NO802170L - Homologasjonsfremgangsmaate for fremstilling av etanol fra metanol. - Google Patents
Homologasjonsfremgangsmaate for fremstilling av etanol fra metanol.Info
- Publication number
- NO802170L NO802170L NO802170A NO802170A NO802170L NO 802170 L NO802170 L NO 802170L NO 802170 A NO802170 A NO 802170A NO 802170 A NO802170 A NO 802170A NO 802170 L NO802170 L NO 802170L
- Authority
- NO
- Norway
- Prior art keywords
- cobalt
- catalyst
- phosphine
- ruthenium
- molar ratio
- Prior art date
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 title claims abstract description 61
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 title claims abstract description 57
- 238000000034 method Methods 0.000 title claims abstract description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims abstract description 98
- 239000003054 catalyst Substances 0.000 claims abstract description 71
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims abstract description 51
- 238000006243 chemical reaction Methods 0.000 claims abstract description 38
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 31
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 30
- 150000004820 halides Chemical class 0.000 claims abstract description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 30
- 239000001257 hydrogen Substances 0.000 claims abstract description 30
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 22
- 239000011630 iodine Substances 0.000 claims abstract description 21
- 230000000694 effects Effects 0.000 claims abstract description 18
- 230000008569 process Effects 0.000 claims abstract description 9
- 229910017052 cobalt Inorganic materials 0.000 claims description 40
- 239000010941 cobalt Substances 0.000 claims description 40
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 37
- 239000003446 ligand Substances 0.000 claims description 37
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 20
- 229910052707 ruthenium Inorganic materials 0.000 claims description 20
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 claims description 8
- NQZFAUXPNWSLBI-UHFFFAOYSA-N carbon monoxide;ruthenium Chemical group [Ru].[Ru].[Ru].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] NQZFAUXPNWSLBI-UHFFFAOYSA-N 0.000 claims description 7
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 claims description 7
- 150000003304 ruthenium compounds Chemical class 0.000 claims description 5
- ZBYYWKJVSFHYJL-UHFFFAOYSA-L cobalt(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Co+2].CC([O-])=O.CC([O-])=O ZBYYWKJVSFHYJL-UHFFFAOYSA-L 0.000 claims description 4
- 229910052698 phosphorus Inorganic materials 0.000 claims description 4
- 239000011574 phosphorus Substances 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000001869 cobalt compounds Chemical class 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 2
- -1 phosphine compound Chemical class 0.000 abstract description 12
- 239000011541 reaction mixture Substances 0.000 abstract description 7
- 230000006872 improvement Effects 0.000 abstract description 5
- 230000015572 biosynthetic process Effects 0.000 abstract description 4
- VLWBWEUXNYUQKJ-UHFFFAOYSA-N cobalt ruthenium Chemical compound [Co].[Ru] VLWBWEUXNYUQKJ-UHFFFAOYSA-N 0.000 abstract 1
- 238000002474 experimental method Methods 0.000 description 36
- 239000007789 gas Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000000376 reactant Substances 0.000 description 8
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 4
- 150000002497 iodine compounds Chemical class 0.000 description 4
- 150000003003 phosphines Chemical class 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 229940011182 cobalt acetate Drugs 0.000 description 3
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- AVWLPUQJODERGA-UHFFFAOYSA-L cobalt(2+);diiodide Chemical compound [Co+2].[I-].[I-] AVWLPUQJODERGA-UHFFFAOYSA-L 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- SIYFKTNRNLQRHS-UHFFFAOYSA-N (3-methoxyphenyl)-dimethylphosphane Chemical compound COC1=CC=CC(P(C)C)=C1 SIYFKTNRNLQRHS-UHFFFAOYSA-N 0.000 description 1
- IYWJIYWFPADQAN-LNTINUHCSA-N (z)-4-hydroxypent-3-en-2-one;ruthenium Chemical compound [Ru].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O IYWJIYWFPADQAN-LNTINUHCSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SKIDNYUZJPMKFC-UHFFFAOYSA-N 1-iododecane Chemical compound CCCCCCCCCCI SKIDNYUZJPMKFC-UHFFFAOYSA-N 0.000 description 1
- WNPGSEJRPYSCDQ-UHFFFAOYSA-N 3-(iodomethyl)heptane Chemical compound CCCCC(CC)CI WNPGSEJRPYSCDQ-UHFFFAOYSA-N 0.000 description 1
- AJSIXIDFJCHNFF-UHFFFAOYSA-N 6,6-diphenylhexylphosphane Chemical compound C=1C=CC=CC=1C(CCCCCP)C1=CC=CC=C1 AJSIXIDFJCHNFF-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910021503 Cobalt(II) hydroxide Inorganic materials 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- IRFULBOCZHZKIX-UHFFFAOYSA-N [Co].[I] Chemical compound [Co].[I] IRFULBOCZHZKIX-UHFFFAOYSA-N 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- ZZYSOUTXXFZJBK-UHFFFAOYSA-L butanoate;cobalt(2+) Chemical compound [Co+2].CCCC([O-])=O.CCCC([O-])=O ZZYSOUTXXFZJBK-UHFFFAOYSA-L 0.000 description 1
- HAHDAHKRCJXVAP-UHFFFAOYSA-N carbanide;cobalt Chemical compound [CH3-].[Co] HAHDAHKRCJXVAP-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 229910000428 cobalt oxide Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- NMNZGKIKHBYUNG-UHFFFAOYSA-L cobalt(2+);hexanoate Chemical compound [Co+2].CCCCCC([O-])=O.CCCCCC([O-])=O NMNZGKIKHBYUNG-UHFFFAOYSA-L 0.000 description 1
- ADBMTWSCACVHKJ-UHFFFAOYSA-L cobalt(2+);hydrogen carbonate Chemical compound [Co+2].OC([O-])=O.OC([O-])=O ADBMTWSCACVHKJ-UHFFFAOYSA-L 0.000 description 1
- BXDNFAXUAQVKRQ-UHFFFAOYSA-L cobalt(2+);pentanoate Chemical compound [Co+2].CCCCC([O-])=O.CCCCC([O-])=O BXDNFAXUAQVKRQ-UHFFFAOYSA-L 0.000 description 1
- TZWGXFOSKIHUPW-UHFFFAOYSA-L cobalt(2+);propanoate Chemical compound [Co+2].CCC([O-])=O.CCC([O-])=O TZWGXFOSKIHUPW-UHFFFAOYSA-L 0.000 description 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 1
- PFQLIVQUKOIJJD-UHFFFAOYSA-L cobalt(ii) formate Chemical compound [Co+2].[O-]C=O.[O-]C=O PFQLIVQUKOIJJD-UHFFFAOYSA-L 0.000 description 1
- ASKVAEGIVYSGNY-UHFFFAOYSA-L cobalt(ii) hydroxide Chemical compound [OH-].[OH-].[Co+2] ASKVAEGIVYSGNY-UHFFFAOYSA-L 0.000 description 1
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 1
- FJDJVBXSSLDNJB-LNTINUHCSA-N cobalt;(z)-4-hydroxypent-3-en-2-one Chemical compound [Co].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O FJDJVBXSSLDNJB-LNTINUHCSA-N 0.000 description 1
- UPWSATGSDQUFBL-UHFFFAOYSA-N cobalt;ethanone Chemical compound [Co].C[C]=O UPWSATGSDQUFBL-UHFFFAOYSA-N 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- FHMSEBUGWCTWHW-UHFFFAOYSA-N dibutyl(cyclohexyl)phosphane Chemical compound CCCCP(CCCC)C1CCCCC1 FHMSEBUGWCTWHW-UHFFFAOYSA-N 0.000 description 1
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- QWYFOIJABGVEFP-UHFFFAOYSA-L manganese(ii) iodide Chemical compound [Mn+2].[I-].[I-] QWYFOIJABGVEFP-UHFFFAOYSA-L 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- HAQNILKXKHODOO-UHFFFAOYSA-K octanoate;ruthenium(3+) Chemical compound [Ru+3].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O.CCCCCCCC([O-])=O HAQNILKXKHODOO-UHFFFAOYSA-K 0.000 description 1
- 125000005515 organic divalent group Chemical group 0.000 description 1
- 150000005527 organic iodine compounds Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- LEIZJJNFNQIIKH-UHFFFAOYSA-K propanoate;ruthenium(3+) Chemical compound [Ru+3].CCC([O-])=O.CCC([O-])=O.CCC([O-])=O LEIZJJNFNQIIKH-UHFFFAOYSA-K 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- OJLCQGGSMYKWEK-UHFFFAOYSA-K ruthenium(3+);triacetate Chemical compound [Ru+3].CC([O-])=O.CC([O-])=O.CC([O-])=O OJLCQGGSMYKWEK-UHFFFAOYSA-K 0.000 description 1
- WYRXRHOISWEUST-UHFFFAOYSA-K ruthenium(3+);tribromide Chemical compound [Br-].[Br-].[Br-].[Ru+3] WYRXRHOISWEUST-UHFFFAOYSA-K 0.000 description 1
- LJZVDOUZSMHXJH-UHFFFAOYSA-K ruthenium(3+);triiodide Chemical compound [Ru+3].[I-].[I-].[I-] LJZVDOUZSMHXJH-UHFFFAOYSA-K 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012086 standard solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000004354 sulfur functional group Chemical group 0.000 description 1
- UQFSVBXCNGCBBW-UHFFFAOYSA-M tetraethylammonium iodide Chemical compound [I-].CC[N+](CC)(CC)CC UQFSVBXCNGCBBW-UHFFFAOYSA-M 0.000 description 1
- IFXORIIYQORRMJ-UHFFFAOYSA-N tribenzylphosphane Chemical compound C=1C=CC=CC=1CP(CC=1C=CC=CC=1)CC1=CC=CC=C1 IFXORIIYQORRMJ-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- DFMBSBCYSILJJK-UHFFFAOYSA-N tricyclohexylmethylphosphanium;iodide Chemical compound [I-].C1CCCCC1C(C1CCCCC1)([PH3+])C1CCCCC1 DFMBSBCYSILJJK-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- QAPGHLJQIVDTPT-UHFFFAOYSA-N tris(3-chlorophenyl)phosphane Chemical compound ClC1=CC=CC(P(C=2C=C(Cl)C=CC=2)C=2C=C(Cl)C=CC=2)=C1 QAPGHLJQIVDTPT-UHFFFAOYSA-N 0.000 description 1
- UYUUAUOYLFIRJG-UHFFFAOYSA-N tris(4-methoxyphenyl)phosphane Chemical compound C1=CC(OC)=CC=C1P(C=1C=CC(OC)=CC=1)C1=CC=C(OC)C=C1 UYUUAUOYLFIRJG-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/32—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions without formation of -OH groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Saccharide Compounds (AREA)
- Glass Compositions (AREA)
- Iron Core Of Rotating Electric Machines (AREA)
- Steroid Compounds (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/091,241 US4233466A (en) | 1979-11-15 | 1979-11-15 | Homologation process for the production of ethanol from methanol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO802170L true NO802170L (no) | 1981-05-18 |
Family
ID=22226759
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO802170A NO802170L (no) | 1979-11-15 | 1980-07-18 | Homologasjonsfremgangsmaate for fremstilling av etanol fra metanol. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4233466A (es) |
| EP (1) | EP0029086B1 (es) |
| JP (1) | JPS593972B2 (es) |
| KR (1) | KR830003390A (es) |
| AT (1) | ATE9321T1 (es) |
| AU (1) | AU6085480A (es) |
| BR (1) | BR8004759A (es) |
| CA (1) | CA1165309A (es) |
| DD (1) | DD154483A5 (es) |
| DE (1) | DE3069155D1 (es) |
| DK (1) | DK313680A (es) |
| ES (1) | ES493701A0 (es) |
| FI (1) | FI802326A (es) |
| NO (1) | NO802170L (es) |
| PL (1) | PL126665B1 (es) |
| SG (1) | SG39386G (es) |
| YU (1) | YU197480A (es) |
| ZA (1) | ZA804199B (es) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4346020A (en) * | 1979-05-25 | 1982-08-24 | Gulf Research & Development Company | Novel catalyst system and process for producing ethanol using said novel catalyst system |
| FR2458528A1 (fr) * | 1979-06-07 | 1981-01-02 | Rhone Poulenc Ind | Procede d'homologation du methanol |
| FR2460284A1 (fr) * | 1979-07-04 | 1981-01-23 | Rhone Poulenc Ind | Procede de preparation de l'acetaldehyde |
| US4348541A (en) * | 1979-11-30 | 1982-09-07 | Exxon Research And Engineering Company | Methanol homologation using cobalt-ruthenium catalysts |
| DE3031558C2 (de) * | 1980-08-21 | 1984-04-26 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur Herstellung von Acetaldehyd und Ethanol |
| US4301253A (en) * | 1980-09-25 | 1981-11-17 | Union Carbide Corporation | Process for the selective production of ethanol and methanol directly from synthesis gas |
| DE3042434A1 (de) * | 1980-11-11 | 1982-05-19 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von ethanol und n-propanol aus methanol |
| KR830008966A (ko) * | 1981-01-08 | 1983-12-16 | 에프 에이취 토우스리 쥬니어 | 에탄올의 제조방법 |
| CA1179315A (en) * | 1981-06-30 | 1984-12-11 | Union Carbide Corporation | Process for producing alcohols |
| US4332915A (en) * | 1981-07-02 | 1982-06-01 | Texaco Inc. | Production of alkanols from synthesis gas |
| US4352947A (en) * | 1981-08-03 | 1982-10-05 | Gulf Research & Development Company | Process for producing ethanol |
| US4585798A (en) * | 1981-10-13 | 1986-04-29 | Gulf Research & Development Company | Synthesis gas conversion using ruthenium-promoted cobalt catalyst |
| JPS60136525A (ja) * | 1983-12-26 | 1985-07-20 | Agency Of Ind Science & Technol | エタノ−ルの製造法 |
| JPS60215640A (ja) * | 1984-04-10 | 1985-10-29 | Agency Of Ind Science & Technol | エタノ−ルの製造法 |
| US4954665A (en) * | 1985-11-07 | 1990-09-04 | Union Carbide Chemicals And Plastics Company Inc. | Methanol homologation |
| US4727200A (en) * | 1987-03-27 | 1988-02-23 | Union Carbide Corporation | Alcohol homologation |
| US7199276B2 (en) * | 2003-11-19 | 2007-04-03 | Exxonmobil Chemical Patents Inc. | Controlling the ratio of ethylene to propylene produced in an oxygenate to olefin conversion process |
| US7196239B2 (en) * | 2003-11-19 | 2007-03-27 | Exxonmobil Chemical Patents Inc. | Methanol and ethanol production for an oxygenate to olefin reaction system |
| US7288689B2 (en) * | 2003-11-19 | 2007-10-30 | Exxonmobil Chemical Patents Inc. | Methanol and fuel alcohol production for an oxygenate to olefin reaction system |
| US20060149109A1 (en) * | 2004-12-30 | 2006-07-06 | Ruziska Philip A | Converting methanol and ethanol to light olefins |
| CA2658483A1 (en) | 2006-07-21 | 2008-01-24 | Xyleco, Inc. | Conversion systems for biomass |
| US7718832B1 (en) | 2006-12-29 | 2010-05-18 | Pacific Renewable Fuels, Inc. | Combination catalytic process for producing ethanol from synthesis gas |
| US9227895B2 (en) * | 2007-07-09 | 2016-01-05 | Albemarle Corporation | Methods and apparatus for producing alcohols from syngas |
| US20090014689A1 (en) * | 2007-07-09 | 2009-01-15 | Range Fuels, Inc. | Methods and apparatus for producing syngas and alcohols |
| US20090018371A1 (en) * | 2007-07-09 | 2009-01-15 | Range Fuels, Inc. | Methods and apparatus for producing alcohols from syngas |
| US8366796B2 (en) * | 2007-07-09 | 2013-02-05 | Range Fuels, Inc. | Modular and distributed methods and systems to convert biomass to syngas |
| US8142530B2 (en) * | 2007-07-09 | 2012-03-27 | Range Fuels, Inc. | Methods and apparatus for producing syngas and alcohols |
| US20090151251A1 (en) * | 2007-12-17 | 2009-06-18 | Range Fuels, Inc. | Methods and apparatus for producing syngas and alcohols |
| US20090221725A1 (en) * | 2008-02-28 | 2009-09-03 | Enerkem, Inc. | Production of ethanol from methanol |
| CN105254473B (zh) * | 2015-11-09 | 2018-10-26 | 华东理工大学 | 甲醇同系化法制备乙醇的方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3248432A (en) * | 1961-12-12 | 1966-04-26 | Commercial Solvents Corp | Process for the production of ethyl alcohol |
| US3285948A (en) * | 1965-01-22 | 1966-11-15 | Commercial Solvents Corp | Halides of ruthenium and osmium in conjunction with cobalt and iodine in the production of ethanol from methanol |
| BE842430A (nl) * | 1975-06-09 | 1976-12-01 | Werkwijze ter bereiding van ethanol uit methanol koolmonoxyde en waterstof | |
| CA1107302A (en) * | 1977-11-08 | 1981-08-18 | Brian R. Gane | Process for the hydrocarbonylation of methanol to ethanol in the presence of an inert liquid |
| US4158100A (en) * | 1977-11-10 | 1979-06-12 | Chem Systems, Inc. | Process for the preparation of β-phenylethyl alcohol via homologation |
| US4133966A (en) * | 1977-12-23 | 1979-01-09 | Gulf Research & Development Company | Selective formation of ethanol from methanol, hydrogen and carbon monoxide |
| CA1133513A (en) * | 1978-10-03 | 1982-10-12 | David G. Stewart | Process for the production of ethanol and/or acetaldehyde by reacting methanol with synthesis gas |
| EP0013464A1 (en) * | 1979-01-09 | 1980-07-23 | Gulf Research & Development Company | Selective formation of ethanol from methanol, hydrogen and carbon monoxide |
-
1979
- 1979-11-15 US US06/091,241 patent/US4233466A/en not_active Expired - Lifetime
-
1980
- 1980-07-11 ZA ZA00804199A patent/ZA804199B/xx unknown
- 1980-07-18 NO NO802170A patent/NO802170L/no unknown
- 1980-07-21 DK DK313680A patent/DK313680A/da unknown
- 1980-07-23 EP EP80104335A patent/EP0029086B1/en not_active Expired
- 1980-07-23 DE DE8080104335T patent/DE3069155D1/de not_active Expired
- 1980-07-23 AT AT80104335T patent/ATE9321T1/de not_active IP Right Cessation
- 1980-07-23 FI FI802326A patent/FI802326A/fi not_active Application Discontinuation
- 1980-07-24 ES ES493701A patent/ES493701A0/es active Granted
- 1980-07-25 CA CA000357026A patent/CA1165309A/en not_active Expired
- 1980-07-28 AU AU60854/80A patent/AU6085480A/en not_active Abandoned
- 1980-07-30 BR BR8004759A patent/BR8004759A/pt unknown
- 1980-08-04 PL PL1980226066A patent/PL126665B1/pl unknown
- 1980-08-05 YU YU01974/80A patent/YU197480A/xx unknown
- 1980-08-09 KR KR1019800003169A patent/KR830003390A/ko unknown
- 1980-08-11 JP JP55109340A patent/JPS593972B2/ja not_active Expired
- 1980-11-11 DD DD80225106A patent/DD154483A5/de unknown
-
1986
- 1986-04-30 SG SG393/86A patent/SG39386G/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5671027A (en) | 1981-06-13 |
| US4233466A (en) | 1980-11-11 |
| EP0029086B1 (en) | 1984-09-12 |
| YU197480A (en) | 1983-10-31 |
| PL126665B1 (en) | 1983-08-31 |
| KR830003390A (ko) | 1983-06-20 |
| AU6085480A (en) | 1981-05-21 |
| PL226066A1 (es) | 1981-06-19 |
| JPS593972B2 (ja) | 1984-01-27 |
| ES8106122A1 (es) | 1981-08-01 |
| DK313680A (da) | 1981-05-16 |
| ES493701A0 (es) | 1981-08-01 |
| ZA804199B (en) | 1981-07-29 |
| FI802326A (fi) | 1981-05-16 |
| ATE9321T1 (de) | 1984-09-15 |
| CA1165309A (en) | 1984-04-10 |
| SG39386G (en) | 1986-08-01 |
| DE3069155D1 (en) | 1984-10-18 |
| BR8004759A (pt) | 1981-06-09 |
| EP0029086A1 (en) | 1981-05-27 |
| DD154483A5 (de) | 1982-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO802170L (no) | Homologasjonsfremgangsmaate for fremstilling av etanol fra metanol. | |
| US4239924A (en) | Ethanol from methanol | |
| NO148712B (no) | Fremgangsmaate ved fremstilling av etylidendiacetat | |
| EP0029723A1 (en) | Process for the production of ethanol and/or acetaldehyde in the presence of metal complex catalyst systems | |
| US4659518A (en) | Preparation of carboxylic acids | |
| US4277634A (en) | Process for the selective homologation of methanol to ethanol | |
| US3968133A (en) | Carboxylation process for preparing linear fatty acids or esters | |
| EP0003876A1 (en) | Process for the hydrocarbonylation of methanol to ethanol in the presence of added oxygen-containing organic compounds | |
| US4239925A (en) | Ethanol from methanol | |
| US3839378A (en) | Process for preparing carboxylic acid or ester thereof | |
| EP0001936B1 (en) | Process for the production of acetaldehyde by the reaction of methanol with synthesis gas | |
| EP0037586B1 (en) | Process for the selective hydroformylation of methanol to acetaldehyde | |
| US4346020A (en) | Novel catalyst system and process for producing ethanol using said novel catalyst system | |
| EP0048046B1 (en) | Method for the manufacture of ethylidene diacetate | |
| US5194676A (en) | Catalyst and process for the synthesis of saturated carboxylic esters | |
| US4558153A (en) | Preparation of carboxylic acids and esters | |
| US4614816A (en) | Preparation of carboxylic acids and esters thereof | |
| EP0034374B1 (en) | Selective homologation of acetals or ethers to monohydric or polyhydric alcohols | |
| JPH0733349B2 (ja) | エチリデンジアセテートの製造方法 | |
| US4356126A (en) | Carbonylation of alkanols and/or aliphatic ethers | |
| EP0155122A2 (en) | Production of esters | |
| EP0141535A2 (en) | Process for the production of ethanol and/or acetaldehyde by the metal catalysed liquid phase reaction of methanol, carbon monoxide and hydrogen in the presence of a solvent | |
| US4357480A (en) | Process for the production of ethanol by the liquid phase hydrocarbonylation of methanol | |
| EP0013464A1 (en) | Selective formation of ethanol from methanol, hydrogen and carbon monoxide | |
| EP0064285A1 (en) | Method of producing 1,9-nonanedial and/or 9-hydroxy-7-nonen-1-al |