en) | 1984-03-07 |
| AU1439083A (en) | 1983-11-17 |
| ATE32107T1 (de) | 1988-02-15 |
| JPS58207385A (ja) | 1983-12-02 |
| EP0094353A2 (de) | 1983-11-16 |
| EP0094353B1 (de) | 1988-01-20 |
| AU572092B2 (en) | 1988-05-05 |
| CA1233781A (en) | 1988-03-08 |
| DE3375409D1 (en) | 1988-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO831651L (no) | Aluminiumelektrolysecelle. | |
| US4560448A (en) | Aluminum wettable materials for aluminum production | |
| NO843422L (no) | Komponenter for aluminiumproduksjonsceller | |
| CA2003660C (en) | Supersaturation plating of aluminum wettable cathode coatings during aluminum smelting in drained cathode cells | |
| RU2005115103A (ru) | Электролизеры для получения алюминия электролизом с анодами на основе металлов | |
| CA2393429A1 (en) | Aluminium electrowinning with metal-based anodes | |
| RU2281987C2 (ru) | Пористый керамический материал, смачиваемый алюминием | |
| US3880729A (en) | Process for electrodepositing titanium diboride from fused salts | |
| US5534119A (en) | Method of reducing erosion of carbon-containing components of aluminum production cells | |
| Bikul'Chus | Chloride removal from reinforced concrete and relevant loss of strength | |
| AU682855B2 (en) | Conditioning of cell components for aluminium production | |
| EP0843745B1 (de) | Erhaltung von schutzflächen auf kohlenstoff-kathoden in aluminium - elektrolyseofen | |
| EP1366216B1 (de) | Zelle zur elektrogewinnung von aluminium operierend mit auf metall basierenden anoden | |
| Vasshaug et al. | Formation and dissolution of aluminium carbide in cathode blocks | |
| AU2002236145B2 (en) | Cell for the electrowinning of aluminium operating with metal-based anodes | |
| JPS5913087A (ja) | 濡性のないアルミニウム電解槽充填物 | |
| WO2004074549A2 (en) | Aluminium electrowinning cells with metal-based anodes | |
| AU2002236145A1 (en) | Cell for the electrowinning of aluminium operating with metal-based anodes | |
| US20060151334A1 (en) | Method of conditioning iron alloy-based anodes for aluminium electrowinning | |
| AU2002236143A1 (en) | Aluminium-wettable porous ceramic material |