NO802507L - 6-pyridazinoner med kardiotonisk virkning. - Google Patents
6-pyridazinoner med kardiotonisk virkning.Info
- Publication number
- NO802507L NO802507L NO802507A NO802507A NO802507L NO 802507 L NO802507 L NO 802507L NO 802507 A NO802507 A NO 802507A NO 802507 A NO802507 A NO 802507A NO 802507 L NO802507 L NO 802507L
- Authority
- NO
- Norway
- Prior art keywords
- pyridinyl
- pyridazinone
- dihydro
- methyl
- acid
- Prior art date
Links
- 230000003177 cardiotonic effect Effects 0.000 title description 9
- 150000003839 salts Chemical class 0.000 claims description 42
- 239000002253 acid Substances 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 24
- -1 4-pyridinyl Chemical group 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 17
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical class OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 34
- 239000000203 mixture Substances 0.000 description 25
- 239000000243 solution Substances 0.000 description 19
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 10
- FBOQGQULUAPQCC-UHFFFAOYSA-N 3-pyridin-4-yl-4,5-dihydro-1h-pyridazin-6-one Chemical compound N1C(=O)CCC(C=2C=CN=CC=2)=N1 FBOQGQULUAPQCC-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- UTISRGMYIPHHBR-UHFFFAOYSA-N 4-oxo-4-pyridin-4-ylbutanenitrile Chemical compound N#CCCC(=O)C1=CC=NC=C1 UTISRGMYIPHHBR-UHFFFAOYSA-N 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- IRWZLWUYVNDDIX-UHFFFAOYSA-N 2-methyl-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C)N=C1C1=CC=NC=C1 IRWZLWUYVNDDIX-UHFFFAOYSA-N 0.000 description 6
- LPRDIYKZZIDTPV-UHFFFAOYSA-N 3-pyridin-4-yl-1h-pyridazin-6-one Chemical compound N1C(=O)C=CC(C=2C=CN=CC=2)=N1 LPRDIYKZZIDTPV-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- YWJGORHFDXGFTF-UHFFFAOYSA-N 2-methyl-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(C)N=C1C1=CC=NC=C1 YWJGORHFDXGFTF-UHFFFAOYSA-N 0.000 description 5
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 206010047139 Vasoconstriction Diseases 0.000 description 5
- 239000004310 lactic acid Substances 0.000 description 5
- 235000014655 lactic acid Nutrition 0.000 description 5
- 229940098779 methanesulfonic acid Drugs 0.000 description 5
- 230000025033 vasoconstriction Effects 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000000496 cardiotonic agent Substances 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000006356 dehydrogenation reaction Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012493 hydrazine sulfate Substances 0.000 description 3
- 229910000377 hydrazine sulfate Inorganic materials 0.000 description 3
- 210000003540 papillary muscle Anatomy 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- INOKSURCXXQEIB-UHFFFAOYSA-N 3-pyridin-3-yl-4,5-dihydro-1h-pyridazin-6-one Chemical compound N1C(=O)CCC(C=2C=NC=CC=2)=N1 INOKSURCXXQEIB-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- LIAWOTKNAVAKCX-UHFFFAOYSA-N hydrazine;dihydrochloride Chemical compound Cl.Cl.NN LIAWOTKNAVAKCX-UHFFFAOYSA-N 0.000 description 2
- ONUGLWXPCMEGCK-UHFFFAOYSA-N hydrazine;methanesulfonic acid Chemical compound NN.CS(O)(=O)=O.CS(O)(=O)=O ONUGLWXPCMEGCK-UHFFFAOYSA-N 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- HTAWQGONZIWLRC-UHFFFAOYSA-N methylhydrazine;dihydrochloride Chemical compound Cl.Cl.CNN HTAWQGONZIWLRC-UHFFFAOYSA-N 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000035485 pulse pressure Effects 0.000 description 2
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- KOOCPRQXWCJHNW-UHFFFAOYSA-N 2-(2-hydroxyethyl)-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CCO)N=C1C1=CC=NC=C1 KOOCPRQXWCJHNW-UHFFFAOYSA-N 0.000 description 1
- MIFCHHIMUJKAEI-UHFFFAOYSA-N 2-(2-hydroxyethyl)-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CCO)N=C1C1=CC=NC=C1 MIFCHHIMUJKAEI-UHFFFAOYSA-N 0.000 description 1
- WYWBURABCIWPBH-UHFFFAOYSA-N 2-(2-hydroxypropyl)-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CC(O)C)N=C1C1=CC=NC=C1 WYWBURABCIWPBH-UHFFFAOYSA-N 0.000 description 1
- MSJLJOBINJMLPA-UHFFFAOYSA-N 2-(2-hydroxypropyl)-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CC(O)C)N=C1C1=CC=NC=C1 MSJLJOBINJMLPA-UHFFFAOYSA-N 0.000 description 1
- WSTBGHOXXJYEHT-UHFFFAOYSA-N 2-(2-methylpropyl)-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CC(C)C)N=C1C1=CC=NC=C1 WSTBGHOXXJYEHT-UHFFFAOYSA-N 0.000 description 1
- MZOBUXRIAFXDEP-UHFFFAOYSA-N 2-(2-methylpropyl)-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CC(C)C)N=C1C1=CC=NC=C1 MZOBUXRIAFXDEP-UHFFFAOYSA-N 0.000 description 1
- BHCBOPYPAJDMJL-UHFFFAOYSA-N 2-(3-hydroxypropyl)-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CCCO)N=C1C1=CC=NC=C1 BHCBOPYPAJDMJL-UHFFFAOYSA-N 0.000 description 1
- JQGSUFYBABFXPW-UHFFFAOYSA-N 2-(4-hydroxybutyl)-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CCCCO)N=C1C1=CC=NC=C1 JQGSUFYBABFXPW-UHFFFAOYSA-N 0.000 description 1
- PZBHMJQTZBQVNM-UHFFFAOYSA-N 2-(4-hydroxybutyl)-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CCCCO)N=C1C1=CC=NC=C1 PZBHMJQTZBQVNM-UHFFFAOYSA-N 0.000 description 1
- GPJBUMMGZAVHLE-UHFFFAOYSA-N 2-ethyl-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CC)N=C1C1=CC=NC=C1 GPJBUMMGZAVHLE-UHFFFAOYSA-N 0.000 description 1
- XQVQIBFPZHYXTC-UHFFFAOYSA-N 2-ethyl-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CC)N=C1C1=CC=NC=C1 XQVQIBFPZHYXTC-UHFFFAOYSA-N 0.000 description 1
- RDBIYYHHRLWXJB-UHFFFAOYSA-N 2-hexyl-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CCCCCC)N=C1C1=CC=NC=C1 RDBIYYHHRLWXJB-UHFFFAOYSA-N 0.000 description 1
- YKLFPKNCJCUCSG-UHFFFAOYSA-N 2-hexyl-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CCCCCC)N=C1C1=CC=NC=C1 YKLFPKNCJCUCSG-UHFFFAOYSA-N 0.000 description 1
- QLKSIWZFDNEDIU-UHFFFAOYSA-N 2-methyl-6-(2-methylpyridin-3-yl)-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C)N=C1C1=CC=CN=C1C QLKSIWZFDNEDIU-UHFFFAOYSA-N 0.000 description 1
- LFIKHFDBARUUPN-UHFFFAOYSA-N 2-methyl-6-(2-methylpyridin-3-yl)pyridazin-3-one Chemical compound CC1=NC=CC=C1C1=NN(C)C(=O)C=C1 LFIKHFDBARUUPN-UHFFFAOYSA-N 0.000 description 1
- RSAJRAAFBGTDKP-UHFFFAOYSA-N 2-methyl-6-(5-methylpyridin-3-yl)-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C)N=C1C1=CN=CC(C)=C1 RSAJRAAFBGTDKP-UHFFFAOYSA-N 0.000 description 1
- SHEYTAJXEIGSIO-UHFFFAOYSA-N 2-methyl-6-pyridin-3-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C)N=C1C1=CC=CN=C1 SHEYTAJXEIGSIO-UHFFFAOYSA-N 0.000 description 1
- XKNIUVQBSHGDJM-UHFFFAOYSA-N 2-methyl-6-pyridin-3-ylpyridazin-3-one Chemical compound C1=CC(=O)N(C)N=C1C1=CC=CN=C1 XKNIUVQBSHGDJM-UHFFFAOYSA-N 0.000 description 1
- APHMLGDTZFVBPX-UHFFFAOYSA-N 2-methyl-6-pyridin-4-yl-4,5-dihydropyridazin-3-one;hydrochloride Chemical compound Cl.C1CC(=O)N(C)N=C1C1=CC=NC=C1 APHMLGDTZFVBPX-UHFFFAOYSA-N 0.000 description 1
- UUVWBIZOMLVGJT-UHFFFAOYSA-N 2-propan-2-yl-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C(C)C)N=C1C1=CC=NC=C1 UUVWBIZOMLVGJT-UHFFFAOYSA-N 0.000 description 1
- PGSCRFOXTNJWEB-UHFFFAOYSA-N 2-propan-2-yl-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(C(C)C)N=C1C1=CC=NC=C1 PGSCRFOXTNJWEB-UHFFFAOYSA-N 0.000 description 1
- VPXIHRAAMJQAEA-UHFFFAOYSA-N 2-propyl-6-pyridin-4-yl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(CCC)N=C1C1=CC=NC=C1 VPXIHRAAMJQAEA-UHFFFAOYSA-N 0.000 description 1
- RPUYCTDFHXPWHJ-UHFFFAOYSA-N 2-propyl-6-pyridin-4-ylpyridazin-3-one Chemical compound C1=CC(=O)N(CCC)N=C1C1=CC=NC=C1 RPUYCTDFHXPWHJ-UHFFFAOYSA-N 0.000 description 1
- YUNWXAGTTHZGPB-UHFFFAOYSA-N 3-(2,6-dimethylpyridin-4-yl)-1h-pyridazin-6-one Chemical compound CC1=NC(C)=CC(C2=NNC(=O)C=C2)=C1 YUNWXAGTTHZGPB-UHFFFAOYSA-N 0.000 description 1
- KHWNRIVVRGAXSP-UHFFFAOYSA-N 3-(2,6-dimethylpyridin-4-yl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC1=NC(C)=CC(C=2CCC(O)=NN=2)=C1 KHWNRIVVRGAXSP-UHFFFAOYSA-N 0.000 description 1
- QSZSECGVFAOGHT-UHFFFAOYSA-N 3-(2-methylpyridin-3-yl)-1h-pyridazin-6-one Chemical compound CC1=NC=CC=C1C1=CC=C(O)N=N1 QSZSECGVFAOGHT-UHFFFAOYSA-N 0.000 description 1
- WQIZIWHVMZHADV-UHFFFAOYSA-N 3-(2-methylpyridin-3-yl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC1=NC=CC=C1C1=NNC(=O)CC1 WQIZIWHVMZHADV-UHFFFAOYSA-N 0.000 description 1
- AYJCYJJVFFRRAF-UHFFFAOYSA-N 3-(3-ethylpyridin-4-yl)-1h-pyridazin-6-one Chemical compound CCC1=CN=CC=C1C1=NNC(=O)C=C1 AYJCYJJVFFRRAF-UHFFFAOYSA-N 0.000 description 1
- NRAQCHGPXPVMFO-UHFFFAOYSA-N 3-(3-ethylpyridin-4-yl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound CCC1=CN=CC=C1C1=NN=C(O)CC1 NRAQCHGPXPVMFO-UHFFFAOYSA-N 0.000 description 1
- PWKDVSFTKHEPKK-UHFFFAOYSA-N 3-(5-methylpyridin-3-yl)-1h-pyridazin-6-one Chemical compound CC1=CN=CC(C2=NNC(=O)C=C2)=C1 PWKDVSFTKHEPKK-UHFFFAOYSA-N 0.000 description 1
- ABFCLWMKHINZCM-UHFFFAOYSA-N 3-(5-methylpyridin-3-yl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC1=CN=CC(C=2CCC(=O)NN=2)=C1 ABFCLWMKHINZCM-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- DDCLFSUBVBCSFN-UHFFFAOYSA-N 3-pyridin-2-yl-1h-pyridazin-6-one Chemical compound N1C(=O)C=CC(C=2N=CC=CC=2)=N1 DDCLFSUBVBCSFN-UHFFFAOYSA-N 0.000 description 1
- NUMUMQPXRJCWEC-UHFFFAOYSA-N 3-pyridin-4-yl-1h-pyridazin-6-one;hydrate Chemical compound O.N1C(=O)C=CC(C=2C=CN=CC=2)=N1 NUMUMQPXRJCWEC-UHFFFAOYSA-N 0.000 description 1
- UVEJMKKLGJZUPD-UHFFFAOYSA-N 4-(2,6-dimethylpyridin-4-yl)-4-oxobutanenitrile Chemical compound CC1=CC(C(=O)CCC#N)=CC(C)=N1 UVEJMKKLGJZUPD-UHFFFAOYSA-N 0.000 description 1
- AJCBVBSUGQKYPJ-UHFFFAOYSA-N 4-(2-methylpyridin-3-yl)-4-oxobutanenitrile Chemical compound CC1=NC=CC=C1C(=O)CCC#N AJCBVBSUGQKYPJ-UHFFFAOYSA-N 0.000 description 1
- HRNOJFSHSRNNLF-UHFFFAOYSA-N 4-(3-ethylpyridin-4-yl)-4-oxobutanenitrile Chemical compound CCC1=CN=CC=C1C(=O)CCC#N HRNOJFSHSRNNLF-UHFFFAOYSA-N 0.000 description 1
- IFMWGQWYIXZVEQ-UHFFFAOYSA-N 4-(5-methylpyridin-3-yl)-4-oxobutanenitrile Chemical compound CC1=CN=CC(C(=O)CCC#N)=C1 IFMWGQWYIXZVEQ-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- RKXWIKVGGKZDJY-UHFFFAOYSA-N 4-oxo-4-pyridin-3-ylbutanenitrile Chemical compound N#CCCC(=O)C1=CC=CN=C1 RKXWIKVGGKZDJY-UHFFFAOYSA-N 0.000 description 1
- QHBYZGQLPMSIFR-UHFFFAOYSA-N 4-oxo-4-pyridin-4-ylbutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=NC=C1 QHBYZGQLPMSIFR-UHFFFAOYSA-N 0.000 description 1
- AKBFPXJWJKEUJH-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-4-yl)-2-methyl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C)N=C1C1=CC(C)=NC(C)=C1 AKBFPXJWJKEUJH-UHFFFAOYSA-N 0.000 description 1
- NWQSPMLQEAXXTO-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-4-yl)-2-methylpyridazin-3-one Chemical compound CC1=NC(C)=CC(C2=NN(C)C(=O)C=C2)=C1 NWQSPMLQEAXXTO-UHFFFAOYSA-N 0.000 description 1
- CMSAIAYYZTWCIZ-UHFFFAOYSA-N 6-(3-ethylpyridin-4-yl)-2-methyl-4,5-dihydropyridazin-3-one Chemical compound CCC1=CN=CC=C1C1=NN(C)C(=O)CC1 CMSAIAYYZTWCIZ-UHFFFAOYSA-N 0.000 description 1
- YNVVGOQUHLIIRK-UHFFFAOYSA-N 6-(3-ethylpyridin-4-yl)-2-methylpyridazin-3-one Chemical compound CCC1=CN=CC=C1C1=NN(C)C(=O)C=C1 YNVVGOQUHLIIRK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 241000282324 Felis Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229960004676 antithrombotic agent Drugs 0.000 description 1
- 230000001746 atrial effect Effects 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000005242 cardiac chamber Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000000936 membranestabilizing effect Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- ZHNFLHYOFXQIOW-LPYZJUEESA-N quinine sulfate dihydrate Chemical compound [H+].[H+].O.O.[O-]S([O-])(=O)=O.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 ZHNFLHYOFXQIOW-LPYZJUEESA-N 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/57—Nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7106579A | 1979-08-30 | 1979-08-30 | |
| US06/144,576 US4304777A (en) | 1979-08-30 | 1980-04-28 | 6-(Pyridinyl)-3(2H)-pyridazinones and their use as cardiotonics |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO802507L true NO802507L (no) | 1981-03-02 |
Family
ID=26751794
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO802507A NO802507L (no) | 1979-08-30 | 1980-08-22 | 6-pyridazinoner med kardiotonisk virkning. |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4304777A (pt) |
| AR (1) | AR226704A1 (pt) |
| AT (1) | ATA427680A (pt) |
| AU (1) | AU532052B2 (pt) |
| CA (1) | CA1155848A (pt) |
| DE (1) | DE3032137A1 (pt) |
| DK (1) | DK364880A (pt) |
| ES (1) | ES8107215A1 (pt) |
| FI (1) | FI802676A (pt) |
| FR (1) | FR2464264A1 (pt) |
| GB (1) | GB2057438B (pt) |
| IL (1) | IL60918A (pt) |
| IT (1) | IT1141012B (pt) |
| LU (1) | LU82728A1 (pt) |
| NL (1) | NL8004815A (pt) |
| NO (1) | NO802507L (pt) |
| NZ (1) | NZ194811A (pt) |
| PT (1) | PT71736B (pt) |
| SE (1) | SE8005946L (pt) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL62679A0 (en) * | 1980-04-28 | 1981-06-29 | Sterling Drug Inc | 4,5-dihydro-3(2h)-pyridazinone derivatives,their preparation and pharmaceutical compositions containing them |
| US4486431A (en) * | 1981-01-14 | 1984-12-04 | Sterling Drug Inc. | Cardiotonic use of 4,5-dihydro-6-(4-pyridinyl)-3(2H)-pyridazinones |
| US4397854A (en) | 1981-05-14 | 1983-08-09 | Warner-Lambert Company | Substituted 6-phenyl-3(2H)-pyridazinones useful as cardiotonic agents |
| US4404203A (en) | 1981-05-14 | 1983-09-13 | Warner-Lambert Company | Substituted 6-phenyl-3(2H)-pyridazinones useful as cardiotonic agents |
| US4353905A (en) | 1981-09-17 | 1982-10-12 | Warner-Lambert Company | Substituted 4,5-dihydro-6-[4-(1H-imidazol-1-yl)phenyl]-3(2H)-pyridazinones and 6-[4-(1H-imidazol-1-yl)phenyl]-3(2H)-pyridazinones |
| IE54598B1 (en) * | 1981-11-12 | 1989-12-06 | Ici Plc | Pharmaceutically-active pyridylvinylpyridazinones |
| US4591591A (en) * | 1984-03-08 | 1986-05-27 | Eli Lilly And Company | Pyridazinone derivatives as inotropic agents |
| US4647564A (en) * | 1984-05-14 | 1987-03-03 | Eli Lilly And Company | Inotropic agents |
| US4631279A (en) * | 1984-10-15 | 1986-12-23 | Eli Lilly And Company | 6-(pyridinylphenyl)dihydropyridazinones as inotropic agents |
| US4617302A (en) * | 1984-10-15 | 1986-10-14 | Eli Lilly And Company | Inotropic agents |
| HU195645B (en) * | 1985-10-30 | 1988-06-28 | Gyogyszerkutato Intezet | Process for preparing novel 3(2h)-pyridazinone derivatives and pharmaceutical compositions comprising the same |
| DE3626865A1 (de) * | 1986-08-08 | 1988-02-11 | Boehringer Mannheim Gmbh | Neue pyridazinon-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| GB9015764D0 (en) * | 1990-07-18 | 1990-09-05 | Fujisawa Pharmaceutical Co | Pyrazolopyridine compound and processes for preparation thereof |
| CN1038249C (zh) * | 1991-08-28 | 1998-05-06 | 罗姆和哈斯公司 | 含有二氢哒嗪酮及其相关化合物的杀菌组合物 |
| EP3365335B1 (en) | 2015-10-23 | 2024-02-14 | Array Biopharma, Inc. | 2-aryl- and 2-heteroaryl-substituted 2-pyridazin-3(2h)-one compounds as inhibitors of fgfr tyrosine kinases |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3822260A (en) * | 1970-10-09 | 1974-07-02 | American Cyanamid Co | 6-(cyanophenyl)-4,5-dihydro-3(2h)-pyridazinones |
| US3746712A (en) * | 1971-06-08 | 1973-07-17 | A Ross | 6-(substituted-phenyl)-5-methyl-4,5-dihydro-3(2h)-pyridazinones |
| US3812256A (en) * | 1971-06-08 | 1974-05-21 | American Cyanamid Co | Novel method for lowering blood pressure in mammals |
| US4004009A (en) * | 1975-07-31 | 1977-01-18 | Sandoz, Inc. | Antihypertensive aryl pyrazolo[4,3-c]pyridazinones |
| US4004012A (en) * | 1975-10-14 | 1977-01-18 | Sterling Drug Inc. | 3-Cyano-5-(pyridinyl)-2(1H)-pyridinones |
| US4072746A (en) * | 1975-10-14 | 1978-02-07 | Sterling Drug Inc. | 3-Amino-5-(pyridinyl)-2(1H)-pyridinones |
-
1980
- 1980-04-28 US US06/144,576 patent/US4304777A/en not_active Expired - Lifetime
- 1980-08-20 IT IT24230/80A patent/IT1141012B/it active
- 1980-08-21 FR FR8018304A patent/FR2464264A1/fr active Pending
- 1980-08-21 GB GB8027262A patent/GB2057438B/en not_active Expired
- 1980-08-22 AT AT0427680A patent/ATA427680A/de not_active Application Discontinuation
- 1980-08-22 NO NO802507A patent/NO802507L/no unknown
- 1980-08-25 FI FI802676A patent/FI802676A/fi not_active Application Discontinuation
- 1980-08-25 SE SE8005946A patent/SE8005946L/xx not_active Application Discontinuation
- 1980-08-25 PT PT71736A patent/PT71736B/pt unknown
- 1980-08-26 LU LU82728A patent/LU82728A1/fr unknown
- 1980-08-26 DE DE19803032137 patent/DE3032137A1/de not_active Withdrawn
- 1980-08-26 IL IL60918A patent/IL60918A/xx unknown
- 1980-08-26 AR AR282296A patent/AR226704A1/es active
- 1980-08-26 DK DK364880A patent/DK364880A/da not_active Application Discontinuation
- 1980-08-26 NL NL8004815A patent/NL8004815A/nl not_active Application Discontinuation
- 1980-08-28 ES ES494559A patent/ES8107215A1/es not_active Expired
- 1980-08-29 NZ NZ194811A patent/NZ194811A/en unknown
- 1980-08-29 CA CA000359361A patent/CA1155848A/en not_active Expired
- 1980-09-01 AU AU61928/80A patent/AU532052B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| GB2057438B (en) | 1983-09-07 |
| ES494559A0 (es) | 1981-08-16 |
| DE3032137A1 (de) | 1981-03-19 |
| US4304777A (en) | 1981-12-08 |
| IT1141012B (it) | 1986-10-01 |
| PT71736A (en) | 1980-09-01 |
| SE8005946L (sv) | 1981-03-02 |
| FR2464264A1 (fr) | 1981-03-06 |
| FI802676A (fi) | 1981-03-01 |
| IL60918A0 (en) | 1980-10-26 |
| LU82728A1 (fr) | 1981-03-24 |
| IL60918A (en) | 1983-11-30 |
| CA1155848A (en) | 1983-10-25 |
| NZ194811A (en) | 1984-05-31 |
| AU532052B2 (en) | 1983-09-15 |
| NL8004815A (nl) | 1981-03-03 |
| ES8107215A1 (es) | 1981-08-16 |
| IT8024230A0 (it) | 1980-08-20 |
| GB2057438A (en) | 1981-04-01 |
| DK364880A (da) | 1981-03-01 |
| AU6192880A (en) | 1981-03-05 |
| ATA427680A (de) | 1983-12-15 |
| PT71736B (en) | 1981-06-15 |
| AR226704A1 (es) | 1982-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO802507L (no) | 6-pyridazinoner med kardiotonisk virkning. | |
| NO811041L (no) | Imidazopyridiner og fremgangsmaate til deres fremstilling | |
| US4465686A (en) | 5-(Hydroxy- and/or amino-phenyl)-6-(lower-alkyl)-2-(1H)-pyridinones, their cardiotonic use and preparation | |
| US4264603A (en) | 5-(Pyridinyl)-1H-pyrazolo[3,4-b]pyridine-3-amines, their use as cardiotonics and their preparation | |
| US4599423A (en) | Preparation of 5-(hydroxy- and/or aminophenyl-6-lower-alkyl)-2(1H)-pyridinones | |
| AU561765B2 (en) | Pyridinyl-2-pyrimidinamines useful as cardiotonics and preparation thereof | |
| US4304775A (en) | 3-Hydrazino-6-(pyridinyl) pyridazines and cardiotonic use thereof | |
| EP0150205A1 (en) | ad(pyridinyl)-2-pyrimidinyl bdureas useful as cardiotonics and preparation thereof | |
| CA1188303A (en) | 5-(pyridinyl)-1h-benzimidazoles and 1-hydroxy-6- (pyridinyl)-1h-benzimidazoles, their preparation and use as cardiotonics | |
| US4375467A (en) | 5-(Pyridinyl)-1H-pyrazolo[3,4-b] pyridines and their cardiotonic use | |
| US4391811A (en) | 2-Amino-6-(pyridinyl)-3H-imidazo[4,5-b]pyridines and their cardiotonic use | |
| US4337253A (en) | 4,5-Dihydro-2-methyl-6-(4-pyridinyl)-3(2H)-pyridazinone and its use as a cardiotonic | |
| US4590194A (en) | 3-[methyl or dimethyl)amino]-6-(pyridinyl)pyridazines and their cardiotonic use | |
| US4374141A (en) | 2-Substituted amino-5-(pyridinyl)-nicotinamides and their cardiotonic use | |
| US4346221A (en) | Preparation of 4-amino-6-(pyridinyl)-3(2H)-pyridazinones from 6-(pyridinyl)-3(2H)-pyridazinones | |
| US4354026A (en) | 3-Chloro-6-(pyridinyl)-pyridazines | |
| US4305943A (en) | 4-Amino-6-(pyridinyl)-3(2H)-pyridazinones and their use as cardiotonics | |
| US4304776A (en) | 4-Substituted-6-(pyridinyl)-3(2h)-pyridazinones and their use as intermediates and cardiotonics | |
| CA1166255A (en) | 4,5-dihydro-2-substituted-6-(pyridinyl)-3(2h)- pyridazinones, preparation and cardiotonic use thereof | |
| NO803911L (no) | 3-acylamino-5-(pyridinyl)-2(1h)-pyridinoner og fremgangsmaate til fremstilling derav | |
| US4362734A (en) | 2-(Substituted-amino)-5-(pyridinyl-nicotinonitriles, and their cardiotonic use | |
| US4338446A (en) | Di-(lower-alkyl)hydroxy-[2-oxo-2-(pyridinyl)ethyl]-propanedioates | |
| GB2089791A (en) | 1,2-dihydro-5-(pyridinyl) nicotinamide derivatives and their preparation | |
| US4362735A (en) | 3-[(3-Oxo-1-butenyl)amino]-5-(pyridinyl)-2(1H)-pyridinones and their cardiotonic use | |
| NO811421L (no) | 4,5-dihydro-6(pyridinyl)-3(2h)-pyridazinoner, egnet som kardiotoniske midler, og fremgangsmaate til deres fremstilling |